/* Start:/bitrix/templates/webdelivery/assets/css/app.css?17848132781052459*/
@charset "UTF-8";
:root {
  --font-family: "Roboto Flex", sans-serif;
  --heading-font: var(--font-family);
  --default-font: var(--font-family);
  font-size: 14px;
  --gap: 15px;
  --gap-1-5: calc(var(--gap) * 1.5);
  --gap-2: calc(var(--gap) * 2);
  --gap-big: 40px;
  --font-size-base: 14px;
  --font-size-badge: 10px;
  --font-size-tiny: 12px;
  --font-size-small: 13px;
  --font-size-medium: 16px;
  --font-size-big: 18px;
  --font-size-bigger: 20px;
  --font-size-legend: 22px;
  --font-size-large: 28px;
  --font-size-title: 28px;
  --font-size-headline: 36px;
  --line-height: 1.6;
  --line-height-tiny: 1.45;
  --line-height-small: 1.53;
  --line-height-title: 1.25;
  --radius: 20px;
  --speed: 0.3s;
  --button-size: 40px;
  --safe-top: env(safe-area-inset-top);
  --safe-bottom: env(safe-area-inset-bottom);
  --safe-left: env(safe-area-inset-left);
  --safe-right: env(safe-area-inset-right);
  --scroll-width: 5px;
  --desktop-nav-width: 6rem;
  --mobile-nav-height: 60px;
  --desktop-header-heigh: 60px;
  --mobile-header-heigh: 50px;
  --sidebar-width: 360px;
  --sticky-offset: 150px;
}

@media (prefers-color-scheme: dark) {
  :root {
    --color-scheme: dark;
    --layout-color: hsla(228, 8%, 9%, 1);
    --paper-color: hsla(228, 8%, 12%, 1);
    --paper-color-transparent: hsla(228, 8%, 12%, .8);
    --border-color: hsla(228, 8%, 33%, 1);
    --input-color: hsla(228, 8%, 9%, 1);
    --main-text-color: hsla(0, 0%, 92%, 1);
    --muted-text-color: hsla(0, 0%, 63%, 1);
    --hint-text-color: hsla(230, 0%, 50%, 1);
    --icons: hsla(0, 0%, 67%, 1);
    --primary-color: hsla(162, 48%, 35%, 1);
    --primary-color-dark: hsla(162, 48%, 25%, 1);
    --primary-color-transparent: hsla(162, 48%, 35%, .3);
    --default-color: hsla(228, 8%, 17%, 1);
    --default-color-hover: hsla(228, 8%, 22%, 1);
    --fill-btn-color: hsla(0, 0%, 95%, 1);
    --ripple-filled: hsla(0, 0%, 100%, 0.3);
    --focus-highlight: hsla(0, 0%, 81%, 0.05);
    --warning: hsla(40, 98%, 47%, 1);
    --danger: hsla(354, 96%, 62%, 1);
    --success: hsla(162, 48%, 49%, 1);
    --info: hsla(207, 90%, 43%, 1);
    --switcher: hsla(0, 0%, 100%, 1);
    --inverse-color: hsla(38 ,22% ,90%, 1);
    --inverse-transparent-color: hsla(38 ,22% ,90%, .8);
    --inverse-text-color: hsla(230, 8%, 7%, 1);
    --inverse-focus-highlight: hsla(0, 3%, 52%, 0.25);
    --shadow-first: hsla(230, 8%, 7%, .5);
    --shadow-second: hsla(230, 8%, 7%, .7);
    --social-default-color: hsla(228, 8%, 22%, 1);
    --dev-icon-color: hsla(354, 96%, 62%, 1);
    --dev-link-color: hsla(280, 32%, 56%, 1);
  }
  :root [logo-dark] {
    display: none;
  }
}
@media (prefers-color-scheme: light) {
  :root {
    --color-scheme: light;
    --layout-color: hsla(220, 19%, 94%, 1);
    --paper-color: hsla(0, 0%, 100%, 1);
    --paper-color-transparent: hsla(0, 0%, 100%, .8);
    --border-color: hsla(207, 11%, 80%, 1);
    --input-color: hsla(220, 19%, 92%, 1);
    --main-text-color: hsla(230, 8%, 7%, 1);
    --muted-text-color: hsla(230, 0%, 34%, 1);
    --hint-text-color: hsla(230, 0%, 50%, 1);
    --icons: hsla(0, 0%, 43%, 1);
    --primary-color: hsla(162, 48%, 35%, 1);
    --primary-color-dark: hsla(162, 48%, 25%, 1);
    --primary-color-transparent: hsla(162, 48%, 35%, .3);
    --default-color: hsla(228, 8%, 90%, 1);
    --default-color-hover: hsla(228, 8%, 85%, 1);
    --fill-btn-color: hsla(0, 0%, 98%, 1);
    --ripple-filled: hsla(0, 0%, 100%, 0.3);
    --focus-highlight: hsla(0, 0%, 35%, 0.1);
    --warning: hsla(40, 98%, 47%, 1);
    --danger: hsla(354, 96%, 62%, 1);
    --success: hsla(162, 48%, 49%, 1);
    --info: hsla(207, 90%, 55%, 1);
    --switcher: hsla(0, 0%, 100%, 1);
    --inverse-color: hsla(215 ,36% ,10%, 1);
    --inverse-transparent-color: hsla(215 ,36% ,10%, .8);
    --inverse-text-color: hsla(0, 0%, 90%, 1);
    --inverse-focus-highlight: hsla(0, 0%, 50%, 0.25);
    --shadow-first: hsla(224, 40%, 21%, .08);
    --shadow-second: hsla(224, 40%, 21%, .13);
    --social-default-color: hsla(220, 10%, 76%, 1);
    --dev-icon-color: hsla(354, 96%, 62%, 1);
    --dev-link-color: hsla(309, 43%, 30%, 1);
  }
  :root [logo-light] {
    display: none;
  }
}
/*!
 * Bootstrap Reboot v4.6.2 (https://getbootstrap.com/)
 * Copyright 2011-2022 The Bootstrap Authors
 * Copyright 2011-2022 Twitter, Inc.
 * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
 * Forked from Normalize.css, licensed MIT (https://github.com/necolas/normalize.css/blob/master/LICENSE.md)
 */
*,
*::before,
*::after {
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}

html {
  font-family: sans-serif;
  line-height: 1.15;
  -webkit-text-size-adjust: 100%;
  -webkit-tap-highlight-color: rgba(0, 0, 0, 0);
}

article, aside, figcaption, figure, footer, header, hgroup, main, nav, section {
  display: block;
}

body {
  margin: 0;
  font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", "Liberation Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
  font-size: 1rem;
  font-weight: 400;
  line-height: 1.5;
  color: #212529;
  text-align: left;
  background-color: #fff;
}

[tabindex="-1"]:focus:not(:focus-visible) {
  outline: 0 !important;
}

hr {
  -webkit-box-sizing: content-box;
          box-sizing: content-box;
  height: 0;
  overflow: visible;
}

h1, h2, h3, h4, h5, h6 {
  margin-top: 0;
  margin-bottom: 0.5rem;
}

p {
  margin-top: 0;
  margin-bottom: 1rem;
}

abbr[title],
abbr[data-original-title] {
  text-decoration: underline;
  -webkit-text-decoration: underline dotted;
          text-decoration: underline dotted;
  cursor: help;
  border-bottom: 0;
  -webkit-text-decoration-skip-ink: none;
          text-decoration-skip-ink: none;
}

address {
  margin-bottom: 1rem;
  font-style: normal;
  line-height: inherit;
}

ol,
ul,
dl {
  margin-top: 0;
  margin-bottom: 1rem;
}

ol ol,
ul ul,
ol ul,
ul ol {
  margin-bottom: 0;
}

dt {
  font-weight: 700;
}

dd {
  margin-bottom: 0.5rem;
  margin-left: 0;
}

blockquote {
  margin: 0 0 1rem;
}

b,
strong {
  font-weight: bolder;
}

small {
  font-size: 80%;
}

sub,
sup {
  position: relative;
  font-size: 75%;
  line-height: 0;
  vertical-align: baseline;
}

sub {
  bottom: -0.25em;
}

sup {
  top: -0.5em;
}

a {
  color: #007bff;
  text-decoration: none;
  background-color: transparent;
}
a:hover {
  color: #0056b3;
  text-decoration: underline;
}

a:not([href]):not([class]) {
  color: inherit;
  text-decoration: none;
}
a:not([href]):not([class]):hover {
  color: inherit;
  text-decoration: none;
}

pre,
code,
kbd,
samp {
  font-family: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
  font-size: 1em;
}

pre {
  margin-top: 0;
  margin-bottom: 1rem;
  overflow: auto;
  -ms-overflow-style: scrollbar;
}

figure {
  margin: 0 0 1rem;
}

img {
  vertical-align: middle;
  border-style: none;
}

svg {
  overflow: hidden;
  vertical-align: middle;
}

table {
  border-collapse: collapse;
}

caption {
  padding-top: 0.75rem;
  padding-bottom: 0.75rem;
  color: #6c757d;
  text-align: left;
  caption-side: bottom;
}

th {
  text-align: inherit;
  text-align: -webkit-match-parent;
}

label {
  display: inline-block;
  margin-bottom: 0.5rem;
}

button {
  border-radius: 0;
}

button:focus:not(:focus-visible) {
  outline: 0;
}

input,
button,
select,
optgroup,
textarea {
  margin: 0;
  font-family: inherit;
  font-size: inherit;
  line-height: inherit;
}

button,
input {
  overflow: visible;
}

button,
select {
  text-transform: none;
}

[role=button] {
  cursor: pointer;
}

select {
  word-wrap: normal;
}

button,
[type=button],
[type=reset],
[type=submit] {
  -webkit-appearance: button;
}

button:not(:disabled),
[type=button]:not(:disabled),
[type=reset]:not(:disabled),
[type=submit]:not(:disabled) {
  cursor: pointer;
}

button::-moz-focus-inner,
[type=button]::-moz-focus-inner,
[type=reset]::-moz-focus-inner,
[type=submit]::-moz-focus-inner {
  padding: 0;
  border-style: none;
}

input[type=radio],
input[type=checkbox] {
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  padding: 0;
}

textarea {
  overflow: auto;
  resize: vertical;
}

fieldset {
  min-width: 0;
  padding: 0;
  margin: 0;
  border: 0;
}

legend {
  display: block;
  width: 100%;
  max-width: 100%;
  padding: 0;
  margin-bottom: 0.5rem;
  font-size: 1.5rem;
  line-height: inherit;
  color: inherit;
  white-space: normal;
}

progress {
  vertical-align: baseline;
}

[type=number]::-webkit-inner-spin-button,
[type=number]::-webkit-outer-spin-button {
  height: auto;
}

[type=search] {
  outline-offset: -2px;
  -webkit-appearance: none;
}

[type=search]::-webkit-search-decoration {
  -webkit-appearance: none;
}

::-webkit-file-upload-button {
  font: inherit;
  -webkit-appearance: button;
}

output {
  display: inline-block;
}

summary {
  display: list-item;
  cursor: pointer;
}

template {
  display: none;
}

[hidden] {
  display: none !important;
}

/*!
 * Bootstrap Grid v4.6.2 (https://getbootstrap.com/)
 * Copyright 2011-2022 The Bootstrap Authors
 * Copyright 2011-2022 Twitter, Inc.
 * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
 */
html {
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  -ms-overflow-style: scrollbar;
}

*,
*::before,
*::after {
  -webkit-box-sizing: inherit;
          box-sizing: inherit;
}

.container,
.container-fluid,
.container-xl,
.container-lg,
.container-md,
.container-sm {
  width: 100%;
  padding-right: 15px;
  padding-left: 15px;
  margin-right: auto;
  margin-left: auto;
}

@media (min-width: 576px) {
  .container-sm, .container {
    max-width: 540px;
  }
}
@media (min-width: 768px) {
  .container-md, .container-sm, .container {
    max-width: 720px;
  }
}
@media (min-width: 992px) {
  .container-lg, .container-md, .container-sm, .container {
    max-width: 960px;
  }
}
@media (min-width: 1200px) {
  .container-xl, .container-lg, .container-md, .container-sm, .container {
    max-width: 1140px;
  }
}
.row {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
      flex-wrap: wrap;
  margin-right: -15px;
  margin-left: -15px;
}

.no-gutters {
  margin-right: 0;
  margin-left: 0;
}
.no-gutters > .col,
.no-gutters > [class*=col-] {
  padding-right: 0;
  padding-left: 0;
}

.col-xxl,
.col-xxl-auto, .col-xxl-12, .col-xxl-11, .col-xxl-10, .col-xxl-9, .col-xxl-8, .col-xxl-7, .col-xxl-6, .col-xxl-5, .col-xxl-4, .col-xxl-3, .col-xxl-2, .col-xxl-1, .col-xl,
.col-xl-auto, .col-xl-12, .col-xl-11, .col-xl-10, .col-xl-9, .col-xl-8, .col-xl-7, .col-xl-6, .col-xl-5, .col-xl-4, .col-xl-3, .col-xl-2, .col-xl-1, .col-lg,
.col-lg-auto, .col-lg-12, .col-lg-11, .col-lg-10, .col-lg-9, .col-lg-8, .col-lg-7, .col-lg-6, .col-lg-5, .col-lg-4, .col-lg-3, .col-lg-2, .col-lg-1, .col-md,
.col-md-auto, .col-md-12, .col-md-11, .col-md-10, .col-md-9, .col-md-8, .col-md-7, .col-md-6, .col-md-5, .col-md-4, .col-md-3, .col-md-2, .col-md-1, .col-sm,
.col-sm-auto, .col-sm-12, .col-sm-11, .col-sm-10, .col-sm-9, .col-sm-8, .col-sm-7, .col-sm-6, .col-sm-5, .col-sm-4, .col-sm-3, .col-sm-2, .col-sm-1, .col,
.col-auto, .col-12, .col-11, .col-10, .col-9, .col-8, .col-7, .col-6, .col-5, .col-4, .col-3, .col-2, .col-1 {
  position: relative;
  width: 100%;
  padding-right: 15px;
  padding-left: 15px;
}

.col {
  -ms-flex-preferred-size: 0;
      flex-basis: 0;
  -webkit-box-flex: 1;
      -ms-flex-positive: 1;
          flex-grow: 1;
  max-width: 100%;
}

.row-cols-1 > * {
  -webkit-box-flex: 0;
      -ms-flex: 0 0 100%;
          flex: 0 0 100%;
  max-width: 100%;
}

.row-cols-2 > * {
  -webkit-box-flex: 0;
      -ms-flex: 0 0 50%;
          flex: 0 0 50%;
  max-width: 50%;
}

.row-cols-3 > * {
  -webkit-box-flex: 0;
      -ms-flex: 0 0 33.3333333333%;
          flex: 0 0 33.3333333333%;
  max-width: 33.3333333333%;
}

.row-cols-4 > * {
  -webkit-box-flex: 0;
      -ms-flex: 0 0 25%;
          flex: 0 0 25%;
  max-width: 25%;
}

.row-cols-5 > * {
  -webkit-box-flex: 0;
      -ms-flex: 0 0 20%;
          flex: 0 0 20%;
  max-width: 20%;
}

.row-cols-6 > * {
  -webkit-box-flex: 0;
      -ms-flex: 0 0 16.6666666667%;
          flex: 0 0 16.6666666667%;
  max-width: 16.6666666667%;
}

.col-auto {
  -webkit-box-flex: 0;
      -ms-flex: 0 0 auto;
          flex: 0 0 auto;
  width: auto;
  max-width: 100%;
}

.col-1 {
  -webkit-box-flex: 0;
      -ms-flex: 0 0 8.33333333%;
          flex: 0 0 8.33333333%;
  max-width: 8.33333333%;
}

.col-2 {
  -webkit-box-flex: 0;
      -ms-flex: 0 0 16.66666667%;
          flex: 0 0 16.66666667%;
  max-width: 16.66666667%;
}

.col-3 {
  -webkit-box-flex: 0;
      -ms-flex: 0 0 25%;
          flex: 0 0 25%;
  max-width: 25%;
}

.col-4 {
  -webkit-box-flex: 0;
      -ms-flex: 0 0 33.33333333%;
          flex: 0 0 33.33333333%;
  max-width: 33.33333333%;
}

.col-5 {
  -webkit-box-flex: 0;
      -ms-flex: 0 0 41.66666667%;
          flex: 0 0 41.66666667%;
  max-width: 41.66666667%;
}

.col-6 {
  -webkit-box-flex: 0;
      -ms-flex: 0 0 50%;
          flex: 0 0 50%;
  max-width: 50%;
}

.col-7 {
  -webkit-box-flex: 0;
      -ms-flex: 0 0 58.33333333%;
          flex: 0 0 58.33333333%;
  max-width: 58.33333333%;
}

.col-8 {
  -webkit-box-flex: 0;
      -ms-flex: 0 0 66.66666667%;
          flex: 0 0 66.66666667%;
  max-width: 66.66666667%;
}

.col-9 {
  -webkit-box-flex: 0;
      -ms-flex: 0 0 75%;
          flex: 0 0 75%;
  max-width: 75%;
}

.col-10 {
  -webkit-box-flex: 0;
      -ms-flex: 0 0 83.33333333%;
          flex: 0 0 83.33333333%;
  max-width: 83.33333333%;
}

.col-11 {
  -webkit-box-flex: 0;
      -ms-flex: 0 0 91.66666667%;
          flex: 0 0 91.66666667%;
  max-width: 91.66666667%;
}

.col-12 {
  -webkit-box-flex: 0;
      -ms-flex: 0 0 100%;
          flex: 0 0 100%;
  max-width: 100%;
}

.order-first {
  -webkit-box-ordinal-group: 0;
      -ms-flex-order: -1;
          order: -1;
}

.order-last {
  -webkit-box-ordinal-group: 14;
      -ms-flex-order: 13;
          order: 13;
}

.order-0 {
  -webkit-box-ordinal-group: 1;
      -ms-flex-order: 0;
          order: 0;
}

.order-1 {
  -webkit-box-ordinal-group: 2;
      -ms-flex-order: 1;
          order: 1;
}

.order-2 {
  -webkit-box-ordinal-group: 3;
      -ms-flex-order: 2;
          order: 2;
}

.order-3 {
  -webkit-box-ordinal-group: 4;
      -ms-flex-order: 3;
          order: 3;
}

.order-4 {
  -webkit-box-ordinal-group: 5;
      -ms-flex-order: 4;
          order: 4;
}

.order-5 {
  -webkit-box-ordinal-group: 6;
      -ms-flex-order: 5;
          order: 5;
}

.order-6 {
  -webkit-box-ordinal-group: 7;
      -ms-flex-order: 6;
          order: 6;
}

.order-7 {
  -webkit-box-ordinal-group: 8;
      -ms-flex-order: 7;
          order: 7;
}

.order-8 {
  -webkit-box-ordinal-group: 9;
      -ms-flex-order: 8;
          order: 8;
}

.order-9 {
  -webkit-box-ordinal-group: 10;
      -ms-flex-order: 9;
          order: 9;
}

.order-10 {
  -webkit-box-ordinal-group: 11;
      -ms-flex-order: 10;
          order: 10;
}

.order-11 {
  -webkit-box-ordinal-group: 12;
      -ms-flex-order: 11;
          order: 11;
}

.order-12 {
  -webkit-box-ordinal-group: 13;
      -ms-flex-order: 12;
          order: 12;
}

.offset-1 {
  margin-left: 8.33333333%;
}

.offset-2 {
  margin-left: 16.66666667%;
}

.offset-3 {
  margin-left: 25%;
}

.offset-4 {
  margin-left: 33.33333333%;
}

.offset-5 {
  margin-left: 41.66666667%;
}

.offset-6 {
  margin-left: 50%;
}

.offset-7 {
  margin-left: 58.33333333%;
}

.offset-8 {
  margin-left: 66.66666667%;
}

.offset-9 {
  margin-left: 75%;
}

.offset-10 {
  margin-left: 83.33333333%;
}

.offset-11 {
  margin-left: 91.66666667%;
}

@media (min-width: 576px) {
  .col-sm {
    -ms-flex-preferred-size: 0;
        flex-basis: 0;
    -webkit-box-flex: 1;
        -ms-flex-positive: 1;
            flex-grow: 1;
    max-width: 100%;
  }
  .row-cols-sm-1 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 100%;
            flex: 0 0 100%;
    max-width: 100%;
  }
  .row-cols-sm-2 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 50%;
            flex: 0 0 50%;
    max-width: 50%;
  }
  .row-cols-sm-3 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 33.3333333333%;
            flex: 0 0 33.3333333333%;
    max-width: 33.3333333333%;
  }
  .row-cols-sm-4 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 25%;
            flex: 0 0 25%;
    max-width: 25%;
  }
  .row-cols-sm-5 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 20%;
            flex: 0 0 20%;
    max-width: 20%;
  }
  .row-cols-sm-6 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 16.6666666667%;
            flex: 0 0 16.6666666667%;
    max-width: 16.6666666667%;
  }
  .col-sm-auto {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 auto;
            flex: 0 0 auto;
    width: auto;
    max-width: 100%;
  }
  .col-sm-1 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 8.33333333%;
            flex: 0 0 8.33333333%;
    max-width: 8.33333333%;
  }
  .col-sm-2 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 16.66666667%;
            flex: 0 0 16.66666667%;
    max-width: 16.66666667%;
  }
  .col-sm-3 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 25%;
            flex: 0 0 25%;
    max-width: 25%;
  }
  .col-sm-4 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 33.33333333%;
            flex: 0 0 33.33333333%;
    max-width: 33.33333333%;
  }
  .col-sm-5 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 41.66666667%;
            flex: 0 0 41.66666667%;
    max-width: 41.66666667%;
  }
  .col-sm-6 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 50%;
            flex: 0 0 50%;
    max-width: 50%;
  }
  .col-sm-7 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 58.33333333%;
            flex: 0 0 58.33333333%;
    max-width: 58.33333333%;
  }
  .col-sm-8 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 66.66666667%;
            flex: 0 0 66.66666667%;
    max-width: 66.66666667%;
  }
  .col-sm-9 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 75%;
            flex: 0 0 75%;
    max-width: 75%;
  }
  .col-sm-10 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 83.33333333%;
            flex: 0 0 83.33333333%;
    max-width: 83.33333333%;
  }
  .col-sm-11 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 91.66666667%;
            flex: 0 0 91.66666667%;
    max-width: 91.66666667%;
  }
  .col-sm-12 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 100%;
            flex: 0 0 100%;
    max-width: 100%;
  }
  .order-sm-first {
    -webkit-box-ordinal-group: 0;
        -ms-flex-order: -1;
            order: -1;
  }
  .order-sm-last {
    -webkit-box-ordinal-group: 14;
        -ms-flex-order: 13;
            order: 13;
  }
  .order-sm-0 {
    -webkit-box-ordinal-group: 1;
        -ms-flex-order: 0;
            order: 0;
  }
  .order-sm-1 {
    -webkit-box-ordinal-group: 2;
        -ms-flex-order: 1;
            order: 1;
  }
  .order-sm-2 {
    -webkit-box-ordinal-group: 3;
        -ms-flex-order: 2;
            order: 2;
  }
  .order-sm-3 {
    -webkit-box-ordinal-group: 4;
        -ms-flex-order: 3;
            order: 3;
  }
  .order-sm-4 {
    -webkit-box-ordinal-group: 5;
        -ms-flex-order: 4;
            order: 4;
  }
  .order-sm-5 {
    -webkit-box-ordinal-group: 6;
        -ms-flex-order: 5;
            order: 5;
  }
  .order-sm-6 {
    -webkit-box-ordinal-group: 7;
        -ms-flex-order: 6;
            order: 6;
  }
  .order-sm-7 {
    -webkit-box-ordinal-group: 8;
        -ms-flex-order: 7;
            order: 7;
  }
  .order-sm-8 {
    -webkit-box-ordinal-group: 9;
        -ms-flex-order: 8;
            order: 8;
  }
  .order-sm-9 {
    -webkit-box-ordinal-group: 10;
        -ms-flex-order: 9;
            order: 9;
  }
  .order-sm-10 {
    -webkit-box-ordinal-group: 11;
        -ms-flex-order: 10;
            order: 10;
  }
  .order-sm-11 {
    -webkit-box-ordinal-group: 12;
        -ms-flex-order: 11;
            order: 11;
  }
  .order-sm-12 {
    -webkit-box-ordinal-group: 13;
        -ms-flex-order: 12;
            order: 12;
  }
  .offset-sm-0 {
    margin-left: 0;
  }
  .offset-sm-1 {
    margin-left: 8.33333333%;
  }
  .offset-sm-2 {
    margin-left: 16.66666667%;
  }
  .offset-sm-3 {
    margin-left: 25%;
  }
  .offset-sm-4 {
    margin-left: 33.33333333%;
  }
  .offset-sm-5 {
    margin-left: 41.66666667%;
  }
  .offset-sm-6 {
    margin-left: 50%;
  }
  .offset-sm-7 {
    margin-left: 58.33333333%;
  }
  .offset-sm-8 {
    margin-left: 66.66666667%;
  }
  .offset-sm-9 {
    margin-left: 75%;
  }
  .offset-sm-10 {
    margin-left: 83.33333333%;
  }
  .offset-sm-11 {
    margin-left: 91.66666667%;
  }
}
@media (min-width: 768px) {
  .col-md {
    -ms-flex-preferred-size: 0;
        flex-basis: 0;
    -webkit-box-flex: 1;
        -ms-flex-positive: 1;
            flex-grow: 1;
    max-width: 100%;
  }
  .row-cols-md-1 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 100%;
            flex: 0 0 100%;
    max-width: 100%;
  }
  .row-cols-md-2 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 50%;
            flex: 0 0 50%;
    max-width: 50%;
  }
  .row-cols-md-3 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 33.3333333333%;
            flex: 0 0 33.3333333333%;
    max-width: 33.3333333333%;
  }
  .row-cols-md-4 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 25%;
            flex: 0 0 25%;
    max-width: 25%;
  }
  .row-cols-md-5 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 20%;
            flex: 0 0 20%;
    max-width: 20%;
  }
  .row-cols-md-6 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 16.6666666667%;
            flex: 0 0 16.6666666667%;
    max-width: 16.6666666667%;
  }
  .col-md-auto {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 auto;
            flex: 0 0 auto;
    width: auto;
    max-width: 100%;
  }
  .col-md-1 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 8.33333333%;
            flex: 0 0 8.33333333%;
    max-width: 8.33333333%;
  }
  .col-md-2 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 16.66666667%;
            flex: 0 0 16.66666667%;
    max-width: 16.66666667%;
  }
  .col-md-3 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 25%;
            flex: 0 0 25%;
    max-width: 25%;
  }
  .col-md-4 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 33.33333333%;
            flex: 0 0 33.33333333%;
    max-width: 33.33333333%;
  }
  .col-md-5 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 41.66666667%;
            flex: 0 0 41.66666667%;
    max-width: 41.66666667%;
  }
  .col-md-6 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 50%;
            flex: 0 0 50%;
    max-width: 50%;
  }
  .col-md-7 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 58.33333333%;
            flex: 0 0 58.33333333%;
    max-width: 58.33333333%;
  }
  .col-md-8 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 66.66666667%;
            flex: 0 0 66.66666667%;
    max-width: 66.66666667%;
  }
  .col-md-9 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 75%;
            flex: 0 0 75%;
    max-width: 75%;
  }
  .col-md-10 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 83.33333333%;
            flex: 0 0 83.33333333%;
    max-width: 83.33333333%;
  }
  .col-md-11 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 91.66666667%;
            flex: 0 0 91.66666667%;
    max-width: 91.66666667%;
  }
  .col-md-12 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 100%;
            flex: 0 0 100%;
    max-width: 100%;
  }
  .order-md-first {
    -webkit-box-ordinal-group: 0;
        -ms-flex-order: -1;
            order: -1;
  }
  .order-md-last {
    -webkit-box-ordinal-group: 14;
        -ms-flex-order: 13;
            order: 13;
  }
  .order-md-0 {
    -webkit-box-ordinal-group: 1;
        -ms-flex-order: 0;
            order: 0;
  }
  .order-md-1 {
    -webkit-box-ordinal-group: 2;
        -ms-flex-order: 1;
            order: 1;
  }
  .order-md-2 {
    -webkit-box-ordinal-group: 3;
        -ms-flex-order: 2;
            order: 2;
  }
  .order-md-3 {
    -webkit-box-ordinal-group: 4;
        -ms-flex-order: 3;
            order: 3;
  }
  .order-md-4 {
    -webkit-box-ordinal-group: 5;
        -ms-flex-order: 4;
            order: 4;
  }
  .order-md-5 {
    -webkit-box-ordinal-group: 6;
        -ms-flex-order: 5;
            order: 5;
  }
  .order-md-6 {
    -webkit-box-ordinal-group: 7;
        -ms-flex-order: 6;
            order: 6;
  }
  .order-md-7 {
    -webkit-box-ordinal-group: 8;
        -ms-flex-order: 7;
            order: 7;
  }
  .order-md-8 {
    -webkit-box-ordinal-group: 9;
        -ms-flex-order: 8;
            order: 8;
  }
  .order-md-9 {
    -webkit-box-ordinal-group: 10;
        -ms-flex-order: 9;
            order: 9;
  }
  .order-md-10 {
    -webkit-box-ordinal-group: 11;
        -ms-flex-order: 10;
            order: 10;
  }
  .order-md-11 {
    -webkit-box-ordinal-group: 12;
        -ms-flex-order: 11;
            order: 11;
  }
  .order-md-12 {
    -webkit-box-ordinal-group: 13;
        -ms-flex-order: 12;
            order: 12;
  }
  .offset-md-0 {
    margin-left: 0;
  }
  .offset-md-1 {
    margin-left: 8.33333333%;
  }
  .offset-md-2 {
    margin-left: 16.66666667%;
  }
  .offset-md-3 {
    margin-left: 25%;
  }
  .offset-md-4 {
    margin-left: 33.33333333%;
  }
  .offset-md-5 {
    margin-left: 41.66666667%;
  }
  .offset-md-6 {
    margin-left: 50%;
  }
  .offset-md-7 {
    margin-left: 58.33333333%;
  }
  .offset-md-8 {
    margin-left: 66.66666667%;
  }
  .offset-md-9 {
    margin-left: 75%;
  }
  .offset-md-10 {
    margin-left: 83.33333333%;
  }
  .offset-md-11 {
    margin-left: 91.66666667%;
  }
}
@media (min-width: 992px) {
  .col-lg {
    -ms-flex-preferred-size: 0;
        flex-basis: 0;
    -webkit-box-flex: 1;
        -ms-flex-positive: 1;
            flex-grow: 1;
    max-width: 100%;
  }
  .row-cols-lg-1 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 100%;
            flex: 0 0 100%;
    max-width: 100%;
  }
  .row-cols-lg-2 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 50%;
            flex: 0 0 50%;
    max-width: 50%;
  }
  .row-cols-lg-3 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 33.3333333333%;
            flex: 0 0 33.3333333333%;
    max-width: 33.3333333333%;
  }
  .row-cols-lg-4 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 25%;
            flex: 0 0 25%;
    max-width: 25%;
  }
  .row-cols-lg-5 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 20%;
            flex: 0 0 20%;
    max-width: 20%;
  }
  .row-cols-lg-6 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 16.6666666667%;
            flex: 0 0 16.6666666667%;
    max-width: 16.6666666667%;
  }
  .col-lg-auto {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 auto;
            flex: 0 0 auto;
    width: auto;
    max-width: 100%;
  }
  .col-lg-1 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 8.33333333%;
            flex: 0 0 8.33333333%;
    max-width: 8.33333333%;
  }
  .col-lg-2 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 16.66666667%;
            flex: 0 0 16.66666667%;
    max-width: 16.66666667%;
  }
  .col-lg-3 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 25%;
            flex: 0 0 25%;
    max-width: 25%;
  }
  .col-lg-4 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 33.33333333%;
            flex: 0 0 33.33333333%;
    max-width: 33.33333333%;
  }
  .col-lg-5 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 41.66666667%;
            flex: 0 0 41.66666667%;
    max-width: 41.66666667%;
  }
  .col-lg-6 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 50%;
            flex: 0 0 50%;
    max-width: 50%;
  }
  .col-lg-7 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 58.33333333%;
            flex: 0 0 58.33333333%;
    max-width: 58.33333333%;
  }
  .col-lg-8 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 66.66666667%;
            flex: 0 0 66.66666667%;
    max-width: 66.66666667%;
  }
  .col-lg-9 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 75%;
            flex: 0 0 75%;
    max-width: 75%;
  }
  .col-lg-10 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 83.33333333%;
            flex: 0 0 83.33333333%;
    max-width: 83.33333333%;
  }
  .col-lg-11 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 91.66666667%;
            flex: 0 0 91.66666667%;
    max-width: 91.66666667%;
  }
  .col-lg-12 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 100%;
            flex: 0 0 100%;
    max-width: 100%;
  }
  .order-lg-first {
    -webkit-box-ordinal-group: 0;
        -ms-flex-order: -1;
            order: -1;
  }
  .order-lg-last {
    -webkit-box-ordinal-group: 14;
        -ms-flex-order: 13;
            order: 13;
  }
  .order-lg-0 {
    -webkit-box-ordinal-group: 1;
        -ms-flex-order: 0;
            order: 0;
  }
  .order-lg-1 {
    -webkit-box-ordinal-group: 2;
        -ms-flex-order: 1;
            order: 1;
  }
  .order-lg-2 {
    -webkit-box-ordinal-group: 3;
        -ms-flex-order: 2;
            order: 2;
  }
  .order-lg-3 {
    -webkit-box-ordinal-group: 4;
        -ms-flex-order: 3;
            order: 3;
  }
  .order-lg-4 {
    -webkit-box-ordinal-group: 5;
        -ms-flex-order: 4;
            order: 4;
  }
  .order-lg-5 {
    -webkit-box-ordinal-group: 6;
        -ms-flex-order: 5;
            order: 5;
  }
  .order-lg-6 {
    -webkit-box-ordinal-group: 7;
        -ms-flex-order: 6;
            order: 6;
  }
  .order-lg-7 {
    -webkit-box-ordinal-group: 8;
        -ms-flex-order: 7;
            order: 7;
  }
  .order-lg-8 {
    -webkit-box-ordinal-group: 9;
        -ms-flex-order: 8;
            order: 8;
  }
  .order-lg-9 {
    -webkit-box-ordinal-group: 10;
        -ms-flex-order: 9;
            order: 9;
  }
  .order-lg-10 {
    -webkit-box-ordinal-group: 11;
        -ms-flex-order: 10;
            order: 10;
  }
  .order-lg-11 {
    -webkit-box-ordinal-group: 12;
        -ms-flex-order: 11;
            order: 11;
  }
  .order-lg-12 {
    -webkit-box-ordinal-group: 13;
        -ms-flex-order: 12;
            order: 12;
  }
  .offset-lg-0 {
    margin-left: 0;
  }
  .offset-lg-1 {
    margin-left: 8.33333333%;
  }
  .offset-lg-2 {
    margin-left: 16.66666667%;
  }
  .offset-lg-3 {
    margin-left: 25%;
  }
  .offset-lg-4 {
    margin-left: 33.33333333%;
  }
  .offset-lg-5 {
    margin-left: 41.66666667%;
  }
  .offset-lg-6 {
    margin-left: 50%;
  }
  .offset-lg-7 {
    margin-left: 58.33333333%;
  }
  .offset-lg-8 {
    margin-left: 66.66666667%;
  }
  .offset-lg-9 {
    margin-left: 75%;
  }
  .offset-lg-10 {
    margin-left: 83.33333333%;
  }
  .offset-lg-11 {
    margin-left: 91.66666667%;
  }
}
@media (min-width: 1200px) {
  .col-xl {
    -ms-flex-preferred-size: 0;
        flex-basis: 0;
    -webkit-box-flex: 1;
        -ms-flex-positive: 1;
            flex-grow: 1;
    max-width: 100%;
  }
  .row-cols-xl-1 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 100%;
            flex: 0 0 100%;
    max-width: 100%;
  }
  .row-cols-xl-2 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 50%;
            flex: 0 0 50%;
    max-width: 50%;
  }
  .row-cols-xl-3 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 33.3333333333%;
            flex: 0 0 33.3333333333%;
    max-width: 33.3333333333%;
  }
  .row-cols-xl-4 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 25%;
            flex: 0 0 25%;
    max-width: 25%;
  }
  .row-cols-xl-5 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 20%;
            flex: 0 0 20%;
    max-width: 20%;
  }
  .row-cols-xl-6 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 16.6666666667%;
            flex: 0 0 16.6666666667%;
    max-width: 16.6666666667%;
  }
  .col-xl-auto {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 auto;
            flex: 0 0 auto;
    width: auto;
    max-width: 100%;
  }
  .col-xl-1 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 8.33333333%;
            flex: 0 0 8.33333333%;
    max-width: 8.33333333%;
  }
  .col-xl-2 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 16.66666667%;
            flex: 0 0 16.66666667%;
    max-width: 16.66666667%;
  }
  .col-xl-3 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 25%;
            flex: 0 0 25%;
    max-width: 25%;
  }
  .col-xl-4 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 33.33333333%;
            flex: 0 0 33.33333333%;
    max-width: 33.33333333%;
  }
  .col-xl-5 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 41.66666667%;
            flex: 0 0 41.66666667%;
    max-width: 41.66666667%;
  }
  .col-xl-6 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 50%;
            flex: 0 0 50%;
    max-width: 50%;
  }
  .col-xl-7 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 58.33333333%;
            flex: 0 0 58.33333333%;
    max-width: 58.33333333%;
  }
  .col-xl-8 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 66.66666667%;
            flex: 0 0 66.66666667%;
    max-width: 66.66666667%;
  }
  .col-xl-9 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 75%;
            flex: 0 0 75%;
    max-width: 75%;
  }
  .col-xl-10 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 83.33333333%;
            flex: 0 0 83.33333333%;
    max-width: 83.33333333%;
  }
  .col-xl-11 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 91.66666667%;
            flex: 0 0 91.66666667%;
    max-width: 91.66666667%;
  }
  .col-xl-12 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 100%;
            flex: 0 0 100%;
    max-width: 100%;
  }
  .order-xl-first {
    -webkit-box-ordinal-group: 0;
        -ms-flex-order: -1;
            order: -1;
  }
  .order-xl-last {
    -webkit-box-ordinal-group: 14;
        -ms-flex-order: 13;
            order: 13;
  }
  .order-xl-0 {
    -webkit-box-ordinal-group: 1;
        -ms-flex-order: 0;
            order: 0;
  }
  .order-xl-1 {
    -webkit-box-ordinal-group: 2;
        -ms-flex-order: 1;
            order: 1;
  }
  .order-xl-2 {
    -webkit-box-ordinal-group: 3;
        -ms-flex-order: 2;
            order: 2;
  }
  .order-xl-3 {
    -webkit-box-ordinal-group: 4;
        -ms-flex-order: 3;
            order: 3;
  }
  .order-xl-4 {
    -webkit-box-ordinal-group: 5;
        -ms-flex-order: 4;
            order: 4;
  }
  .order-xl-5 {
    -webkit-box-ordinal-group: 6;
        -ms-flex-order: 5;
            order: 5;
  }
  .order-xl-6 {
    -webkit-box-ordinal-group: 7;
        -ms-flex-order: 6;
            order: 6;
  }
  .order-xl-7 {
    -webkit-box-ordinal-group: 8;
        -ms-flex-order: 7;
            order: 7;
  }
  .order-xl-8 {
    -webkit-box-ordinal-group: 9;
        -ms-flex-order: 8;
            order: 8;
  }
  .order-xl-9 {
    -webkit-box-ordinal-group: 10;
        -ms-flex-order: 9;
            order: 9;
  }
  .order-xl-10 {
    -webkit-box-ordinal-group: 11;
        -ms-flex-order: 10;
            order: 10;
  }
  .order-xl-11 {
    -webkit-box-ordinal-group: 12;
        -ms-flex-order: 11;
            order: 11;
  }
  .order-xl-12 {
    -webkit-box-ordinal-group: 13;
        -ms-flex-order: 12;
            order: 12;
  }
  .offset-xl-0 {
    margin-left: 0;
  }
  .offset-xl-1 {
    margin-left: 8.33333333%;
  }
  .offset-xl-2 {
    margin-left: 16.66666667%;
  }
  .offset-xl-3 {
    margin-left: 25%;
  }
  .offset-xl-4 {
    margin-left: 33.33333333%;
  }
  .offset-xl-5 {
    margin-left: 41.66666667%;
  }
  .offset-xl-6 {
    margin-left: 50%;
  }
  .offset-xl-7 {
    margin-left: 58.33333333%;
  }
  .offset-xl-8 {
    margin-left: 66.66666667%;
  }
  .offset-xl-9 {
    margin-left: 75%;
  }
  .offset-xl-10 {
    margin-left: 83.33333333%;
  }
  .offset-xl-11 {
    margin-left: 91.66666667%;
  }
}
@media (min-width: 1400px) {
  .col-xxl {
    -ms-flex-preferred-size: 0;
        flex-basis: 0;
    -webkit-box-flex: 1;
        -ms-flex-positive: 1;
            flex-grow: 1;
    max-width: 100%;
  }
  .row-cols-xxl-1 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 100%;
            flex: 0 0 100%;
    max-width: 100%;
  }
  .row-cols-xxl-2 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 50%;
            flex: 0 0 50%;
    max-width: 50%;
  }
  .row-cols-xxl-3 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 33.3333333333%;
            flex: 0 0 33.3333333333%;
    max-width: 33.3333333333%;
  }
  .row-cols-xxl-4 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 25%;
            flex: 0 0 25%;
    max-width: 25%;
  }
  .row-cols-xxl-5 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 20%;
            flex: 0 0 20%;
    max-width: 20%;
  }
  .row-cols-xxl-6 > * {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 16.6666666667%;
            flex: 0 0 16.6666666667%;
    max-width: 16.6666666667%;
  }
  .col-xxl-auto {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 auto;
            flex: 0 0 auto;
    width: auto;
    max-width: 100%;
  }
  .col-xxl-1 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 8.33333333%;
            flex: 0 0 8.33333333%;
    max-width: 8.33333333%;
  }
  .col-xxl-2 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 16.66666667%;
            flex: 0 0 16.66666667%;
    max-width: 16.66666667%;
  }
  .col-xxl-3 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 25%;
            flex: 0 0 25%;
    max-width: 25%;
  }
  .col-xxl-4 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 33.33333333%;
            flex: 0 0 33.33333333%;
    max-width: 33.33333333%;
  }
  .col-xxl-5 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 41.66666667%;
            flex: 0 0 41.66666667%;
    max-width: 41.66666667%;
  }
  .col-xxl-6 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 50%;
            flex: 0 0 50%;
    max-width: 50%;
  }
  .col-xxl-7 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 58.33333333%;
            flex: 0 0 58.33333333%;
    max-width: 58.33333333%;
  }
  .col-xxl-8 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 66.66666667%;
            flex: 0 0 66.66666667%;
    max-width: 66.66666667%;
  }
  .col-xxl-9 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 75%;
            flex: 0 0 75%;
    max-width: 75%;
  }
  .col-xxl-10 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 83.33333333%;
            flex: 0 0 83.33333333%;
    max-width: 83.33333333%;
  }
  .col-xxl-11 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 91.66666667%;
            flex: 0 0 91.66666667%;
    max-width: 91.66666667%;
  }
  .col-xxl-12 {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 100%;
            flex: 0 0 100%;
    max-width: 100%;
  }
  .order-xxl-first {
    -webkit-box-ordinal-group: 0;
        -ms-flex-order: -1;
            order: -1;
  }
  .order-xxl-last {
    -webkit-box-ordinal-group: 14;
        -ms-flex-order: 13;
            order: 13;
  }
  .order-xxl-0 {
    -webkit-box-ordinal-group: 1;
        -ms-flex-order: 0;
            order: 0;
  }
  .order-xxl-1 {
    -webkit-box-ordinal-group: 2;
        -ms-flex-order: 1;
            order: 1;
  }
  .order-xxl-2 {
    -webkit-box-ordinal-group: 3;
        -ms-flex-order: 2;
            order: 2;
  }
  .order-xxl-3 {
    -webkit-box-ordinal-group: 4;
        -ms-flex-order: 3;
            order: 3;
  }
  .order-xxl-4 {
    -webkit-box-ordinal-group: 5;
        -ms-flex-order: 4;
            order: 4;
  }
  .order-xxl-5 {
    -webkit-box-ordinal-group: 6;
        -ms-flex-order: 5;
            order: 5;
  }
  .order-xxl-6 {
    -webkit-box-ordinal-group: 7;
        -ms-flex-order: 6;
            order: 6;
  }
  .order-xxl-7 {
    -webkit-box-ordinal-group: 8;
        -ms-flex-order: 7;
            order: 7;
  }
  .order-xxl-8 {
    -webkit-box-ordinal-group: 9;
        -ms-flex-order: 8;
            order: 8;
  }
  .order-xxl-9 {
    -webkit-box-ordinal-group: 10;
        -ms-flex-order: 9;
            order: 9;
  }
  .order-xxl-10 {
    -webkit-box-ordinal-group: 11;
        -ms-flex-order: 10;
            order: 10;
  }
  .order-xxl-11 {
    -webkit-box-ordinal-group: 12;
        -ms-flex-order: 11;
            order: 11;
  }
  .order-xxl-12 {
    -webkit-box-ordinal-group: 13;
        -ms-flex-order: 12;
            order: 12;
  }
  .offset-xxl-0 {
    margin-left: 0;
  }
  .offset-xxl-1 {
    margin-left: 8.33333333%;
  }
  .offset-xxl-2 {
    margin-left: 16.66666667%;
  }
  .offset-xxl-3 {
    margin-left: 25%;
  }
  .offset-xxl-4 {
    margin-left: 33.33333333%;
  }
  .offset-xxl-5 {
    margin-left: 41.66666667%;
  }
  .offset-xxl-6 {
    margin-left: 50%;
  }
  .offset-xxl-7 {
    margin-left: 58.33333333%;
  }
  .offset-xxl-8 {
    margin-left: 66.66666667%;
  }
  .offset-xxl-9 {
    margin-left: 75%;
  }
  .offset-xxl-10 {
    margin-left: 83.33333333%;
  }
  .offset-xxl-11 {
    margin-left: 91.66666667%;
  }
}
.d-none {
  display: none !important;
}

.d-inline {
  display: inline !important;
}

.d-inline-block {
  display: inline-block !important;
}

.d-block {
  display: block !important;
}

.d-table {
  display: table !important;
}

.d-table-row {
  display: table-row !important;
}

.d-table-cell {
  display: table-cell !important;
}

.d-flex {
  display: -webkit-box !important;
  display: -ms-flexbox !important;
  display: flex !important;
}

.d-inline-flex {
  display: -webkit-inline-box !important;
  display: -ms-inline-flexbox !important;
  display: inline-flex !important;
}

@media (min-width: 576px) {
  .d-sm-none {
    display: none !important;
  }
  .d-sm-inline {
    display: inline !important;
  }
  .d-sm-inline-block {
    display: inline-block !important;
  }
  .d-sm-block {
    display: block !important;
  }
  .d-sm-table {
    display: table !important;
  }
  .d-sm-table-row {
    display: table-row !important;
  }
  .d-sm-table-cell {
    display: table-cell !important;
  }
  .d-sm-flex {
    display: -webkit-box !important;
    display: -ms-flexbox !important;
    display: flex !important;
  }
  .d-sm-inline-flex {
    display: -webkit-inline-box !important;
    display: -ms-inline-flexbox !important;
    display: inline-flex !important;
  }
}
@media (min-width: 768px) {
  .d-md-none {
    display: none !important;
  }
  .d-md-inline {
    display: inline !important;
  }
  .d-md-inline-block {
    display: inline-block !important;
  }
  .d-md-block {
    display: block !important;
  }
  .d-md-table {
    display: table !important;
  }
  .d-md-table-row {
    display: table-row !important;
  }
  .d-md-table-cell {
    display: table-cell !important;
  }
  .d-md-flex {
    display: -webkit-box !important;
    display: -ms-flexbox !important;
    display: flex !important;
  }
  .d-md-inline-flex {
    display: -webkit-inline-box !important;
    display: -ms-inline-flexbox !important;
    display: inline-flex !important;
  }
}
@media (min-width: 992px) {
  .d-lg-none {
    display: none !important;
  }
  .d-lg-inline {
    display: inline !important;
  }
  .d-lg-inline-block {
    display: inline-block !important;
  }
  .d-lg-block {
    display: block !important;
  }
  .d-lg-table {
    display: table !important;
  }
  .d-lg-table-row {
    display: table-row !important;
  }
  .d-lg-table-cell {
    display: table-cell !important;
  }
  .d-lg-flex {
    display: -webkit-box !important;
    display: -ms-flexbox !important;
    display: flex !important;
  }
  .d-lg-inline-flex {
    display: -webkit-inline-box !important;
    display: -ms-inline-flexbox !important;
    display: inline-flex !important;
  }
}
@media (min-width: 1200px) {
  .d-xl-none {
    display: none !important;
  }
  .d-xl-inline {
    display: inline !important;
  }
  .d-xl-inline-block {
    display: inline-block !important;
  }
  .d-xl-block {
    display: block !important;
  }
  .d-xl-table {
    display: table !important;
  }
  .d-xl-table-row {
    display: table-row !important;
  }
  .d-xl-table-cell {
    display: table-cell !important;
  }
  .d-xl-flex {
    display: -webkit-box !important;
    display: -ms-flexbox !important;
    display: flex !important;
  }
  .d-xl-inline-flex {
    display: -webkit-inline-box !important;
    display: -ms-inline-flexbox !important;
    display: inline-flex !important;
  }
}
@media (min-width: 1400px) {
  .d-xxl-none {
    display: none !important;
  }
  .d-xxl-inline {
    display: inline !important;
  }
  .d-xxl-inline-block {
    display: inline-block !important;
  }
  .d-xxl-block {
    display: block !important;
  }
  .d-xxl-table {
    display: table !important;
  }
  .d-xxl-table-row {
    display: table-row !important;
  }
  .d-xxl-table-cell {
    display: table-cell !important;
  }
  .d-xxl-flex {
    display: -webkit-box !important;
    display: -ms-flexbox !important;
    display: flex !important;
  }
  .d-xxl-inline-flex {
    display: -webkit-inline-box !important;
    display: -ms-inline-flexbox !important;
    display: inline-flex !important;
  }
}
@media print {
  .d-print-none {
    display: none !important;
  }
  .d-print-inline {
    display: inline !important;
  }
  .d-print-inline-block {
    display: inline-block !important;
  }
  .d-print-block {
    display: block !important;
  }
  .d-print-table {
    display: table !important;
  }
  .d-print-table-row {
    display: table-row !important;
  }
  .d-print-table-cell {
    display: table-cell !important;
  }
  .d-print-flex {
    display: -webkit-box !important;
    display: -ms-flexbox !important;
    display: flex !important;
  }
  .d-print-inline-flex {
    display: -webkit-inline-box !important;
    display: -ms-inline-flexbox !important;
    display: inline-flex !important;
  }
}
.flex-row {
  -webkit-box-orient: horizontal !important;
  -webkit-box-direction: normal !important;
      -ms-flex-direction: row !important;
          flex-direction: row !important;
}

.flex-column {
  -webkit-box-orient: vertical !important;
  -webkit-box-direction: normal !important;
      -ms-flex-direction: column !important;
          flex-direction: column !important;
}

.flex-row-reverse {
  -webkit-box-orient: horizontal !important;
  -webkit-box-direction: reverse !important;
      -ms-flex-direction: row-reverse !important;
          flex-direction: row-reverse !important;
}

.flex-column-reverse {
  -webkit-box-orient: vertical !important;
  -webkit-box-direction: reverse !important;
      -ms-flex-direction: column-reverse !important;
          flex-direction: column-reverse !important;
}

.flex-wrap {
  -ms-flex-wrap: wrap !important;
      flex-wrap: wrap !important;
}

.flex-nowrap {
  -ms-flex-wrap: nowrap !important;
      flex-wrap: nowrap !important;
}

.flex-wrap-reverse {
  -ms-flex-wrap: wrap-reverse !important;
      flex-wrap: wrap-reverse !important;
}

.flex-fill {
  -webkit-box-flex: 1 !important;
      -ms-flex: 1 1 auto !important;
          flex: 1 1 auto !important;
}

.flex-grow-0 {
  -webkit-box-flex: 0 !important;
      -ms-flex-positive: 0 !important;
          flex-grow: 0 !important;
}

.flex-grow-1 {
  -webkit-box-flex: 1 !important;
      -ms-flex-positive: 1 !important;
          flex-grow: 1 !important;
}

.flex-shrink-0 {
  -ms-flex-negative: 0 !important;
      flex-shrink: 0 !important;
}

.flex-shrink-1 {
  -ms-flex-negative: 1 !important;
      flex-shrink: 1 !important;
}

.justify-content-start {
  -webkit-box-pack: start !important;
      -ms-flex-pack: start !important;
          justify-content: flex-start !important;
}

.justify-content-end {
  -webkit-box-pack: end !important;
      -ms-flex-pack: end !important;
          justify-content: flex-end !important;
}

.justify-content-center {
  -webkit-box-pack: center !important;
      -ms-flex-pack: center !important;
          justify-content: center !important;
}

.justify-content-between {
  -webkit-box-pack: justify !important;
      -ms-flex-pack: justify !important;
          justify-content: space-between !important;
}

.justify-content-around {
  -ms-flex-pack: distribute !important;
      justify-content: space-around !important;
}

.align-items-start {
  -webkit-box-align: start !important;
      -ms-flex-align: start !important;
          align-items: flex-start !important;
}

.align-items-end {
  -webkit-box-align: end !important;
      -ms-flex-align: end !important;
          align-items: flex-end !important;
}

.align-items-center {
  -webkit-box-align: center !important;
      -ms-flex-align: center !important;
          align-items: center !important;
}

.align-items-baseline {
  -webkit-box-align: baseline !important;
      -ms-flex-align: baseline !important;
          align-items: baseline !important;
}

.align-items-stretch {
  -webkit-box-align: stretch !important;
      -ms-flex-align: stretch !important;
          align-items: stretch !important;
}

.align-content-start {
  -ms-flex-line-pack: start !important;
      align-content: flex-start !important;
}

.align-content-end {
  -ms-flex-line-pack: end !important;
      align-content: flex-end !important;
}

.align-content-center {
  -ms-flex-line-pack: center !important;
      align-content: center !important;
}

.align-content-between {
  -ms-flex-line-pack: justify !important;
      align-content: space-between !important;
}

.align-content-around {
  -ms-flex-line-pack: distribute !important;
      align-content: space-around !important;
}

.align-content-stretch {
  -ms-flex-line-pack: stretch !important;
      align-content: stretch !important;
}

.align-self-auto {
  -ms-flex-item-align: auto !important;
      align-self: auto !important;
}

.align-self-start {
  -ms-flex-item-align: start !important;
      align-self: flex-start !important;
}

.align-self-end {
  -ms-flex-item-align: end !important;
      align-self: flex-end !important;
}

.align-self-center {
  -ms-flex-item-align: center !important;
      align-self: center !important;
}

.align-self-baseline {
  -ms-flex-item-align: baseline !important;
      align-self: baseline !important;
}

.align-self-stretch {
  -ms-flex-item-align: stretch !important;
      align-self: stretch !important;
}

@media (min-width: 576px) {
  .flex-sm-row {
    -webkit-box-orient: horizontal !important;
    -webkit-box-direction: normal !important;
        -ms-flex-direction: row !important;
            flex-direction: row !important;
  }
  .flex-sm-column {
    -webkit-box-orient: vertical !important;
    -webkit-box-direction: normal !important;
        -ms-flex-direction: column !important;
            flex-direction: column !important;
  }
  .flex-sm-row-reverse {
    -webkit-box-orient: horizontal !important;
    -webkit-box-direction: reverse !important;
        -ms-flex-direction: row-reverse !important;
            flex-direction: row-reverse !important;
  }
  .flex-sm-column-reverse {
    -webkit-box-orient: vertical !important;
    -webkit-box-direction: reverse !important;
        -ms-flex-direction: column-reverse !important;
            flex-direction: column-reverse !important;
  }
  .flex-sm-wrap {
    -ms-flex-wrap: wrap !important;
        flex-wrap: wrap !important;
  }
  .flex-sm-nowrap {
    -ms-flex-wrap: nowrap !important;
        flex-wrap: nowrap !important;
  }
  .flex-sm-wrap-reverse {
    -ms-flex-wrap: wrap-reverse !important;
        flex-wrap: wrap-reverse !important;
  }
  .flex-sm-fill {
    -webkit-box-flex: 1 !important;
        -ms-flex: 1 1 auto !important;
            flex: 1 1 auto !important;
  }
  .flex-sm-grow-0 {
    -webkit-box-flex: 0 !important;
        -ms-flex-positive: 0 !important;
            flex-grow: 0 !important;
  }
  .flex-sm-grow-1 {
    -webkit-box-flex: 1 !important;
        -ms-flex-positive: 1 !important;
            flex-grow: 1 !important;
  }
  .flex-sm-shrink-0 {
    -ms-flex-negative: 0 !important;
        flex-shrink: 0 !important;
  }
  .flex-sm-shrink-1 {
    -ms-flex-negative: 1 !important;
        flex-shrink: 1 !important;
  }
  .justify-content-sm-start {
    -webkit-box-pack: start !important;
        -ms-flex-pack: start !important;
            justify-content: flex-start !important;
  }
  .justify-content-sm-end {
    -webkit-box-pack: end !important;
        -ms-flex-pack: end !important;
            justify-content: flex-end !important;
  }
  .justify-content-sm-center {
    -webkit-box-pack: center !important;
        -ms-flex-pack: center !important;
            justify-content: center !important;
  }
  .justify-content-sm-between {
    -webkit-box-pack: justify !important;
        -ms-flex-pack: justify !important;
            justify-content: space-between !important;
  }
  .justify-content-sm-around {
    -ms-flex-pack: distribute !important;
        justify-content: space-around !important;
  }
  .align-items-sm-start {
    -webkit-box-align: start !important;
        -ms-flex-align: start !important;
            align-items: flex-start !important;
  }
  .align-items-sm-end {
    -webkit-box-align: end !important;
        -ms-flex-align: end !important;
            align-items: flex-end !important;
  }
  .align-items-sm-center {
    -webkit-box-align: center !important;
        -ms-flex-align: center !important;
            align-items: center !important;
  }
  .align-items-sm-baseline {
    -webkit-box-align: baseline !important;
        -ms-flex-align: baseline !important;
            align-items: baseline !important;
  }
  .align-items-sm-stretch {
    -webkit-box-align: stretch !important;
        -ms-flex-align: stretch !important;
            align-items: stretch !important;
  }
  .align-content-sm-start {
    -ms-flex-line-pack: start !important;
        align-content: flex-start !important;
  }
  .align-content-sm-end {
    -ms-flex-line-pack: end !important;
        align-content: flex-end !important;
  }
  .align-content-sm-center {
    -ms-flex-line-pack: center !important;
        align-content: center !important;
  }
  .align-content-sm-between {
    -ms-flex-line-pack: justify !important;
        align-content: space-between !important;
  }
  .align-content-sm-around {
    -ms-flex-line-pack: distribute !important;
        align-content: space-around !important;
  }
  .align-content-sm-stretch {
    -ms-flex-line-pack: stretch !important;
        align-content: stretch !important;
  }
  .align-self-sm-auto {
    -ms-flex-item-align: auto !important;
        align-self: auto !important;
  }
  .align-self-sm-start {
    -ms-flex-item-align: start !important;
        align-self: flex-start !important;
  }
  .align-self-sm-end {
    -ms-flex-item-align: end !important;
        align-self: flex-end !important;
  }
  .align-self-sm-center {
    -ms-flex-item-align: center !important;
        align-self: center !important;
  }
  .align-self-sm-baseline {
    -ms-flex-item-align: baseline !important;
        align-self: baseline !important;
  }
  .align-self-sm-stretch {
    -ms-flex-item-align: stretch !important;
        align-self: stretch !important;
  }
}
@media (min-width: 768px) {
  .flex-md-row {
    -webkit-box-orient: horizontal !important;
    -webkit-box-direction: normal !important;
        -ms-flex-direction: row !important;
            flex-direction: row !important;
  }
  .flex-md-column {
    -webkit-box-orient: vertical !important;
    -webkit-box-direction: normal !important;
        -ms-flex-direction: column !important;
            flex-direction: column !important;
  }
  .flex-md-row-reverse {
    -webkit-box-orient: horizontal !important;
    -webkit-box-direction: reverse !important;
        -ms-flex-direction: row-reverse !important;
            flex-direction: row-reverse !important;
  }
  .flex-md-column-reverse {
    -webkit-box-orient: vertical !important;
    -webkit-box-direction: reverse !important;
        -ms-flex-direction: column-reverse !important;
            flex-direction: column-reverse !important;
  }
  .flex-md-wrap {
    -ms-flex-wrap: wrap !important;
        flex-wrap: wrap !important;
  }
  .flex-md-nowrap {
    -ms-flex-wrap: nowrap !important;
        flex-wrap: nowrap !important;
  }
  .flex-md-wrap-reverse {
    -ms-flex-wrap: wrap-reverse !important;
        flex-wrap: wrap-reverse !important;
  }
  .flex-md-fill {
    -webkit-box-flex: 1 !important;
        -ms-flex: 1 1 auto !important;
            flex: 1 1 auto !important;
  }
  .flex-md-grow-0 {
    -webkit-box-flex: 0 !important;
        -ms-flex-positive: 0 !important;
            flex-grow: 0 !important;
  }
  .flex-md-grow-1 {
    -webkit-box-flex: 1 !important;
        -ms-flex-positive: 1 !important;
            flex-grow: 1 !important;
  }
  .flex-md-shrink-0 {
    -ms-flex-negative: 0 !important;
        flex-shrink: 0 !important;
  }
  .flex-md-shrink-1 {
    -ms-flex-negative: 1 !important;
        flex-shrink: 1 !important;
  }
  .justify-content-md-start {
    -webkit-box-pack: start !important;
        -ms-flex-pack: start !important;
            justify-content: flex-start !important;
  }
  .justify-content-md-end {
    -webkit-box-pack: end !important;
        -ms-flex-pack: end !important;
            justify-content: flex-end !important;
  }
  .justify-content-md-center {
    -webkit-box-pack: center !important;
        -ms-flex-pack: center !important;
            justify-content: center !important;
  }
  .justify-content-md-between {
    -webkit-box-pack: justify !important;
        -ms-flex-pack: justify !important;
            justify-content: space-between !important;
  }
  .justify-content-md-around {
    -ms-flex-pack: distribute !important;
        justify-content: space-around !important;
  }
  .align-items-md-start {
    -webkit-box-align: start !important;
        -ms-flex-align: start !important;
            align-items: flex-start !important;
  }
  .align-items-md-end {
    -webkit-box-align: end !important;
        -ms-flex-align: end !important;
            align-items: flex-end !important;
  }
  .align-items-md-center {
    -webkit-box-align: center !important;
        -ms-flex-align: center !important;
            align-items: center !important;
  }
  .align-items-md-baseline {
    -webkit-box-align: baseline !important;
        -ms-flex-align: baseline !important;
            align-items: baseline !important;
  }
  .align-items-md-stretch {
    -webkit-box-align: stretch !important;
        -ms-flex-align: stretch !important;
            align-items: stretch !important;
  }
  .align-content-md-start {
    -ms-flex-line-pack: start !important;
        align-content: flex-start !important;
  }
  .align-content-md-end {
    -ms-flex-line-pack: end !important;
        align-content: flex-end !important;
  }
  .align-content-md-center {
    -ms-flex-line-pack: center !important;
        align-content: center !important;
  }
  .align-content-md-between {
    -ms-flex-line-pack: justify !important;
        align-content: space-between !important;
  }
  .align-content-md-around {
    -ms-flex-line-pack: distribute !important;
        align-content: space-around !important;
  }
  .align-content-md-stretch {
    -ms-flex-line-pack: stretch !important;
        align-content: stretch !important;
  }
  .align-self-md-auto {
    -ms-flex-item-align: auto !important;
        align-self: auto !important;
  }
  .align-self-md-start {
    -ms-flex-item-align: start !important;
        align-self: flex-start !important;
  }
  .align-self-md-end {
    -ms-flex-item-align: end !important;
        align-self: flex-end !important;
  }
  .align-self-md-center {
    -ms-flex-item-align: center !important;
        align-self: center !important;
  }
  .align-self-md-baseline {
    -ms-flex-item-align: baseline !important;
        align-self: baseline !important;
  }
  .align-self-md-stretch {
    -ms-flex-item-align: stretch !important;
        align-self: stretch !important;
  }
}
@media (min-width: 992px) {
  .flex-lg-row {
    -webkit-box-orient: horizontal !important;
    -webkit-box-direction: normal !important;
        -ms-flex-direction: row !important;
            flex-direction: row !important;
  }
  .flex-lg-column {
    -webkit-box-orient: vertical !important;
    -webkit-box-direction: normal !important;
        -ms-flex-direction: column !important;
            flex-direction: column !important;
  }
  .flex-lg-row-reverse {
    -webkit-box-orient: horizontal !important;
    -webkit-box-direction: reverse !important;
        -ms-flex-direction: row-reverse !important;
            flex-direction: row-reverse !important;
  }
  .flex-lg-column-reverse {
    -webkit-box-orient: vertical !important;
    -webkit-box-direction: reverse !important;
        -ms-flex-direction: column-reverse !important;
            flex-direction: column-reverse !important;
  }
  .flex-lg-wrap {
    -ms-flex-wrap: wrap !important;
        flex-wrap: wrap !important;
  }
  .flex-lg-nowrap {
    -ms-flex-wrap: nowrap !important;
        flex-wrap: nowrap !important;
  }
  .flex-lg-wrap-reverse {
    -ms-flex-wrap: wrap-reverse !important;
        flex-wrap: wrap-reverse !important;
  }
  .flex-lg-fill {
    -webkit-box-flex: 1 !important;
        -ms-flex: 1 1 auto !important;
            flex: 1 1 auto !important;
  }
  .flex-lg-grow-0 {
    -webkit-box-flex: 0 !important;
        -ms-flex-positive: 0 !important;
            flex-grow: 0 !important;
  }
  .flex-lg-grow-1 {
    -webkit-box-flex: 1 !important;
        -ms-flex-positive: 1 !important;
            flex-grow: 1 !important;
  }
  .flex-lg-shrink-0 {
    -ms-flex-negative: 0 !important;
        flex-shrink: 0 !important;
  }
  .flex-lg-shrink-1 {
    -ms-flex-negative: 1 !important;
        flex-shrink: 1 !important;
  }
  .justify-content-lg-start {
    -webkit-box-pack: start !important;
        -ms-flex-pack: start !important;
            justify-content: flex-start !important;
  }
  .justify-content-lg-end {
    -webkit-box-pack: end !important;
        -ms-flex-pack: end !important;
            justify-content: flex-end !important;
  }
  .justify-content-lg-center {
    -webkit-box-pack: center !important;
        -ms-flex-pack: center !important;
            justify-content: center !important;
  }
  .justify-content-lg-between {
    -webkit-box-pack: justify !important;
        -ms-flex-pack: justify !important;
            justify-content: space-between !important;
  }
  .justify-content-lg-around {
    -ms-flex-pack: distribute !important;
        justify-content: space-around !important;
  }
  .align-items-lg-start {
    -webkit-box-align: start !important;
        -ms-flex-align: start !important;
            align-items: flex-start !important;
  }
  .align-items-lg-end {
    -webkit-box-align: end !important;
        -ms-flex-align: end !important;
            align-items: flex-end !important;
  }
  .align-items-lg-center {
    -webkit-box-align: center !important;
        -ms-flex-align: center !important;
            align-items: center !important;
  }
  .align-items-lg-baseline {
    -webkit-box-align: baseline !important;
        -ms-flex-align: baseline !important;
            align-items: baseline !important;
  }
  .align-items-lg-stretch {
    -webkit-box-align: stretch !important;
        -ms-flex-align: stretch !important;
            align-items: stretch !important;
  }
  .align-content-lg-start {
    -ms-flex-line-pack: start !important;
        align-content: flex-start !important;
  }
  .align-content-lg-end {
    -ms-flex-line-pack: end !important;
        align-content: flex-end !important;
  }
  .align-content-lg-center {
    -ms-flex-line-pack: center !important;
        align-content: center !important;
  }
  .align-content-lg-between {
    -ms-flex-line-pack: justify !important;
        align-content: space-between !important;
  }
  .align-content-lg-around {
    -ms-flex-line-pack: distribute !important;
        align-content: space-around !important;
  }
  .align-content-lg-stretch {
    -ms-flex-line-pack: stretch !important;
        align-content: stretch !important;
  }
  .align-self-lg-auto {
    -ms-flex-item-align: auto !important;
        align-self: auto !important;
  }
  .align-self-lg-start {
    -ms-flex-item-align: start !important;
        align-self: flex-start !important;
  }
  .align-self-lg-end {
    -ms-flex-item-align: end !important;
        align-self: flex-end !important;
  }
  .align-self-lg-center {
    -ms-flex-item-align: center !important;
        align-self: center !important;
  }
  .align-self-lg-baseline {
    -ms-flex-item-align: baseline !important;
        align-self: baseline !important;
  }
  .align-self-lg-stretch {
    -ms-flex-item-align: stretch !important;
        align-self: stretch !important;
  }
}
@media (min-width: 1200px) {
  .flex-xl-row {
    -webkit-box-orient: horizontal !important;
    -webkit-box-direction: normal !important;
        -ms-flex-direction: row !important;
            flex-direction: row !important;
  }
  .flex-xl-column {
    -webkit-box-orient: vertical !important;
    -webkit-box-direction: normal !important;
        -ms-flex-direction: column !important;
            flex-direction: column !important;
  }
  .flex-xl-row-reverse {
    -webkit-box-orient: horizontal !important;
    -webkit-box-direction: reverse !important;
        -ms-flex-direction: row-reverse !important;
            flex-direction: row-reverse !important;
  }
  .flex-xl-column-reverse {
    -webkit-box-orient: vertical !important;
    -webkit-box-direction: reverse !important;
        -ms-flex-direction: column-reverse !important;
            flex-direction: column-reverse !important;
  }
  .flex-xl-wrap {
    -ms-flex-wrap: wrap !important;
        flex-wrap: wrap !important;
  }
  .flex-xl-nowrap {
    -ms-flex-wrap: nowrap !important;
        flex-wrap: nowrap !important;
  }
  .flex-xl-wrap-reverse {
    -ms-flex-wrap: wrap-reverse !important;
        flex-wrap: wrap-reverse !important;
  }
  .flex-xl-fill {
    -webkit-box-flex: 1 !important;
        -ms-flex: 1 1 auto !important;
            flex: 1 1 auto !important;
  }
  .flex-xl-grow-0 {
    -webkit-box-flex: 0 !important;
        -ms-flex-positive: 0 !important;
            flex-grow: 0 !important;
  }
  .flex-xl-grow-1 {
    -webkit-box-flex: 1 !important;
        -ms-flex-positive: 1 !important;
            flex-grow: 1 !important;
  }
  .flex-xl-shrink-0 {
    -ms-flex-negative: 0 !important;
        flex-shrink: 0 !important;
  }
  .flex-xl-shrink-1 {
    -ms-flex-negative: 1 !important;
        flex-shrink: 1 !important;
  }
  .justify-content-xl-start {
    -webkit-box-pack: start !important;
        -ms-flex-pack: start !important;
            justify-content: flex-start !important;
  }
  .justify-content-xl-end {
    -webkit-box-pack: end !important;
        -ms-flex-pack: end !important;
            justify-content: flex-end !important;
  }
  .justify-content-xl-center {
    -webkit-box-pack: center !important;
        -ms-flex-pack: center !important;
            justify-content: center !important;
  }
  .justify-content-xl-between {
    -webkit-box-pack: justify !important;
        -ms-flex-pack: justify !important;
            justify-content: space-between !important;
  }
  .justify-content-xl-around {
    -ms-flex-pack: distribute !important;
        justify-content: space-around !important;
  }
  .align-items-xl-start {
    -webkit-box-align: start !important;
        -ms-flex-align: start !important;
            align-items: flex-start !important;
  }
  .align-items-xl-end {
    -webkit-box-align: end !important;
        -ms-flex-align: end !important;
            align-items: flex-end !important;
  }
  .align-items-xl-center {
    -webkit-box-align: center !important;
        -ms-flex-align: center !important;
            align-items: center !important;
  }
  .align-items-xl-baseline {
    -webkit-box-align: baseline !important;
        -ms-flex-align: baseline !important;
            align-items: baseline !important;
  }
  .align-items-xl-stretch {
    -webkit-box-align: stretch !important;
        -ms-flex-align: stretch !important;
            align-items: stretch !important;
  }
  .align-content-xl-start {
    -ms-flex-line-pack: start !important;
        align-content: flex-start !important;
  }
  .align-content-xl-end {
    -ms-flex-line-pack: end !important;
        align-content: flex-end !important;
  }
  .align-content-xl-center {
    -ms-flex-line-pack: center !important;
        align-content: center !important;
  }
  .align-content-xl-between {
    -ms-flex-line-pack: justify !important;
        align-content: space-between !important;
  }
  .align-content-xl-around {
    -ms-flex-line-pack: distribute !important;
        align-content: space-around !important;
  }
  .align-content-xl-stretch {
    -ms-flex-line-pack: stretch !important;
        align-content: stretch !important;
  }
  .align-self-xl-auto {
    -ms-flex-item-align: auto !important;
        align-self: auto !important;
  }
  .align-self-xl-start {
    -ms-flex-item-align: start !important;
        align-self: flex-start !important;
  }
  .align-self-xl-end {
    -ms-flex-item-align: end !important;
        align-self: flex-end !important;
  }
  .align-self-xl-center {
    -ms-flex-item-align: center !important;
        align-self: center !important;
  }
  .align-self-xl-baseline {
    -ms-flex-item-align: baseline !important;
        align-self: baseline !important;
  }
  .align-self-xl-stretch {
    -ms-flex-item-align: stretch !important;
        align-self: stretch !important;
  }
}
@media (min-width: 1400px) {
  .flex-xxl-row {
    -webkit-box-orient: horizontal !important;
    -webkit-box-direction: normal !important;
        -ms-flex-direction: row !important;
            flex-direction: row !important;
  }
  .flex-xxl-column {
    -webkit-box-orient: vertical !important;
    -webkit-box-direction: normal !important;
        -ms-flex-direction: column !important;
            flex-direction: column !important;
  }
  .flex-xxl-row-reverse {
    -webkit-box-orient: horizontal !important;
    -webkit-box-direction: reverse !important;
        -ms-flex-direction: row-reverse !important;
            flex-direction: row-reverse !important;
  }
  .flex-xxl-column-reverse {
    -webkit-box-orient: vertical !important;
    -webkit-box-direction: reverse !important;
        -ms-flex-direction: column-reverse !important;
            flex-direction: column-reverse !important;
  }
  .flex-xxl-wrap {
    -ms-flex-wrap: wrap !important;
        flex-wrap: wrap !important;
  }
  .flex-xxl-nowrap {
    -ms-flex-wrap: nowrap !important;
        flex-wrap: nowrap !important;
  }
  .flex-xxl-wrap-reverse {
    -ms-flex-wrap: wrap-reverse !important;
        flex-wrap: wrap-reverse !important;
  }
  .flex-xxl-fill {
    -webkit-box-flex: 1 !important;
        -ms-flex: 1 1 auto !important;
            flex: 1 1 auto !important;
  }
  .flex-xxl-grow-0 {
    -webkit-box-flex: 0 !important;
        -ms-flex-positive: 0 !important;
            flex-grow: 0 !important;
  }
  .flex-xxl-grow-1 {
    -webkit-box-flex: 1 !important;
        -ms-flex-positive: 1 !important;
            flex-grow: 1 !important;
  }
  .flex-xxl-shrink-0 {
    -ms-flex-negative: 0 !important;
        flex-shrink: 0 !important;
  }
  .flex-xxl-shrink-1 {
    -ms-flex-negative: 1 !important;
        flex-shrink: 1 !important;
  }
  .justify-content-xxl-start {
    -webkit-box-pack: start !important;
        -ms-flex-pack: start !important;
            justify-content: flex-start !important;
  }
  .justify-content-xxl-end {
    -webkit-box-pack: end !important;
        -ms-flex-pack: end !important;
            justify-content: flex-end !important;
  }
  .justify-content-xxl-center {
    -webkit-box-pack: center !important;
        -ms-flex-pack: center !important;
            justify-content: center !important;
  }
  .justify-content-xxl-between {
    -webkit-box-pack: justify !important;
        -ms-flex-pack: justify !important;
            justify-content: space-between !important;
  }
  .justify-content-xxl-around {
    -ms-flex-pack: distribute !important;
        justify-content: space-around !important;
  }
  .align-items-xxl-start {
    -webkit-box-align: start !important;
        -ms-flex-align: start !important;
            align-items: flex-start !important;
  }
  .align-items-xxl-end {
    -webkit-box-align: end !important;
        -ms-flex-align: end !important;
            align-items: flex-end !important;
  }
  .align-items-xxl-center {
    -webkit-box-align: center !important;
        -ms-flex-align: center !important;
            align-items: center !important;
  }
  .align-items-xxl-baseline {
    -webkit-box-align: baseline !important;
        -ms-flex-align: baseline !important;
            align-items: baseline !important;
  }
  .align-items-xxl-stretch {
    -webkit-box-align: stretch !important;
        -ms-flex-align: stretch !important;
            align-items: stretch !important;
  }
  .align-content-xxl-start {
    -ms-flex-line-pack: start !important;
        align-content: flex-start !important;
  }
  .align-content-xxl-end {
    -ms-flex-line-pack: end !important;
        align-content: flex-end !important;
  }
  .align-content-xxl-center {
    -ms-flex-line-pack: center !important;
        align-content: center !important;
  }
  .align-content-xxl-between {
    -ms-flex-line-pack: justify !important;
        align-content: space-between !important;
  }
  .align-content-xxl-around {
    -ms-flex-line-pack: distribute !important;
        align-content: space-around !important;
  }
  .align-content-xxl-stretch {
    -ms-flex-line-pack: stretch !important;
        align-content: stretch !important;
  }
  .align-self-xxl-auto {
    -ms-flex-item-align: auto !important;
        align-self: auto !important;
  }
  .align-self-xxl-start {
    -ms-flex-item-align: start !important;
        align-self: flex-start !important;
  }
  .align-self-xxl-end {
    -ms-flex-item-align: end !important;
        align-self: flex-end !important;
  }
  .align-self-xxl-center {
    -ms-flex-item-align: center !important;
        align-self: center !important;
  }
  .align-self-xxl-baseline {
    -ms-flex-item-align: baseline !important;
        align-self: baseline !important;
  }
  .align-self-xxl-stretch {
    -ms-flex-item-align: stretch !important;
        align-self: stretch !important;
  }
}
.m-0 {
  margin: 0 !important;
}

.mt-0,
.my-0 {
  margin-top: 0 !important;
}

.mr-0,
.mx-0 {
  margin-right: 0 !important;
}

.mb-0,
.my-0 {
  margin-bottom: 0 !important;
}

.ml-0,
.mx-0 {
  margin-left: 0 !important;
}

.m-1 {
  margin: 0.25rem !important;
}

.mt-1,
.my-1 {
  margin-top: 0.25rem !important;
}

.mr-1,
.mx-1 {
  margin-right: 0.25rem !important;
}

.mb-1,
.my-1 {
  margin-bottom: 0.25rem !important;
}

.ml-1,
.mx-1 {
  margin-left: 0.25rem !important;
}

.m-2 {
  margin: 0.5rem !important;
}

.mt-2,
.my-2 {
  margin-top: 0.5rem !important;
}

.mr-2,
.mx-2 {
  margin-right: 0.5rem !important;
}

.mb-2,
.my-2 {
  margin-bottom: 0.5rem !important;
}

.ml-2,
.mx-2 {
  margin-left: 0.5rem !important;
}

.m-3 {
  margin: 1rem !important;
}

.mt-3,
.my-3 {
  margin-top: 1rem !important;
}

.mr-3,
.mx-3 {
  margin-right: 1rem !important;
}

.mb-3,
.my-3 {
  margin-bottom: 1rem !important;
}

.ml-3,
.mx-3 {
  margin-left: 1rem !important;
}

.m-4 {
  margin: 1.5rem !important;
}

.mt-4,
.my-4 {
  margin-top: 1.5rem !important;
}

.mr-4,
.mx-4 {
  margin-right: 1.5rem !important;
}

.mb-4,
.my-4 {
  margin-bottom: 1.5rem !important;
}

.ml-4,
.mx-4 {
  margin-left: 1.5rem !important;
}

.m-5 {
  margin: 3rem !important;
}

.mt-5,
.my-5 {
  margin-top: 3rem !important;
}

.mr-5,
.mx-5 {
  margin-right: 3rem !important;
}

.mb-5,
.my-5 {
  margin-bottom: 3rem !important;
}

.ml-5,
.mx-5 {
  margin-left: 3rem !important;
}

.p-0 {
  padding: 0 !important;
}

.pt-0,
.py-0 {
  padding-top: 0 !important;
}

.pr-0,
.px-0 {
  padding-right: 0 !important;
}

.pb-0,
.py-0 {
  padding-bottom: 0 !important;
}

.pl-0,
.px-0 {
  padding-left: 0 !important;
}

.p-1 {
  padding: 0.25rem !important;
}

.pt-1,
.py-1 {
  padding-top: 0.25rem !important;
}

.pr-1,
.px-1 {
  padding-right: 0.25rem !important;
}

.pb-1,
.py-1 {
  padding-bottom: 0.25rem !important;
}

.pl-1,
.px-1 {
  padding-left: 0.25rem !important;
}

.p-2 {
  padding: 0.5rem !important;
}

.pt-2,
.py-2 {
  padding-top: 0.5rem !important;
}

.pr-2,
.px-2 {
  padding-right: 0.5rem !important;
}

.pb-2,
.py-2 {
  padding-bottom: 0.5rem !important;
}

.pl-2,
.px-2 {
  padding-left: 0.5rem !important;
}

.p-3 {
  padding: 1rem !important;
}

.pt-3,
.py-3 {
  padding-top: 1rem !important;
}

.pr-3,
.px-3 {
  padding-right: 1rem !important;
}

.pb-3,
.py-3 {
  padding-bottom: 1rem !important;
}

.pl-3,
.px-3 {
  padding-left: 1rem !important;
}

.p-4 {
  padding: 1.5rem !important;
}

.pt-4,
.py-4 {
  padding-top: 1.5rem !important;
}

.pr-4,
.px-4 {
  padding-right: 1.5rem !important;
}

.pb-4,
.py-4 {
  padding-bottom: 1.5rem !important;
}

.pl-4,
.px-4 {
  padding-left: 1.5rem !important;
}

.p-5 {
  padding: 3rem !important;
}

.pt-5,
.py-5 {
  padding-top: 3rem !important;
}

.pr-5,
.px-5 {
  padding-right: 3rem !important;
}

.pb-5,
.py-5 {
  padding-bottom: 3rem !important;
}

.pl-5,
.px-5 {
  padding-left: 3rem !important;
}

.m-n1 {
  margin: -0.25rem !important;
}

.mt-n1,
.my-n1 {
  margin-top: -0.25rem !important;
}

.mr-n1,
.mx-n1 {
  margin-right: -0.25rem !important;
}

.mb-n1,
.my-n1 {
  margin-bottom: -0.25rem !important;
}

.ml-n1,
.mx-n1 {
  margin-left: -0.25rem !important;
}

.m-n2 {
  margin: -0.5rem !important;
}

.mt-n2,
.my-n2 {
  margin-top: -0.5rem !important;
}

.mr-n2,
.mx-n2 {
  margin-right: -0.5rem !important;
}

.mb-n2,
.my-n2 {
  margin-bottom: -0.5rem !important;
}

.ml-n2,
.mx-n2 {
  margin-left: -0.5rem !important;
}

.m-n3 {
  margin: -1rem !important;
}

.mt-n3,
.my-n3 {
  margin-top: -1rem !important;
}

.mr-n3,
.mx-n3 {
  margin-right: -1rem !important;
}

.mb-n3,
.my-n3 {
  margin-bottom: -1rem !important;
}

.ml-n3,
.mx-n3 {
  margin-left: -1rem !important;
}

.m-n4 {
  margin: -1.5rem !important;
}

.mt-n4,
.my-n4 {
  margin-top: -1.5rem !important;
}

.mr-n4,
.mx-n4 {
  margin-right: -1.5rem !important;
}

.mb-n4,
.my-n4 {
  margin-bottom: -1.5rem !important;
}

.ml-n4,
.mx-n4 {
  margin-left: -1.5rem !important;
}

.m-n5 {
  margin: -3rem !important;
}

.mt-n5,
.my-n5 {
  margin-top: -3rem !important;
}

.mr-n5,
.mx-n5 {
  margin-right: -3rem !important;
}

.mb-n5,
.my-n5 {
  margin-bottom: -3rem !important;
}

.ml-n5,
.mx-n5 {
  margin-left: -3rem !important;
}

.m-auto {
  margin: auto !important;
}

.mt-auto,
.my-auto {
  margin-top: auto !important;
}

.mr-auto,
.mx-auto {
  margin-right: auto !important;
}

.mb-auto,
.my-auto {
  margin-bottom: auto !important;
}

.ml-auto,
.mx-auto {
  margin-left: auto !important;
}

@media (min-width: 576px) {
  .m-sm-0 {
    margin: 0 !important;
  }
  .mt-sm-0,
  .my-sm-0 {
    margin-top: 0 !important;
  }
  .mr-sm-0,
  .mx-sm-0 {
    margin-right: 0 !important;
  }
  .mb-sm-0,
  .my-sm-0 {
    margin-bottom: 0 !important;
  }
  .ml-sm-0,
  .mx-sm-0 {
    margin-left: 0 !important;
  }
  .m-sm-1 {
    margin: 0.25rem !important;
  }
  .mt-sm-1,
  .my-sm-1 {
    margin-top: 0.25rem !important;
  }
  .mr-sm-1,
  .mx-sm-1 {
    margin-right: 0.25rem !important;
  }
  .mb-sm-1,
  .my-sm-1 {
    margin-bottom: 0.25rem !important;
  }
  .ml-sm-1,
  .mx-sm-1 {
    margin-left: 0.25rem !important;
  }
  .m-sm-2 {
    margin: 0.5rem !important;
  }
  .mt-sm-2,
  .my-sm-2 {
    margin-top: 0.5rem !important;
  }
  .mr-sm-2,
  .mx-sm-2 {
    margin-right: 0.5rem !important;
  }
  .mb-sm-2,
  .my-sm-2 {
    margin-bottom: 0.5rem !important;
  }
  .ml-sm-2,
  .mx-sm-2 {
    margin-left: 0.5rem !important;
  }
  .m-sm-3 {
    margin: 1rem !important;
  }
  .mt-sm-3,
  .my-sm-3 {
    margin-top: 1rem !important;
  }
  .mr-sm-3,
  .mx-sm-3 {
    margin-right: 1rem !important;
  }
  .mb-sm-3,
  .my-sm-3 {
    margin-bottom: 1rem !important;
  }
  .ml-sm-3,
  .mx-sm-3 {
    margin-left: 1rem !important;
  }
  .m-sm-4 {
    margin: 1.5rem !important;
  }
  .mt-sm-4,
  .my-sm-4 {
    margin-top: 1.5rem !important;
  }
  .mr-sm-4,
  .mx-sm-4 {
    margin-right: 1.5rem !important;
  }
  .mb-sm-4,
  .my-sm-4 {
    margin-bottom: 1.5rem !important;
  }
  .ml-sm-4,
  .mx-sm-4 {
    margin-left: 1.5rem !important;
  }
  .m-sm-5 {
    margin: 3rem !important;
  }
  .mt-sm-5,
  .my-sm-5 {
    margin-top: 3rem !important;
  }
  .mr-sm-5,
  .mx-sm-5 {
    margin-right: 3rem !important;
  }
  .mb-sm-5,
  .my-sm-5 {
    margin-bottom: 3rem !important;
  }
  .ml-sm-5,
  .mx-sm-5 {
    margin-left: 3rem !important;
  }
  .p-sm-0 {
    padding: 0 !important;
  }
  .pt-sm-0,
  .py-sm-0 {
    padding-top: 0 !important;
  }
  .pr-sm-0,
  .px-sm-0 {
    padding-right: 0 !important;
  }
  .pb-sm-0,
  .py-sm-0 {
    padding-bottom: 0 !important;
  }
  .pl-sm-0,
  .px-sm-0 {
    padding-left: 0 !important;
  }
  .p-sm-1 {
    padding: 0.25rem !important;
  }
  .pt-sm-1,
  .py-sm-1 {
    padding-top: 0.25rem !important;
  }
  .pr-sm-1,
  .px-sm-1 {
    padding-right: 0.25rem !important;
  }
  .pb-sm-1,
  .py-sm-1 {
    padding-bottom: 0.25rem !important;
  }
  .pl-sm-1,
  .px-sm-1 {
    padding-left: 0.25rem !important;
  }
  .p-sm-2 {
    padding: 0.5rem !important;
  }
  .pt-sm-2,
  .py-sm-2 {
    padding-top: 0.5rem !important;
  }
  .pr-sm-2,
  .px-sm-2 {
    padding-right: 0.5rem !important;
  }
  .pb-sm-2,
  .py-sm-2 {
    padding-bottom: 0.5rem !important;
  }
  .pl-sm-2,
  .px-sm-2 {
    padding-left: 0.5rem !important;
  }
  .p-sm-3 {
    padding: 1rem !important;
  }
  .pt-sm-3,
  .py-sm-3 {
    padding-top: 1rem !important;
  }
  .pr-sm-3,
  .px-sm-3 {
    padding-right: 1rem !important;
  }
  .pb-sm-3,
  .py-sm-3 {
    padding-bottom: 1rem !important;
  }
  .pl-sm-3,
  .px-sm-3 {
    padding-left: 1rem !important;
  }
  .p-sm-4 {
    padding: 1.5rem !important;
  }
  .pt-sm-4,
  .py-sm-4 {
    padding-top: 1.5rem !important;
  }
  .pr-sm-4,
  .px-sm-4 {
    padding-right: 1.5rem !important;
  }
  .pb-sm-4,
  .py-sm-4 {
    padding-bottom: 1.5rem !important;
  }
  .pl-sm-4,
  .px-sm-4 {
    padding-left: 1.5rem !important;
  }
  .p-sm-5 {
    padding: 3rem !important;
  }
  .pt-sm-5,
  .py-sm-5 {
    padding-top: 3rem !important;
  }
  .pr-sm-5,
  .px-sm-5 {
    padding-right: 3rem !important;
  }
  .pb-sm-5,
  .py-sm-5 {
    padding-bottom: 3rem !important;
  }
  .pl-sm-5,
  .px-sm-5 {
    padding-left: 3rem !important;
  }
  .m-sm-n1 {
    margin: -0.25rem !important;
  }
  .mt-sm-n1,
  .my-sm-n1 {
    margin-top: -0.25rem !important;
  }
  .mr-sm-n1,
  .mx-sm-n1 {
    margin-right: -0.25rem !important;
  }
  .mb-sm-n1,
  .my-sm-n1 {
    margin-bottom: -0.25rem !important;
  }
  .ml-sm-n1,
  .mx-sm-n1 {
    margin-left: -0.25rem !important;
  }
  .m-sm-n2 {
    margin: -0.5rem !important;
  }
  .mt-sm-n2,
  .my-sm-n2 {
    margin-top: -0.5rem !important;
  }
  .mr-sm-n2,
  .mx-sm-n2 {
    margin-right: -0.5rem !important;
  }
  .mb-sm-n2,
  .my-sm-n2 {
    margin-bottom: -0.5rem !important;
  }
  .ml-sm-n2,
  .mx-sm-n2 {
    margin-left: -0.5rem !important;
  }
  .m-sm-n3 {
    margin: -1rem !important;
  }
  .mt-sm-n3,
  .my-sm-n3 {
    margin-top: -1rem !important;
  }
  .mr-sm-n3,
  .mx-sm-n3 {
    margin-right: -1rem !important;
  }
  .mb-sm-n3,
  .my-sm-n3 {
    margin-bottom: -1rem !important;
  }
  .ml-sm-n3,
  .mx-sm-n3 {
    margin-left: -1rem !important;
  }
  .m-sm-n4 {
    margin: -1.5rem !important;
  }
  .mt-sm-n4,
  .my-sm-n4 {
    margin-top: -1.5rem !important;
  }
  .mr-sm-n4,
  .mx-sm-n4 {
    margin-right: -1.5rem !important;
  }
  .mb-sm-n4,
  .my-sm-n4 {
    margin-bottom: -1.5rem !important;
  }
  .ml-sm-n4,
  .mx-sm-n4 {
    margin-left: -1.5rem !important;
  }
  .m-sm-n5 {
    margin: -3rem !important;
  }
  .mt-sm-n5,
  .my-sm-n5 {
    margin-top: -3rem !important;
  }
  .mr-sm-n5,
  .mx-sm-n5 {
    margin-right: -3rem !important;
  }
  .mb-sm-n5,
  .my-sm-n5 {
    margin-bottom: -3rem !important;
  }
  .ml-sm-n5,
  .mx-sm-n5 {
    margin-left: -3rem !important;
  }
  .m-sm-auto {
    margin: auto !important;
  }
  .mt-sm-auto,
  .my-sm-auto {
    margin-top: auto !important;
  }
  .mr-sm-auto,
  .mx-sm-auto {
    margin-right: auto !important;
  }
  .mb-sm-auto,
  .my-sm-auto {
    margin-bottom: auto !important;
  }
  .ml-sm-auto,
  .mx-sm-auto {
    margin-left: auto !important;
  }
}
@media (min-width: 768px) {
  .m-md-0 {
    margin: 0 !important;
  }
  .mt-md-0,
  .my-md-0 {
    margin-top: 0 !important;
  }
  .mr-md-0,
  .mx-md-0 {
    margin-right: 0 !important;
  }
  .mb-md-0,
  .my-md-0 {
    margin-bottom: 0 !important;
  }
  .ml-md-0,
  .mx-md-0 {
    margin-left: 0 !important;
  }
  .m-md-1 {
    margin: 0.25rem !important;
  }
  .mt-md-1,
  .my-md-1 {
    margin-top: 0.25rem !important;
  }
  .mr-md-1,
  .mx-md-1 {
    margin-right: 0.25rem !important;
  }
  .mb-md-1,
  .my-md-1 {
    margin-bottom: 0.25rem !important;
  }
  .ml-md-1,
  .mx-md-1 {
    margin-left: 0.25rem !important;
  }
  .m-md-2 {
    margin: 0.5rem !important;
  }
  .mt-md-2,
  .my-md-2 {
    margin-top: 0.5rem !important;
  }
  .mr-md-2,
  .mx-md-2 {
    margin-right: 0.5rem !important;
  }
  .mb-md-2,
  .my-md-2 {
    margin-bottom: 0.5rem !important;
  }
  .ml-md-2,
  .mx-md-2 {
    margin-left: 0.5rem !important;
  }
  .m-md-3 {
    margin: 1rem !important;
  }
  .mt-md-3,
  .my-md-3 {
    margin-top: 1rem !important;
  }
  .mr-md-3,
  .mx-md-3 {
    margin-right: 1rem !important;
  }
  .mb-md-3,
  .my-md-3 {
    margin-bottom: 1rem !important;
  }
  .ml-md-3,
  .mx-md-3 {
    margin-left: 1rem !important;
  }
  .m-md-4 {
    margin: 1.5rem !important;
  }
  .mt-md-4,
  .my-md-4 {
    margin-top: 1.5rem !important;
  }
  .mr-md-4,
  .mx-md-4 {
    margin-right: 1.5rem !important;
  }
  .mb-md-4,
  .my-md-4 {
    margin-bottom: 1.5rem !important;
  }
  .ml-md-4,
  .mx-md-4 {
    margin-left: 1.5rem !important;
  }
  .m-md-5 {
    margin: 3rem !important;
  }
  .mt-md-5,
  .my-md-5 {
    margin-top: 3rem !important;
  }
  .mr-md-5,
  .mx-md-5 {
    margin-right: 3rem !important;
  }
  .mb-md-5,
  .my-md-5 {
    margin-bottom: 3rem !important;
  }
  .ml-md-5,
  .mx-md-5 {
    margin-left: 3rem !important;
  }
  .p-md-0 {
    padding: 0 !important;
  }
  .pt-md-0,
  .py-md-0 {
    padding-top: 0 !important;
  }
  .pr-md-0,
  .px-md-0 {
    padding-right: 0 !important;
  }
  .pb-md-0,
  .py-md-0 {
    padding-bottom: 0 !important;
  }
  .pl-md-0,
  .px-md-0 {
    padding-left: 0 !important;
  }
  .p-md-1 {
    padding: 0.25rem !important;
  }
  .pt-md-1,
  .py-md-1 {
    padding-top: 0.25rem !important;
  }
  .pr-md-1,
  .px-md-1 {
    padding-right: 0.25rem !important;
  }
  .pb-md-1,
  .py-md-1 {
    padding-bottom: 0.25rem !important;
  }
  .pl-md-1,
  .px-md-1 {
    padding-left: 0.25rem !important;
  }
  .p-md-2 {
    padding: 0.5rem !important;
  }
  .pt-md-2,
  .py-md-2 {
    padding-top: 0.5rem !important;
  }
  .pr-md-2,
  .px-md-2 {
    padding-right: 0.5rem !important;
  }
  .pb-md-2,
  .py-md-2 {
    padding-bottom: 0.5rem !important;
  }
  .pl-md-2,
  .px-md-2 {
    padding-left: 0.5rem !important;
  }
  .p-md-3 {
    padding: 1rem !important;
  }
  .pt-md-3,
  .py-md-3 {
    padding-top: 1rem !important;
  }
  .pr-md-3,
  .px-md-3 {
    padding-right: 1rem !important;
  }
  .pb-md-3,
  .py-md-3 {
    padding-bottom: 1rem !important;
  }
  .pl-md-3,
  .px-md-3 {
    padding-left: 1rem !important;
  }
  .p-md-4 {
    padding: 1.5rem !important;
  }
  .pt-md-4,
  .py-md-4 {
    padding-top: 1.5rem !important;
  }
  .pr-md-4,
  .px-md-4 {
    padding-right: 1.5rem !important;
  }
  .pb-md-4,
  .py-md-4 {
    padding-bottom: 1.5rem !important;
  }
  .pl-md-4,
  .px-md-4 {
    padding-left: 1.5rem !important;
  }
  .p-md-5 {
    padding: 3rem !important;
  }
  .pt-md-5,
  .py-md-5 {
    padding-top: 3rem !important;
  }
  .pr-md-5,
  .px-md-5 {
    padding-right: 3rem !important;
  }
  .pb-md-5,
  .py-md-5 {
    padding-bottom: 3rem !important;
  }
  .pl-md-5,
  .px-md-5 {
    padding-left: 3rem !important;
  }
  .m-md-n1 {
    margin: -0.25rem !important;
  }
  .mt-md-n1,
  .my-md-n1 {
    margin-top: -0.25rem !important;
  }
  .mr-md-n1,
  .mx-md-n1 {
    margin-right: -0.25rem !important;
  }
  .mb-md-n1,
  .my-md-n1 {
    margin-bottom: -0.25rem !important;
  }
  .ml-md-n1,
  .mx-md-n1 {
    margin-left: -0.25rem !important;
  }
  .m-md-n2 {
    margin: -0.5rem !important;
  }
  .mt-md-n2,
  .my-md-n2 {
    margin-top: -0.5rem !important;
  }
  .mr-md-n2,
  .mx-md-n2 {
    margin-right: -0.5rem !important;
  }
  .mb-md-n2,
  .my-md-n2 {
    margin-bottom: -0.5rem !important;
  }
  .ml-md-n2,
  .mx-md-n2 {
    margin-left: -0.5rem !important;
  }
  .m-md-n3 {
    margin: -1rem !important;
  }
  .mt-md-n3,
  .my-md-n3 {
    margin-top: -1rem !important;
  }
  .mr-md-n3,
  .mx-md-n3 {
    margin-right: -1rem !important;
  }
  .mb-md-n3,
  .my-md-n3 {
    margin-bottom: -1rem !important;
  }
  .ml-md-n3,
  .mx-md-n3 {
    margin-left: -1rem !important;
  }
  .m-md-n4 {
    margin: -1.5rem !important;
  }
  .mt-md-n4,
  .my-md-n4 {
    margin-top: -1.5rem !important;
  }
  .mr-md-n4,
  .mx-md-n4 {
    margin-right: -1.5rem !important;
  }
  .mb-md-n4,
  .my-md-n4 {
    margin-bottom: -1.5rem !important;
  }
  .ml-md-n4,
  .mx-md-n4 {
    margin-left: -1.5rem !important;
  }
  .m-md-n5 {
    margin: -3rem !important;
  }
  .mt-md-n5,
  .my-md-n5 {
    margin-top: -3rem !important;
  }
  .mr-md-n5,
  .mx-md-n5 {
    margin-right: -3rem !important;
  }
  .mb-md-n5,
  .my-md-n5 {
    margin-bottom: -3rem !important;
  }
  .ml-md-n5,
  .mx-md-n5 {
    margin-left: -3rem !important;
  }
  .m-md-auto {
    margin: auto !important;
  }
  .mt-md-auto,
  .my-md-auto {
    margin-top: auto !important;
  }
  .mr-md-auto,
  .mx-md-auto {
    margin-right: auto !important;
  }
  .mb-md-auto,
  .my-md-auto {
    margin-bottom: auto !important;
  }
  .ml-md-auto,
  .mx-md-auto {
    margin-left: auto !important;
  }
}
@media (min-width: 992px) {
  .m-lg-0 {
    margin: 0 !important;
  }
  .mt-lg-0,
  .my-lg-0 {
    margin-top: 0 !important;
  }
  .mr-lg-0,
  .mx-lg-0 {
    margin-right: 0 !important;
  }
  .mb-lg-0,
  .my-lg-0 {
    margin-bottom: 0 !important;
  }
  .ml-lg-0,
  .mx-lg-0 {
    margin-left: 0 !important;
  }
  .m-lg-1 {
    margin: 0.25rem !important;
  }
  .mt-lg-1,
  .my-lg-1 {
    margin-top: 0.25rem !important;
  }
  .mr-lg-1,
  .mx-lg-1 {
    margin-right: 0.25rem !important;
  }
  .mb-lg-1,
  .my-lg-1 {
    margin-bottom: 0.25rem !important;
  }
  .ml-lg-1,
  .mx-lg-1 {
    margin-left: 0.25rem !important;
  }
  .m-lg-2 {
    margin: 0.5rem !important;
  }
  .mt-lg-2,
  .my-lg-2 {
    margin-top: 0.5rem !important;
  }
  .mr-lg-2,
  .mx-lg-2 {
    margin-right: 0.5rem !important;
  }
  .mb-lg-2,
  .my-lg-2 {
    margin-bottom: 0.5rem !important;
  }
  .ml-lg-2,
  .mx-lg-2 {
    margin-left: 0.5rem !important;
  }
  .m-lg-3 {
    margin: 1rem !important;
  }
  .mt-lg-3,
  .my-lg-3 {
    margin-top: 1rem !important;
  }
  .mr-lg-3,
  .mx-lg-3 {
    margin-right: 1rem !important;
  }
  .mb-lg-3,
  .my-lg-3 {
    margin-bottom: 1rem !important;
  }
  .ml-lg-3,
  .mx-lg-3 {
    margin-left: 1rem !important;
  }
  .m-lg-4 {
    margin: 1.5rem !important;
  }
  .mt-lg-4,
  .my-lg-4 {
    margin-top: 1.5rem !important;
  }
  .mr-lg-4,
  .mx-lg-4 {
    margin-right: 1.5rem !important;
  }
  .mb-lg-4,
  .my-lg-4 {
    margin-bottom: 1.5rem !important;
  }
  .ml-lg-4,
  .mx-lg-4 {
    margin-left: 1.5rem !important;
  }
  .m-lg-5 {
    margin: 3rem !important;
  }
  .mt-lg-5,
  .my-lg-5 {
    margin-top: 3rem !important;
  }
  .mr-lg-5,
  .mx-lg-5 {
    margin-right: 3rem !important;
  }
  .mb-lg-5,
  .my-lg-5 {
    margin-bottom: 3rem !important;
  }
  .ml-lg-5,
  .mx-lg-5 {
    margin-left: 3rem !important;
  }
  .p-lg-0 {
    padding: 0 !important;
  }
  .pt-lg-0,
  .py-lg-0 {
    padding-top: 0 !important;
  }
  .pr-lg-0,
  .px-lg-0 {
    padding-right: 0 !important;
  }
  .pb-lg-0,
  .py-lg-0 {
    padding-bottom: 0 !important;
  }
  .pl-lg-0,
  .px-lg-0 {
    padding-left: 0 !important;
  }
  .p-lg-1 {
    padding: 0.25rem !important;
  }
  .pt-lg-1,
  .py-lg-1 {
    padding-top: 0.25rem !important;
  }
  .pr-lg-1,
  .px-lg-1 {
    padding-right: 0.25rem !important;
  }
  .pb-lg-1,
  .py-lg-1 {
    padding-bottom: 0.25rem !important;
  }
  .pl-lg-1,
  .px-lg-1 {
    padding-left: 0.25rem !important;
  }
  .p-lg-2 {
    padding: 0.5rem !important;
  }
  .pt-lg-2,
  .py-lg-2 {
    padding-top: 0.5rem !important;
  }
  .pr-lg-2,
  .px-lg-2 {
    padding-right: 0.5rem !important;
  }
  .pb-lg-2,
  .py-lg-2 {
    padding-bottom: 0.5rem !important;
  }
  .pl-lg-2,
  .px-lg-2 {
    padding-left: 0.5rem !important;
  }
  .p-lg-3 {
    padding: 1rem !important;
  }
  .pt-lg-3,
  .py-lg-3 {
    padding-top: 1rem !important;
  }
  .pr-lg-3,
  .px-lg-3 {
    padding-right: 1rem !important;
  }
  .pb-lg-3,
  .py-lg-3 {
    padding-bottom: 1rem !important;
  }
  .pl-lg-3,
  .px-lg-3 {
    padding-left: 1rem !important;
  }
  .p-lg-4 {
    padding: 1.5rem !important;
  }
  .pt-lg-4,
  .py-lg-4 {
    padding-top: 1.5rem !important;
  }
  .pr-lg-4,
  .px-lg-4 {
    padding-right: 1.5rem !important;
  }
  .pb-lg-4,
  .py-lg-4 {
    padding-bottom: 1.5rem !important;
  }
  .pl-lg-4,
  .px-lg-4 {
    padding-left: 1.5rem !important;
  }
  .p-lg-5 {
    padding: 3rem !important;
  }
  .pt-lg-5,
  .py-lg-5 {
    padding-top: 3rem !important;
  }
  .pr-lg-5,
  .px-lg-5 {
    padding-right: 3rem !important;
  }
  .pb-lg-5,
  .py-lg-5 {
    padding-bottom: 3rem !important;
  }
  .pl-lg-5,
  .px-lg-5 {
    padding-left: 3rem !important;
  }
  .m-lg-n1 {
    margin: -0.25rem !important;
  }
  .mt-lg-n1,
  .my-lg-n1 {
    margin-top: -0.25rem !important;
  }
  .mr-lg-n1,
  .mx-lg-n1 {
    margin-right: -0.25rem !important;
  }
  .mb-lg-n1,
  .my-lg-n1 {
    margin-bottom: -0.25rem !important;
  }
  .ml-lg-n1,
  .mx-lg-n1 {
    margin-left: -0.25rem !important;
  }
  .m-lg-n2 {
    margin: -0.5rem !important;
  }
  .mt-lg-n2,
  .my-lg-n2 {
    margin-top: -0.5rem !important;
  }
  .mr-lg-n2,
  .mx-lg-n2 {
    margin-right: -0.5rem !important;
  }
  .mb-lg-n2,
  .my-lg-n2 {
    margin-bottom: -0.5rem !important;
  }
  .ml-lg-n2,
  .mx-lg-n2 {
    margin-left: -0.5rem !important;
  }
  .m-lg-n3 {
    margin: -1rem !important;
  }
  .mt-lg-n3,
  .my-lg-n3 {
    margin-top: -1rem !important;
  }
  .mr-lg-n3,
  .mx-lg-n3 {
    margin-right: -1rem !important;
  }
  .mb-lg-n3,
  .my-lg-n3 {
    margin-bottom: -1rem !important;
  }
  .ml-lg-n3,
  .mx-lg-n3 {
    margin-left: -1rem !important;
  }
  .m-lg-n4 {
    margin: -1.5rem !important;
  }
  .mt-lg-n4,
  .my-lg-n4 {
    margin-top: -1.5rem !important;
  }
  .mr-lg-n4,
  .mx-lg-n4 {
    margin-right: -1.5rem !important;
  }
  .mb-lg-n4,
  .my-lg-n4 {
    margin-bottom: -1.5rem !important;
  }
  .ml-lg-n4,
  .mx-lg-n4 {
    margin-left: -1.5rem !important;
  }
  .m-lg-n5 {
    margin: -3rem !important;
  }
  .mt-lg-n5,
  .my-lg-n5 {
    margin-top: -3rem !important;
  }
  .mr-lg-n5,
  .mx-lg-n5 {
    margin-right: -3rem !important;
  }
  .mb-lg-n5,
  .my-lg-n5 {
    margin-bottom: -3rem !important;
  }
  .ml-lg-n5,
  .mx-lg-n5 {
    margin-left: -3rem !important;
  }
  .m-lg-auto {
    margin: auto !important;
  }
  .mt-lg-auto,
  .my-lg-auto {
    margin-top: auto !important;
  }
  .mr-lg-auto,
  .mx-lg-auto {
    margin-right: auto !important;
  }
  .mb-lg-auto,
  .my-lg-auto {
    margin-bottom: auto !important;
  }
  .ml-lg-auto,
  .mx-lg-auto {
    margin-left: auto !important;
  }
}
@media (min-width: 1200px) {
  .m-xl-0 {
    margin: 0 !important;
  }
  .mt-xl-0,
  .my-xl-0 {
    margin-top: 0 !important;
  }
  .mr-xl-0,
  .mx-xl-0 {
    margin-right: 0 !important;
  }
  .mb-xl-0,
  .my-xl-0 {
    margin-bottom: 0 !important;
  }
  .ml-xl-0,
  .mx-xl-0 {
    margin-left: 0 !important;
  }
  .m-xl-1 {
    margin: 0.25rem !important;
  }
  .mt-xl-1,
  .my-xl-1 {
    margin-top: 0.25rem !important;
  }
  .mr-xl-1,
  .mx-xl-1 {
    margin-right: 0.25rem !important;
  }
  .mb-xl-1,
  .my-xl-1 {
    margin-bottom: 0.25rem !important;
  }
  .ml-xl-1,
  .mx-xl-1 {
    margin-left: 0.25rem !important;
  }
  .m-xl-2 {
    margin: 0.5rem !important;
  }
  .mt-xl-2,
  .my-xl-2 {
    margin-top: 0.5rem !important;
  }
  .mr-xl-2,
  .mx-xl-2 {
    margin-right: 0.5rem !important;
  }
  .mb-xl-2,
  .my-xl-2 {
    margin-bottom: 0.5rem !important;
  }
  .ml-xl-2,
  .mx-xl-2 {
    margin-left: 0.5rem !important;
  }
  .m-xl-3 {
    margin: 1rem !important;
  }
  .mt-xl-3,
  .my-xl-3 {
    margin-top: 1rem !important;
  }
  .mr-xl-3,
  .mx-xl-3 {
    margin-right: 1rem !important;
  }
  .mb-xl-3,
  .my-xl-3 {
    margin-bottom: 1rem !important;
  }
  .ml-xl-3,
  .mx-xl-3 {
    margin-left: 1rem !important;
  }
  .m-xl-4 {
    margin: 1.5rem !important;
  }
  .mt-xl-4,
  .my-xl-4 {
    margin-top: 1.5rem !important;
  }
  .mr-xl-4,
  .mx-xl-4 {
    margin-right: 1.5rem !important;
  }
  .mb-xl-4,
  .my-xl-4 {
    margin-bottom: 1.5rem !important;
  }
  .ml-xl-4,
  .mx-xl-4 {
    margin-left: 1.5rem !important;
  }
  .m-xl-5 {
    margin: 3rem !important;
  }
  .mt-xl-5,
  .my-xl-5 {
    margin-top: 3rem !important;
  }
  .mr-xl-5,
  .mx-xl-5 {
    margin-right: 3rem !important;
  }
  .mb-xl-5,
  .my-xl-5 {
    margin-bottom: 3rem !important;
  }
  .ml-xl-5,
  .mx-xl-5 {
    margin-left: 3rem !important;
  }
  .p-xl-0 {
    padding: 0 !important;
  }
  .pt-xl-0,
  .py-xl-0 {
    padding-top: 0 !important;
  }
  .pr-xl-0,
  .px-xl-0 {
    padding-right: 0 !important;
  }
  .pb-xl-0,
  .py-xl-0 {
    padding-bottom: 0 !important;
  }
  .pl-xl-0,
  .px-xl-0 {
    padding-left: 0 !important;
  }
  .p-xl-1 {
    padding: 0.25rem !important;
  }
  .pt-xl-1,
  .py-xl-1 {
    padding-top: 0.25rem !important;
  }
  .pr-xl-1,
  .px-xl-1 {
    padding-right: 0.25rem !important;
  }
  .pb-xl-1,
  .py-xl-1 {
    padding-bottom: 0.25rem !important;
  }
  .pl-xl-1,
  .px-xl-1 {
    padding-left: 0.25rem !important;
  }
  .p-xl-2 {
    padding: 0.5rem !important;
  }
  .pt-xl-2,
  .py-xl-2 {
    padding-top: 0.5rem !important;
  }
  .pr-xl-2,
  .px-xl-2 {
    padding-right: 0.5rem !important;
  }
  .pb-xl-2,
  .py-xl-2 {
    padding-bottom: 0.5rem !important;
  }
  .pl-xl-2,
  .px-xl-2 {
    padding-left: 0.5rem !important;
  }
  .p-xl-3 {
    padding: 1rem !important;
  }
  .pt-xl-3,
  .py-xl-3 {
    padding-top: 1rem !important;
  }
  .pr-xl-3,
  .px-xl-3 {
    padding-right: 1rem !important;
  }
  .pb-xl-3,
  .py-xl-3 {
    padding-bottom: 1rem !important;
  }
  .pl-xl-3,
  .px-xl-3 {
    padding-left: 1rem !important;
  }
  .p-xl-4 {
    padding: 1.5rem !important;
  }
  .pt-xl-4,
  .py-xl-4 {
    padding-top: 1.5rem !important;
  }
  .pr-xl-4,
  .px-xl-4 {
    padding-right: 1.5rem !important;
  }
  .pb-xl-4,
  .py-xl-4 {
    padding-bottom: 1.5rem !important;
  }
  .pl-xl-4,
  .px-xl-4 {
    padding-left: 1.5rem !important;
  }
  .p-xl-5 {
    padding: 3rem !important;
  }
  .pt-xl-5,
  .py-xl-5 {
    padding-top: 3rem !important;
  }
  .pr-xl-5,
  .px-xl-5 {
    padding-right: 3rem !important;
  }
  .pb-xl-5,
  .py-xl-5 {
    padding-bottom: 3rem !important;
  }
  .pl-xl-5,
  .px-xl-5 {
    padding-left: 3rem !important;
  }
  .m-xl-n1 {
    margin: -0.25rem !important;
  }
  .mt-xl-n1,
  .my-xl-n1 {
    margin-top: -0.25rem !important;
  }
  .mr-xl-n1,
  .mx-xl-n1 {
    margin-right: -0.25rem !important;
  }
  .mb-xl-n1,
  .my-xl-n1 {
    margin-bottom: -0.25rem !important;
  }
  .ml-xl-n1,
  .mx-xl-n1 {
    margin-left: -0.25rem !important;
  }
  .m-xl-n2 {
    margin: -0.5rem !important;
  }
  .mt-xl-n2,
  .my-xl-n2 {
    margin-top: -0.5rem !important;
  }
  .mr-xl-n2,
  .mx-xl-n2 {
    margin-right: -0.5rem !important;
  }
  .mb-xl-n2,
  .my-xl-n2 {
    margin-bottom: -0.5rem !important;
  }
  .ml-xl-n2,
  .mx-xl-n2 {
    margin-left: -0.5rem !important;
  }
  .m-xl-n3 {
    margin: -1rem !important;
  }
  .mt-xl-n3,
  .my-xl-n3 {
    margin-top: -1rem !important;
  }
  .mr-xl-n3,
  .mx-xl-n3 {
    margin-right: -1rem !important;
  }
  .mb-xl-n3,
  .my-xl-n3 {
    margin-bottom: -1rem !important;
  }
  .ml-xl-n3,
  .mx-xl-n3 {
    margin-left: -1rem !important;
  }
  .m-xl-n4 {
    margin: -1.5rem !important;
  }
  .mt-xl-n4,
  .my-xl-n4 {
    margin-top: -1.5rem !important;
  }
  .mr-xl-n4,
  .mx-xl-n4 {
    margin-right: -1.5rem !important;
  }
  .mb-xl-n4,
  .my-xl-n4 {
    margin-bottom: -1.5rem !important;
  }
  .ml-xl-n4,
  .mx-xl-n4 {
    margin-left: -1.5rem !important;
  }
  .m-xl-n5 {
    margin: -3rem !important;
  }
  .mt-xl-n5,
  .my-xl-n5 {
    margin-top: -3rem !important;
  }
  .mr-xl-n5,
  .mx-xl-n5 {
    margin-right: -3rem !important;
  }
  .mb-xl-n5,
  .my-xl-n5 {
    margin-bottom: -3rem !important;
  }
  .ml-xl-n5,
  .mx-xl-n5 {
    margin-left: -3rem !important;
  }
  .m-xl-auto {
    margin: auto !important;
  }
  .mt-xl-auto,
  .my-xl-auto {
    margin-top: auto !important;
  }
  .mr-xl-auto,
  .mx-xl-auto {
    margin-right: auto !important;
  }
  .mb-xl-auto,
  .my-xl-auto {
    margin-bottom: auto !important;
  }
  .ml-xl-auto,
  .mx-xl-auto {
    margin-left: auto !important;
  }
}
@media (min-width: 1400px) {
  .m-xxl-0 {
    margin: 0 !important;
  }
  .mt-xxl-0,
  .my-xxl-0 {
    margin-top: 0 !important;
  }
  .mr-xxl-0,
  .mx-xxl-0 {
    margin-right: 0 !important;
  }
  .mb-xxl-0,
  .my-xxl-0 {
    margin-bottom: 0 !important;
  }
  .ml-xxl-0,
  .mx-xxl-0 {
    margin-left: 0 !important;
  }
  .m-xxl-1 {
    margin: 0.25rem !important;
  }
  .mt-xxl-1,
  .my-xxl-1 {
    margin-top: 0.25rem !important;
  }
  .mr-xxl-1,
  .mx-xxl-1 {
    margin-right: 0.25rem !important;
  }
  .mb-xxl-1,
  .my-xxl-1 {
    margin-bottom: 0.25rem !important;
  }
  .ml-xxl-1,
  .mx-xxl-1 {
    margin-left: 0.25rem !important;
  }
  .m-xxl-2 {
    margin: 0.5rem !important;
  }
  .mt-xxl-2,
  .my-xxl-2 {
    margin-top: 0.5rem !important;
  }
  .mr-xxl-2,
  .mx-xxl-2 {
    margin-right: 0.5rem !important;
  }
  .mb-xxl-2,
  .my-xxl-2 {
    margin-bottom: 0.5rem !important;
  }
  .ml-xxl-2,
  .mx-xxl-2 {
    margin-left: 0.5rem !important;
  }
  .m-xxl-3 {
    margin: 1rem !important;
  }
  .mt-xxl-3,
  .my-xxl-3 {
    margin-top: 1rem !important;
  }
  .mr-xxl-3,
  .mx-xxl-3 {
    margin-right: 1rem !important;
  }
  .mb-xxl-3,
  .my-xxl-3 {
    margin-bottom: 1rem !important;
  }
  .ml-xxl-3,
  .mx-xxl-3 {
    margin-left: 1rem !important;
  }
  .m-xxl-4 {
    margin: 1.5rem !important;
  }
  .mt-xxl-4,
  .my-xxl-4 {
    margin-top: 1.5rem !important;
  }
  .mr-xxl-4,
  .mx-xxl-4 {
    margin-right: 1.5rem !important;
  }
  .mb-xxl-4,
  .my-xxl-4 {
    margin-bottom: 1.5rem !important;
  }
  .ml-xxl-4,
  .mx-xxl-4 {
    margin-left: 1.5rem !important;
  }
  .m-xxl-5 {
    margin: 3rem !important;
  }
  .mt-xxl-5,
  .my-xxl-5 {
    margin-top: 3rem !important;
  }
  .mr-xxl-5,
  .mx-xxl-5 {
    margin-right: 3rem !important;
  }
  .mb-xxl-5,
  .my-xxl-5 {
    margin-bottom: 3rem !important;
  }
  .ml-xxl-5,
  .mx-xxl-5 {
    margin-left: 3rem !important;
  }
  .p-xxl-0 {
    padding: 0 !important;
  }
  .pt-xxl-0,
  .py-xxl-0 {
    padding-top: 0 !important;
  }
  .pr-xxl-0,
  .px-xxl-0 {
    padding-right: 0 !important;
  }
  .pb-xxl-0,
  .py-xxl-0 {
    padding-bottom: 0 !important;
  }
  .pl-xxl-0,
  .px-xxl-0 {
    padding-left: 0 !important;
  }
  .p-xxl-1 {
    padding: 0.25rem !important;
  }
  .pt-xxl-1,
  .py-xxl-1 {
    padding-top: 0.25rem !important;
  }
  .pr-xxl-1,
  .px-xxl-1 {
    padding-right: 0.25rem !important;
  }
  .pb-xxl-1,
  .py-xxl-1 {
    padding-bottom: 0.25rem !important;
  }
  .pl-xxl-1,
  .px-xxl-1 {
    padding-left: 0.25rem !important;
  }
  .p-xxl-2 {
    padding: 0.5rem !important;
  }
  .pt-xxl-2,
  .py-xxl-2 {
    padding-top: 0.5rem !important;
  }
  .pr-xxl-2,
  .px-xxl-2 {
    padding-right: 0.5rem !important;
  }
  .pb-xxl-2,
  .py-xxl-2 {
    padding-bottom: 0.5rem !important;
  }
  .pl-xxl-2,
  .px-xxl-2 {
    padding-left: 0.5rem !important;
  }
  .p-xxl-3 {
    padding: 1rem !important;
  }
  .pt-xxl-3,
  .py-xxl-3 {
    padding-top: 1rem !important;
  }
  .pr-xxl-3,
  .px-xxl-3 {
    padding-right: 1rem !important;
  }
  .pb-xxl-3,
  .py-xxl-3 {
    padding-bottom: 1rem !important;
  }
  .pl-xxl-3,
  .px-xxl-3 {
    padding-left: 1rem !important;
  }
  .p-xxl-4 {
    padding: 1.5rem !important;
  }
  .pt-xxl-4,
  .py-xxl-4 {
    padding-top: 1.5rem !important;
  }
  .pr-xxl-4,
  .px-xxl-4 {
    padding-right: 1.5rem !important;
  }
  .pb-xxl-4,
  .py-xxl-4 {
    padding-bottom: 1.5rem !important;
  }
  .pl-xxl-4,
  .px-xxl-4 {
    padding-left: 1.5rem !important;
  }
  .p-xxl-5 {
    padding: 3rem !important;
  }
  .pt-xxl-5,
  .py-xxl-5 {
    padding-top: 3rem !important;
  }
  .pr-xxl-5,
  .px-xxl-5 {
    padding-right: 3rem !important;
  }
  .pb-xxl-5,
  .py-xxl-5 {
    padding-bottom: 3rem !important;
  }
  .pl-xxl-5,
  .px-xxl-5 {
    padding-left: 3rem !important;
  }
  .m-xxl-n1 {
    margin: -0.25rem !important;
  }
  .mt-xxl-n1,
  .my-xxl-n1 {
    margin-top: -0.25rem !important;
  }
  .mr-xxl-n1,
  .mx-xxl-n1 {
    margin-right: -0.25rem !important;
  }
  .mb-xxl-n1,
  .my-xxl-n1 {
    margin-bottom: -0.25rem !important;
  }
  .ml-xxl-n1,
  .mx-xxl-n1 {
    margin-left: -0.25rem !important;
  }
  .m-xxl-n2 {
    margin: -0.5rem !important;
  }
  .mt-xxl-n2,
  .my-xxl-n2 {
    margin-top: -0.5rem !important;
  }
  .mr-xxl-n2,
  .mx-xxl-n2 {
    margin-right: -0.5rem !important;
  }
  .mb-xxl-n2,
  .my-xxl-n2 {
    margin-bottom: -0.5rem !important;
  }
  .ml-xxl-n2,
  .mx-xxl-n2 {
    margin-left: -0.5rem !important;
  }
  .m-xxl-n3 {
    margin: -1rem !important;
  }
  .mt-xxl-n3,
  .my-xxl-n3 {
    margin-top: -1rem !important;
  }
  .mr-xxl-n3,
  .mx-xxl-n3 {
    margin-right: -1rem !important;
  }
  .mb-xxl-n3,
  .my-xxl-n3 {
    margin-bottom: -1rem !important;
  }
  .ml-xxl-n3,
  .mx-xxl-n3 {
    margin-left: -1rem !important;
  }
  .m-xxl-n4 {
    margin: -1.5rem !important;
  }
  .mt-xxl-n4,
  .my-xxl-n4 {
    margin-top: -1.5rem !important;
  }
  .mr-xxl-n4,
  .mx-xxl-n4 {
    margin-right: -1.5rem !important;
  }
  .mb-xxl-n4,
  .my-xxl-n4 {
    margin-bottom: -1.5rem !important;
  }
  .ml-xxl-n4,
  .mx-xxl-n4 {
    margin-left: -1.5rem !important;
  }
  .m-xxl-n5 {
    margin: -3rem !important;
  }
  .mt-xxl-n5,
  .my-xxl-n5 {
    margin-top: -3rem !important;
  }
  .mr-xxl-n5,
  .mx-xxl-n5 {
    margin-right: -3rem !important;
  }
  .mb-xxl-n5,
  .my-xxl-n5 {
    margin-bottom: -3rem !important;
  }
  .ml-xxl-n5,
  .mx-xxl-n5 {
    margin-left: -3rem !important;
  }
  .m-xxl-auto {
    margin: auto !important;
  }
  .mt-xxl-auto,
  .my-xxl-auto {
    margin-top: auto !important;
  }
  .mr-xxl-auto,
  .mx-xxl-auto {
    margin-right: auto !important;
  }
  .mb-xxl-auto,
  .my-xxl-auto {
    margin-bottom: auto !important;
  }
  .ml-xxl-auto,
  .mx-xxl-auto {
    margin-left: auto !important;
  }
}
.flex-row {
  -webkit-box-orient: horizontal !important;
  -webkit-box-direction: normal !important;
      -ms-flex-direction: row !important;
          flex-direction: row !important;
}

.flex-column {
  -webkit-box-orient: vertical !important;
  -webkit-box-direction: normal !important;
      -ms-flex-direction: column !important;
          flex-direction: column !important;
}

.flex-row-reverse {
  -webkit-box-orient: horizontal !important;
  -webkit-box-direction: reverse !important;
      -ms-flex-direction: row-reverse !important;
          flex-direction: row-reverse !important;
}

.flex-column-reverse {
  -webkit-box-orient: vertical !important;
  -webkit-box-direction: reverse !important;
      -ms-flex-direction: column-reverse !important;
          flex-direction: column-reverse !important;
}

.flex-wrap {
  -ms-flex-wrap: wrap !important;
      flex-wrap: wrap !important;
}

.flex-nowrap {
  -ms-flex-wrap: nowrap !important;
      flex-wrap: nowrap !important;
}

.flex-wrap-reverse {
  -ms-flex-wrap: wrap-reverse !important;
      flex-wrap: wrap-reverse !important;
}

.flex-fill {
  -webkit-box-flex: 1 !important;
      -ms-flex: 1 1 auto !important;
          flex: 1 1 auto !important;
}

.flex-grow-0 {
  -webkit-box-flex: 0 !important;
      -ms-flex-positive: 0 !important;
          flex-grow: 0 !important;
}

.flex-grow-1 {
  -webkit-box-flex: 1 !important;
      -ms-flex-positive: 1 !important;
          flex-grow: 1 !important;
}

.flex-shrink-0 {
  -ms-flex-negative: 0 !important;
      flex-shrink: 0 !important;
}

.flex-shrink-1 {
  -ms-flex-negative: 1 !important;
      flex-shrink: 1 !important;
}

.justify-content-start {
  -webkit-box-pack: start !important;
      -ms-flex-pack: start !important;
          justify-content: flex-start !important;
}

.justify-content-end {
  -webkit-box-pack: end !important;
      -ms-flex-pack: end !important;
          justify-content: flex-end !important;
}

.justify-content-center {
  -webkit-box-pack: center !important;
      -ms-flex-pack: center !important;
          justify-content: center !important;
}

.justify-content-between {
  -webkit-box-pack: justify !important;
      -ms-flex-pack: justify !important;
          justify-content: space-between !important;
}

.justify-content-around {
  -ms-flex-pack: distribute !important;
      justify-content: space-around !important;
}

.align-items-start {
  -webkit-box-align: start !important;
      -ms-flex-align: start !important;
          align-items: flex-start !important;
}

.align-items-end {
  -webkit-box-align: end !important;
      -ms-flex-align: end !important;
          align-items: flex-end !important;
}

.align-items-center {
  -webkit-box-align: center !important;
      -ms-flex-align: center !important;
          align-items: center !important;
}

.align-items-baseline {
  -webkit-box-align: baseline !important;
      -ms-flex-align: baseline !important;
          align-items: baseline !important;
}

.align-items-stretch {
  -webkit-box-align: stretch !important;
      -ms-flex-align: stretch !important;
          align-items: stretch !important;
}

.align-content-start {
  -ms-flex-line-pack: start !important;
      align-content: flex-start !important;
}

.align-content-end {
  -ms-flex-line-pack: end !important;
      align-content: flex-end !important;
}

.align-content-center {
  -ms-flex-line-pack: center !important;
      align-content: center !important;
}

.align-content-between {
  -ms-flex-line-pack: justify !important;
      align-content: space-between !important;
}

.align-content-around {
  -ms-flex-line-pack: distribute !important;
      align-content: space-around !important;
}

.align-content-stretch {
  -ms-flex-line-pack: stretch !important;
      align-content: stretch !important;
}

.align-self-auto {
  -ms-flex-item-align: auto !important;
      align-self: auto !important;
}

.align-self-start {
  -ms-flex-item-align: start !important;
      align-self: flex-start !important;
}

.align-self-end {
  -ms-flex-item-align: end !important;
      align-self: flex-end !important;
}

.align-self-center {
  -ms-flex-item-align: center !important;
      align-self: center !important;
}

.align-self-baseline {
  -ms-flex-item-align: baseline !important;
      align-self: baseline !important;
}

.align-self-stretch {
  -ms-flex-item-align: stretch !important;
      align-self: stretch !important;
}

@media (min-width: 576px) {
  .flex-sm-row {
    -webkit-box-orient: horizontal !important;
    -webkit-box-direction: normal !important;
        -ms-flex-direction: row !important;
            flex-direction: row !important;
  }
  .flex-sm-column {
    -webkit-box-orient: vertical !important;
    -webkit-box-direction: normal !important;
        -ms-flex-direction: column !important;
            flex-direction: column !important;
  }
  .flex-sm-row-reverse {
    -webkit-box-orient: horizontal !important;
    -webkit-box-direction: reverse !important;
        -ms-flex-direction: row-reverse !important;
            flex-direction: row-reverse !important;
  }
  .flex-sm-column-reverse {
    -webkit-box-orient: vertical !important;
    -webkit-box-direction: reverse !important;
        -ms-flex-direction: column-reverse !important;
            flex-direction: column-reverse !important;
  }
  .flex-sm-wrap {
    -ms-flex-wrap: wrap !important;
        flex-wrap: wrap !important;
  }
  .flex-sm-nowrap {
    -ms-flex-wrap: nowrap !important;
        flex-wrap: nowrap !important;
  }
  .flex-sm-wrap-reverse {
    -ms-flex-wrap: wrap-reverse !important;
        flex-wrap: wrap-reverse !important;
  }
  .flex-sm-fill {
    -webkit-box-flex: 1 !important;
        -ms-flex: 1 1 auto !important;
            flex: 1 1 auto !important;
  }
  .flex-sm-grow-0 {
    -webkit-box-flex: 0 !important;
        -ms-flex-positive: 0 !important;
            flex-grow: 0 !important;
  }
  .flex-sm-grow-1 {
    -webkit-box-flex: 1 !important;
        -ms-flex-positive: 1 !important;
            flex-grow: 1 !important;
  }
  .flex-sm-shrink-0 {
    -ms-flex-negative: 0 !important;
        flex-shrink: 0 !important;
  }
  .flex-sm-shrink-1 {
    -ms-flex-negative: 1 !important;
        flex-shrink: 1 !important;
  }
  .justify-content-sm-start {
    -webkit-box-pack: start !important;
        -ms-flex-pack: start !important;
            justify-content: flex-start !important;
  }
  .justify-content-sm-end {
    -webkit-box-pack: end !important;
        -ms-flex-pack: end !important;
            justify-content: flex-end !important;
  }
  .justify-content-sm-center {
    -webkit-box-pack: center !important;
        -ms-flex-pack: center !important;
            justify-content: center !important;
  }
  .justify-content-sm-between {
    -webkit-box-pack: justify !important;
        -ms-flex-pack: justify !important;
            justify-content: space-between !important;
  }
  .justify-content-sm-around {
    -ms-flex-pack: distribute !important;
        justify-content: space-around !important;
  }
  .align-items-sm-start {
    -webkit-box-align: start !important;
        -ms-flex-align: start !important;
            align-items: flex-start !important;
  }
  .align-items-sm-end {
    -webkit-box-align: end !important;
        -ms-flex-align: end !important;
            align-items: flex-end !important;
  }
  .align-items-sm-center {
    -webkit-box-align: center !important;
        -ms-flex-align: center !important;
            align-items: center !important;
  }
  .align-items-sm-baseline {
    -webkit-box-align: baseline !important;
        -ms-flex-align: baseline !important;
            align-items: baseline !important;
  }
  .align-items-sm-stretch {
    -webkit-box-align: stretch !important;
        -ms-flex-align: stretch !important;
            align-items: stretch !important;
  }
  .align-content-sm-start {
    -ms-flex-line-pack: start !important;
        align-content: flex-start !important;
  }
  .align-content-sm-end {
    -ms-flex-line-pack: end !important;
        align-content: flex-end !important;
  }
  .align-content-sm-center {
    -ms-flex-line-pack: center !important;
        align-content: center !important;
  }
  .align-content-sm-between {
    -ms-flex-line-pack: justify !important;
        align-content: space-between !important;
  }
  .align-content-sm-around {
    -ms-flex-line-pack: distribute !important;
        align-content: space-around !important;
  }
  .align-content-sm-stretch {
    -ms-flex-line-pack: stretch !important;
        align-content: stretch !important;
  }
  .align-self-sm-auto {
    -ms-flex-item-align: auto !important;
        align-self: auto !important;
  }
  .align-self-sm-start {
    -ms-flex-item-align: start !important;
        align-self: flex-start !important;
  }
  .align-self-sm-end {
    -ms-flex-item-align: end !important;
        align-self: flex-end !important;
  }
  .align-self-sm-center {
    -ms-flex-item-align: center !important;
        align-self: center !important;
  }
  .align-self-sm-baseline {
    -ms-flex-item-align: baseline !important;
        align-self: baseline !important;
  }
  .align-self-sm-stretch {
    -ms-flex-item-align: stretch !important;
        align-self: stretch !important;
  }
}
@media (min-width: 768px) {
  .flex-md-row {
    -webkit-box-orient: horizontal !important;
    -webkit-box-direction: normal !important;
        -ms-flex-direction: row !important;
            flex-direction: row !important;
  }
  .flex-md-column {
    -webkit-box-orient: vertical !important;
    -webkit-box-direction: normal !important;
        -ms-flex-direction: column !important;
            flex-direction: column !important;
  }
  .flex-md-row-reverse {
    -webkit-box-orient: horizontal !important;
    -webkit-box-direction: reverse !important;
        -ms-flex-direction: row-reverse !important;
            flex-direction: row-reverse !important;
  }
  .flex-md-column-reverse {
    -webkit-box-orient: vertical !important;
    -webkit-box-direction: reverse !important;
        -ms-flex-direction: column-reverse !important;
            flex-direction: column-reverse !important;
  }
  .flex-md-wrap {
    -ms-flex-wrap: wrap !important;
        flex-wrap: wrap !important;
  }
  .flex-md-nowrap {
    -ms-flex-wrap: nowrap !important;
        flex-wrap: nowrap !important;
  }
  .flex-md-wrap-reverse {
    -ms-flex-wrap: wrap-reverse !important;
        flex-wrap: wrap-reverse !important;
  }
  .flex-md-fill {
    -webkit-box-flex: 1 !important;
        -ms-flex: 1 1 auto !important;
            flex: 1 1 auto !important;
  }
  .flex-md-grow-0 {
    -webkit-box-flex: 0 !important;
        -ms-flex-positive: 0 !important;
            flex-grow: 0 !important;
  }
  .flex-md-grow-1 {
    -webkit-box-flex: 1 !important;
        -ms-flex-positive: 1 !important;
            flex-grow: 1 !important;
  }
  .flex-md-shrink-0 {
    -ms-flex-negative: 0 !important;
        flex-shrink: 0 !important;
  }
  .flex-md-shrink-1 {
    -ms-flex-negative: 1 !important;
        flex-shrink: 1 !important;
  }
  .justify-content-md-start {
    -webkit-box-pack: start !important;
        -ms-flex-pack: start !important;
            justify-content: flex-start !important;
  }
  .justify-content-md-end {
    -webkit-box-pack: end !important;
        -ms-flex-pack: end !important;
            justify-content: flex-end !important;
  }
  .justify-content-md-center {
    -webkit-box-pack: center !important;
        -ms-flex-pack: center !important;
            justify-content: center !important;
  }
  .justify-content-md-between {
    -webkit-box-pack: justify !important;
        -ms-flex-pack: justify !important;
            justify-content: space-between !important;
  }
  .justify-content-md-around {
    -ms-flex-pack: distribute !important;
        justify-content: space-around !important;
  }
  .align-items-md-start {
    -webkit-box-align: start !important;
        -ms-flex-align: start !important;
            align-items: flex-start !important;
  }
  .align-items-md-end {
    -webkit-box-align: end !important;
        -ms-flex-align: end !important;
            align-items: flex-end !important;
  }
  .align-items-md-center {
    -webkit-box-align: center !important;
        -ms-flex-align: center !important;
            align-items: center !important;
  }
  .align-items-md-baseline {
    -webkit-box-align: baseline !important;
        -ms-flex-align: baseline !important;
            align-items: baseline !important;
  }
  .align-items-md-stretch {
    -webkit-box-align: stretch !important;
        -ms-flex-align: stretch !important;
            align-items: stretch !important;
  }
  .align-content-md-start {
    -ms-flex-line-pack: start !important;
        align-content: flex-start !important;
  }
  .align-content-md-end {
    -ms-flex-line-pack: end !important;
        align-content: flex-end !important;
  }
  .align-content-md-center {
    -ms-flex-line-pack: center !important;
        align-content: center !important;
  }
  .align-content-md-between {
    -ms-flex-line-pack: justify !important;
        align-content: space-between !important;
  }
  .align-content-md-around {
    -ms-flex-line-pack: distribute !important;
        align-content: space-around !important;
  }
  .align-content-md-stretch {
    -ms-flex-line-pack: stretch !important;
        align-content: stretch !important;
  }
  .align-self-md-auto {
    -ms-flex-item-align: auto !important;
        align-self: auto !important;
  }
  .align-self-md-start {
    -ms-flex-item-align: start !important;
        align-self: flex-start !important;
  }
  .align-self-md-end {
    -ms-flex-item-align: end !important;
        align-self: flex-end !important;
  }
  .align-self-md-center {
    -ms-flex-item-align: center !important;
        align-self: center !important;
  }
  .align-self-md-baseline {
    -ms-flex-item-align: baseline !important;
        align-self: baseline !important;
  }
  .align-self-md-stretch {
    -ms-flex-item-align: stretch !important;
        align-self: stretch !important;
  }
}
@media (min-width: 992px) {
  .flex-lg-row {
    -webkit-box-orient: horizontal !important;
    -webkit-box-direction: normal !important;
        -ms-flex-direction: row !important;
            flex-direction: row !important;
  }
  .flex-lg-column {
    -webkit-box-orient: vertical !important;
    -webkit-box-direction: normal !important;
        -ms-flex-direction: column !important;
            flex-direction: column !important;
  }
  .flex-lg-row-reverse {
    -webkit-box-orient: horizontal !important;
    -webkit-box-direction: reverse !important;
        -ms-flex-direction: row-reverse !important;
            flex-direction: row-reverse !important;
  }
  .flex-lg-column-reverse {
    -webkit-box-orient: vertical !important;
    -webkit-box-direction: reverse !important;
        -ms-flex-direction: column-reverse !important;
            flex-direction: column-reverse !important;
  }
  .flex-lg-wrap {
    -ms-flex-wrap: wrap !important;
        flex-wrap: wrap !important;
  }
  .flex-lg-nowrap {
    -ms-flex-wrap: nowrap !important;
        flex-wrap: nowrap !important;
  }
  .flex-lg-wrap-reverse {
    -ms-flex-wrap: wrap-reverse !important;
        flex-wrap: wrap-reverse !important;
  }
  .flex-lg-fill {
    -webkit-box-flex: 1 !important;
        -ms-flex: 1 1 auto !important;
            flex: 1 1 auto !important;
  }
  .flex-lg-grow-0 {
    -webkit-box-flex: 0 !important;
        -ms-flex-positive: 0 !important;
            flex-grow: 0 !important;
  }
  .flex-lg-grow-1 {
    -webkit-box-flex: 1 !important;
        -ms-flex-positive: 1 !important;
            flex-grow: 1 !important;
  }
  .flex-lg-shrink-0 {
    -ms-flex-negative: 0 !important;
        flex-shrink: 0 !important;
  }
  .flex-lg-shrink-1 {
    -ms-flex-negative: 1 !important;
        flex-shrink: 1 !important;
  }
  .justify-content-lg-start {
    -webkit-box-pack: start !important;
        -ms-flex-pack: start !important;
            justify-content: flex-start !important;
  }
  .justify-content-lg-end {
    -webkit-box-pack: end !important;
        -ms-flex-pack: end !important;
            justify-content: flex-end !important;
  }
  .justify-content-lg-center {
    -webkit-box-pack: center !important;
        -ms-flex-pack: center !important;
            justify-content: center !important;
  }
  .justify-content-lg-between {
    -webkit-box-pack: justify !important;
        -ms-flex-pack: justify !important;
            justify-content: space-between !important;
  }
  .justify-content-lg-around {
    -ms-flex-pack: distribute !important;
        justify-content: space-around !important;
  }
  .align-items-lg-start {
    -webkit-box-align: start !important;
        -ms-flex-align: start !important;
            align-items: flex-start !important;
  }
  .align-items-lg-end {
    -webkit-box-align: end !important;
        -ms-flex-align: end !important;
            align-items: flex-end !important;
  }
  .align-items-lg-center {
    -webkit-box-align: center !important;
        -ms-flex-align: center !important;
            align-items: center !important;
  }
  .align-items-lg-baseline {
    -webkit-box-align: baseline !important;
        -ms-flex-align: baseline !important;
            align-items: baseline !important;
  }
  .align-items-lg-stretch {
    -webkit-box-align: stretch !important;
        -ms-flex-align: stretch !important;
            align-items: stretch !important;
  }
  .align-content-lg-start {
    -ms-flex-line-pack: start !important;
        align-content: flex-start !important;
  }
  .align-content-lg-end {
    -ms-flex-line-pack: end !important;
        align-content: flex-end !important;
  }
  .align-content-lg-center {
    -ms-flex-line-pack: center !important;
        align-content: center !important;
  }
  .align-content-lg-between {
    -ms-flex-line-pack: justify !important;
        align-content: space-between !important;
  }
  .align-content-lg-around {
    -ms-flex-line-pack: distribute !important;
        align-content: space-around !important;
  }
  .align-content-lg-stretch {
    -ms-flex-line-pack: stretch !important;
        align-content: stretch !important;
  }
  .align-self-lg-auto {
    -ms-flex-item-align: auto !important;
        align-self: auto !important;
  }
  .align-self-lg-start {
    -ms-flex-item-align: start !important;
        align-self: flex-start !important;
  }
  .align-self-lg-end {
    -ms-flex-item-align: end !important;
        align-self: flex-end !important;
  }
  .align-self-lg-center {
    -ms-flex-item-align: center !important;
        align-self: center !important;
  }
  .align-self-lg-baseline {
    -ms-flex-item-align: baseline !important;
        align-self: baseline !important;
  }
  .align-self-lg-stretch {
    -ms-flex-item-align: stretch !important;
        align-self: stretch !important;
  }
}
@media (min-width: 1200px) {
  .flex-xl-row {
    -webkit-box-orient: horizontal !important;
    -webkit-box-direction: normal !important;
        -ms-flex-direction: row !important;
            flex-direction: row !important;
  }
  .flex-xl-column {
    -webkit-box-orient: vertical !important;
    -webkit-box-direction: normal !important;
        -ms-flex-direction: column !important;
            flex-direction: column !important;
  }
  .flex-xl-row-reverse {
    -webkit-box-orient: horizontal !important;
    -webkit-box-direction: reverse !important;
        -ms-flex-direction: row-reverse !important;
            flex-direction: row-reverse !important;
  }
  .flex-xl-column-reverse {
    -webkit-box-orient: vertical !important;
    -webkit-box-direction: reverse !important;
        -ms-flex-direction: column-reverse !important;
            flex-direction: column-reverse !important;
  }
  .flex-xl-wrap {
    -ms-flex-wrap: wrap !important;
        flex-wrap: wrap !important;
  }
  .flex-xl-nowrap {
    -ms-flex-wrap: nowrap !important;
        flex-wrap: nowrap !important;
  }
  .flex-xl-wrap-reverse {
    -ms-flex-wrap: wrap-reverse !important;
        flex-wrap: wrap-reverse !important;
  }
  .flex-xl-fill {
    -webkit-box-flex: 1 !important;
        -ms-flex: 1 1 auto !important;
            flex: 1 1 auto !important;
  }
  .flex-xl-grow-0 {
    -webkit-box-flex: 0 !important;
        -ms-flex-positive: 0 !important;
            flex-grow: 0 !important;
  }
  .flex-xl-grow-1 {
    -webkit-box-flex: 1 !important;
        -ms-flex-positive: 1 !important;
            flex-grow: 1 !important;
  }
  .flex-xl-shrink-0 {
    -ms-flex-negative: 0 !important;
        flex-shrink: 0 !important;
  }
  .flex-xl-shrink-1 {
    -ms-flex-negative: 1 !important;
        flex-shrink: 1 !important;
  }
  .justify-content-xl-start {
    -webkit-box-pack: start !important;
        -ms-flex-pack: start !important;
            justify-content: flex-start !important;
  }
  .justify-content-xl-end {
    -webkit-box-pack: end !important;
        -ms-flex-pack: end !important;
            justify-content: flex-end !important;
  }
  .justify-content-xl-center {
    -webkit-box-pack: center !important;
        -ms-flex-pack: center !important;
            justify-content: center !important;
  }
  .justify-content-xl-between {
    -webkit-box-pack: justify !important;
        -ms-flex-pack: justify !important;
            justify-content: space-between !important;
  }
  .justify-content-xl-around {
    -ms-flex-pack: distribute !important;
        justify-content: space-around !important;
  }
  .align-items-xl-start {
    -webkit-box-align: start !important;
        -ms-flex-align: start !important;
            align-items: flex-start !important;
  }
  .align-items-xl-end {
    -webkit-box-align: end !important;
        -ms-flex-align: end !important;
            align-items: flex-end !important;
  }
  .align-items-xl-center {
    -webkit-box-align: center !important;
        -ms-flex-align: center !important;
            align-items: center !important;
  }
  .align-items-xl-baseline {
    -webkit-box-align: baseline !important;
        -ms-flex-align: baseline !important;
            align-items: baseline !important;
  }
  .align-items-xl-stretch {
    -webkit-box-align: stretch !important;
        -ms-flex-align: stretch !important;
            align-items: stretch !important;
  }
  .align-content-xl-start {
    -ms-flex-line-pack: start !important;
        align-content: flex-start !important;
  }
  .align-content-xl-end {
    -ms-flex-line-pack: end !important;
        align-content: flex-end !important;
  }
  .align-content-xl-center {
    -ms-flex-line-pack: center !important;
        align-content: center !important;
  }
  .align-content-xl-between {
    -ms-flex-line-pack: justify !important;
        align-content: space-between !important;
  }
  .align-content-xl-around {
    -ms-flex-line-pack: distribute !important;
        align-content: space-around !important;
  }
  .align-content-xl-stretch {
    -ms-flex-line-pack: stretch !important;
        align-content: stretch !important;
  }
  .align-self-xl-auto {
    -ms-flex-item-align: auto !important;
        align-self: auto !important;
  }
  .align-self-xl-start {
    -ms-flex-item-align: start !important;
        align-self: flex-start !important;
  }
  .align-self-xl-end {
    -ms-flex-item-align: end !important;
        align-self: flex-end !important;
  }
  .align-self-xl-center {
    -ms-flex-item-align: center !important;
        align-self: center !important;
  }
  .align-self-xl-baseline {
    -ms-flex-item-align: baseline !important;
        align-self: baseline !important;
  }
  .align-self-xl-stretch {
    -ms-flex-item-align: stretch !important;
        align-self: stretch !important;
  }
}
@media (min-width: 1400px) {
  .flex-xxl-row {
    -webkit-box-orient: horizontal !important;
    -webkit-box-direction: normal !important;
        -ms-flex-direction: row !important;
            flex-direction: row !important;
  }
  .flex-xxl-column {
    -webkit-box-orient: vertical !important;
    -webkit-box-direction: normal !important;
        -ms-flex-direction: column !important;
            flex-direction: column !important;
  }
  .flex-xxl-row-reverse {
    -webkit-box-orient: horizontal !important;
    -webkit-box-direction: reverse !important;
        -ms-flex-direction: row-reverse !important;
            flex-direction: row-reverse !important;
  }
  .flex-xxl-column-reverse {
    -webkit-box-orient: vertical !important;
    -webkit-box-direction: reverse !important;
        -ms-flex-direction: column-reverse !important;
            flex-direction: column-reverse !important;
  }
  .flex-xxl-wrap {
    -ms-flex-wrap: wrap !important;
        flex-wrap: wrap !important;
  }
  .flex-xxl-nowrap {
    -ms-flex-wrap: nowrap !important;
        flex-wrap: nowrap !important;
  }
  .flex-xxl-wrap-reverse {
    -ms-flex-wrap: wrap-reverse !important;
        flex-wrap: wrap-reverse !important;
  }
  .flex-xxl-fill {
    -webkit-box-flex: 1 !important;
        -ms-flex: 1 1 auto !important;
            flex: 1 1 auto !important;
  }
  .flex-xxl-grow-0 {
    -webkit-box-flex: 0 !important;
        -ms-flex-positive: 0 !important;
            flex-grow: 0 !important;
  }
  .flex-xxl-grow-1 {
    -webkit-box-flex: 1 !important;
        -ms-flex-positive: 1 !important;
            flex-grow: 1 !important;
  }
  .flex-xxl-shrink-0 {
    -ms-flex-negative: 0 !important;
        flex-shrink: 0 !important;
  }
  .flex-xxl-shrink-1 {
    -ms-flex-negative: 1 !important;
        flex-shrink: 1 !important;
  }
  .justify-content-xxl-start {
    -webkit-box-pack: start !important;
        -ms-flex-pack: start !important;
            justify-content: flex-start !important;
  }
  .justify-content-xxl-end {
    -webkit-box-pack: end !important;
        -ms-flex-pack: end !important;
            justify-content: flex-end !important;
  }
  .justify-content-xxl-center {
    -webkit-box-pack: center !important;
        -ms-flex-pack: center !important;
            justify-content: center !important;
  }
  .justify-content-xxl-between {
    -webkit-box-pack: justify !important;
        -ms-flex-pack: justify !important;
            justify-content: space-between !important;
  }
  .justify-content-xxl-around {
    -ms-flex-pack: distribute !important;
        justify-content: space-around !important;
  }
  .align-items-xxl-start {
    -webkit-box-align: start !important;
        -ms-flex-align: start !important;
            align-items: flex-start !important;
  }
  .align-items-xxl-end {
    -webkit-box-align: end !important;
        -ms-flex-align: end !important;
            align-items: flex-end !important;
  }
  .align-items-xxl-center {
    -webkit-box-align: center !important;
        -ms-flex-align: center !important;
            align-items: center !important;
  }
  .align-items-xxl-baseline {
    -webkit-box-align: baseline !important;
        -ms-flex-align: baseline !important;
            align-items: baseline !important;
  }
  .align-items-xxl-stretch {
    -webkit-box-align: stretch !important;
        -ms-flex-align: stretch !important;
            align-items: stretch !important;
  }
  .align-content-xxl-start {
    -ms-flex-line-pack: start !important;
        align-content: flex-start !important;
  }
  .align-content-xxl-end {
    -ms-flex-line-pack: end !important;
        align-content: flex-end !important;
  }
  .align-content-xxl-center {
    -ms-flex-line-pack: center !important;
        align-content: center !important;
  }
  .align-content-xxl-between {
    -ms-flex-line-pack: justify !important;
        align-content: space-between !important;
  }
  .align-content-xxl-around {
    -ms-flex-line-pack: distribute !important;
        align-content: space-around !important;
  }
  .align-content-xxl-stretch {
    -ms-flex-line-pack: stretch !important;
        align-content: stretch !important;
  }
  .align-self-xxl-auto {
    -ms-flex-item-align: auto !important;
        align-self: auto !important;
  }
  .align-self-xxl-start {
    -ms-flex-item-align: start !important;
        align-self: flex-start !important;
  }
  .align-self-xxl-end {
    -ms-flex-item-align: end !important;
        align-self: flex-end !important;
  }
  .align-self-xxl-center {
    -ms-flex-item-align: center !important;
        align-self: center !important;
  }
  .align-self-xxl-baseline {
    -ms-flex-item-align: baseline !important;
        align-self: baseline !important;
  }
  .align-self-xxl-stretch {
    -ms-flex-item-align: stretch !important;
        align-self: stretch !important;
  }
}
/*!
 * Font Awesome Free 5.15.1 by @fontawesome - https://fontawesome.com
 * License - https://fontawesome.com/license/free (Icons: CC BY 4.0, Fonts: SIL OFL 1.1, Code: MIT License)
 */
.fa,
.fas,
.far,
.fal,
.fad,
.fab {
  -moz-osx-font-smoothing: grayscale;
  -webkit-font-smoothing: antialiased;
  display: inline-block;
  font-style: normal;
  font-variant: normal;
  text-rendering: auto;
  line-height: 1;
}

.fa-lg {
  font-size: 1.33333em;
  line-height: 0.75em;
  vertical-align: -0.0667em;
}

.fa-xs {
  font-size: 0.75em;
}

.fa-sm {
  font-size: 0.875em;
}

.fa-1x {
  font-size: 1em;
}

.fa-2x {
  font-size: 2em;
}

.fa-3x {
  font-size: 3em;
}

.fa-4x {
  font-size: 4em;
}

.fa-5x {
  font-size: 5em;
}

.fa-6x {
  font-size: 6em;
}

.fa-7x {
  font-size: 7em;
}

.fa-8x {
  font-size: 8em;
}

.fa-9x {
  font-size: 9em;
}

.fa-10x {
  font-size: 10em;
}

.fa-fw {
  text-align: center;
  width: 1.25em;
}

.fa-ul {
  list-style-type: none;
  margin-left: 2.5em;
  padding-left: 0;
}

.fa-ul > li {
  position: relative;
}

.fa-li {
  left: -2em;
  position: absolute;
  text-align: center;
  width: 2em;
  line-height: inherit;
}

.fa-border {
  border: solid 0.08em #eee;
  border-radius: 0.1em;
  padding: 0.2em 0.25em 0.15em;
}

.fa-pull-left {
  float: left;
}

.fa-pull-right {
  float: right;
}

.fa.fa-pull-left,
.fas.fa-pull-left,
.far.fa-pull-left,
.fal.fa-pull-left,
.fab.fa-pull-left {
  margin-right: 0.3em;
}

.fa.fa-pull-right,
.fas.fa-pull-right,
.far.fa-pull-right,
.fal.fa-pull-right,
.fab.fa-pull-right {
  margin-left: 0.3em;
}

.fa-spin {
  -webkit-animation: fa-spin 2s infinite linear;
  animation: fa-spin 2s infinite linear;
}

.fa-pulse {
  -webkit-animation: fa-spin 1s infinite steps(8);
  animation: fa-spin 1s infinite steps(8);
}

@-webkit-keyframes fa-spin {
  0% {
    -webkit-transform: rotate(0deg);
    transform: rotate(0deg);
  }
  100% {
    -webkit-transform: rotate(360deg);
    transform: rotate(360deg);
  }
}
@keyframes fa-spin {
  0% {
    -webkit-transform: rotate(0deg);
    transform: rotate(0deg);
  }
  100% {
    -webkit-transform: rotate(360deg);
    transform: rotate(360deg);
  }
}
.fa-rotate-90 {
  -ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=1)";
  -webkit-transform: rotate(90deg);
  transform: rotate(90deg);
}

.fa-rotate-180 {
  -ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=2)";
  -webkit-transform: rotate(180deg);
  transform: rotate(180deg);
}

.fa-rotate-270 {
  -ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=3)";
  -webkit-transform: rotate(270deg);
  transform: rotate(270deg);
}

.fa-flip-horizontal {
  -ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1)";
  -webkit-transform: scale(-1, 1);
  transform: scale(-1, 1);
}

.fa-flip-vertical {
  -ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)";
  -webkit-transform: scale(1, -1);
  transform: scale(1, -1);
}

.fa-flip-both, .fa-flip-horizontal.fa-flip-vertical {
  -ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)";
  -webkit-transform: scale(-1, -1);
  transform: scale(-1, -1);
}

:root .fa-rotate-90,
:root .fa-rotate-180,
:root .fa-rotate-270,
:root .fa-flip-horizontal,
:root .fa-flip-vertical,
:root .fa-flip-both {
  -webkit-filter: none;
  filter: none;
}

.fa-stack {
  display: inline-block;
  height: 2em;
  line-height: 2em;
  position: relative;
  vertical-align: middle;
  width: 2.5em;
}

.fa-stack-1x,
.fa-stack-2x {
  left: 0;
  position: absolute;
  text-align: center;
  width: 100%;
}

.fa-stack-1x {
  line-height: inherit;
}

.fa-stack-2x {
  font-size: 2em;
}

.fa-inverse {
  color: #fff;
}


.fa-500px:before {
  content: "\f26e";
}

.fa-accessible-icon:before {
  content: "\f368";
}

.fa-accusoft:before {
  content: "\f369";
}

.fa-acquisitions-incorporated:before {
  content: "\f6af";
}

.fa-ad:before {
  content: "\f641";
}

.fa-address-book:before {
  content: "\f2b9";
}

.fa-address-card:before {
  content: "\f2bb";
}

.fa-adjust:before {
  content: "\f042";
}

.fa-adn:before {
  content: "\f170";
}

.fa-adversal:before {
  content: "\f36a";
}

.fa-affiliatetheme:before {
  content: "\f36b";
}

.fa-air-freshener:before {
  content: "\f5d0";
}

.fa-airbnb:before {
  content: "\f834";
}

.fa-algolia:before {
  content: "\f36c";
}

.fa-align-center:before {
  content: "\f037";
}

.fa-align-justify:before {
  content: "\f039";
}

.fa-align-left:before {
  content: "\f036";
}

.fa-align-right:before {
  content: "\f038";
}

.fa-alipay:before {
  content: "\f642";
}

.fa-allergies:before {
  content: "\f461";
}

.fa-amazon:before {
  content: "\f270";
}

.fa-amazon-pay:before {
  content: "\f42c";
}

.fa-ambulance:before {
  content: "\f0f9";
}

.fa-american-sign-language-interpreting:before {
  content: "\f2a3";
}

.fa-amilia:before {
  content: "\f36d";
}

.fa-anchor:before {
  content: "\f13d";
}

.fa-android:before {
  content: "\f17b";
}

.fa-angellist:before {
  content: "\f209";
}

.fa-angle-double-down:before {
  content: "\f103";
}

.fa-angle-double-left:before {
  content: "\f100";
}

.fa-angle-double-right:before {
  content: "\f101";
}

.fa-angle-double-up:before {
  content: "\f102";
}

.fa-angle-down:before {
  content: "\f107";
}

.fa-angle-left:before {
  content: "\f104";
}

.fa-angle-right:before {
  content: "\f105";
}

.fa-angle-up:before {
  content: "\f106";
}

.fa-angry:before {
  content: "\f556";
}

.fa-angrycreative:before {
  content: "\f36e";
}

.fa-angular:before {
  content: "\f420";
}

.fa-ankh:before {
  content: "\f644";
}

.fa-app-store:before {
  content: "\f36f";
}

.fa-app-store-ios:before {
  content: "\f370";
}

.fa-apper:before {
  content: "\f371";
}

.fa-apple:before {
  content: "\f179";
}

.fa-apple-alt:before {
  content: "\f5d1";
}

.fa-apple-pay:before {
  content: "\f415";
}

.fa-archive:before {
  content: "\f187";
}

.fa-archway:before {
  content: "\f557";
}

.fa-arrow-alt-circle-down:before {
  content: "\f358";
}

.fa-arrow-alt-circle-left:before {
  content: "\f359";
}

.fa-arrow-alt-circle-right:before {
  content: "\f35a";
}

.fa-arrow-alt-circle-up:before {
  content: "\f35b";
}

.fa-arrow-circle-down:before {
  content: "\f0ab";
}

.fa-arrow-circle-left:before {
  content: "\f0a8";
}

.fa-arrow-circle-right:before {
  content: "\f0a9";
}

.fa-arrow-circle-up:before {
  content: "\f0aa";
}

.fa-arrow-down:before {
  content: "\f063";
}

.fa-arrow-left:before {
  content: "\f060";
}

.fa-arrow-right:before {
  content: "\f061";
}

.fa-arrow-up:before {
  content: "\f062";
}

.fa-arrows-alt:before {
  content: "\f0b2";
}

.fa-arrows-alt-h:before {
  content: "\f337";
}

.fa-arrows-alt-v:before {
  content: "\f338";
}

.fa-artstation:before {
  content: "\f77a";
}

.fa-assistive-listening-systems:before {
  content: "\f2a2";
}

.fa-asterisk:before {
  content: "\f069";
}

.fa-asymmetrik:before {
  content: "\f372";
}

.fa-at:before {
  content: "\f1fa";
}

.fa-atlas:before {
  content: "\f558";
}

.fa-atlassian:before {
  content: "\f77b";
}

.fa-atom:before {
  content: "\f5d2";
}

.fa-audible:before {
  content: "\f373";
}

.fa-audio-description:before {
  content: "\f29e";
}

.fa-autoprefixer:before {
  content: "\f41c";
}

.fa-avianex:before {
  content: "\f374";
}

.fa-aviato:before {
  content: "\f421";
}

.fa-award:before {
  content: "\f559";
}

.fa-aws:before {
  content: "\f375";
}

.fa-baby:before {
  content: "\f77c";
}

.fa-baby-carriage:before {
  content: "\f77d";
}

.fa-backspace:before {
  content: "\f55a";
}

.fa-backward:before {
  content: "\f04a";
}

.fa-bacon:before {
  content: "\f7e5";
}

.fa-bacteria:before {
  content: "\e059";
}

.fa-bacterium:before {
  content: "\e05a";
}

.fa-bahai:before {
  content: "\f666";
}

.fa-balance-scale:before {
  content: "\f24e";
}

.fa-balance-scale-left:before {
  content: "\f515";
}

.fa-balance-scale-right:before {
  content: "\f516";
}

.fa-ban:before {
  content: "\f05e";
}

.fa-band-aid:before {
  content: "\f462";
}

.fa-bandcamp:before {
  content: "\f2d5";
}

.fa-barcode:before {
  content: "\f02a";
}

.fa-bars:before {
  content: "\f0c9";
}

.fa-baseball-ball:before {
  content: "\f433";
}

.fa-basketball-ball:before {
  content: "\f434";
}

.fa-bath:before {
  content: "\f2cd";
}

.fa-battery-empty:before {
  content: "\f244";
}

.fa-battery-full:before {
  content: "\f240";
}

.fa-battery-half:before {
  content: "\f242";
}

.fa-battery-quarter:before {
  content: "\f243";
}

.fa-battery-three-quarters:before {
  content: "\f241";
}

.fa-battle-net:before {
  content: "\f835";
}

.fa-bed:before {
  content: "\f236";
}

.fa-beer:before {
  content: "\f0fc";
}

.fa-behance:before {
  content: "\f1b4";
}

.fa-behance-square:before {
  content: "\f1b5";
}

.fa-bell:before {
  content: "\f0f3";
}

.fa-bell-slash:before {
  content: "\f1f6";
}

.fa-bezier-curve:before {
  content: "\f55b";
}

.fa-bible:before {
  content: "\f647";
}

.fa-bicycle:before {
  content: "\f206";
}

.fa-biking:before {
  content: "\f84a";
}

.fa-bimobject:before {
  content: "\f378";
}

.fa-binoculars:before {
  content: "\f1e5";
}

.fa-biohazard:before {
  content: "\f780";
}

.fa-birthday-cake:before {
  content: "\f1fd";
}

.fa-bitbucket:before {
  content: "\f171";
}

.fa-bitcoin:before {
  content: "\f379";
}

.fa-bity:before {
  content: "\f37a";
}

.fa-black-tie:before {
  content: "\f27e";
}

.fa-blackberry:before {
  content: "\f37b";
}

.fa-blender:before {
  content: "\f517";
}

.fa-blender-phone:before {
  content: "\f6b6";
}

.fa-blind:before {
  content: "\f29d";
}

.fa-blog:before {
  content: "\f781";
}

.fa-blogger:before {
  content: "\f37c";
}

.fa-blogger-b:before {
  content: "\f37d";
}

.fa-bluetooth:before {
  content: "\f293";
}

.fa-bluetooth-b:before {
  content: "\f294";
}

.fa-bold:before {
  content: "\f032";
}

.fa-bolt:before {
  content: "\f0e7";
}

.fa-bomb:before {
  content: "\f1e2";
}

.fa-bone:before {
  content: "\f5d7";
}

.fa-bong:before {
  content: "\f55c";
}

.fa-book:before {
  content: "\f02d";
}

.fa-book-dead:before {
  content: "\f6b7";
}

.fa-book-medical:before {
  content: "\f7e6";
}

.fa-book-open:before {
  content: "\f518";
}

.fa-book-reader:before {
  content: "\f5da";
}

.fa-bookmark:before {
  content: "\f02e";
}

.fa-bootstrap:before {
  content: "\f836";
}

.fa-border-all:before {
  content: "\f84c";
}

.fa-border-none:before {
  content: "\f850";
}

.fa-border-style:before {
  content: "\f853";
}

.fa-bowling-ball:before {
  content: "\f436";
}

.fa-box:before {
  content: "\f466";
}

.fa-box-open:before {
  content: "\f49e";
}

.fa-box-tissue:before {
  content: "\e05b";
}

.fa-boxes:before {
  content: "\f468";
}

.fa-braille:before {
  content: "\f2a1";
}

.fa-brain:before {
  content: "\f5dc";
}

.fa-bread-slice:before {
  content: "\f7ec";
}

.fa-briefcase:before {
  content: "\f0b1";
}

.fa-briefcase-medical:before {
  content: "\f469";
}

.fa-broadcast-tower:before {
  content: "\f519";
}

.fa-broom:before {
  content: "\f51a";
}

.fa-brush:before {
  content: "\f55d";
}

.fa-btc:before {
  content: "\f15a";
}

.fa-buffer:before {
  content: "\f837";
}

.fa-bug:before {
  content: "\f188";
}

.fa-building:before {
  content: "\f1ad";
}

.fa-bullhorn:before {
  content: "\f0a1";
}

.fa-bullseye:before {
  content: "\f140";
}

.fa-burn:before {
  content: "\f46a";
}

.fa-buromobelexperte:before {
  content: "\f37f";
}

.fa-bus:before {
  content: "\f207";
}

.fa-bus-alt:before {
  content: "\f55e";
}

.fa-business-time:before {
  content: "\f64a";
}

.fa-buy-n-large:before {
  content: "\f8a6";
}

.fa-buysellads:before {
  content: "\f20d";
}

.fa-calculator:before {
  content: "\f1ec";
}

.fa-calendar:before {
  content: "\f133";
}

.fa-calendar-alt:before {
  content: "\f073";
}

.fa-calendar-check:before {
  content: "\f274";
}

.fa-calendar-day:before {
  content: "\f783";
}

.fa-calendar-minus:before {
  content: "\f272";
}

.fa-calendar-plus:before {
  content: "\f271";
}

.fa-calendar-times:before {
  content: "\f273";
}

.fa-calendar-week:before {
  content: "\f784";
}

.fa-camera:before {
  content: "\f030";
}

.fa-camera-retro:before {
  content: "\f083";
}

.fa-campground:before {
  content: "\f6bb";
}

.fa-canadian-maple-leaf:before {
  content: "\f785";
}

.fa-candy-cane:before {
  content: "\f786";
}

.fa-cannabis:before {
  content: "\f55f";
}

.fa-capsules:before {
  content: "\f46b";
}

.fa-car:before {
  content: "\f1b9";
}

.fa-car-alt:before {
  content: "\f5de";
}

.fa-car-battery:before {
  content: "\f5df";
}

.fa-car-crash:before {
  content: "\f5e1";
}

.fa-car-side:before {
  content: "\f5e4";
}

.fa-caravan:before {
  content: "\f8ff";
}

.fa-caret-down:before {
  content: "\f0d7";
}

.fa-caret-left:before {
  content: "\f0d9";
}

.fa-caret-right:before {
  content: "\f0da";
}

.fa-caret-square-down:before {
  content: "\f150";
}

.fa-caret-square-left:before {
  content: "\f191";
}

.fa-caret-square-right:before {
  content: "\f152";
}

.fa-caret-square-up:before {
  content: "\f151";
}

.fa-caret-up:before {
  content: "\f0d8";
}

.fa-carrot:before {
  content: "\f787";
}

.fa-cart-arrow-down:before {
  content: "\f218";
}

.fa-cart-plus:before {
  content: "\f217";
}

.fa-cash-register:before {
  content: "\f788";
}

.fa-cat:before {
  content: "\f6be";
}

.fa-cc-amazon-pay:before {
  content: "\f42d";
}

.fa-cc-amex:before {
  content: "\f1f3";
}

.fa-cc-apple-pay:before {
  content: "\f416";
}

.fa-cc-diners-club:before {
  content: "\f24c";
}

.fa-cc-discover:before {
  content: "\f1f2";
}

.fa-cc-jcb:before {
  content: "\f24b";
}

.fa-cc-mastercard:before {
  content: "\f1f1";
}

.fa-cc-paypal:before {
  content: "\f1f4";
}

.fa-cc-stripe:before {
  content: "\f1f5";
}

.fa-cc-visa:before {
  content: "\f1f0";
}

.fa-centercode:before {
  content: "\f380";
}

.fa-centos:before {
  content: "\f789";
}

.fa-certificate:before {
  content: "\f0a3";
}

.fa-chair:before {
  content: "\f6c0";
}

.fa-chalkboard:before {
  content: "\f51b";
}

.fa-chalkboard-teacher:before {
  content: "\f51c";
}

.fa-charging-station:before {
  content: "\f5e7";
}

.fa-chart-area:before {
  content: "\f1fe";
}

.fa-chart-bar:before {
  content: "\f080";
}

.fa-chart-line:before {
  content: "\f201";
}

.fa-chart-pie:before {
  content: "\f200";
}

.fa-check:before {
  content: "\f00c";
}

.fa-check-circle:before {
  content: "\f058";
}

.fa-check-double:before {
  content: "\f560";
}

.fa-check-square:before {
  content: "\f14a";
}

.fa-cheese:before {
  content: "\f7ef";
}

.fa-chess:before {
  content: "\f439";
}

.fa-chess-bishop:before {
  content: "\f43a";
}

.fa-chess-board:before {
  content: "\f43c";
}

.fa-chess-king:before {
  content: "\f43f";
}

.fa-chess-knight:before {
  content: "\f441";
}

.fa-chess-pawn:before {
  content: "\f443";
}

.fa-chess-queen:before {
  content: "\f445";
}

.fa-chess-rook:before {
  content: "\f447";
}

.fa-chevron-circle-down:before {
  content: "\f13a";
}

.fa-chevron-circle-left:before {
  content: "\f137";
}

.fa-chevron-circle-right:before {
  content: "\f138";
}

.fa-chevron-circle-up:before {
  content: "\f139";
}

.fa-chevron-down:before {
  content: "\f078";
}

.fa-chevron-left:before {
  content: "\f053";
}

.fa-chevron-right:before {
  content: "\f054";
}

.fa-chevron-up:before {
  content: "\f077";
}

.fa-child:before {
  content: "\f1ae";
}

.fa-chrome:before {
  content: "\f268";
}

.fa-chromecast:before {
  content: "\f838";
}

.fa-church:before {
  content: "\f51d";
}

.fa-circle:before {
  content: "\f111";
}

.fa-circle-notch:before {
  content: "\f1ce";
}

.fa-city:before {
  content: "\f64f";
}

.fa-clinic-medical:before {
  content: "\f7f2";
}

.fa-clipboard:before {
  content: "\f328";
}

.fa-clipboard-check:before {
  content: "\f46c";
}

.fa-clipboard-list:before {
  content: "\f46d";
}

.fa-clock:before {
  content: "\f017";
}

.fa-clone:before {
  content: "\f24d";
}

.fa-closed-captioning:before {
  content: "\f20a";
}

.fa-cloud:before {
  content: "\f0c2";
}

.fa-cloud-download-alt:before {
  content: "\f381";
}

.fa-cloud-meatball:before {
  content: "\f73b";
}

.fa-cloud-moon:before {
  content: "\f6c3";
}

.fa-cloud-moon-rain:before {
  content: "\f73c";
}

.fa-cloud-rain:before {
  content: "\f73d";
}

.fa-cloud-showers-heavy:before {
  content: "\f740";
}

.fa-cloud-sun:before {
  content: "\f6c4";
}

.fa-cloud-sun-rain:before {
  content: "\f743";
}

.fa-cloud-upload-alt:before {
  content: "\f382";
}

.fa-cloudflare:before {
  content: "\e07d";
}

.fa-cloudscale:before {
  content: "\f383";
}

.fa-cloudsmith:before {
  content: "\f384";
}

.fa-cloudversify:before {
  content: "\f385";
}

.fa-cocktail:before {
  content: "\f561";
}

.fa-code:before {
  content: "\f121";
}

.fa-code-branch:before {
  content: "\f126";
}

.fa-codepen:before {
  content: "\f1cb";
}

.fa-codiepie:before {
  content: "\f284";
}

.fa-coffee:before {
  content: "\f0f4";
}

.fa-cog:before {
  content: "\f013";
}

.fa-cogs:before {
  content: "\f085";
}

.fa-coins:before {
  content: "\f51e";
}

.fa-columns:before {
  content: "\f0db";
}

.fa-comment:before {
  content: "\f075";
}

.fa-comment-alt:before {
  content: "\f27a";
}

.fa-comment-dollar:before {
  content: "\f651";
}

.fa-comment-dots:before {
  content: "\f4ad";
}

.fa-comment-medical:before {
  content: "\f7f5";
}

.fa-comment-slash:before {
  content: "\f4b3";
}

.fa-comments:before {
  content: "\f086";
}

.fa-comments-dollar:before {
  content: "\f653";
}

.fa-compact-disc:before {
  content: "\f51f";
}

.fa-compass:before {
  content: "\f14e";
}

.fa-compress:before {
  content: "\f066";
}

.fa-compress-alt:before {
  content: "\f422";
}

.fa-compress-arrows-alt:before {
  content: "\f78c";
}

.fa-concierge-bell:before {
  content: "\f562";
}

.fa-confluence:before {
  content: "\f78d";
}

.fa-connectdevelop:before {
  content: "\f20e";
}

.fa-contao:before {
  content: "\f26d";
}

.fa-cookie:before {
  content: "\f563";
}

.fa-cookie-bite:before {
  content: "\f564";
}

.fa-copy:before {
  content: "\f0c5";
}

.fa-copyright:before {
  content: "\f1f9";
}

.fa-cotton-bureau:before {
  content: "\f89e";
}

.fa-couch:before {
  content: "\f4b8";
}

.fa-cpanel:before {
  content: "\f388";
}

.fa-creative-commons:before {
  content: "\f25e";
}

.fa-creative-commons-by:before {
  content: "\f4e7";
}

.fa-creative-commons-nc:before {
  content: "\f4e8";
}

.fa-creative-commons-nc-eu:before {
  content: "\f4e9";
}

.fa-creative-commons-nc-jp:before {
  content: "\f4ea";
}

.fa-creative-commons-nd:before {
  content: "\f4eb";
}

.fa-creative-commons-pd:before {
  content: "\f4ec";
}

.fa-creative-commons-pd-alt:before {
  content: "\f4ed";
}

.fa-creative-commons-remix:before {
  content: "\f4ee";
}

.fa-creative-commons-sa:before {
  content: "\f4ef";
}

.fa-creative-commons-sampling:before {
  content: "\f4f0";
}

.fa-creative-commons-sampling-plus:before {
  content: "\f4f1";
}

.fa-creative-commons-share:before {
  content: "\f4f2";
}

.fa-creative-commons-zero:before {
  content: "\f4f3";
}

.fa-credit-card:before {
  content: "\f09d";
}

.fa-critical-role:before {
  content: "\f6c9";
}

.fa-crop:before {
  content: "\f125";
}

.fa-crop-alt:before {
  content: "\f565";
}

.fa-cross:before {
  content: "\f654";
}

.fa-crosshairs:before {
  content: "\f05b";
}

.fa-crow:before {
  content: "\f520";
}

.fa-crown:before {
  content: "\f521";
}

.fa-crutch:before {
  content: "\f7f7";
}

.fa-css3:before {
  content: "\f13c";
}

.fa-css3-alt:before {
  content: "\f38b";
}

.fa-cube:before {
  content: "\f1b2";
}

.fa-cubes:before {
  content: "\f1b3";
}

.fa-cut:before {
  content: "\f0c4";
}

.fa-cuttlefish:before {
  content: "\f38c";
}

.fa-d-and-d:before {
  content: "\f38d";
}

.fa-d-and-d-beyond:before {
  content: "\f6ca";
}

.fa-dailymotion:before {
  content: "\e052";
}

.fa-dashcube:before {
  content: "\f210";
}

.fa-database:before {
  content: "\f1c0";
}

.fa-deaf:before {
  content: "\f2a4";
}

.fa-deezer:before {
  content: "\e077";
}

.fa-delicious:before {
  content: "\f1a5";
}

.fa-democrat:before {
  content: "\f747";
}

.fa-deploydog:before {
  content: "\f38e";
}

.fa-deskpro:before {
  content: "\f38f";
}

.fa-desktop:before {
  content: "\f108";
}

.fa-dev:before {
  content: "\f6cc";
}

.fa-deviantart:before {
  content: "\f1bd";
}

.fa-dharmachakra:before {
  content: "\f655";
}

.fa-dhl:before {
  content: "\f790";
}

.fa-diagnoses:before {
  content: "\f470";
}

.fa-diaspora:before {
  content: "\f791";
}

.fa-dice:before {
  content: "\f522";
}

.fa-dice-d20:before {
  content: "\f6cf";
}

.fa-dice-d6:before {
  content: "\f6d1";
}

.fa-dice-five:before {
  content: "\f523";
}

.fa-dice-four:before {
  content: "\f524";
}

.fa-dice-one:before {
  content: "\f525";
}

.fa-dice-six:before {
  content: "\f526";
}

.fa-dice-three:before {
  content: "\f527";
}

.fa-dice-two:before {
  content: "\f528";
}

.fa-digg:before {
  content: "\f1a6";
}

.fa-digital-ocean:before {
  content: "\f391";
}

.fa-digital-tachograph:before {
  content: "\f566";
}

.fa-directions:before {
  content: "\f5eb";
}

.fa-discord:before {
  content: "\f392";
}

.fa-discourse:before {
  content: "\f393";
}

.fa-disease:before {
  content: "\f7fa";
}

.fa-divide:before {
  content: "\f529";
}

.fa-dizzy:before {
  content: "\f567";
}

.fa-dna:before {
  content: "\f471";
}

.fa-dochub:before {
  content: "\f394";
}

.fa-docker:before {
  content: "\f395";
}

.fa-dog:before {
  content: "\f6d3";
}

.fa-dollar-sign:before {
  content: "\f155";
}

.fa-dolly:before {
  content: "\f472";
}

.fa-dolly-flatbed:before {
  content: "\f474";
}

.fa-donate:before {
  content: "\f4b9";
}

.fa-door-closed:before {
  content: "\f52a";
}

.fa-door-open:before {
  content: "\f52b";
}

.fa-dot-circle:before {
  content: "\f192";
}

.fa-dove:before {
  content: "\f4ba";
}

.fa-download:before {
  content: "\f019";
}

.fa-draft2digital:before {
  content: "\f396";
}

.fa-drafting-compass:before {
  content: "\f568";
}

.fa-dragon:before {
  content: "\f6d5";
}

.fa-draw-polygon:before {
  content: "\f5ee";
}

.fa-dribbble:before {
  content: "\f17d";
}

.fa-dribbble-square:before {
  content: "\f397";
}

.fa-dropbox:before {
  content: "\f16b";
}

.fa-drum:before {
  content: "\f569";
}

.fa-drum-steelpan:before {
  content: "\f56a";
}

.fa-drumstick-bite:before {
  content: "\f6d7";
}

.fa-drupal:before {
  content: "\f1a9";
}

.fa-dumbbell:before {
  content: "\f44b";
}

.fa-dumpster:before {
  content: "\f793";
}

.fa-dumpster-fire:before {
  content: "\f794";
}

.fa-dungeon:before {
  content: "\f6d9";
}

.fa-dyalog:before {
  content: "\f399";
}

.fa-earlybirds:before {
  content: "\f39a";
}

.fa-ebay:before {
  content: "\f4f4";
}

.fa-edge:before {
  content: "\f282";
}

.fa-edge-legacy:before {
  content: "\e078";
}

.fa-edit:before {
  content: "\f044";
}

.fa-egg:before {
  content: "\f7fb";
}

.fa-eject:before {
  content: "\f052";
}

.fa-elementor:before {
  content: "\f430";
}

.fa-ellipsis-h:before {
  content: "\f141";
}

.fa-ellipsis-v:before {
  content: "\f142";
}

.fa-ello:before {
  content: "\f5f1";
}

.fa-ember:before {
  content: "\f423";
}

.fa-empire:before {
  content: "\f1d1";
}

.fa-envelope:before {
  content: "\f0e0";
}

.fa-envelope-open:before {
  content: "\f2b6";
}

.fa-envelope-open-text:before {
  content: "\f658";
}

.fa-envelope-square:before {
  content: "\f199";
}

.fa-envira:before {
  content: "\f299";
}

.fa-equals:before {
  content: "\f52c";
}

.fa-eraser:before {
  content: "\f12d";
}

.fa-erlang:before {
  content: "\f39d";
}

.fa-ethereum:before {
  content: "\f42e";
}

.fa-ethernet:before {
  content: "\f796";
}

.fa-etsy:before {
  content: "\f2d7";
}

.fa-euro-sign:before {
  content: "\f153";
}

.fa-evernote:before {
  content: "\f839";
}

.fa-exchange-alt:before {
  content: "\f362";
}

.fa-exclamation:before {
  content: "\f12a";
}

.fa-exclamation-circle:before {
  content: "\f06a";
}

.fa-exclamation-triangle:before {
  content: "\f071";
}

.fa-expand:before {
  content: "\f065";
}

.fa-expand-alt:before {
  content: "\f424";
}

.fa-expand-arrows-alt:before {
  content: "\f31e";
}

.fa-expeditedssl:before {
  content: "\f23e";
}

.fa-external-link-alt:before {
  content: "\f35d";
}

.fa-external-link-square-alt:before {
  content: "\f360";
}

.fa-eye:before {
  content: "\f06e";
}

.fa-eye-dropper:before {
  content: "\f1fb";
}

.fa-eye-slash:before {
  content: "\f070";
}

.fa-facebook:before {
  content: "\f09a";
}

.fa-facebook-f:before {
  content: "\f39e";
}

.fa-facebook-messenger:before {
  content: "\f39f";
}

.fa-facebook-square:before {
  content: "\f082";
}

.fa-fan:before {
  content: "\f863";
}

.fa-fantasy-flight-games:before {
  content: "\f6dc";
}

.fa-fast-backward:before {
  content: "\f049";
}

.fa-fast-forward:before {
  content: "\f050";
}

.fa-faucet:before {
  content: "\e005";
}

.fa-fax:before {
  content: "\f1ac";
}

.fa-feather:before {
  content: "\f52d";
}

.fa-feather-alt:before {
  content: "\f56b";
}

.fa-fedex:before {
  content: "\f797";
}

.fa-fedora:before {
  content: "\f798";
}

.fa-female:before {
  content: "\f182";
}

.fa-fighter-jet:before {
  content: "\f0fb";
}

.fa-figma:before {
  content: "\f799";
}

.fa-file:before {
  content: "\f15b";
}

.fa-file-alt:before {
  content: "\f15c";
}

.fa-file-archive:before {
  content: "\f1c6";
}

.fa-file-audio:before {
  content: "\f1c7";
}

.fa-file-code:before {
  content: "\f1c9";
}

.fa-file-contract:before {
  content: "\f56c";
}

.fa-file-csv:before {
  content: "\f6dd";
}

.fa-file-download:before {
  content: "\f56d";
}

.fa-file-excel:before {
  content: "\f1c3";
}

.fa-file-export:before {
  content: "\f56e";
}

.fa-file-image:before {
  content: "\f1c5";
}

.fa-file-import:before {
  content: "\f56f";
}

.fa-file-invoice:before {
  content: "\f570";
}

.fa-file-invoice-dollar:before {
  content: "\f571";
}

.fa-file-medical:before {
  content: "\f477";
}

.fa-file-medical-alt:before {
  content: "\f478";
}

.fa-file-pdf:before {
  content: "\f1c1";
}

.fa-file-powerpoint:before {
  content: "\f1c4";
}

.fa-file-prescription:before {
  content: "\f572";
}

.fa-file-signature:before {
  content: "\f573";
}

.fa-file-upload:before {
  content: "\f574";
}

.fa-file-video:before {
  content: "\f1c8";
}

.fa-file-word:before {
  content: "\f1c2";
}

.fa-fill:before {
  content: "\f575";
}

.fa-fill-drip:before {
  content: "\f576";
}

.fa-film:before {
  content: "\f008";
}

.fa-filter:before {
  content: "\f0b0";
}

.fa-fingerprint:before {
  content: "\f577";
}

.fa-fire:before {
  content: "\f06d";
}

.fa-fire-alt:before {
  content: "\f7e4";
}

.fa-fire-extinguisher:before {
  content: "\f134";
}

.fa-firefox:before {
  content: "\f269";
}

.fa-firefox-browser:before {
  content: "\e007";
}

.fa-first-aid:before {
  content: "\f479";
}

.fa-first-order:before {
  content: "\f2b0";
}

.fa-first-order-alt:before {
  content: "\f50a";
}

.fa-firstdraft:before {
  content: "\f3a1";
}

.fa-fish:before {
  content: "\f578";
}

.fa-fist-raised:before {
  content: "\f6de";
}

.fa-flag:before {
  content: "\f024";
}

.fa-flag-checkered:before {
  content: "\f11e";
}

.fa-flag-usa:before {
  content: "\f74d";
}

.fa-flask:before {
  content: "\f0c3";
}

.fa-flickr:before {
  content: "\f16e";
}

.fa-flipboard:before {
  content: "\f44d";
}

.fa-flushed:before {
  content: "\f579";
}

.fa-fly:before {
  content: "\f417";
}

.fa-folder:before {
  content: "\f07b";
}

.fa-folder-minus:before {
  content: "\f65d";
}

.fa-folder-open:before {
  content: "\f07c";
}

.fa-folder-plus:before {
  content: "\f65e";
}

.fa-font:before {
  content: "\f031";
}

.fa-font-awesome:before {
  content: "\f2b4";
}

.fa-font-awesome-alt:before {
  content: "\f35c";
}

.fa-font-awesome-flag:before {
  content: "\f425";
}

.fa-font-awesome-logo-full:before {
  content: "\f4e6";
}

.fa-fonticons:before {
  content: "\f280";
}

.fa-fonticons-fi:before {
  content: "\f3a2";
}

.fa-football-ball:before {
  content: "\f44e";
}

.fa-fort-awesome:before {
  content: "\f286";
}

.fa-fort-awesome-alt:before {
  content: "\f3a3";
}

.fa-forumbee:before {
  content: "\f211";
}

.fa-forward:before {
  content: "\f04e";
}

.fa-foursquare:before {
  content: "\f180";
}

.fa-free-code-camp:before {
  content: "\f2c5";
}

.fa-freebsd:before {
  content: "\f3a4";
}

.fa-frog:before {
  content: "\f52e";
}

.fa-frown:before {
  content: "\f119";
}

.fa-frown-open:before {
  content: "\f57a";
}

.fa-fulcrum:before {
  content: "\f50b";
}

.fa-funnel-dollar:before {
  content: "\f662";
}

.fa-futbol:before {
  content: "\f1e3";
}

.fa-galactic-republic:before {
  content: "\f50c";
}

.fa-galactic-senate:before {
  content: "\f50d";
}

.fa-gamepad:before {
  content: "\f11b";
}

.fa-gas-pump:before {
  content: "\f52f";
}

.fa-gavel:before {
  content: "\f0e3";
}

.fa-gem:before {
  content: "\f3a5";
}

.fa-genderless:before {
  content: "\f22d";
}

.fa-get-pocket:before {
  content: "\f265";
}

.fa-gg:before {
  content: "\f260";
}

.fa-gg-circle:before {
  content: "\f261";
}

.fa-ghost:before {
  content: "\f6e2";
}

.fa-gift:before {
  content: "\f06b";
}

.fa-gifts:before {
  content: "\f79c";
}

.fa-git:before {
  content: "\f1d3";
}

.fa-git-alt:before {
  content: "\f841";
}

.fa-git-square:before {
  content: "\f1d2";
}

.fa-github:before {
  content: "\f09b";
}

.fa-github-alt:before {
  content: "\f113";
}

.fa-github-square:before {
  content: "\f092";
}

.fa-gitkraken:before {
  content: "\f3a6";
}

.fa-gitlab:before {
  content: "\f296";
}

.fa-gitter:before {
  content: "\f426";
}

.fa-glass-cheers:before {
  content: "\f79f";
}

.fa-glass-martini:before {
  content: "\f000";
}

.fa-glass-martini-alt:before {
  content: "\f57b";
}

.fa-glass-whiskey:before {
  content: "\f7a0";
}

.fa-glasses:before {
  content: "\f530";
}

.fa-glide:before {
  content: "\f2a5";
}

.fa-glide-g:before {
  content: "\f2a6";
}

.fa-globe:before {
  content: "\f0ac";
}

.fa-globe-africa:before {
  content: "\f57c";
}

.fa-globe-americas:before {
  content: "\f57d";
}

.fa-globe-asia:before {
  content: "\f57e";
}

.fa-globe-europe:before {
  content: "\f7a2";
}

.fa-gofore:before {
  content: "\f3a7";
}

.fa-golf-ball:before {
  content: "\f450";
}

.fa-goodreads:before {
  content: "\f3a8";
}

.fa-goodreads-g:before {
  content: "\f3a9";
}

.fa-google:before {
  content: "\f1a0";
}

.fa-google-drive:before {
  content: "\f3aa";
}

.fa-google-pay:before {
  content: "\e079";
}

.fa-google-play:before {
  content: "\f3ab";
}

.fa-google-plus:before {
  content: "\f2b3";
}

.fa-google-plus-g:before {
  content: "\f0d5";
}

.fa-google-plus-square:before {
  content: "\f0d4";
}

.fa-google-wallet:before {
  content: "\f1ee";
}

.fa-gopuram:before {
  content: "\f664";
}

.fa-graduation-cap:before {
  content: "\f19d";
}

.fa-gratipay:before {
  content: "\f184";
}

.fa-grav:before {
  content: "\f2d6";
}

.fa-greater-than:before {
  content: "\f531";
}

.fa-greater-than-equal:before {
  content: "\f532";
}

.fa-grimace:before {
  content: "\f57f";
}

.fa-grin:before {
  content: "\f580";
}

.fa-grin-alt:before {
  content: "\f581";
}

.fa-grin-beam:before {
  content: "\f582";
}

.fa-grin-beam-sweat:before {
  content: "\f583";
}

.fa-grin-hearts:before {
  content: "\f584";
}

.fa-grin-squint:before {
  content: "\f585";
}

.fa-grin-squint-tears:before {
  content: "\f586";
}

.fa-grin-stars:before {
  content: "\f587";
}

.fa-grin-tears:before {
  content: "\f588";
}

.fa-grin-tongue:before {
  content: "\f589";
}

.fa-grin-tongue-squint:before {
  content: "\f58a";
}

.fa-grin-tongue-wink:before {
  content: "\f58b";
}

.fa-grin-wink:before {
  content: "\f58c";
}

.fa-grip-horizontal:before {
  content: "\f58d";
}

.fa-grip-lines:before {
  content: "\f7a4";
}

.fa-grip-lines-vertical:before {
  content: "\f7a5";
}

.fa-grip-vertical:before {
  content: "\f58e";
}

.fa-gripfire:before {
  content: "\f3ac";
}

.fa-grunt:before {
  content: "\f3ad";
}

.fa-guilded:before {
  content: "\e07e";
}

.fa-guitar:before {
  content: "\f7a6";
}

.fa-gulp:before {
  content: "\f3ae";
}

.fa-h-square:before {
  content: "\f0fd";
}

.fa-hacker-news:before {
  content: "\f1d4";
}

.fa-hacker-news-square:before {
  content: "\f3af";
}

.fa-hackerrank:before {
  content: "\f5f7";
}

.fa-hamburger:before {
  content: "\f805";
}

.fa-hammer:before {
  content: "\f6e3";
}

.fa-hamsa:before {
  content: "\f665";
}

.fa-hand-holding:before {
  content: "\f4bd";
}

.fa-hand-holding-heart:before {
  content: "\f4be";
}

.fa-hand-holding-medical:before {
  content: "\e05c";
}

.fa-hand-holding-usd:before {
  content: "\f4c0";
}

.fa-hand-holding-water:before {
  content: "\f4c1";
}

.fa-hand-lizard:before {
  content: "\f258";
}

.fa-hand-middle-finger:before {
  content: "\f806";
}

.fa-hand-paper:before {
  content: "\f256";
}

.fa-hand-peace:before {
  content: "\f25b";
}

.fa-hand-point-down:before {
  content: "\f0a7";
}

.fa-hand-point-left:before {
  content: "\f0a5";
}

.fa-hand-point-right:before {
  content: "\f0a4";
}

.fa-hand-point-up:before {
  content: "\f0a6";
}

.fa-hand-pointer:before {
  content: "\f25a";
}

.fa-hand-rock:before {
  content: "\f255";
}

.fa-hand-scissors:before {
  content: "\f257";
}

.fa-hand-sparkles:before {
  content: "\e05d";
}

.fa-hand-spock:before {
  content: "\f259";
}

.fa-hands:before {
  content: "\f4c2";
}

.fa-hands-helping:before {
  content: "\f4c4";
}

.fa-hands-wash:before {
  content: "\e05e";
}

.fa-handshake:before {
  content: "\f2b5";
}

.fa-handshake-alt-slash:before {
  content: "\e05f";
}

.fa-handshake-slash:before {
  content: "\e060";
}

.fa-hanukiah:before {
  content: "\f6e6";
}

.fa-hard-hat:before {
  content: "\f807";
}

.fa-hashtag:before {
  content: "\f292";
}

.fa-hat-cowboy:before {
  content: "\f8c0";
}

.fa-hat-cowboy-side:before {
  content: "\f8c1";
}

.fa-hat-wizard:before {
  content: "\f6e8";
}

.fa-hdd:before {
  content: "\f0a0";
}

.fa-head-side-cough:before {
  content: "\e061";
}

.fa-head-side-cough-slash:before {
  content: "\e062";
}

.fa-head-side-mask:before {
  content: "\e063";
}

.fa-head-side-virus:before {
  content: "\e064";
}

.fa-heading:before {
  content: "\f1dc";
}

.fa-headphones:before {
  content: "\f025";
}

.fa-headphones-alt:before {
  content: "\f58f";
}

.fa-headset:before {
  content: "\f590";
}

.fa-heart:before {
  content: "\f004";
}

.fa-heart-broken:before {
  content: "\f7a9";
}

.fa-heartbeat:before {
  content: "\f21e";
}

.fa-helicopter:before {
  content: "\f533";
}

.fa-highlighter:before {
  content: "\f591";
}

.fa-hiking:before {
  content: "\f6ec";
}

.fa-hippo:before {
  content: "\f6ed";
}

.fa-hips:before {
  content: "\f452";
}

.fa-hire-a-helper:before {
  content: "\f3b0";
}

.fa-history:before {
  content: "\f1da";
}

.fa-hive:before {
  content: "\e07f";
}

.fa-hockey-puck:before {
  content: "\f453";
}

.fa-holly-berry:before {
  content: "\f7aa";
}

.fa-home:before {
  content: "\f015";
}

.fa-hooli:before {
  content: "\f427";
}

.fa-hornbill:before {
  content: "\f592";
}

.fa-horse:before {
  content: "\f6f0";
}

.fa-horse-head:before {
  content: "\f7ab";
}

.fa-hospital:before {
  content: "\f0f8";
}

.fa-hospital-alt:before {
  content: "\f47d";
}

.fa-hospital-symbol:before {
  content: "\f47e";
}

.fa-hospital-user:before {
  content: "\f80d";
}

.fa-hot-tub:before {
  content: "\f593";
}

.fa-hotdog:before {
  content: "\f80f";
}

.fa-hotel:before {
  content: "\f594";
}

.fa-hotjar:before {
  content: "\f3b1";
}

.fa-hourglass:before {
  content: "\f254";
}

.fa-hourglass-end:before {
  content: "\f253";
}

.fa-hourglass-half:before {
  content: "\f252";
}

.fa-hourglass-start:before {
  content: "\f251";
}

.fa-house-damage:before {
  content: "\f6f1";
}

.fa-house-user:before {
  content: "\e065";
}

.fa-houzz:before {
  content: "\f27c";
}

.fa-hryvnia:before {
  content: "\f6f2";
}

.fa-html5:before {
  content: "\f13b";
}

.fa-hubspot:before {
  content: "\f3b2";
}

.fa-i-cursor:before {
  content: "\f246";
}

.fa-ice-cream:before {
  content: "\f810";
}

.fa-icicles:before {
  content: "\f7ad";
}

.fa-icons:before {
  content: "\f86d";
}

.fa-id-badge:before {
  content: "\f2c1";
}

.fa-id-card:before {
  content: "\f2c2";
}

.fa-id-card-alt:before {
  content: "\f47f";
}

.fa-ideal:before {
  content: "\e013";
}

.fa-igloo:before {
  content: "\f7ae";
}

.fa-image:before {
  content: "\f03e";
}

.fa-images:before {
  content: "\f302";
}

.fa-imdb:before {
  content: "\f2d8";
}

.fa-inbox:before {
  content: "\f01c";
}

.fa-indent:before {
  content: "\f03c";
}

.fa-industry:before {
  content: "\f275";
}

.fa-infinity:before {
  content: "\f534";
}

.fa-info:before {
  content: "\f129";
}

.fa-info-circle:before {
  content: "\f05a";
}

.fa-innosoft:before {
  content: "\e080";
}

.fa-instagram:before {
  content: "\f16d";
}

.fa-instagram-square:before {
  content: "\e055";
}

.fa-instalod:before {
  content: "\e081";
}

.fa-intercom:before {
  content: "\f7af";
}

.fa-internet-explorer:before {
  content: "\f26b";
}

.fa-invision:before {
  content: "\f7b0";
}

.fa-ioxhost:before {
  content: "\f208";
}

.fa-italic:before {
  content: "\f033";
}

.fa-itch-io:before {
  content: "\f83a";
}

.fa-itunes:before {
  content: "\f3b4";
}

.fa-itunes-note:before {
  content: "\f3b5";
}

.fa-java:before {
  content: "\f4e4";
}

.fa-jedi:before {
  content: "\f669";
}

.fa-jedi-order:before {
  content: "\f50e";
}

.fa-jenkins:before {
  content: "\f3b6";
}

.fa-jira:before {
  content: "\f7b1";
}

.fa-joget:before {
  content: "\f3b7";
}

.fa-joint:before {
  content: "\f595";
}

.fa-joomla:before {
  content: "\f1aa";
}

.fa-journal-whills:before {
  content: "\f66a";
}

.fa-js:before {
  content: "\f3b8";
}

.fa-js-square:before {
  content: "\f3b9";
}

.fa-jsfiddle:before {
  content: "\f1cc";
}

.fa-kaaba:before {
  content: "\f66b";
}

.fa-kaggle:before {
  content: "\f5fa";
}

.fa-key:before {
  content: "\f084";
}

.fa-keybase:before {
  content: "\f4f5";
}

.fa-keyboard:before {
  content: "\f11c";
}

.fa-keycdn:before {
  content: "\f3ba";
}

.fa-khanda:before {
  content: "\f66d";
}

.fa-kickstarter:before {
  content: "\f3bb";
}

.fa-kickstarter-k:before {
  content: "\f3bc";
}

.fa-kiss:before {
  content: "\f596";
}

.fa-kiss-beam:before {
  content: "\f597";
}

.fa-kiss-wink-heart:before {
  content: "\f598";
}

.fa-kiwi-bird:before {
  content: "\f535";
}

.fa-korvue:before {
  content: "\f42f";
}

.fa-landmark:before {
  content: "\f66f";
}

.fa-language:before {
  content: "\f1ab";
}

.fa-laptop:before {
  content: "\f109";
}

.fa-laptop-code:before {
  content: "\f5fc";
}

.fa-laptop-house:before {
  content: "\e066";
}

.fa-laptop-medical:before {
  content: "\f812";
}

.fa-laravel:before {
  content: "\f3bd";
}

.fa-lastfm:before {
  content: "\f202";
}

.fa-lastfm-square:before {
  content: "\f203";
}

.fa-laugh:before {
  content: "\f599";
}

.fa-laugh-beam:before {
  content: "\f59a";
}

.fa-laugh-squint:before {
  content: "\f59b";
}

.fa-laugh-wink:before {
  content: "\f59c";
}

.fa-layer-group:before {
  content: "\f5fd";
}

.fa-leaf:before {
  content: "\f06c";
}

.fa-leanpub:before {
  content: "\f212";
}

.fa-lemon:before {
  content: "\f094";
}

.fa-less:before {
  content: "\f41d";
}

.fa-less-than:before {
  content: "\f536";
}

.fa-less-than-equal:before {
  content: "\f537";
}

.fa-level-down-alt:before {
  content: "\f3be";
}

.fa-level-up-alt:before {
  content: "\f3bf";
}

.fa-life-ring:before {
  content: "\f1cd";
}

.fa-lightbulb:before {
  content: "\f0eb";
}

.fa-line:before {
  content: "\f3c0";
}

.fa-link:before {
  content: "\f0c1";
}

.fa-linkedin:before {
  content: "\f08c";
}

.fa-linkedin-in:before {
  content: "\f0e1";
}

.fa-linode:before {
  content: "\f2b8";
}

.fa-linux:before {
  content: "\f17c";
}

.fa-lira-sign:before {
  content: "\f195";
}

.fa-list:before {
  content: "\f03a";
}

.fa-list-alt:before {
  content: "\f022";
}

.fa-list-ol:before {
  content: "\f0cb";
}

.fa-list-ul:before {
  content: "\f0ca";
}

.fa-location-arrow:before {
  content: "\f124";
}

.fa-lock:before {
  content: "\f023";
}

.fa-lock-open:before {
  content: "\f3c1";
}

.fa-long-arrow-alt-down:before {
  content: "\f309";
}

.fa-long-arrow-alt-left:before {
  content: "\f30a";
}

.fa-long-arrow-alt-right:before {
  content: "\f30b";
}

.fa-long-arrow-alt-up:before {
  content: "\f30c";
}

.fa-low-vision:before {
  content: "\f2a8";
}

.fa-luggage-cart:before {
  content: "\f59d";
}

.fa-lungs:before {
  content: "\f604";
}

.fa-lungs-virus:before {
  content: "\e067";
}

.fa-lyft:before {
  content: "\f3c3";
}

.fa-magento:before {
  content: "\f3c4";
}

.fa-magic:before {
  content: "\f0d0";
}

.fa-magnet:before {
  content: "\f076";
}

.fa-mail-bulk:before {
  content: "\f674";
}

.fa-mailchimp:before {
  content: "\f59e";
}

.fa-male:before {
  content: "\f183";
}

.fa-mandalorian:before {
  content: "\f50f";
}

.fa-map:before {
  content: "\f279";
}

.fa-map-marked:before {
  content: "\f59f";
}

.fa-map-marked-alt:before {
  content: "\f5a0";
}

.fa-map-marker:before {
  content: "\f041";
}

.fa-map-marker-alt:before {
  content: "\f3c5";
}

.fa-map-pin:before {
  content: "\f276";
}

.fa-map-signs:before {
  content: "\f277";
}

.fa-markdown:before {
  content: "\f60f";
}

.fa-marker:before {
  content: "\f5a1";
}

.fa-mars:before {
  content: "\f222";
}

.fa-mars-double:before {
  content: "\f227";
}

.fa-mars-stroke:before {
  content: "\f229";
}

.fa-mars-stroke-h:before {
  content: "\f22b";
}

.fa-mars-stroke-v:before {
  content: "\f22a";
}

.fa-mask:before {
  content: "\f6fa";
}

.fa-mastodon:before {
  content: "\f4f6";
}

.fa-maxcdn:before {
  content: "\f136";
}

.fa-mdb:before {
  content: "\f8ca";
}

.fa-medal:before {
  content: "\f5a2";
}

.fa-medapps:before {
  content: "\f3c6";
}

.fa-medium:before {
  content: "\f23a";
}

.fa-medium-m:before {
  content: "\f3c7";
}

.fa-medkit:before {
  content: "\f0fa";
}

.fa-medrt:before {
  content: "\f3c8";
}

.fa-meetup:before {
  content: "\f2e0";
}

.fa-megaport:before {
  content: "\f5a3";
}

.fa-meh:before {
  content: "\f11a";
}

.fa-meh-blank:before {
  content: "\f5a4";
}

.fa-meh-rolling-eyes:before {
  content: "\f5a5";
}

.fa-memory:before {
  content: "\f538";
}

.fa-mendeley:before {
  content: "\f7b3";
}

.fa-menorah:before {
  content: "\f676";
}

.fa-mercury:before {
  content: "\f223";
}

.fa-meteor:before {
  content: "\f753";
}

.fa-microblog:before {
  content: "\e01a";
}

.fa-microchip:before {
  content: "\f2db";
}

.fa-microphone:before {
  content: "\f130";
}

.fa-microphone-alt:before {
  content: "\f3c9";
}

.fa-microphone-alt-slash:before {
  content: "\f539";
}

.fa-microphone-slash:before {
  content: "\f131";
}

.fa-microscope:before {
  content: "\f610";
}

.fa-microsoft:before {
  content: "\f3ca";
}

.fa-minus:before {
  content: "\f068";
}

.fa-minus-circle:before {
  content: "\f056";
}

.fa-minus-square:before {
  content: "\f146";
}

.fa-mitten:before {
  content: "\f7b5";
}

.fa-mix:before {
  content: "\f3cb";
}

.fa-mixcloud:before {
  content: "\f289";
}

.fa-mixer:before {
  content: "\e056";
}

.fa-mizuni:before {
  content: "\f3cc";
}

.fa-mobile:before {
  content: "\f10b";
}

.fa-mobile-alt:before {
  content: "\f3cd";
}

.fa-modx:before {
  content: "\f285";
}

.fa-monero:before {
  content: "\f3d0";
}

.fa-money-bill:before {
  content: "\f0d6";
}

.fa-money-bill-alt:before {
  content: "\f3d1";
}

.fa-money-bill-wave:before {
  content: "\f53a";
}

.fa-money-bill-wave-alt:before {
  content: "\f53b";
}

.fa-money-check:before {
  content: "\f53c";
}

.fa-money-check-alt:before {
  content: "\f53d";
}

.fa-monument:before {
  content: "\f5a6";
}

.fa-moon:before {
  content: "\f186";
}

.fa-mortar-pestle:before {
  content: "\f5a7";
}

.fa-mosque:before {
  content: "\f678";
}

.fa-motorcycle:before {
  content: "\f21c";
}

.fa-mountain:before {
  content: "\f6fc";
}

.fa-mouse:before {
  content: "\f8cc";
}

.fa-mouse-pointer:before {
  content: "\f245";
}

.fa-mug-hot:before {
  content: "\f7b6";
}

.fa-music:before {
  content: "\f001";
}

.fa-napster:before {
  content: "\f3d2";
}

.fa-neos:before {
  content: "\f612";
}

.fa-network-wired:before {
  content: "\f6ff";
}

.fa-neuter:before {
  content: "\f22c";
}

.fa-newspaper:before {
  content: "\f1ea";
}

.fa-nimblr:before {
  content: "\f5a8";
}

.fa-node:before {
  content: "\f419";
}

.fa-node-js:before {
  content: "\f3d3";
}

.fa-not-equal:before {
  content: "\f53e";
}

.fa-notes-medical:before {
  content: "\f481";
}

.fa-npm:before {
  content: "\f3d4";
}

.fa-ns8:before {
  content: "\f3d5";
}

.fa-nutritionix:before {
  content: "\f3d6";
}

.fa-object-group:before {
  content: "\f247";
}

.fa-object-ungroup:before {
  content: "\f248";
}

.fa-octopus-deploy:before {
  content: "\e082";
}

.fa-odnoklassniki:before {
  content: "\f263";
}

.fa-odnoklassniki-square:before {
  content: "\f264";
}

.fa-oil-can:before {
  content: "\f613";
}

.fa-old-republic:before {
  content: "\f510";
}

.fa-om:before {
  content: "\f679";
}

.fa-opencart:before {
  content: "\f23d";
}

.fa-openid:before {
  content: "\f19b";
}

.fa-opera:before {
  content: "\f26a";
}

.fa-optin-monster:before {
  content: "\f23c";
}

.fa-orcid:before {
  content: "\f8d2";
}

.fa-osi:before {
  content: "\f41a";
}

.fa-otter:before {
  content: "\f700";
}

.fa-outdent:before {
  content: "\f03b";
}

.fa-page4:before {
  content: "\f3d7";
}

.fa-pagelines:before {
  content: "\f18c";
}

.fa-pager:before {
  content: "\f815";
}

.fa-paint-brush:before {
  content: "\f1fc";
}

.fa-paint-roller:before {
  content: "\f5aa";
}

.fa-palette:before {
  content: "\f53f";
}

.fa-palfed:before {
  content: "\f3d8";
}

.fa-pallet:before {
  content: "\f482";
}

.fa-paper-plane:before {
  content: "\f1d8";
}

.fa-paperclip:before {
  content: "\f0c6";
}

.fa-parachute-box:before {
  content: "\f4cd";
}

.fa-paragraph:before {
  content: "\f1dd";
}

.fa-parking:before {
  content: "\f540";
}

.fa-passport:before {
  content: "\f5ab";
}

.fa-pastafarianism:before {
  content: "\f67b";
}

.fa-paste:before {
  content: "\f0ea";
}

.fa-patreon:before {
  content: "\f3d9";
}

.fa-pause:before {
  content: "\f04c";
}

.fa-pause-circle:before {
  content: "\f28b";
}

.fa-paw:before {
  content: "\f1b0";
}

.fa-paypal:before {
  content: "\f1ed";
}

.fa-peace:before {
  content: "\f67c";
}

.fa-pen:before {
  content: "\f304";
}

.fa-pen-alt:before {
  content: "\f305";
}

.fa-pen-fancy:before {
  content: "\f5ac";
}

.fa-pen-nib:before {
  content: "\f5ad";
}

.fa-pen-square:before {
  content: "\f14b";
}

.fa-pencil-alt:before {
  content: "\f303";
}

.fa-pencil-ruler:before {
  content: "\f5ae";
}

.fa-penny-arcade:before {
  content: "\f704";
}

.fa-people-arrows:before {
  content: "\e068";
}

.fa-people-carry:before {
  content: "\f4ce";
}

.fa-pepper-hot:before {
  content: "\f816";
}

.fa-perbyte:before {
  content: "\e083";
}

.fa-percent:before {
  content: "\f295";
}

.fa-percentage:before {
  content: "\f541";
}

.fa-periscope:before {
  content: "\f3da";
}

.fa-person-booth:before {
  content: "\f756";
}

.fa-phabricator:before {
  content: "\f3db";
}

.fa-phoenix-framework:before {
  content: "\f3dc";
}

.fa-phoenix-squadron:before {
  content: "\f511";
}

.fa-phone:before {
  content: "\f095";
}

.fa-phone-alt:before {
  content: "\f879";
}

.fa-phone-slash:before {
  content: "\f3dd";
}

.fa-phone-square:before {
  content: "\f098";
}

.fa-phone-square-alt:before {
  content: "\f87b";
}

.fa-phone-volume:before {
  content: "\f2a0";
}

.fa-photo-video:before {
  content: "\f87c";
}

.fa-php:before {
  content: "\f457";
}

.fa-pied-piper:before {
  content: "\f2ae";
}

.fa-pied-piper-alt:before {
  content: "\f1a8";
}

.fa-pied-piper-hat:before {
  content: "\f4e5";
}

.fa-pied-piper-pp:before {
  content: "\f1a7";
}

.fa-pied-piper-square:before {
  content: "\e01e";
}

.fa-piggy-bank:before {
  content: "\f4d3";
}

.fa-pills:before {
  content: "\f484";
}

.fa-pinterest:before {
  content: "\f0d2";
}

.fa-pinterest-p:before {
  content: "\f231";
}

.fa-pinterest-square:before {
  content: "\f0d3";
}

.fa-pizza-slice:before {
  content: "\f818";
}

.fa-place-of-worship:before {
  content: "\f67f";
}

.fa-plane:before {
  content: "\f072";
}

.fa-plane-arrival:before {
  content: "\f5af";
}

.fa-plane-departure:before {
  content: "\f5b0";
}

.fa-plane-slash:before {
  content: "\e069";
}

.fa-play:before {
  content: "\f04b";
}

.fa-play-circle:before {
  content: "\f144";
}

.fa-playstation:before {
  content: "\f3df";
}

.fa-plug:before {
  content: "\f1e6";
}

.fa-plus:before {
  content: "\f067";
}

.fa-plus-circle:before {
  content: "\f055";
}

.fa-plus-square:before {
  content: "\f0fe";
}

.fa-podcast:before {
  content: "\f2ce";
}

.fa-poll:before {
  content: "\f681";
}

.fa-poll-h:before {
  content: "\f682";
}

.fa-poo:before {
  content: "\f2fe";
}

.fa-poo-storm:before {
  content: "\f75a";
}

.fa-poop:before {
  content: "\f619";
}

.fa-portrait:before {
  content: "\f3e0";
}

.fa-pound-sign:before {
  content: "\f154";
}

.fa-power-off:before {
  content: "\f011";
}

.fa-pray:before {
  content: "\f683";
}

.fa-praying-hands:before {
  content: "\f684";
}

.fa-prescription:before {
  content: "\f5b1";
}

.fa-prescription-bottle:before {
  content: "\f485";
}

.fa-prescription-bottle-alt:before {
  content: "\f486";
}

.fa-print:before {
  content: "\f02f";
}

.fa-procedures:before {
  content: "\f487";
}

.fa-product-hunt:before {
  content: "\f288";
}

.fa-project-diagram:before {
  content: "\f542";
}

.fa-pump-medical:before {
  content: "\e06a";
}

.fa-pump-soap:before {
  content: "\e06b";
}

.fa-pushed:before {
  content: "\f3e1";
}

.fa-puzzle-piece:before {
  content: "\f12e";
}

.fa-python:before {
  content: "\f3e2";
}

.fa-qq:before {
  content: "\f1d6";
}

.fa-qrcode:before {
  content: "\f029";
}

.fa-question:before {
  content: "\f128";
}

.fa-question-circle:before {
  content: "\f059";
}

.fa-quidditch:before {
  content: "\f458";
}

.fa-quinscape:before {
  content: "\f459";
}

.fa-quora:before {
  content: "\f2c4";
}

.fa-quote-left:before {
  content: "\f10d";
}

.fa-quote-right:before {
  content: "\f10e";
}

.fa-quran:before {
  content: "\f687";
}

.fa-r-project:before {
  content: "\f4f7";
}

.fa-radiation:before {
  content: "\f7b9";
}

.fa-radiation-alt:before {
  content: "\f7ba";
}

.fa-rainbow:before {
  content: "\f75b";
}

.fa-random:before {
  content: "\f074";
}

.fa-raspberry-pi:before {
  content: "\f7bb";
}

.fa-ravelry:before {
  content: "\f2d9";
}

.fa-react:before {
  content: "\f41b";
}

.fa-reacteurope:before {
  content: "\f75d";
}

.fa-readme:before {
  content: "\f4d5";
}

.fa-rebel:before {
  content: "\f1d0";
}

.fa-receipt:before {
  content: "\f543";
}

.fa-record-vinyl:before {
  content: "\f8d9";
}

.fa-recycle:before {
  content: "\f1b8";
}

.fa-red-river:before {
  content: "\f3e3";
}

.fa-reddit:before {
  content: "\f1a1";
}

.fa-reddit-alien:before {
  content: "\f281";
}

.fa-reddit-square:before {
  content: "\f1a2";
}

.fa-redhat:before {
  content: "\f7bc";
}

.fa-redo:before {
  content: "\f01e";
}

.fa-redo-alt:before {
  content: "\f2f9";
}

.fa-registered:before {
  content: "\f25d";
}

.fa-remove-format:before {
  content: "\f87d";
}

.fa-renren:before {
  content: "\f18b";
}

.fa-reply:before {
  content: "\f3e5";
}

.fa-reply-all:before {
  content: "\f122";
}

.fa-replyd:before {
  content: "\f3e6";
}

.fa-republican:before {
  content: "\f75e";
}

.fa-researchgate:before {
  content: "\f4f8";
}

.fa-resolving:before {
  content: "\f3e7";
}

.fa-restroom:before {
  content: "\f7bd";
}

.fa-retweet:before {
  content: "\f079";
}

.fa-rev:before {
  content: "\f5b2";
}

.fa-ribbon:before {
  content: "\f4d6";
}

.fa-ring:before {
  content: "\f70b";
}

.fa-road:before {
  content: "\f018";
}

.fa-robot:before {
  content: "\f544";
}

.fa-rocket:before {
  content: "\f135";
}

.fa-rocketchat:before {
  content: "\f3e8";
}

.fa-rockrms:before {
  content: "\f3e9";
}

.fa-route:before {
  content: "\f4d7";
}

.fa-rss:before {
  content: "\f09e";
}

.fa-rss-square:before {
  content: "\f143";
}

.fa-ruble-sign:before {
  content: "\f158";
}

.fa-ruler:before {
  content: "\f545";
}

.fa-ruler-combined:before {
  content: "\f546";
}

.fa-ruler-horizontal:before {
  content: "\f547";
}

.fa-ruler-vertical:before {
  content: "\f548";
}

.fa-running:before {
  content: "\f70c";
}

.fa-rupee-sign:before {
  content: "\f156";
}

.fa-rust:before {
  content: "\e07a";
}

.fa-sad-cry:before {
  content: "\f5b3";
}

.fa-sad-tear:before {
  content: "\f5b4";
}

.fa-safari:before {
  content: "\f267";
}

.fa-salesforce:before {
  content: "\f83b";
}

.fa-sass:before {
  content: "\f41e";
}

.fa-satellite:before {
  content: "\f7bf";
}

.fa-satellite-dish:before {
  content: "\f7c0";
}

.fa-save:before {
  content: "\f0c7";
}

.fa-schlix:before {
  content: "\f3ea";
}

.fa-school:before {
  content: "\f549";
}

.fa-screwdriver:before {
  content: "\f54a";
}

.fa-scribd:before {
  content: "\f28a";
}

.fa-scroll:before {
  content: "\f70e";
}

.fa-sd-card:before {
  content: "\f7c2";
}

.fa-search:before {
  content: "\f002";
}

.fa-search-dollar:before {
  content: "\f688";
}

.fa-search-location:before {
  content: "\f689";
}

.fa-search-minus:before {
  content: "\f010";
}

.fa-search-plus:before {
  content: "\f00e";
}

.fa-searchengin:before {
  content: "\f3eb";
}

.fa-seedling:before {
  content: "\f4d8";
}

.fa-sellcast:before {
  content: "\f2da";
}

.fa-sellsy:before {
  content: "\f213";
}

.fa-server:before {
  content: "\f233";
}

.fa-servicestack:before {
  content: "\f3ec";
}

.fa-shapes:before {
  content: "\f61f";
}

.fa-share:before {
  content: "\f064";
}

.fa-share-alt:before {
  content: "\f1e0";
}

.fa-share-alt-square:before {
  content: "\f1e1";
}

.fa-share-square:before {
  content: "\f14d";
}

.fa-shekel-sign:before {
  content: "\f20b";
}

.fa-shield-alt:before {
  content: "\f3ed";
}

.fa-shield-virus:before {
  content: "\e06c";
}

.fa-ship:before {
  content: "\f21a";
}

.fa-shipping-fast:before {
  content: "\f48b";
}

.fa-shirtsinbulk:before {
  content: "\f214";
}

.fa-shoe-prints:before {
  content: "\f54b";
}

.fa-shopify:before {
  content: "\e057";
}

.fa-shopping-bag:before {
  content: "\f290";
}

.fa-shopping-basket:before {
  content: "\f291";
}

.fa-shopping-cart:before {
  content: "\f07a";
}

.fa-shopware:before {
  content: "\f5b5";
}

.fa-shower:before {
  content: "\f2cc";
}

.fa-shuttle-van:before {
  content: "\f5b6";
}

.fa-sign:before {
  content: "\f4d9";
}

.fa-sign-in-alt:before {
  content: "\f2f6";
}

.fa-sign-language:before {
  content: "\f2a7";
}

.fa-sign-out-alt:before {
  content: "\f2f5";
}

.fa-signal:before {
  content: "\f012";
}

.fa-signature:before {
  content: "\f5b7";
}

.fa-sim-card:before {
  content: "\f7c4";
}

.fa-simplybuilt:before {
  content: "\f215";
}

.fa-sink:before {
  content: "\e06d";
}

.fa-sistrix:before {
  content: "\f3ee";
}

.fa-sitemap:before {
  content: "\f0e8";
}

.fa-sith:before {
  content: "\f512";
}

.fa-skating:before {
  content: "\f7c5";
}

.fa-sketch:before {
  content: "\f7c6";
}

.fa-skiing:before {
  content: "\f7c9";
}

.fa-skiing-nordic:before {
  content: "\f7ca";
}

.fa-skull:before {
  content: "\f54c";
}

.fa-skull-crossbones:before {
  content: "\f714";
}

.fa-skyatlas:before {
  content: "\f216";
}

.fa-skype:before {
  content: "\f17e";
}

.fa-slack:before {
  content: "\f198";
}

.fa-slack-hash:before {
  content: "\f3ef";
}

.fa-slash:before {
  content: "\f715";
}

.fa-sleigh:before {
  content: "\f7cc";
}

.fa-sliders-h:before {
  content: "\f1de";
}

.fa-slideshare:before {
  content: "\f1e7";
}

.fa-smile:before {
  content: "\f118";
}

.fa-smile-beam:before {
  content: "\f5b8";
}

.fa-smile-wink:before {
  content: "\f4da";
}

.fa-smog:before {
  content: "\f75f";
}

.fa-smoking:before {
  content: "\f48d";
}

.fa-smoking-ban:before {
  content: "\f54d";
}

.fa-sms:before {
  content: "\f7cd";
}

.fa-snapchat:before {
  content: "\f2ab";
}

.fa-snapchat-ghost:before {
  content: "\f2ac";
}

.fa-snapchat-square:before {
  content: "\f2ad";
}

.fa-snowboarding:before {
  content: "\f7ce";
}

.fa-snowflake:before {
  content: "\f2dc";
}

.fa-snowman:before {
  content: "\f7d0";
}

.fa-snowplow:before {
  content: "\f7d2";
}

.fa-soap:before {
  content: "\e06e";
}

.fa-socks:before {
  content: "\f696";
}

.fa-solar-panel:before {
  content: "\f5ba";
}

.fa-sort:before {
  content: "\f0dc";
}

.fa-sort-alpha-down:before {
  content: "\f15d";
}

.fa-sort-alpha-down-alt:before {
  content: "\f881";
}

.fa-sort-alpha-up:before {
  content: "\f15e";
}

.fa-sort-alpha-up-alt:before {
  content: "\f882";
}

.fa-sort-amount-down:before {
  content: "\f160";
}

.fa-sort-amount-down-alt:before {
  content: "\f884";
}

.fa-sort-amount-up:before {
  content: "\f161";
}

.fa-sort-amount-up-alt:before {
  content: "\f885";
}

.fa-sort-down:before {
  content: "\f0dd";
}

.fa-sort-numeric-down:before {
  content: "\f162";
}

.fa-sort-numeric-down-alt:before {
  content: "\f886";
}

.fa-sort-numeric-up:before {
  content: "\f163";
}

.fa-sort-numeric-up-alt:before {
  content: "\f887";
}

.fa-sort-up:before {
  content: "\f0de";
}

.fa-soundcloud:before {
  content: "\f1be";
}

.fa-sourcetree:before {
  content: "\f7d3";
}

.fa-spa:before {
  content: "\f5bb";
}

.fa-space-shuttle:before {
  content: "\f197";
}

.fa-speakap:before {
  content: "\f3f3";
}

.fa-speaker-deck:before {
  content: "\f83c";
}

.fa-spell-check:before {
  content: "\f891";
}

.fa-spider:before {
  content: "\f717";
}

.fa-spinner:before {
  content: "\f110";
}

.fa-splotch:before {
  content: "\f5bc";
}

.fa-spotify:before {
  content: "\f1bc";
}

.fa-spray-can:before {
  content: "\f5bd";
}

.fa-square:before {
  content: "\f0c8";
}

.fa-square-full:before {
  content: "\f45c";
}

.fa-square-root-alt:before {
  content: "\f698";
}

.fa-squarespace:before {
  content: "\f5be";
}

.fa-stack-exchange:before {
  content: "\f18d";
}

.fa-stack-overflow:before {
  content: "\f16c";
}

.fa-stackpath:before {
  content: "\f842";
}

.fa-stamp:before {
  content: "\f5bf";
}

.fa-star:before {
  content: "\f005";
}

.fa-star-and-crescent:before {
  content: "\f699";
}

.fa-star-half:before {
  content: "\f089";
}

.fa-star-half-alt:before {
  content: "\f5c0";
}

.fa-star-of-david:before {
  content: "\f69a";
}

.fa-star-of-life:before {
  content: "\f621";
}

.fa-staylinked:before {
  content: "\f3f5";
}

.fa-steam:before {
  content: "\f1b6";
}

.fa-steam-square:before {
  content: "\f1b7";
}

.fa-steam-symbol:before {
  content: "\f3f6";
}

.fa-step-backward:before {
  content: "\f048";
}

.fa-step-forward:before {
  content: "\f051";
}

.fa-stethoscope:before {
  content: "\f0f1";
}

.fa-sticker-mule:before {
  content: "\f3f7";
}

.fa-sticky-note:before {
  content: "\f249";
}

.fa-stop:before {
  content: "\f04d";
}

.fa-stop-circle:before {
  content: "\f28d";
}

.fa-stopwatch:before {
  content: "\f2f2";
}

.fa-stopwatch-20:before {
  content: "\e06f";
}

.fa-store:before {
  content: "\f54e";
}

.fa-store-alt:before {
  content: "\f54f";
}

.fa-store-alt-slash:before {
  content: "\e070";
}

.fa-store-slash:before {
  content: "\e071";
}

.fa-strava:before {
  content: "\f428";
}

.fa-stream:before {
  content: "\f550";
}

.fa-street-view:before {
  content: "\f21d";
}

.fa-strikethrough:before {
  content: "\f0cc";
}

.fa-stripe:before {
  content: "\f429";
}

.fa-stripe-s:before {
  content: "\f42a";
}

.fa-stroopwafel:before {
  content: "\f551";
}

.fa-studiovinari:before {
  content: "\f3f8";
}

.fa-stumbleupon:before {
  content: "\f1a4";
}

.fa-stumbleupon-circle:before {
  content: "\f1a3";
}

.fa-subscript:before {
  content: "\f12c";
}

.fa-subway:before {
  content: "\f239";
}

.fa-suitcase:before {
  content: "\f0f2";
}

.fa-suitcase-rolling:before {
  content: "\f5c1";
}

.fa-sun:before {
  content: "\f185";
}

.fa-superpowers:before {
  content: "\f2dd";
}

.fa-superscript:before {
  content: "\f12b";
}

.fa-supple:before {
  content: "\f3f9";
}

.fa-surprise:before {
  content: "\f5c2";
}

.fa-suse:before {
  content: "\f7d6";
}

.fa-swatchbook:before {
  content: "\f5c3";
}

.fa-swift:before {
  content: "\f8e1";
}

.fa-swimmer:before {
  content: "\f5c4";
}

.fa-swimming-pool:before {
  content: "\f5c5";
}

.fa-symfony:before {
  content: "\f83d";
}

.fa-synagogue:before {
  content: "\f69b";
}

.fa-sync:before {
  content: "\f021";
}

.fa-sync-alt:before {
  content: "\f2f1";
}

.fa-syringe:before {
  content: "\f48e";
}

.fa-table:before {
  content: "\f0ce";
}

.fa-table-tennis:before {
  content: "\f45d";
}

.fa-tablet:before {
  content: "\f10a";
}

.fa-tablet-alt:before {
  content: "\f3fa";
}

.fa-tablets:before {
  content: "\f490";
}

.fa-tachometer-alt:before {
  content: "\f3fd";
}

.fa-tag:before {
  content: "\f02b";
}

.fa-tags:before {
  content: "\f02c";
}

.fa-tape:before {
  content: "\f4db";
}

.fa-tasks:before {
  content: "\f0ae";
}

.fa-taxi:before {
  content: "\f1ba";
}

.fa-teamspeak:before {
  content: "\f4f9";
}

.fa-teeth:before {
  content: "\f62e";
}

.fa-teeth-open:before {
  content: "\f62f";
}

.fa-telegram:before {
  content: "\f2c6";
}

.fa-telegram-plane:before {
  content: "\f3fe";
}

.fa-temperature-high:before {
  content: "\f769";
}

.fa-temperature-low:before {
  content: "\f76b";
}

.fa-tencent-weibo:before {
  content: "\f1d5";
}

.fa-tenge:before {
  content: "\f7d7";
}

.fa-terminal:before {
  content: "\f120";
}

.fa-text-height:before {
  content: "\f034";
}

.fa-text-width:before {
  content: "\f035";
}

.fa-th:before {
  content: "\f00a";
}

.fa-th-large:before {
  content: "\f009";
}

.fa-th-list:before {
  content: "\f00b";
}

.fa-the-red-yeti:before {
  content: "\f69d";
}

.fa-theater-masks:before {
  content: "\f630";
}

.fa-themeco:before {
  content: "\f5c6";
}

.fa-themeisle:before {
  content: "\f2b2";
}

.fa-thermometer:before {
  content: "\f491";
}

.fa-thermometer-empty:before {
  content: "\f2cb";
}

.fa-thermometer-full:before {
  content: "\f2c7";
}

.fa-thermometer-half:before {
  content: "\f2c9";
}

.fa-thermometer-quarter:before {
  content: "\f2ca";
}

.fa-thermometer-three-quarters:before {
  content: "\f2c8";
}

.fa-think-peaks:before {
  content: "\f731";
}

.fa-thumbs-down:before {
  content: "\f165";
}

.fa-thumbs-up:before {
  content: "\f164";
}

.fa-thumbtack:before {
  content: "\f08d";
}

.fa-ticket-alt:before {
  content: "\f3ff";
}

.fa-tiktok:before {
  content: "\e07b";
}

.fa-times:before {
  content: "\f00d";
}

.fa-times-circle:before {
  content: "\f057";
}

.fa-tint:before {
  content: "\f043";
}

.fa-tint-slash:before {
  content: "\f5c7";
}

.fa-tired:before {
  content: "\f5c8";
}

.fa-toggle-off:before {
  content: "\f204";
}

.fa-toggle-on:before {
  content: "\f205";
}

.fa-toilet:before {
  content: "\f7d8";
}

.fa-toilet-paper:before {
  content: "\f71e";
}

.fa-toilet-paper-slash:before {
  content: "\e072";
}

.fa-toolbox:before {
  content: "\f552";
}

.fa-tools:before {
  content: "\f7d9";
}

.fa-tooth:before {
  content: "\f5c9";
}

.fa-torah:before {
  content: "\f6a0";
}

.fa-torii-gate:before {
  content: "\f6a1";
}

.fa-tractor:before {
  content: "\f722";
}

.fa-trade-federation:before {
  content: "\f513";
}

.fa-trademark:before {
  content: "\f25c";
}

.fa-traffic-light:before {
  content: "\f637";
}

.fa-trailer:before {
  content: "\e041";
}

.fa-train:before {
  content: "\f238";
}

.fa-tram:before {
  content: "\f7da";
}

.fa-transgender:before {
  content: "\f224";
}

.fa-transgender-alt:before {
  content: "\f225";
}

.fa-trash:before {
  content: "\f1f8";
}

.fa-trash-alt:before {
  content: "\f2ed";
}

.fa-trash-restore:before {
  content: "\f829";
}

.fa-trash-restore-alt:before {
  content: "\f82a";
}

.fa-tree:before {
  content: "\f1bb";
}

.fa-trello:before {
  content: "\f181";
}

.fa-tripadvisor:before {
  content: "\f262";
}

.fa-trophy:before {
  content: "\f091";
}

.fa-truck:before {
  content: "\f0d1";
}

.fa-truck-loading:before {
  content: "\f4de";
}

.fa-truck-monster:before {
  content: "\f63b";
}

.fa-truck-moving:before {
  content: "\f4df";
}

.fa-truck-pickup:before {
  content: "\f63c";
}

.fa-tshirt:before {
  content: "\f553";
}

.fa-tty:before {
  content: "\f1e4";
}

.fa-tumblr:before {
  content: "\f173";
}

.fa-tumblr-square:before {
  content: "\f174";
}

.fa-tv:before {
  content: "\f26c";
}

.fa-twitch:before {
  content: "\f1e8";
}

.fa-twitter:before {
  content: "\f099";
}

.fa-twitter-square:before {
  content: "\f081";
}

.fa-typo3:before {
  content: "\f42b";
}

.fa-uber:before {
  content: "\f402";
}

.fa-ubuntu:before {
  content: "\f7df";
}

.fa-uikit:before {
  content: "\f403";
}

.fa-umbraco:before {
  content: "\f8e8";
}

.fa-umbrella:before {
  content: "\f0e9";
}

.fa-umbrella-beach:before {
  content: "\f5ca";
}

.fa-uncharted:before {
  content: "\e084";
}

.fa-underline:before {
  content: "\f0cd";
}

.fa-undo:before {
  content: "\f0e2";
}

.fa-undo-alt:before {
  content: "\f2ea";
}

.fa-uniregistry:before {
  content: "\f404";
}

.fa-unity:before {
  content: "\e049";
}

.fa-universal-access:before {
  content: "\f29a";
}

.fa-university:before {
  content: "\f19c";
}

.fa-unlink:before {
  content: "\f127";
}

.fa-unlock:before {
  content: "\f09c";
}

.fa-unlock-alt:before {
  content: "\f13e";
}

.fa-unsplash:before {
  content: "\e07c";
}

.fa-untappd:before {
  content: "\f405";
}

.fa-upload:before {
  content: "\f093";
}

.fa-ups:before {
  content: "\f7e0";
}

.fa-usb:before {
  content: "\f287";
}

.fa-user:before {
  content: "\f007";
}

.fa-user-alt:before {
  content: "\f406";
}

.fa-user-alt-slash:before {
  content: "\f4fa";
}

.fa-user-astronaut:before {
  content: "\f4fb";
}

.fa-user-check:before {
  content: "\f4fc";
}

.fa-user-circle:before {
  content: "\f2bd";
}

.fa-user-clock:before {
  content: "\f4fd";
}

.fa-user-cog:before {
  content: "\f4fe";
}

.fa-user-edit:before {
  content: "\f4ff";
}

.fa-user-friends:before {
  content: "\f500";
}

.fa-user-graduate:before {
  content: "\f501";
}

.fa-user-injured:before {
  content: "\f728";
}

.fa-user-lock:before {
  content: "\f502";
}

.fa-user-md:before {
  content: "\f0f0";
}

.fa-user-minus:before {
  content: "\f503";
}

.fa-user-ninja:before {
  content: "\f504";
}

.fa-user-nurse:before {
  content: "\f82f";
}

.fa-user-plus:before {
  content: "\f234";
}

.fa-user-secret:before {
  content: "\f21b";
}

.fa-user-shield:before {
  content: "\f505";
}

.fa-user-slash:before {
  content: "\f506";
}

.fa-user-tag:before {
  content: "\f507";
}

.fa-user-tie:before {
  content: "\f508";
}

.fa-user-times:before {
  content: "\f235";
}

.fa-users:before {
  content: "\f0c0";
}

.fa-users-cog:before {
  content: "\f509";
}

.fa-users-slash:before {
  content: "\e073";
}

.fa-usps:before {
  content: "\f7e1";
}

.fa-ussunnah:before {
  content: "\f407";
}

.fa-utensil-spoon:before {
  content: "\f2e5";
}

.fa-utensils:before {
  content: "\f2e7";
}

.fa-vaadin:before {
  content: "\f408";
}

.fa-vector-square:before {
  content: "\f5cb";
}

.fa-venus:before {
  content: "\f221";
}

.fa-venus-double:before {
  content: "\f226";
}

.fa-venus-mars:before {
  content: "\f228";
}

.fa-vest:before {
  content: "\e085";
}

.fa-vest-patches:before {
  content: "\e086";
}

.fa-viacoin:before {
  content: "\f237";
}

.fa-viadeo:before {
  content: "\f2a9";
}

.fa-viadeo-square:before {
  content: "\f2aa";
}

.fa-vial:before {
  content: "\f492";
}

.fa-vials:before {
  content: "\f493";
}

.fa-viber:before {
  content: "\f409";
}

.fa-video:before {
  content: "\f03d";
}

.fa-video-slash:before {
  content: "\f4e2";
}

.fa-vihara:before {
  content: "\f6a7";
}

.fa-vimeo:before {
  content: "\f40a";
}

.fa-vimeo-square:before {
  content: "\f194";
}

.fa-vimeo-v:before {
  content: "\f27d";
}

.fa-vine:before {
  content: "\f1ca";
}

.fa-virus:before {
  content: "\e074";
}

.fa-virus-slash:before {
  content: "\e075";
}

.fa-viruses:before {
  content: "\e076";
}

.fa-vk:before {
  content: "\f189";
}

.fa-vnv:before {
  content: "\f40b";
}

.fa-voicemail:before {
  content: "\f897";
}

.fa-volleyball-ball:before {
  content: "\f45f";
}

.fa-volume-down:before {
  content: "\f027";
}

.fa-volume-mute:before {
  content: "\f6a9";
}

.fa-volume-off:before {
  content: "\f026";
}

.fa-volume-up:before {
  content: "\f028";
}

.fa-vote-yea:before {
  content: "\f772";
}

.fa-vr-cardboard:before {
  content: "\f729";
}

.fa-vuejs:before {
  content: "\f41f";
}

.fa-walking:before {
  content: "\f554";
}

.fa-wallet:before {
  content: "\f555";
}

.fa-warehouse:before {
  content: "\f494";
}

.fa-watchman-monitoring:before {
  content: "\e087";
}

.fa-water:before {
  content: "\f773";
}

.fa-wave-square:before {
  content: "\f83e";
}

.fa-waze:before {
  content: "\f83f";
}

.fa-weebly:before {
  content: "\f5cc";
}

.fa-weibo:before {
  content: "\f18a";
}

.fa-weight:before {
  content: "\f496";
}

.fa-weight-hanging:before {
  content: "\f5cd";
}

.fa-weixin:before {
  content: "\f1d7";
}

.fa-whatsapp:before {
  content: "\f232";
}

.fa-whatsapp-square:before {
  content: "\f40c";
}

.fa-wheelchair:before {
  content: "\f193";
}

.fa-whmcs:before {
  content: "\f40d";
}

.fa-wifi:before {
  content: "\f1eb";
}

.fa-wikipedia-w:before {
  content: "\f266";
}

.fa-wind:before {
  content: "\f72e";
}

.fa-window-close:before {
  content: "\f410";
}

.fa-window-maximize:before {
  content: "\f2d0";
}

.fa-window-minimize:before {
  content: "\f2d1";
}

.fa-window-restore:before {
  content: "\f2d2";
}

.fa-windows:before {
  content: "\f17a";
}

.fa-wine-bottle:before {
  content: "\f72f";
}

.fa-wine-glass:before {
  content: "\f4e3";
}

.fa-wine-glass-alt:before {
  content: "\f5ce";
}

.fa-wix:before {
  content: "\f5cf";
}

.fa-wizards-of-the-coast:before {
  content: "\f730";
}

.fa-wodu:before {
  content: "\e088";
}

.fa-wolf-pack-battalion:before {
  content: "\f514";
}

.fa-won-sign:before {
  content: "\f159";
}

.fa-wordpress:before {
  content: "\f19a";
}

.fa-wordpress-simple:before {
  content: "\f411";
}

.fa-wpbeginner:before {
  content: "\f297";
}

.fa-wpexplorer:before {
  content: "\f2de";
}

.fa-wpforms:before {
  content: "\f298";
}

.fa-wpressr:before {
  content: "\f3e4";
}

.fa-wrench:before {
  content: "\f0ad";
}

.fa-x-ray:before {
  content: "\f497";
}

.fa-xbox:before {
  content: "\f412";
}

.fa-xing:before {
  content: "\f168";
}

.fa-xing-square:before {
  content: "\f169";
}

.fa-y-combinator:before {
  content: "\f23b";
}

.fa-yahoo:before {
  content: "\f19e";
}

.fa-yammer:before {
  content: "\f840";
}

.fa-yandex:before {
  content: "\f413";
}

.fa-yandex-international:before {
  content: "\f414";
}

.fa-yarn:before {
  content: "\f7e3";
}

.fa-yelp:before {
  content: "\f1e9";
}

.fa-yen-sign:before {
  content: "\f157";
}

.fa-yin-yang:before {
  content: "\f6ad";
}

.fa-yoast:before {
  content: "\f2b1";
}

.fa-youtube:before {
  content: "\f167";
}

.fa-youtube-square:before {
  content: "\f431";
}

.fa-zhihu:before {
  content: "\f63f";
}

.fab {
  font-family: "FA Brands";
  font-weight: 400;
}

.far {
  font-family: "FA Free";
  font-weight: 400;
}

.fa,
.fas {
  font-family: "FA Free";
  font-weight: 900;
}

[class*=fe-] {
  
  font-family: "feathericon" !important;
  speak: none;
  font-style: normal;
  font-weight: normal;
  font-variant: normal;
  text-transform: none;
  line-height: 1;
  
  -webkit-font-smoothing: antialiased;
  -moz-osx-font-smoothing: grayscale;
}

.fe-activity:before {
  content: "\e900";
}

.fe-airplay:before {
  content: "\e901";
}

.fe-alert-circle:before {
  content: "\e902";
}

.fe-alert-octagon:before {
  content: "\e903";
}

.fe-alert-triangle:before {
  content: "\e904";
}

.fe-align-center:before {
  content: "\e905";
}

.fe-align-justify:before {
  content: "\e906";
}

.fe-align-left:before {
  content: "\e907";
}

.fe-align-right:before {
  content: "\e908";
}

.fe-anchor:before {
  content: "\e909";
}

.fe-aperture:before {
  content: "\e90a";
}

.fe-archive:before {
  content: "\e90b";
}

.fe-arrow-down:before {
  content: "\e90c";
}

.fe-arrow-down-circle:before {
  content: "\e90d";
}

.fe-arrow-down-left:before {
  content: "\e90e";
}

.fe-arrow-down-right:before {
  content: "\e90f";
}

.fe-arrow-left:before {
  content: "\e910";
}

.fe-arrow-left-circle:before {
  content: "\e911";
}

.fe-arrow-right:before {
  content: "\e912";
}

.fe-arrow-right-circle:before {
  content: "\e913";
}

.fe-arrow-up:before {
  content: "\e914";
}

.fe-arrow-up-circle:before {
  content: "\e915";
}

.fe-arrow-up-left:before {
  content: "\e916";
}

.fe-arrow-up-right:before {
  content: "\e917";
}

.fe-at-sign:before {
  content: "\e918";
}

.fe-award:before {
  content: "\e919";
}

.fe-bar-chart:before {
  content: "\e91a";
}

.fe-bar-chart-2:before {
  content: "\e91b";
}

.fe-battery:before {
  content: "\e91c";
}

.fe-battery-charging:before {
  content: "\e91d";
}

.fe-bell:before {
  content: "\e91e";
}

.fe-bell-off:before {
  content: "\e91f";
}

.fe-bluetooth:before {
  content: "\e920";
}

.fe-bold:before {
  content: "\e921";
}

.fe-book:before {
  content: "\e922";
}

.fe-book-open:before {
  content: "\e923";
}

.fe-bookmark:before {
  content: "\e924";
}

.fe-box:before {
  content: "\e925";
}

.fe-briefcase:before {
  content: "\e926";
}

.fe-calendar:before {
  content: "\e927";
}

.fe-camera:before {
  content: "\e928";
}

.fe-camera-off:before {
  content: "\e929";
}

.fe-cast:before {
  content: "\e92a";
}

.fe-check:before {
  content: "\e92b";
}

.fe-check-circle:before {
  content: "\e92c";
}

.fe-check-square:before {
  content: "\e92d";
}

.fe-chevron-down:before {
  content: "\e92e";
}

.fe-chevron-left:before {
  content: "\e92f";
}

.fe-chevron-right:before {
  content: "\e930";
}

.fe-chevron-up:before {
  content: "\e931";
}

.fe-chevrons-down:before {
  content: "\e932";
}

.fe-chevrons-left:before {
  content: "\e933";
}

.fe-chevrons-right:before {
  content: "\e934";
}

.fe-chevrons-up:before {
  content: "\e935";
}

.fe-chrome:before {
  content: "\e936";
}

.fe-circle:before {
  content: "\e937";
}

.fe-clipboard:before {
  content: "\e938";
}

.fe-clock:before {
  content: "\e939";
}

.fe-cloud:before {
  content: "\e93a";
}

.fe-cloud-drizzle:before {
  content: "\e93b";
}

.fe-cloud-lightning:before {
  content: "\e93c";
}

.fe-cloud-off:before {
  content: "\e93d";
}

.fe-cloud-rain:before {
  content: "\e93e";
}

.fe-cloud-snow:before {
  content: "\e93f";
}

.fe-code:before {
  content: "\e940";
}

.fe-codepen:before {
  content: "\e941";
}

.fe-command:before {
  content: "\e942";
}

.fe-compass:before {
  content: "\e943";
}

.fe-copy:before {
  content: "\e944";
}

.fe-corner-down-left:before {
  content: "\e945";
}

.fe-corner-down-right:before {
  content: "\e946";
}

.fe-corner-left-down:before {
  content: "\e947";
}

.fe-corner-left-up:before {
  content: "\e948";
}

.fe-corner-right-down:before {
  content: "\e949";
}

.fe-corner-right-up:before {
  content: "\e94a";
}

.fe-corner-up-left:before {
  content: "\e94b";
}

.fe-corner-up-right:before {
  content: "\e94c";
}

.fe-cpu:before {
  content: "\e94d";
}

.fe-credit-card:before {
  content: "\e94e";
}

.fe-crop:before {
  content: "\e94f";
}

.fe-crosshair:before {
  content: "\e950";
}

.fe-database:before {
  content: "\e951";
}

.fe-delete:before {
  content: "\e952";
}

.fe-disc:before {
  content: "\e953";
}

.fe-dollar-sign:before {
  content: "\e954";
}

.fe-download:before {
  content: "\e955";
}

.fe-download-cloud:before {
  content: "\e956";
}

.fe-droplet:before {
  content: "\e957";
}

.fe-edit:before {
  content: "\e958";
}

.fe-edit-2:before {
  content: "\e959";
}

.fe-edit-3:before {
  content: "\e95a";
}

.fe-external-link:before {
  content: "\e95b";
}

.fe-eye:before {
  content: "\e95c";
}

.fe-eye-off:before {
  content: "\e95d";
}

.fe-facebook:before {
  content: "\e95e";
}

.fe-fast-forward:before {
  content: "\e95f";
}

.fe-feather:before {
  content: "\e960";
}

.fe-file:before {
  content: "\e961";
}

.fe-file-minus:before {
  content: "\e962";
}

.fe-file-plus:before {
  content: "\e963";
}

.fe-file-text:before {
  content: "\e964";
}

.fe-film:before {
  content: "\e965";
}

.fe-filter:before {
  content: "\e966";
}

.fe-flag:before {
  content: "\e967";
}

.fe-folder:before {
  content: "\e968";
}

.fe-folder-minus:before {
  content: "\e969";
}

.fe-folder-plus:before {
  content: "\e96a";
}

.fe-gift:before {
  content: "\e96b";
}

.fe-git-branch:before {
  content: "\e96c";
}

.fe-git-commit:before {
  content: "\e96d";
}

.fe-git-merge:before {
  content: "\e96e";
}

.fe-git-pull-request:before {
  content: "\e96f";
}

.fe-github:before {
  content: "\e970";
}

.fe-gitlab:before {
  content: "\e971";
}

.fe-globe:before {
  content: "\e972";
}

.fe-grid:before {
  content: "\e973";
}

.fe-hard-drive:before {
  content: "\e974";
}

.fe-hash:before {
  content: "\e975";
}

.fe-headphones:before {
  content: "\e976";
}

.fe-heart:before {
  content: "\e977";
}

.fe-help-circle:before {
  content: "\e978";
}

.fe-home:before {
  content: "\e979";
}

.fe-image:before {
  content: "\e97a";
}

.fe-inbox:before {
  content: "\e97b";
}

.fe-info:before {
  content: "\e97c";
}

.fe-instagram:before {
  content: "\e97d";
}

.fe-italic:before {
  content: "\e97e";
}

.fe-layers:before {
  content: "\e97f";
}

.fe-layout:before {
  content: "\e980";
}

.fe-life-buoy:before {
  content: "\e981";
}

.fe-link:before {
  content: "\e982";
}

.fe-link-2:before {
  content: "\e983";
}

.fe-linkedin:before {
  content: "\e984";
}

.fe-list:before {
  content: "\e985";
}

.fe-loader:before {
  content: "\e986";
}

.fe-lock:before {
  content: "\e987";
}

.fe-log-in:before {
  content: "\e988";
}

.fe-log-out:before {
  content: "\e989";
}

.fe-mail:before {
  content: "\e98a";
}

.fe-map:before {
  content: "\e98b";
}

.fe-map-pin:before {
  content: "\e98c";
}

.fe-maximize:before {
  content: "\e98d";
}

.fe-maximize-2:before {
  content: "\e98e";
}

.fe-menu:before {
  content: "\e98f";
}

.fe-message-circle:before {
  content: "\e990";
}

.fe-message-square:before {
  content: "\e991";
}

.fe-mic:before {
  content: "\e992";
}

.fe-mic-off:before {
  content: "\e993";
}

.fe-minimize:before {
  content: "\e994";
}

.fe-minimize-2:before {
  content: "\e995";
}

.fe-minus:before {
  content: "\e996";
}

.fe-minus-circle:before {
  content: "\e997";
}

.fe-minus-square:before {
  content: "\e998";
}

.fe-monitor:before {
  content: "\e999";
}

.fe-moon:before {
  content: "\e99a";
}

.fe-more-horizontal:before {
  content: "\e99b";
}

.fe-more-vertical:before {
  content: "\e99c";
}

.fe-move:before {
  content: "\e99d";
}

.fe-music:before {
  content: "\e99e";
}

.fe-navigation:before {
  content: "\e99f";
}

.fe-navigation-2:before {
  content: "\e9a0";
}

.fe-octagon:before {
  content: "\e9a1";
}

.fe-package:before {
  content: "\e9a2";
}

.fe-paperclip:before {
  content: "\e9a3";
}

.fe-pause:before {
  content: "\e9a4";
}

.fe-pause-circle:before {
  content: "\e9a5";
}

.fe-percent:before {
  content: "\e9a6";
}

.fe-phone:before {
  content: "\e9a7";
}

.fe-phone-call:before {
  content: "\e9a8";
}

.fe-phone-forwarded:before {
  content: "\e9a9";
}

.fe-phone-incoming:before {
  content: "\e9aa";
}

.fe-phone-missed:before {
  content: "\e9ab";
}

.fe-phone-off:before {
  content: "\e9ac";
}

.fe-phone-outgoing:before {
  content: "\e9ad";
}

.fe-pie-chart:before {
  content: "\e9ae";
}

.fe-play:before {
  content: "\e9af";
}

.fe-play-circle:before {
  content: "\e9b0";
}

.fe-plus:before {
  content: "\e9b1";
}

.fe-plus-circle:before {
  content: "\e9b2";
}

.fe-plus-square:before {
  content: "\e9b3";
}

.fe-pocket:before {
  content: "\e9b4";
}

.fe-power:before {
  content: "\e9b5";
}

.fe-printer:before {
  content: "\e9b6";
}

.fe-radio:before {
  content: "\e9b7";
}

.fe-refresh-ccw:before {
  content: "\e9b8";
}

.fe-refresh-cw:before {
  content: "\e9b9";
}

.fe-repeat:before {
  content: "\e9ba";
}

.fe-rewind:before {
  content: "\e9bb";
}

.fe-rotate-ccw:before {
  content: "\e9bc";
}

.fe-rotate-cw:before {
  content: "\e9bd";
}

.fe-rss:before {
  content: "\e9be";
}

.fe-save:before {
  content: "\e9bf";
}

.fe-scissors:before {
  content: "\e9c0";
}

.fe-search:before {
  content: "\e9c1";
}

.fe-send:before {
  content: "\e9c2";
}

.fe-server:before {
  content: "\e9c3";
}

.fe-settings:before {
  content: "\e9c4";
}

.fe-share:before {
  content: "\e9c5";
}

.fe-share-2:before {
  content: "\e9c6";
}

.fe-shield:before {
  content: "\e9c7";
}

.fe-shield-off:before {
  content: "\e9c8";
}

.fe-shopping-bag:before {
  content: "\e9c9";
}

.fe-shopping-cart:before {
  content: "\e9ca";
}

.fe-shuffle:before {
  content: "\e9cb";
}

.fe-sidebar:before {
  content: "\e9cc";
}

.fe-skip-back:before {
  content: "\e9cd";
}

.fe-skip-forward:before {
  content: "\e9ce";
}

.fe-slack:before {
  content: "\e9cf";
}

.fe-slash:before {
  content: "\e9d0";
}

.fe-sliders:before {
  content: "\e9d1";
}

.fe-smartphone:before {
  content: "\e9d2";
}

.fe-speaker:before {
  content: "\e9d3";
}

.fe-square:before {
  content: "\e9d4";
}

.fe-star:before {
  content: "\e9d5";
}

.fe-stop-circle:before {
  content: "\e9d6";
}

.fe-sun:before {
  content: "\e9d7";
}

.fe-sunrise:before {
  content: "\e9d8";
}

.fe-sunset:before {
  content: "\e9d9";
}

.fe-tablet:before {
  content: "\e9da";
}

.fe-tag:before {
  content: "\e9db";
}

.fe-target:before {
  content: "\e9dc";
}

.fe-terminal:before {
  content: "\e9dd";
}

.fe-thermometer:before {
  content: "\e9de";
}

.fe-thumbs-down:before {
  content: "\e9df";
}

.fe-thumbs-up:before {
  content: "\e9e0";
}

.fe-toggle-left:before {
  content: "\e9e1";
}

.fe-toggle-right:before {
  content: "\e9e2";
}

.fe-trash:before {
  content: "\e9e3";
}

.fe-trash-2:before {
  content: "\e9e4";
}

.fe-trending-down:before {
  content: "\e9e5";
}

.fe-trending-up:before {
  content: "\e9e6";
}

.fe-triangle:before {
  content: "\e9e7";
}

.fe-truck:before {
  content: "\e9e8";
}

.fe-tv:before {
  content: "\e9e9";
}

.fe-twitter:before {
  content: "\e9ea";
}

.fe-type:before {
  content: "\e9eb";
}

.fe-umbrella:before {
  content: "\e9ec";
}

.fe-underline:before {
  content: "\e9ed";
}

.fe-unlock:before {
  content: "\e9ee";
}

.fe-upload:before {
  content: "\e9ef";
}

.fe-upload-cloud:before {
  content: "\e9f0";
}

.fe-user:before {
  content: "\e9f1";
}

.fe-user-check:before {
  content: "\e9f2";
}

.fe-user-minus:before {
  content: "\e9f3";
}

.fe-user-plus:before {
  content: "\e9f4";
}

.fe-user-x:before {
  content: "\e9f5";
}

.fe-users:before {
  content: "\e9f6";
}

.fe-video:before {
  content: "\e9f7";
}

.fe-video-off:before {
  content: "\e9f8";
}

.fe-voicemail:before {
  content: "\e9f9";
}

.fe-volume:before {
  content: "\e9fa";
}

.fe-volume-1:before {
  content: "\e9fb";
}

.fe-volume-2:before {
  content: "\e9fc";
}

.fe-volume-x:before {
  content: "\e9fd";
}

.fe-watch:before {
  content: "\e9fe";
}

.fe-wifi:before {
  content: "\e9ff";
}

.fe-wifi-off:before {
  content: "\ea00";
}

.fe-wind:before {
  content: "\ea01";
}

.fe-x:before {
  content: "\ea02";
}

.fe-x-circle:before {
  content: "\ea03";
}

.fe-x-square:before {
  content: "\ea04";
}

.fe-youtube:before {
  content: "\ea05";
}

.fe-zap:before {
  content: "\ea06";
}

.fe-zap-off:before {
  content: "\ea07";
}

.fe-zoom-in:before {
  content: "\ea08";
}

.fe-zoom-out:before {
  content: "\ea09";
}

[class*=isax-] {
  
  font-family: "iconsax" !important;
  speak: none;
  font-style: normal;
  font-weight: normal;
  font-variant: normal;
  text-transform: none;
  line-height: 1;
  
  -webkit-font-smoothing: antialiased;
  -moz-osx-font-smoothing: grayscale;
}

.isax-dcube:before {
  content: "\e901";
}

.isax-d-cube-scan:before {
  content: "\e902";
}

.isax-d-rotate:before {
  content: "\e903";
}

.isax-d-square:before {
  content: "\e904";
}

.isax-square:before {
  content: "\e905";
}

.isax-support:before {
  content: "\e906";
}

.isax-activity:before {
  content: "\e907";
}

.isax-add:before {
  content: "\e908";
}

.isax-add-circle:before {
  content: "\e909";
}

.isax-additem:before {
  content: "\e90a";
}

.isax-add-square:before {
  content: "\e90b";
}

.isax-airdrop:before {
  content: "\e90c";
}

.isax-airplane:before {
  content: "\e90d";
}

.isax-airplane-square:before {
  content: "\e90e";
}

.isax-airpod:before {
  content: "\e90f";
}

.isax-airpods:before {
  content: "\e910";
}

.isax-alarm:before {
  content: "\e911";
}

.isax-align-bottom:before {
  content: "\e912";
}

.isax-align-horizontally:before {
  content: "\e913";
}

.isax-align-left:before {
  content: "\e914";
}

.isax-align-right:before {
  content: "\e915";
}

.isax-align-vertically:before {
  content: "\e916";
}

.isax-aquarius:before {
  content: "\e917";
}

.isax-archive:before {
  content: "\e918";
}

.isax-archive-1:before {
  content: "\e919";
}

.isax-archive-2:before {
  content: "\e91a";
}

.isax-archive-add:before {
  content: "\e91b";
}

.isax-archive-book:before {
  content: "\e91c";
}

.isax-archive-minus:before {
  content: "\e91d";
}

.isax-archive-slash:before {
  content: "\e91e";
}

.isax-archive-tick:before {
  content: "\e91f";
}

.isax-arrange-circle:before {
  content: "\e920";
}

.isax-arrange-circle-2:before {
  content: "\e921";
}

.isax-arrange-square:before {
  content: "\e922";
}

.isax-arrange-square-2:before {
  content: "\e923";
}

.isax-arrow:before {
  content: "\e924";
}

.isax-arrow-2:before {
  content: "\e925";
}

.isax-arrow-3:before {
  content: "\e926";
}

.isax-arrow-bottom:before {
  content: "\e927";
}

.isax-arrow-circle-down:before {
  content: "\e928";
}

.isax-arrow-circle-left:before {
  content: "\e929";
}

.isax-arrow-circle-right:before {
  content: "\e92a";
}

.isax-arrow-circle-up:before {
  content: "\e92b";
}

.isax-arrow-down:before {
  content: "\e92c";
}

.isax-arrow-down-1:before {
  content: "\e92d";
}

.isax-arrow-down-2:before {
  content: "\e92e";
}

.isax-arrow-left:before {
  content: "\e92f";
}

.isax-arrow-left-1:before {
  content: "\e930";
}

.isax-arrow-left-2:before {
  content: "\e931";
}

.isax-arrow-left-3:before {
  content: "\e932";
}

.isax-arrow-right:before {
  content: "\e933";
}

.isax-arrow-right-1:before {
  content: "\e934";
}

.isax-arrow-right-2:before {
  content: "\e935";
}

.isax-arrow-right-3:before {
  content: "\e936";
}

.isax-arrow-right-4:before {
  content: "\e937";
}

.isax-arrow-square:before {
  content: "\e938";
}

.isax-arrow-square-down:before {
  content: "\e939";
}

.isax-arrow-square-left:before {
  content: "\e93a";
}

.isax-arrow-square-up:before {
  content: "\e93b";
}

.isax-arrow-swap:before {
  content: "\e93c";
}

.isax-arrow-swap-horizontal:before {
  content: "\e93d";
}

.isax-arrow-up:before {
  content: "\e93e";
}

.isax-arrow-up-1:before {
  content: "\e93f";
}

.isax-arrow-up-2:before {
  content: "\e940";
}

.isax-arrow-up-3:before {
  content: "\e941";
}

.isax-attach-circle:before {
  content: "\e942";
}

.isax-attach-square:before {
  content: "\e943";
}

.isax-audio-square:before {
  content: "\e944";
}

.isax-autobrightness:before {
  content: "\e945";
}

.isax-award:before {
  content: "\e946";
}

.isax-back-square:before {
  content: "\e947";
}

.isax-backward:before {
  content: "\e948";
}

.isax-backward-5-seconds:before {
  content: "\e949";
}

.isax-backward-10-seconds:before {
  content: "\e94a";
}

.isax-backward-15-seconds:before {
  content: "\e94b";
}

.isax-backward-item:before {
  content: "\e94c";
}

.isax-bag:before {
  content: "\e94d";
}

.isax-bag-2:before {
  content: "\e94e";
}

.isax-bag-cross:before {
  content: "\e94f";
}

.isax-bag-cross-1:before {
  content: "\e950";
}

.isax-bag-happy:before {
  content: "\e951";
}

.isax-bag-tick:before {
  content: "\e952";
}

.isax-bag-tick-2:before {
  content: "\e953";
}

.isax-bag-timer:before {
  content: "\e954";
}

.isax-bank:before {
  content: "\e955";
}

.isax-barcode:before {
  content: "\e956";
}

.isax-battery-3full:before {
  content: "\e957";
}

.isax-battery-charging:before {
  content: "\e958";
}

.isax-battery-disable:before {
  content: "\e959";
}

.isax-battery-empty:before {
  content: "\e95a";
}

.isax-battery-empty-1:before {
  content: "\e95b";
}

.isax-battery-full:before {
  content: "\e95c";
}

.isax-bezier:before {
  content: "\e95d";
}

.isax-bill:before {
  content: "\e95e";
}

.isax-bitcoin-card:before {
  content: "\e95f";
}

.isax-bitcoin-convert:before {
  content: "\e960";
}

.isax-bitcoin-refresh:before {
  content: "\e961";
}

.isax-blend:before {
  content: "\e962";
}

.isax-blend-2:before {
  content: "\e963";
}

.isax-bluetooth:before {
  content: "\e964";
}

.isax-bluetooth-2:before {
  content: "\e965";
}

.isax-bluetooth-circle:before {
  content: "\e966";
}

.isax-bluetooth-rectangle:before {
  content: "\e967";
}

.isax-blur:before {
  content: "\e968";
}

.isax-book:before {
  content: "\e969";
}

.isax-book-1:before {
  content: "\e96a";
}

.isax-bookmark:before {
  content: "\e96b";
}

.isax-bookmark-2:before {
  content: "\e96c";
}

.isax-book-saved:before {
  content: "\e96d";
}

.isax-book-square:before {
  content: "\e96e";
}

.isax-box:before {
  content: "\e96f";
}

.isax-box-1:before {
  content: "\e970";
}

.isax-box-2:before {
  content: "\e971";
}

.isax-box-add:before {
  content: "\e972";
}

.isax-box-remove:before {
  content: "\e973";
}

.isax-box-search:before {
  content: "\e974";
}

.isax-box-tick:before {
  content: "\e975";
}

.isax-box-time:before {
  content: "\e976";
}

.isax-briefcase:before {
  content: "\e977";
}

.isax-brifecase-cross:before {
  content: "\e978";
}

.isax-brifecase-tick:before {
  content: "\e979";
}

.isax-brifecase-timer:before {
  content: "\e97a";
}

.isax-broom:before {
  content: "\e97b";
}

.isax-brush:before {
  content: "\e97c";
}

.isax-brush-1:before {
  content: "\e97d";
}

.isax-brush-2:before {
  content: "\e97e";
}

.isax-brush-3:before {
  content: "\e97f";
}

.isax-brush-4:before {
  content: "\e980";
}

.isax-bubble:before {
  content: "\e981";
}

.isax-bucket:before {
  content: "\e982";
}

.isax-bucket-circle:before {
  content: "\e983";
}

.isax-bucket-square:before {
  content: "\e984";
}

.isax-building:before {
  content: "\e985";
}

.isax-building-3:before {
  content: "\e986";
}

.isax-building-4:before {
  content: "\e987";
}

.isax-buildings:before {
  content: "\e988";
}

.isax-buildings-2:before {
  content: "\e989";
}

.isax-buliding:before {
  content: "\e98a";
}

.isax-bus:before {
  content: "\e98b";
}

.isax-buy-crypto:before {
  content: "\e98c";
}

.isax-cake:before {
  content: "\e98d";
}

.isax-calculator:before {
  content: "\e98e";
}

.isax-calendar:before {
  content: "\e98f";
}

.isax-calendar-1:before {
  content: "\e990";
}

.isax-calendar-2:before {
  content: "\e991";
}

.isax-calendar-add:before {
  content: "\e992";
}

.isax-calendar-circle:before {
  content: "\e993";
}

.isax-calendar-edit:before {
  content: "\e994";
}

.isax-calendar-remove:before {
  content: "\e995";
}

.isax-calendar-search:before {
  content: "\e996";
}

.isax-calendar-tick:before {
  content: "\e997";
}

.isax-call:before {
  content: "\e998";
}

.isax-call-add:before {
  content: "\e999";
}

.isax-call-calling:before {
  content: "\e99a";
}

.isax-call-incoming:before {
  content: "\e99b";
}

.isax-call-minus:before {
  content: "\e99c";
}

.isax-call-outgoing:before {
  content: "\e99d";
}

.isax-call-received:before {
  content: "\e99e";
}

.isax-call-remove:before {
  content: "\e99f";
}

.isax-call-slash:before {
  content: "\e9a0";
}

.isax-camera:before {
  content: "\e9a1";
}

.isax-camera-slash:before {
  content: "\e9a2";
}

.isax-candle:before {
  content: "\e9a3";
}

.isax-candle-2:before {
  content: "\e9a4";
}

.isax-car:before {
  content: "\e9a5";
}

.isax-card:before {
  content: "\e9a6";
}

.isax-card-add:before {
  content: "\e9a7";
}

.isax-card-coin:before {
  content: "\e9a8";
}

.isax-card-edit:before {
  content: "\e9a9";
}

.isax-card-pos:before {
  content: "\e9aa";
}

.isax-card-receive:before {
  content: "\e9ab";
}

.isax-card-remove:before {
  content: "\e9ac";
}

.isax-card-remove-1:before {
  content: "\e9ad";
}

.isax-cards:before {
  content: "\e9ae";
}

.isax-card-send:before {
  content: "\e9af";
}

.isax-card-slash:before {
  content: "\e9b0";
}

.isax-card-tick:before {
  content: "\e9b1";
}

.isax-card-tick-1:before {
  content: "\e9b2";
}

.isax-category:before {
  content: "\e9b3";
}

.isax-category-2:before {
  content: "\e9b4";
}

.isax-cd:before {
  content: "\e9b5";
}

.isax-chart:before {
  content: "\e9b6";
}

.isax-chart-1:before {
  content: "\e9b7";
}

.isax-chart-2:before {
  content: "\e9b8";
}

.isax-chart-3:before {
  content: "\e9b9";
}

.isax-chart-21:before {
  content: "\e9ba";
}

.isax-chart-fail:before {
  content: "\e9bb";
}

.isax-chart-square:before {
  content: "\e9bc";
}

.isax-chart-success:before {
  content: "\e9bd";
}

.isax-check:before {
  content: "\e9be";
}

.isax-chrome:before {
  content: "\e9bf";
}

.isax-clipboard:before {
  content: "\e9c0";
}

.isax-clipboard-close:before {
  content: "\e9c1";
}

.isax-clipboard-export:before {
  content: "\e9c2";
}

.isax-clipboard-import:before {
  content: "\e9c3";
}

.isax-clipboard-text:before {
  content: "\e9c4";
}

.isax-clipboard-tick:before {
  content: "\e9c5";
}

.isax-clock:before {
  content: "\e9c6";
}

.isax-clock-1:before {
  content: "\e9c7";
}

.isax-close-circle:before {
  content: "\e9c8";
}

.isax-close-square:before {
  content: "\e9c9";
}

.isax-cloud:before {
  content: "\e9ca";
}

.isax-cloud-add:before {
  content: "\e9cb";
}

.isax-cloud-change:before {
  content: "\e9cc";
}

.isax-cloud-connection:before {
  content: "\e9cd";
}

.isax-cloud-cross:before {
  content: "\e9ce";
}

.isax-cloud-drizzle:before {
  content: "\e9cf";
}

.isax-cloud-fog:before {
  content: "\e9d0";
}

.isax-cloud-lightning:before {
  content: "\e9d1";
}

.isax-cloud-minus:before {
  content: "\e9d2";
}

.isax-cloud-notif:before {
  content: "\e9d3";
}

.isax-cloud-plus:before {
  content: "\e9d4";
}

.isax-cloud-remove:before {
  content: "\e9d5";
}

.isax-cloud-snow:before {
  content: "\e9d6";
}

.isax-cloud-sunny:before {
  content: "\e9d7";
}

.isax-code:before {
  content: "\e9d8";
}

.isax-code-1:before {
  content: "\e9d9";
}

.isax-code-circle:before {
  content: "\e9da";
}

.isax-coffee:before {
  content: "\e9db";
}

.isax-coin:before {
  content: "\e9dc";
}

.isax-coin-1:before {
  content: "\e9dd";
}

.isax-colorfilter:before {
  content: "\e9de";
}

.isax-colors-square:before {
  content: "\e9df";
}

.isax-color-swatch:before {
  content: "\e9e0";
}

.isax-command:before {
  content: "\e9e1";
}

.isax-command-square:before {
  content: "\e9e2";
}

.isax-component:before {
  content: "\e9e3";
}

.isax-computing:before {
  content: "\e9e4";
}

.isax-convert:before {
  content: "\e9e5";
}

.isax-convert-3d-cube:before {
  content: "\e9e6";
}

.isax-convert-card:before {
  content: "\e9e7";
}

.isax-convertshape:before {
  content: "\e9e8";
}

.isax-convertshape-2:before {
  content: "\e9e9";
}

.isax-copy:before {
  content: "\e9ea";
}

.isax-copyright:before {
  content: "\e9eb";
}

.isax-copy-success:before {
  content: "\e9ec";
}

.isax-courthouse:before {
  content: "\e9ed";
}

.isax-cpu:before {
  content: "\e9ee";
}

.isax-cpu-charge:before {
  content: "\e9ef";
}

.isax-cpu-setting:before {
  content: "\e9f0";
}

.isax-creative-commons:before {
  content: "\e9f1";
}

.isax-crop:before {
  content: "\e9f2";
}

.isax-crown:before {
  content: "\e9f3";
}

.isax-crown-1:before {
  content: "\e9f4";
}

.isax-cup:before {
  content: "\e9f5";
}

.isax-danger:before {
  content: "\e9f6";
}

.isax-data:before {
  content: "\e9f7";
}

.isax-data-2 .path1:before {
  content: "\e9f8";
  color: rgb(41, 45, 50);
}

.isax-data-2 .path2:before {
  content: "\e9f9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-data-2 .path3:before {
  content: "\e9fa";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-data-2 .path4:before {
  content: "\e9fb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-data-2 .path5:before {
  content: "\e9fc";
  margin-left: -1em;
  color: rgb(255, 255, 255);
}

.isax-data-2 .path6:before {
  content: "\e9fd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-data-2 .path7:before {
  content: "\e9fe";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-data-2 .path8:before {
  content: "\e9ff";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-designtools:before {
  content: "\ea00";
}

.isax-device-message:before {
  content: "\ea01";
}

.isax-devices:before {
  content: "\ea02";
}

.isax-devices-1:before {
  content: "\ea03";
}

.isax-diagram:before {
  content: "\ea04";
}

.isax-diamonds:before {
  content: "\ea05";
}

.isax-direct:before {
  content: "\ea06";
}

.isax-directbox-default:before {
  content: "\ea07";
}

.isax-directbox-notif:before {
  content: "\ea08";
}

.isax-directbox-receive:before {
  content: "\ea09";
}

.isax-directbox-send:before {
  content: "\ea0a";
}

.isax-direct-down:before {
  content: "\ea0b";
}

.isax-direct-inbox:before {
  content: "\ea0c";
}

.isax-direct-left:before {
  content: "\ea0d";
}

.isax-direct-normal:before {
  content: "\ea0e";
}

.isax-direct-notification:before {
  content: "\ea0f";
}

.isax-direct-right:before {
  content: "\ea10";
}

.isax-direct-send:before {
  content: "\ea11";
}

.isax-direct-up:before {
  content: "\ea12";
}

.isax-discount-circle:before {
  content: "\ea13";
}

.isax-discount-shape:before {
  content: "\ea14";
}

.isax-discover:before {
  content: "\ea15";
}

.isax-discover-1:before {
  content: "\ea16";
}

.isax-dislike:before {
  content: "\ea17";
}

.isax-document:before {
  content: "\ea18";
}

.isax-document-1:before {
  content: "\ea19";
}

.isax-document-cloud:before {
  content: "\ea1a";
}

.isax-document-code:before {
  content: "\ea1b";
}

.isax-document-code-2:before {
  content: "\ea1c";
}

.isax-document-copy:before {
  content: "\ea1d";
}

.isax-document-download:before {
  content: "\ea1e";
}

.isax-document-favorite:before {
  content: "\ea1f";
}

.isax-document-filter:before {
  content: "\ea20";
}

.isax-document-forward:before {
  content: "\ea21";
}

.isax-document-like:before {
  content: "\ea22";
}

.isax-document-normal:before {
  content: "\ea23";
}

.isax-document-previous:before {
  content: "\ea24";
}

.isax-document-sketch:before {
  content: "\ea25";
}

.isax-document-text:before {
  content: "\ea26";
}

.isax-document-text-1:before {
  content: "\ea27";
}

.isax-document-upload:before {
  content: "\ea28";
}

.isax-dollar-circle:before {
  content: "\ea29";
}

.isax-dollar-square:before {
  content: "\ea2a";
}

.isax-driver:before {
  content: "\ea2b";
}

.isax-driver-2:before {
  content: "\ea2c";
}

.isax-driver-refresh:before {
  content: "\ea2d";
}

.isax-driving:before {
  content: "\ea2e";
}

.isax-edit:before {
  content: "\ea2f";
}

.isax-edit-2:before {
  content: "\ea30";
}

.isax-electricity:before {
  content: "\ea31";
}

.isax-element-2:before {
  content: "\ea32";
}

.isax-element-3:before {
  content: "\ea33";
}

.isax-element-4:before {
  content: "\ea34";
}

.isax-element-equal:before {
  content: "\ea35";
}

.isax-element-plus:before {
  content: "\ea36";
}

.isax-emoji-happy:before {
  content: "\ea37";
}

.isax-emoji-normal:before {
  content: "\ea38";
}

.isax-emoji-sad:before {
  content: "\ea39";
}

.isax-empty-wallet:before {
  content: "\ea3a";
}

.isax-empty-wallet-add:before {
  content: "\ea3b";
}

.isax-empty-wallet-change:before {
  content: "\ea3c";
}

.isax-empty-wallet-remove:before {
  content: "\ea3d";
}

.isax-empty-wallet-tick:before {
  content: "\ea3e";
}

.isax-empty-wallet-time:before {
  content: "\ea3f";
}

.isax-eraser:before {
  content: "\ea40";
}

.isax-eraser-1:before {
  content: "\ea41";
}

.isax-export:before {
  content: "\ea42";
}

.isax-export-1:before {
  content: "\ea43";
}

.isax-export-2:before {
  content: "\ea44";
}

.isax-export-3:before {
  content: "\ea45";
}

.isax-external-drive:before {
  content: "\ea46";
}

.isax-eye:before {
  content: "\ea47";
}

.isax-eye-slash:before {
  content: "\ea48";
}

.isax-fatrows:before {
  content: "\ea49";
}

.isax-favorite-chart:before {
  content: "\ea4a";
}

.isax-filter:before {
  content: "\ea4b";
}

.isax-filter-add:before {
  content: "\ea4c";
}

.isax-filter-edit:before {
  content: "\ea4d";
}

.isax-filter-remove:before {
  content: "\ea4e";
}

.isax-filter-search:before {
  content: "\ea4f";
}

.isax-filter-square:before {
  content: "\ea50";
}

.isax-filter-tick:before {
  content: "\ea51";
}

.isax-finger-cricle:before {
  content: "\ea52";
}

.isax-finger-scan:before {
  content: "\ea53";
}

.isax-firstline:before {
  content: "\ea54";
}

.isax-flag:before {
  content: "\ea55";
}

.isax-flag-2:before {
  content: "\ea56";
}

.isax-flash:before {
  content: "\ea57";
}

.isax-flash-1:before {
  content: "\ea58";
}

.isax-flash-circle:before {
  content: "\ea59";
}

.isax-flash-circle-1:before {
  content: "\ea5a";
}

.isax-flash-slash:before {
  content: "\ea5b";
}

.isax-folder:before {
  content: "\ea5c";
}

.isax-folder-2:before {
  content: "\ea5d";
}

.isax-folder-add:before {
  content: "\ea5e";
}

.isax-folder-cloud:before {
  content: "\ea5f";
}

.isax-folder-connection:before {
  content: "\ea60";
}

.isax-folder-cross:before {
  content: "\ea61";
}

.isax-folder-favorite:before {
  content: "\ea62";
}

.isax-folder-minus:before {
  content: "\ea63";
}

.isax-folder-open:before {
  content: "\ea64";
}

.isax-forbidden:before {
  content: "\ea65";
}

.isax-forbidden-2:before {
  content: "\ea66";
}

.isax-format-circle:before {
  content: "\ea67";
}

.isax-format-square:before {
  content: "\ea68";
}

.isax-forward:before {
  content: "\ea69";
}

.isax-forward-5-seconds:before {
  content: "\ea6a";
}

.isax-forward-10-seconds:before {
  content: "\ea6b";
}

.isax-forward-15-seconds:before {
  content: "\ea6c";
}

.isax-forward-item:before {
  content: "\ea6d";
}

.isax-forward-square:before {
  content: "\ea6e";
}

.isax-frame:before {
  content: "\ea6f";
}

.isax-frame-1:before {
  content: "\ea70";
}

.isax-frame-2:before {
  content: "\ea71";
}

.isax-frame-3:before {
  content: "\ea72";
}

.isax-frame-4:before {
  content: "\ea73";
}

.isax-gallery:before {
  content: "\ea74";
}

.isax-gallery-add:before {
  content: "\ea75";
}

.isax-gallery-edit:before {
  content: "\ea76";
}

.isax-gallery-export:before {
  content: "\ea77";
}

.isax-gallery-favorite:before {
  content: "\ea78";
}

.isax-gallery-import:before {
  content: "\ea79";
}

.isax-gallery-remove:before {
  content: "\ea7a";
}

.isax-gallery-slash:before {
  content: "\ea7b";
}

.isax-gallery-tick:before {
  content: "\ea7c";
}

.isax-game:before {
  content: "\ea7d";
}

.isax-gameboy:before {
  content: "\ea7e";
}

.isax-gas-station:before {
  content: "\ea7f";
}

.isax-gemini:before {
  content: "\ea80";
}

.isax-gemini-2:before {
  content: "\ea81";
}

.isax-ghost:before {
  content: "\ea82";
}

.isax-gift:before {
  content: "\ea83";
}

.isax-glass:before {
  content: "\ea84";
}

.isax-glass-1:before {
  content: "\ea85";
}

.isax-global:before {
  content: "\ea86";
}

.isax-global-edit:before {
  content: "\ea87";
}

.isax-global-refresh:before {
  content: "\ea88";
}

.isax-global-search:before {
  content: "\ea89";
}

.isax-gps:before {
  content: "\ea8a";
}

.isax-gps-slash:before {
  content: "\ea8b";
}

.isax-grammerly:before {
  content: "\ea8c";
}

.isax-graph:before {
  content: "\ea8d";
}

.isax-grid-1:before {
  content: "\ea8e";
}

.isax-grid-2:before {
  content: "\ea8f";
}

.isax-grid-3:before {
  content: "\ea90";
}

.isax-grid-4:before {
  content: "\ea91";
}

.isax-grid-5:before {
  content: "\ea92";
}

.isax-grid-6:before {
  content: "\ea93";
}

.isax-grid-7:before {
  content: "\ea94";
}

.isax-grid-8:before {
  content: "\ea95";
}

.isax-grid-9:before {
  content: "\ea96";
}

.isax-grid-edit:before {
  content: "\ea97";
}

.isax-grid-eraser:before {
  content: "\ea98";
}

.isax-grid-lock:before {
  content: "\ea99";
}

.isax-happyemoji:before {
  content: "\ea9a";
}

.isax-hashtag:before {
  content: "\ea9b";
}

.isax-hashtag-1:before {
  content: "\ea9c";
}

.isax-hashtag-down:before {
  content: "\ea9d";
}

.isax-hashtag-up:before {
  content: "\ea9e";
}

.isax-headphone:before {
  content: "\ea9f";
}

.isax-headphones:before {
  content: "\eaa0";
}

.isax-health:before {
  content: "\eaa1";
}

.isax-heart:before {
  content: "\eaa2";
}

.isax-heart-add:before {
  content: "\eaa3";
}

.isax-heart-circle:before {
  content: "\eaa4";
}

.isax-heart-edit:before {
  content: "\eaa5";
}

.isax-heart-remove:before {
  content: "\eaa6";
}

.isax-heart-search:before {
  content: "\eaa7";
}

.isax-heart-slash:before {
  content: "\eaa8";
}

.isax-heart-tick:before {
  content: "\eaa9";
}

.isax-hierarchy:before {
  content: "\eaaa";
}

.isax-hierarchy-2:before {
  content: "\eaab";
}

.isax-hierarchy-3:before {
  content: "\eaac";
}

.isax-hierarchy-square:before {
  content: "\eaad";
}

.isax-hierarchy-square-2:before {
  content: "\eaae";
}

.isax-hierarchy-square-3:before {
  content: "\eaaf";
}

.isax-home:before {
  content: "\eab0";
}

.isax-home-1:before {
  content: "\eab1";
}

.isax-home-2:before {
  content: "\eab2";
}

.isax-home-hashtag:before {
  content: "\eab3";
}

.isax-home-trend-down:before {
  content: "\eab4";
}

.isax-home-trend-up:before {
  content: "\eab5";
}

.isax-home-wifi:before {
  content: "\eab6";
}

.isax-hospital:before {
  content: "\eab7";
}

.isax-house:before {
  content: "\eab8";
}

.isax-house-2:before {
  content: "\eab9";
}

.isax-icon:before {
  content: "\eaba";
}

.isax-image:before {
  content: "\eabb";
}

.isax-import:before {
  content: "\eabc";
}

.isax-import-1:before {
  content: "\eabd";
}

.isax-import-2:before {
  content: "\eabe";
}

.isax-info-circle:before {
  content: "\eabf";
}

.isax-information:before {
  content: "\eac0";
}

.isax-instagram:before {
  content: "\eac1";
}

.isax-judge:before {
  content: "\eac2";
}

.isax-kanban:before {
  content: "\eac3";
}

.isax-key:before {
  content: "\eac4";
}

.isax-keyboard:before {
  content: "\eac5";
}

.isax-keyboard-open:before {
  content: "\eac6";
}

.isax-key-square:before {
  content: "\eac7";
}

.isax-lamp:before {
  content: "\eac8";
}

.isax-lamp-1:before {
  content: "\eac9";
}

.isax-lamp-charge:before {
  content: "\eaca";
}

.isax-lamp-on:before {
  content: "\eacb";
}

.isax-lamp-slash:before {
  content: "\eacc";
}

.isax-language-circle:before {
  content: "\eacd";
}

.isax-language-square:before {
  content: "\eace";
}

.isax-layer:before {
  content: "\eacf";
}

.isax-level:before {
  content: "\ead0";
}

.isax-lifebuoy:before {
  content: "\ead1";
}

.isax-like:before {
  content: "\ead2";
}

.isax-like-1:before {
  content: "\ead3";
}

.isax-like-dislike:before {
  content: "\ead4";
}

.isax-like-shapes:before {
  content: "\ead5";
}

.isax-like-tag:before {
  content: "\ead6";
}

.isax-link:before {
  content: "\ead7";
}

.isax-link-1:before {
  content: "\ead8";
}

.isax-link-2:before {
  content: "\ead9";
}

.isax-link-21:before {
  content: "\eada";
}

.isax-link-circle:before {
  content: "\eadb";
}

.isax-link-square:before {
  content: "\eadc";
}

.isax-location:before {
  content: "\eadd";
}

.isax-location-add:before {
  content: "\eade";
}

.isax-location-cross:before {
  content: "\eadf";
}

.isax-location-minus:before {
  content: "\eae0";
}

.isax-location-slash:before {
  content: "\eae1";
}

.isax-location-tick:before {
  content: "\eae2";
}

.isax-lock:before {
  content: "\eae3";
}

.isax-lock-1:before {
  content: "\eae4";
}

.isax-lock-circle:before {
  content: "\eae5";
}

.isax-lock-slash:before {
  content: "\eae6";
}

.isax-login:before {
  content: "\eae7";
}

.isax-login-1:before {
  content: "\eae8";
}

.isax-logout:before {
  content: "\eae9";
}

.isax-logout-1:before {
  content: "\eaea";
}

.isax-lovely:before {
  content: "\eaeb";
}

.isax-magicpen:before {
  content: "\eaec";
}

.isax-magic-star:before {
  content: "\eaed";
}

.isax-main-component:before {
  content: "\eaee";
}

.isax-man:before {
  content: "\eaef";
}

.isax-map:before {
  content: "\eaf0";
}

.isax-map-1:before {
  content: "\eaf1";
}

.isax-mask:before {
  content: "\eaf2";
}

.isax-mask-1:before {
  content: "\eaf3";
}

.isax-mask-2:before {
  content: "\eaf4";
}

.isax-math:before {
  content: "\eaf5";
}

.isax-maximize:before {
  content: "\eaf6";
}

.isax-maximize-1:before {
  content: "\eaf7";
}

.isax-maximize-2:before {
  content: "\eaf8";
}

.isax-maximize-3:before {
  content: "\eaf9";
}

.isax-maximize-4:before {
  content: "\eafa";
}

.isax-maximize-21:before {
  content: "\eafb";
}

.isax-maximize-circle:before {
  content: "\eafc";
}

.isax-medal:before {
  content: "\eafd";
}

.isax-medal-star:before {
  content: "\eafe";
}

.isax-menu:before {
  content: "\eaff";
}

.isax-menu-1:before {
  content: "\eb00";
}

.isax-menu-board:before {
  content: "\eb01";
}

.isax-message:before {
  content: "\eb02";
}

.isax-message-2:before {
  content: "\eb03";
}

.isax-message-add:before {
  content: "\eb04";
}

.isax-message-add-1:before {
  content: "\eb05";
}

.isax-message-circle:before {
  content: "\eb06";
}

.isax-message-edit:before {
  content: "\eb07";
}

.isax-message-favorite:before {
  content: "\eb08";
}

.isax-message-minus:before {
  content: "\eb09";
}

.isax-message-notif:before {
  content: "\eb0a";
}

.isax-message-programming:before {
  content: "\eb0b";
}

.isax-message-question:before {
  content: "\eb0c";
}

.isax-message-remove:before {
  content: "\eb0d";
}

.isax-messages:before {
  content: "\eb0e";
}

.isax-messages-1:before {
  content: "\eb0f";
}

.isax-messages-2:before {
  content: "\eb10";
}

.isax-messages-3:before {
  content: "\eb11";
}

.isax-message-search:before {
  content: "\eb12";
}

.isax-message-square:before {
  content: "\eb13";
}

.isax-message-text:before {
  content: "\eb14";
}

.isax-message-text-1:before {
  content: "\eb15";
}

.isax-message-tick:before {
  content: "\eb16";
}

.isax-message-time:before {
  content: "\eb17";
}

.isax-microphone:before {
  content: "\eb18";
}

.isax-microphone-2:before {
  content: "\eb19";
}

.isax-microphone-slash:before {
  content: "\eb1a";
}

.isax-microphone-slash-1:before {
  content: "\eb1b";
}

.isax-microscope:before {
  content: "\eb1c";
}

.isax-milk:before {
  content: "\eb1d";
}

.isax-mini-music-sqaure:before {
  content: "\eb1e";
}

.isax-minus:before {
  content: "\eb1f";
}

.isax-minus-cirlce:before {
  content: "\eb20";
}

.isax-minus-square:before {
  content: "\eb21";
}

.isax-mirror:before {
  content: "\eb22";
}

.isax-mirroring-screen:before {
  content: "\eb23";
}

.isax-mobile:before {
  content: "\eb24";
}

.isax-mobile-programming:before {
  content: "\eb25";
}

.isax-money:before {
  content: "\eb26";
}

.isax-money-2:before {
  content: "\eb27";
}

.isax-money-3:before {
  content: "\eb28";
}

.isax-money-4:before {
  content: "\eb29";
}

.isax-money-add:before {
  content: "\eb2a";
}

.isax-money-change:before {
  content: "\eb2b";
}

.isax-money-forbidden:before {
  content: "\eb2c";
}

.isax-money-recive:before {
  content: "\eb2d";
}

.isax-money-remove:before {
  content: "\eb2e";
}

.isax-moneys:before {
  content: "\eb2f";
}

.isax-money-send:before {
  content: "\eb30";
}

.isax-money-tick:before {
  content: "\eb31";
}

.isax-money-time:before {
  content: "\eb32";
}

.isax-monitor:before {
  content: "\eb33";
}

.isax-monitor-mobbile:before {
  content: "\eb34";
}

.isax-monitor-recorder:before {
  content: "\eb35";
}

.isax-moon:before {
  content: "\eb36";
}

.isax-more:before {
  content: "\eb37";
}

.isax-more-2:before {
  content: "\eb38";
}

.isax-more-circle:before {
  content: "\eb39";
}

.isax-more-square:before {
  content: "\eb3a";
}

.isax-mouse:before {
  content: "\eb3b";
}

.isax-mouse-1:before {
  content: "\eb3c";
}

.isax-mouse-circle:before {
  content: "\eb3d";
}

.isax-mouse-square:before {
  content: "\eb3e";
}

.isax-music:before {
  content: "\eb3f";
}

.isax-music-circle:before {
  content: "\eb40";
}

.isax-music-dashboard:before {
  content: "\eb41";
}

.isax-music-filter:before {
  content: "\eb42";
}

.isax-music-library-2:before {
  content: "\eb43";
}

.isax-musicnote:before {
  content: "\eb44";
}

.isax-music-play:before {
  content: "\eb45";
}

.isax-music-playlist:before {
  content: "\eb46";
}

.isax-music-square:before {
  content: "\eb47";
}

.isax-music-square-add:before {
  content: "\eb48";
}

.isax-music-square-remove:before {
  content: "\eb49";
}

.isax-music-square-search:before {
  content: "\eb4a";
}

.isax-next:before {
  content: "\eb4b";
}

.isax-note:before {
  content: "\eb4c";
}

.isax-note-1:before {
  content: "\eb4d";
}

.isax-note-2:before {
  content: "\eb4e";
}

.isax-note-21:before {
  content: "\eb4f";
}

.isax-note-add:before {
  content: "\eb50";
}

.isax-note-favorite:before {
  content: "\eb51";
}

.isax-note-remove:before {
  content: "\eb52";
}

.isax-note-square:before {
  content: "\eb53";
}

.isax-note-text:before {
  content: "\eb54";
}

.isax-notification:before {
  content: "\eb55";
}

.isax-notification-1:before {
  content: "\eb56";
}

.isax-notification-bing:before {
  content: "\eb57";
}

.isax-notification-circle:before {
  content: "\eb58";
}

.isax-notification-favorite:before {
  content: "\eb59";
}

.isax-notification-status:before {
  content: "\eb5a";
}

.isax-omega-circle:before {
  content: "\eb5b";
}

.isax-omega-square:before {
  content: "\eb5c";
}

.isax-paintbucket:before {
  content: "\eb5d";
}

.isax-paperclip:before {
  content: "\eb5e";
}

.isax-paperclip-2:before {
  content: "\eb5f";
}

.isax-password-check:before {
  content: "\eb60";
}

.isax-path:before {
  content: "\eb61";
}

.isax-path-2:before {
  content: "\eb62";
}

.isax-path-square:before {
  content: "\eb63";
}

.isax-pause:before {
  content: "\eb64";
}

.isax-pause-circle:before {
  content: "\eb65";
}

.isax-pen-add:before {
  content: "\eb66";
}

.isax-pen-close:before {
  content: "\eb67";
}

.isax-pen-remove:before {
  content: "\eb68";
}

.isax-pen-tool:before {
  content: "\eb69";
}

.isax-pen-tool-2:before {
  content: "\eb6a";
}

.isax-people:before {
  content: "\eb6b";
}

.isax-percentage-circle:before {
  content: "\eb6c";
}

.isax-percentage-square:before {
  content: "\eb6d";
}

.isax-personalcard:before {
  content: "\eb6e";
}

.isax-pet:before {
  content: "\eb6f";
}

.isax-pharagraphspacing:before {
  content: "\eb70";
}

.isax-picture-frame:before {
  content: "\eb71";
}

.isax-play:before {
  content: "\eb72";
}

.isax-play-add:before {
  content: "\eb73";
}

.isax-play-circle:before {
  content: "\eb74";
}

.isax-play-cricle:before {
  content: "\eb75";
}

.isax-play-remove:before {
  content: "\eb76";
}

.isax-presention-chart:before {
  content: "\eb77";
}

.isax-previous:before {
  content: "\eb78";
}

.isax-printer:before {
  content: "\eb79";
}

.isax-printer-slash:before {
  content: "\eb7a";
}

.isax-profile-2user:before {
  content: "\eb7b";
}

.isax-profile-add:before {
  content: "\eb7c";
}

.isax-profile-circle:before {
  content: "\eb7d";
}

.isax-profile-delete:before {
  content: "\eb7e";
}

.isax-profile-remove:before {
  content: "\eb7f";
}

.isax-profile-tick:before {
  content: "\eb80";
}

.isax-programming-arrow:before {
  content: "\eb81";
}

.isax-programming-arrows:before {
  content: "\eb82";
}

.isax-quote-down:before {
  content: "\eb83";
}

.isax-quote-down-circle:before {
  content: "\eb84";
}

.isax-quote-down-square:before {
  content: "\eb85";
}

.isax-quote-up:before {
  content: "\eb86";
}

.isax-quote-up-circle:before {
  content: "\eb87";
}

.isax-quote-up-square:before {
  content: "\eb88";
}

.isax-radar:before {
  content: "\eb89";
}

.isax-radar-1:before {
  content: "\eb8a";
}

.isax-radar-2:before {
  content: "\eb8b";
}

.isax-radio:before {
  content: "\eb8c";
}

.isax-ram:before {
  content: "\eb8d";
}

.isax-ram-2:before {
  content: "\eb8e";
}

.isax-ranking:before {
  content: "\eb8f";
}

.isax-ranking-1:before {
  content: "\eb90";
}

.isax-receipt:before {
  content: "\eb91";
}

.isax-receipt-1:before {
  content: "\eb92";
}

.isax-receipt-2:before {
  content: "\eb93";
}

.isax-receipt-2-1:before {
  content: "\eb94";
}

.isax-receipt-add:before {
  content: "\eb95";
}

.isax-receipt-discount:before {
  content: "\eb96";
}

.isax-receipt-disscount:before {
  content: "\eb97";
}

.isax-receipt-edit:before {
  content: "\eb98";
}

.isax-receipt-item:before {
  content: "\eb99";
}

.isax-receipt-minus:before {
  content: "\eb9a";
}

.isax-receipt-search:before {
  content: "\eb9b";
}

.isax-receipt-square:before {
  content: "\eb9c";
}

.isax-receipt-text:before {
  content: "\eb9d";
}

.isax-received:before {
  content: "\eb9e";
}

.isax-receive-square:before {
  content: "\eb9f";
}

.isax-receive-square-2:before {
  content: "\eba0";
}

.isax-record:before {
  content: "\eba1";
}

.isax-record-circle:before {
  content: "\eba2";
}

.isax-recovery-convert:before {
  content: "\eba3";
}

.isax-redo:before {
  content: "\eba4";
}

.isax-refresh:before {
  content: "\eba5";
}

.isax-refresh-2:before {
  content: "\eba6";
}

.isax-refresh-circle:before {
  content: "\eba7";
}

.isax-refresh-left-square:before {
  content: "\eba8";
}

.isax-refresh-right-square:before {
  content: "\eba9";
}

.isax-refresh-square-2:before {
  content: "\ebaa";
}

.isax-repeat:before {
  content: "\ebab";
}

.isax-repeat-circle:before {
  content: "\ebac";
}

.isax-repeate-music:before {
  content: "\ebad";
}

.isax-repeate-one:before {
  content: "\ebae";
}

.isax-reserve:before {
  content: "\ebaf";
}

.isax-rotate-left:before {
  content: "\ebb0";
}

.isax-rotate-left-1:before {
  content: "\ebb1";
}

.isax-rotate-right:before {
  content: "\ebb2";
}

.isax-rotate-right-1:before {
  content: "\ebb3";
}

.isax-route-square:before {
  content: "\ebb4";
}

.isax-routing:before {
  content: "\ebb5";
}

.isax-routing-2:before {
  content: "\ebb6";
}

.isax-row-horizontal:before {
  content: "\ebb7";
}

.isax-row-vertical:before {
  content: "\ebb8";
}

.isax-rulerpen:before {
  content: "\ebb9";
}

.isax-ruler:before {
  content: "\ebba";
}

.isax-safe-home:before {
  content: "\ebbb";
}

.isax-sagittarius:before {
  content: "\ebbc";
}

.isax-save-2:before {
  content: "\ebbd";
}

.isax-save-add:before {
  content: "\ebbe";
}

.isax-save-minus:before {
  content: "\ebbf";
}

.isax-save-remove:before {
  content: "\ebc0";
}

.isax-scan:before {
  content: "\ebc1";
}

.isax-scan-barcode:before {
  content: "\ebc2";
}

.isax-scanner:before {
  content: "\ebc3";
}

.isax-scanning:before {
  content: "\ebc4";
}

.isax-scissor:before {
  content: "\ebc5";
}

.isax-scissor-1:before {
  content: "\ebc6";
}

.isax-screenmirroring:before {
  content: "\ebc7";
}

.isax-scroll:before {
  content: "\ebc8";
}

.isax-search-favorite:before {
  content: "\ebc9";
}

.isax-search-favorite-1:before {
  content: "\ebca";
}

.isax-search-normal:before {
  content: "\ebcb";
}

.isax-search-normal-1:before {
  content: "\ebcc";
}

.isax-search-status:before {
  content: "\ebcd";
}

.isax-search-status-1:before {
  content: "\ebce";
}

.isax-search-zoom-in:before {
  content: "\ebcf";
}

.isax-search-zoom-in-1:before {
  content: "\ebd0";
}

.isax-search-zoom-out:before {
  content: "\ebd1";
}

.isax-search-zoom-out-1:before {
  content: "\ebd2";
}

.isax-security:before {
  content: "\ebd3";
}

.isax-security-card:before {
  content: "\ebd4";
}

.isax-security-safe:before {
  content: "\ebd5";
}

.isax-security-time:before {
  content: "\ebd6";
}

.isax-security-user:before {
  content: "\ebd7";
}

.isax-send:before {
  content: "\ebd8";
}

.isax-send-1:before {
  content: "\ebd9";
}

.isax-send-2:before {
  content: "\ebda";
}

.isax-send-sqaure-2:before {
  content: "\ebdb";
}

.isax-send-square:before {
  content: "\ebdc";
}

.isax-setting:before {
  content: "\ebdd";
}

.isax-setting-2:before {
  content: "\ebde";
}

.isax-setting-3:before {
  content: "\ebdf";
}

.isax-setting-4:before {
  content: "\ebe0";
}

.isax-setting-5:before {
  content: "\ebe1";
}

.isax-settings:before {
  content: "\ebe2";
}

.isax-shapes:before {
  content: "\ebe3";
}

.isax-shapes-1:before {
  content: "\ebe4";
}

.isax-share:before {
  content: "\ebe5";
}

.isax-shield:before {
  content: "\ebe6";
}

.isax-shield-cross:before {
  content: "\ebe7";
}

.isax-shield-search:before {
  content: "\ebe8";
}

.isax-shield-slash:before {
  content: "\ebe9";
}

.isax-shield-tick:before {
  content: "\ebea";
}

.isax-ship:before {
  content: "\ebeb";
}

.isax-shop:before {
  content: "\ebec";
}

.isax-shop-add:before {
  content: "\ebed";
}

.isax-shopping-bag:before {
  content: "\ebee";
}

.isax-shopping-cart:before {
  content: "\ebef";
}

.isax-shop-remove:before {
  content: "\ebf0";
}

.isax-shuffle:before {
  content: "\ebf1";
}

.isax-sidebar-bottom:before {
  content: "\ebf2";
}

.isax-sidebar-left:before {
  content: "\ebf3";
}

.isax-sidebar-right:before {
  content: "\ebf4";
}

.isax-sidebar-top:before {
  content: "\ebf5";
}

.isax-signpost:before {
  content: "\ebf6";
}

.isax-simcard:before {
  content: "\ebf7";
}

.isax-simcard-1:before {
  content: "\ebf8";
}

.isax-simcard-2:before {
  content: "\ebf9";
}

.isax-size:before {
  content: "\ebfa";
}

.isax-slash:before {
  content: "\ebfb";
}

.isax-slider:before {
  content: "\ebfc";
}

.isax-slider-horizontal:before {
  content: "\ebfd";
}

.isax-slider-horizontal-1:before {
  content: "\ebfe";
}

.isax-slider-vertical:before {
  content: "\ebff";
}

.isax-slider-vertical-1:before {
  content: "\ec00";
}

.isax-smallcaps:before {
  content: "\ec01";
}

.isax-smart-car:before {
  content: "\ec02";
}

.isax-smart-home:before {
  content: "\ec03";
}

.isax-smileys:before {
  content: "\ec04";
}

.isax-sms:before {
  content: "\ec05";
}

.isax-sms-edit:before {
  content: "\ec06";
}

.isax-sms-notification:before {
  content: "\ec07";
}

.isax-sms-search:before {
  content: "\ec08";
}

.isax-sms-star:before {
  content: "\ec09";
}

.isax-sms-tracking:before {
  content: "\ec0a";
}

.isax-sort:before {
  content: "\ec0b";
}

.isax-sound:before {
  content: "\ec0c";
}

.isax-speaker:before {
  content: "\ec0d";
}

.isax-speedometer:before {
  content: "\ec0e";
}

.isax-star:before {
  content: "\ec0f";
}

.isax-star-1:before {
  content: "\ec10";
}

.isax-star-slash:before {
  content: "\ec11";
}

.isax-status:before {
  content: "\ec12";
}

.isax-status-up:before {
  content: "\ec13";
}

.isax-sticker:before {
  content: "\ec14";
}

.isax-stickynote:before {
  content: "\ec15";
}

.isax-stop:before {
  content: "\ec16";
}

.isax-stop-circle:before {
  content: "\ec17";
}

.isax-story:before {
  content: "\ec18";
}

.isax-strongbox:before {
  content: "\ec19";
}

.isax-strongbox-2:before {
  content: "\ec1a";
}

.isax-subtitle:before {
  content: "\ec1b";
}

.isax-sun:before {
  content: "\ec1c";
}

.isax-sun-1:before {
  content: "\ec1d";
}

.isax-sun-fog:before {
  content: "\ec1e";
}

.isax-tag:before {
  content: "\ec1f";
}

.isax-tag-2:before {
  content: "\ec20";
}

.isax-tag-cross:before {
  content: "\ec21";
}

.isax-tag-right:before {
  content: "\ec22";
}

.isax-tag-user:before {
  content: "\ec23";
}

.isax-task:before {
  content: "\ec24";
}

.isax-task-square:before {
  content: "\ec25";
}

.isax-teacher:before {
  content: "\ec26";
}

.isax-text:before {
  content: "\ec27";
}

.isax-textalign-center:before {
  content: "\ec28";
}

.isax-textalign-justifycenter:before {
  content: "\ec29";
}

.isax-textalign-justifyleft:before {
  content: "\ec2a";
}

.isax-textalign-justifyright:before {
  content: "\ec2b";
}

.isax-textalign-left:before {
  content: "\ec2c";
}

.isax-textalign-right:before {
  content: "\ec2d";
}

.isax-text-block:before {
  content: "\ec2e";
}

.isax-text-bold:before {
  content: "\ec2f";
}

.isax-text-italic:before {
  content: "\ec30";
}

.isax-text-underline:before {
  content: "\ec31";
}

.isax-tick-circle:before {
  content: "\ec32";
}

.isax-ticket:before {
  content: "\ec33";
}

.isax-ticket-2:before {
  content: "\ec34";
}

.isax-ticket-discount:before {
  content: "\ec35";
}

.isax-ticket-expired:before {
  content: "\ec36";
}

.isax-ticket-star:before {
  content: "\ec37";
}

.isax-tick-square:before {
  content: "\ec38";
}

.isax-timer:before {
  content: "\ec39";
}

.isax-timer-1:before {
  content: "\ec3a";
}

.isax-timer-pause:before {
  content: "\ec3b";
}

.isax-timer-start:before {
  content: "\ec3c";
}

.isax-toggle-off:before {
  content: "\ec3d";
}

.isax-toggle-off-circle:before {
  content: "\ec3e";
}

.isax-toggle-on:before {
  content: "\ec3f";
}

.isax-toggle-on-circle:before {
  content: "\ec40";
}

.isax-trade:before {
  content: "\ec41";
}

.isax-transaction-minus:before {
  content: "\ec42";
}

.isax-translate:before {
  content: "\ec43";
}

.isax-trash:before {
  content: "\ec44";
}

.isax-tree:before {
  content: "\ec45";
}

.isax-trend-down:before {
  content: "\ec46";
}

.isax-trend-up:before {
  content: "\ec47";
}

.isax-triangle:before {
  content: "\ec48";
}

.isax-truck:before {
  content: "\ec49";
}

.isax-truck-fast:before {
  content: "\ec4a";
}

.isax-truck-remove:before {
  content: "\ec4b";
}

.isax-truck-tick:before {
  content: "\ec4c";
}

.isax-truck-time:before {
  content: "\ec4d";
}

.isax-trush-square:before {
  content: "\ec4e";
}

.isax-undo:before {
  content: "\ec4f";
}

.isax-unlimited:before {
  content: "\ec50";
}

.isax-unlock:before {
  content: "\ec51";
}

.isax-user:before {
  content: "\ec52";
}

.isax-user-add:before {
  content: "\ec53";
}

.isax-user-cirlce-add:before {
  content: "\ec54";
}

.isax-user-edit:before {
  content: "\ec55";
}

.isax-user-minus:before {
  content: "\ec56";
}

.isax-user-octagon:before {
  content: "\ec57";
}

.isax-user-remove:before {
  content: "\ec58";
}

.isax-user-search:before {
  content: "\ec59";
}

.isax-user-square:before {
  content: "\ec5a";
}

.isax-user-tag:before {
  content: "\ec5b";
}

.isax-user-tick:before {
  content: "\ec5c";
}

.isax-verify:before {
  content: "\ec5d";
}

.isax-video:before {
  content: "\ec5e";
}

.isax-video-add:before {
  content: "\ec5f";
}

.isax-video-circle:before {
  content: "\ec60";
}

.isax-video-horizontal:before {
  content: "\ec61";
}

.isax-video-octagon:before {
  content: "\ec62";
}

.isax-video-play:before {
  content: "\ec63";
}

.isax-video-remove:before {
  content: "\ec64";
}

.isax-video-slash:before {
  content: "\ec65";
}

.isax-video-square:before {
  content: "\ec66";
}

.isax-video-tick:before {
  content: "\ec67";
}

.isax-video-time:before {
  content: "\ec68";
}

.isax-video-vertical:before {
  content: "\ec69";
}

.isax-voice-cricle:before {
  content: "\ec6a";
}

.isax-voice-square:before {
  content: "\ec6b";
}

.isax-volume-cross:before {
  content: "\ec6c";
}

.isax-volume-high:before {
  content: "\ec6d";
}

.isax-volume-low:before {
  content: "\ec6e";
}

.isax-volume-low-1:before {
  content: "\ec6f";
}

.isax-volume-mute:before {
  content: "\ec70";
}

.isax-volume-slash:before {
  content: "\ec71";
}

.isax-volume-up:before {
  content: "\ec72";
}

.isax-wallet:before {
  content: "\ec73";
}

.isax-wallet-1:before {
  content: "\ec74";
}

.isax-wallet-2:before {
  content: "\ec75";
}

.isax-wallet-3:before {
  content: "\ec76";
}

.isax-wallet-add:before {
  content: "\ec77";
}

.isax-wallet-add-1:before {
  content: "\ec78";
}

.isax-wallet-check:before {
  content: "\ec79";
}

.isax-wallet-minus:before {
  content: "\ec7a";
}

.isax-wallet-money:before {
  content: "\ec7b";
}

.isax-wallet-remove:before {
  content: "\ec7c";
}

.isax-wallet-search:before {
  content: "\ec7d";
}

.isax-warning-2:before {
  content: "\ec7e";
}

.isax-watch:before {
  content: "\ec7f";
}

.isax-watch-status:before {
  content: "\ec80";
}

.isax-weight:before {
  content: "\ec81";
}

.isax-weight-1:before {
  content: "\ec82";
}

.isax-wifi:before {
  content: "\ec83";
}

.isax-wifi-square:before {
  content: "\ec84";
}

.isax-wind:before {
  content: "\ec85";
}

.isax-wind-2:before {
  content: "\ec86";
}

.isax-woman:before {
  content: "\ec87";
}

.isax-dcube1 .path1:before {
  content: "\ec88";
  color: rgb(41, 45, 50);
}

.isax-dcube1 .path2:before {
  content: "\ec89";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-dcube1 .path3:before {
  content: "\ec8a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-d-cube-scan1 .path1:before {
  content: "\ec8b";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-d-cube-scan1 .path2:before {
  content: "\ec8c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-d-cube-scan1 .path3:before {
  content: "\ec8d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-d-cube-scan1 .path4:before {
  content: "\ec8e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-d-cube-scan1 .path5:before {
  content: "\ec8f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-d-rotate1 .path1:before {
  content: "\ec90";
  color: rgb(41, 45, 50);
}

.isax-d-rotate1 .path2:before {
  content: "\ec91";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-d-rotate1 .path3:before {
  content: "\ec92";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-d-rotate1 .path4:before {
  content: "\ec93";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-d-square1 .path1:before {
  content: "\ec94";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-d-square1 .path2:before {
  content: "\ec95";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-d-square1 .path3:before {
  content: "\ec96";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-d-square1 .path4:before {
  content: "\ec97";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-square1 .path1:before {
  content: "\ec98";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-square1 .path2:before {
  content: "\ec99";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-square1 .path3:before {
  content: "\ec9a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-support1 .path1:before {
  content: "\ec9b";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-support1 .path2:before {
  content: "\ec9c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-support1 .path3:before {
  content: "\ec9d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-activity1 .path1:before {
  content: "\ec9e";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-activity1 .path2:before {
  content: "\ec9f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-add1 .path1:before {
  content: "\eca0";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-add1 .path2:before {
  content: "\eca1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-add-circle1 .path1:before {
  content: "\eca2";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-add-circle1 .path2:before {
  content: "\eca3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-additem1 .path1:before {
  content: "\eca4";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-additem1 .path2:before {
  content: "\eca5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-additem1 .path3:before {
  content: "\eca6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-add-square1 .path1:before {
  content: "\eca7";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-add-square1 .path2:before {
  content: "\eca8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-airdrop1 .path1:before {
  content: "\eca9";
  color: rgb(41, 45, 50);
}

.isax-airdrop1 .path2:before {
  content: "\ecaa";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-airdrop1 .path3:before {
  content: "\ecab";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-airdrop1 .path4:before {
  content: "\ecac";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-airplane1 .path1:before {
  content: "\ecad";
  color: rgb(41, 45, 50);
}

.isax-airplane1 .path2:before {
  content: "\ecae";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-airplane-square1 .path1:before {
  content: "\ecaf";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-airplane-square1 .path2:before {
  content: "\ecb0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-airpod1 .path1:before {
  content: "\ecb1";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-airpod1 .path2:before {
  content: "\ecb2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-airpods1 .path1:before {
  content: "\ecb3";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-airpods1 .path2:before {
  content: "\ecb4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-airpods1 .path3:before {
  content: "\ecb5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-airpods1 .path4:before {
  content: "\ecb6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-airpods1 .path5:before {
  content: "\ecb7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-airpods1 .path6:before {
  content: "\ecb8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-alarm1 .path1:before {
  content: "\ecb9";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-alarm1 .path2:before {
  content: "\ecba";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-alarm1 .path3:before {
  content: "\ecbb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-alarm1 .path4:before {
  content: "\ecbc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-alarm1 .path5:before {
  content: "\ecbd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-align-bottom1 .path1:before {
  content: "\ecbe";
  color: rgb(41, 45, 50);
}

.isax-align-bottom1 .path2:before {
  content: "\ecbf";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-align-bottom1 .path3:before {
  content: "\ecc0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-align-horizontally1 .path1:before {
  content: "\ecc1";
  color: rgb(41, 45, 50);
}

.isax-align-horizontally1 .path2:before {
  content: "\ecc2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-align-horizontally1 .path3:before {
  content: "\ecc3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-align-horizontally1 .path4:before {
  content: "\ecc4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-align-horizontally1 .path5:before {
  content: "\ecc5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-align-left1 .path1:before {
  content: "\ecc6";
  color: rgb(41, 45, 50);
}

.isax-align-left1 .path2:before {
  content: "\ecc7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-align-left1 .path3:before {
  content: "\ecc8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-align-right1 .path1:before {
  content: "\ecc9";
  color: rgb(41, 45, 50);
}

.isax-align-right1 .path2:before {
  content: "\ecca";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-align-right1 .path3:before {
  content: "\eccb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-align-vertically1 .path1:before {
  content: "\eccc";
  color: rgb(41, 45, 50);
}

.isax-align-vertically1 .path2:before {
  content: "\eccd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-align-vertically1 .path3:before {
  content: "\ecce";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-align-vertically1 .path4:before {
  content: "\eccf";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-align-vertically1 .path5:before {
  content: "\ecd0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-aquarius1 .path1:before {
  content: "\ecd1";
  color: rgb(41, 45, 50);
}

.isax-aquarius1 .path2:before {
  content: "\ecd2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-archive1 .path1:before {
  content: "\ecd3";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-archive1 .path2:before {
  content: "\ecd4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-archive1 .path3:before {
  content: "\ecd5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-archive-11 .path1:before {
  content: "\ecd6";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-archive-11 .path2:before {
  content: "\ecd7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-archive-21 .path1:before {
  content: "\ecd8";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-archive-21 .path2:before {
  content: "\ecd9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-archive-add1 .path1:before {
  content: "\ecda";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-archive-add1 .path2:before {
  content: "\ecdb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-archive-book1 .path1:before {
  content: "\ecdc";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-archive-book1 .path2:before {
  content: "\ecdd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-archive-book1 .path3:before {
  content: "\ecde";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-archive-book1 .path4:before {
  content: "\ecdf";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-archive-minus1 .path1:before {
  content: "\ece0";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-archive-minus1 .path2:before {
  content: "\ece1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-archive-slash1 .path1:before {
  content: "\ece2";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-archive-slash1 .path2:before {
  content: "\ece3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-archive-slash1 .path3:before {
  content: "\ece4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-archive-tick1 .path1:before {
  content: "\ece5";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-archive-tick1 .path2:before {
  content: "\ece6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrange-circle1 .path1:before {
  content: "\ece7";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrange-circle1 .path2:before {
  content: "\ece8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrange-circle1 .path3:before {
  content: "\ece9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrange-circle-21 .path1:before {
  content: "\ecea";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrange-circle-21 .path2:before {
  content: "\eceb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrange-circle-21 .path3:before {
  content: "\ecec";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrange-square1 .path1:before {
  content: "\eced";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrange-square1 .path2:before {
  content: "\ecee";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrange-square1 .path3:before {
  content: "\ecef";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrange-square-21 .path1:before {
  content: "\ecf0";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrange-square-21 .path2:before {
  content: "\ecf1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrange-square-21 .path3:before {
  content: "\ecf2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow1 .path1:before {
  content: "\ecf3";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow1 .path2:before {
  content: "\ecf4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow1 .path3:before {
  content: "\ecf5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow1 .path4:before {
  content: "\ecf6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow1 .path5:before {
  content: "\ecf7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow1 .path6:before {
  content: "\ecf8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-21 .path1:before {
  content: "\ecf9";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-21 .path2:before {
  content: "\ecfa";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-31 .path1:before {
  content: "\ecfb";
  color: rgb(41, 45, 50);
}

.isax-arrow-31 .path2:before {
  content: "\ecfc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-bottom1 .path1:before {
  content: "\ecfd";
  color: rgb(41, 45, 50);
}

.isax-arrow-bottom1 .path2:before {
  content: "\ecfe";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-circle-down1 .path1:before {
  content: "\ecff";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-circle-down1 .path2:before {
  content: "\ed00";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-circle-left1 .path1:before {
  content: "\ed01";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-circle-left1 .path2:before {
  content: "\ed02";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-circle-right1 .path1:before {
  content: "\ed03";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-circle-right1 .path2:before {
  content: "\ed04";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-circle-up1 .path1:before {
  content: "\ed05";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-circle-up1 .path2:before {
  content: "\ed06";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-down1 .path1:before {
  content: "\ed07";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-down1 .path2:before {
  content: "\ed08";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-down-11 .path1:before {
  content: "\ed09";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-down-11 .path2:before {
  content: "\ed0a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-down-21 .path1:before {
  content: "\ed0b";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-down-21 .path2:before {
  content: "\ed0c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-left1 .path1:before {
  content: "\ed0d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-left1 .path2:before {
  content: "\ed0e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-left-11 .path1:before {
  content: "\ed0f";
  color: rgb(41, 45, 50);
}

.isax-arrow-left-11 .path2:before {
  content: "\ed10";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-left-21 .path1:before {
  content: "\ed11";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-left-21 .path2:before {
  content: "\ed12";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-left-31 .path1:before {
  content: "\ed13";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-left-31 .path2:before {
  content: "\ed14";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-right1 .path1:before {
  content: "\ed15";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-right1 .path2:before {
  content: "\ed16";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-right-11 .path1:before {
  content: "\ed17";
  color: rgb(41, 45, 50);
}

.isax-arrow-right-11 .path2:before {
  content: "\ed18";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-right-21 .path1:before {
  content: "\ed19";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-right-21 .path2:before {
  content: "\ed1a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-right-31 .path1:before {
  content: "\ed1b";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-right-31 .path2:before {
  content: "\ed1c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-square1 .path1:before {
  content: "\ed1d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-square1 .path2:before {
  content: "\ed1e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-square-down1 .path1:before {
  content: "\ed1f";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-square-down1 .path2:before {
  content: "\ed20";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-square-left1 .path1:before {
  content: "\ed21";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-square-left1 .path2:before {
  content: "\ed22";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-square-right .path1:before {
  content: "\ed23";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-square-right .path2:before {
  content: "\ed24";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-square-up1 .path1:before {
  content: "\ed25";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-square-up1 .path2:before {
  content: "\ed26";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-swap1 .path1:before {
  content: "\ed27";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-swap1 .path2:before {
  content: "\ed28";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-swap1 .path3:before {
  content: "\ed29";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-swap-horizontal1 .path1:before {
  content: "\ed2a";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-swap-horizontal1 .path2:before {
  content: "\ed2b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-swap-horizontal1 .path3:before {
  content: "\ed2c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-up1 .path1:before {
  content: "\ed2d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-up1 .path2:before {
  content: "\ed2e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-up-11 .path1:before {
  content: "\ed2f";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-up-11 .path2:before {
  content: "\ed30";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-up-21 .path1:before {
  content: "\ed31";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-arrow-up-21 .path2:before {
  content: "\ed32";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-arrow-up-31 .path1:before {
  content: "\ed33";
  color: rgb(41, 45, 50);
}

.isax-arrow-up-31 .path2:before {
  content: "\ed34";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-attach-circle1 .path1:before {
  content: "\ed35";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-attach-circle1 .path2:before {
  content: "\ed36";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-attach-square1 .path1:before {
  content: "\ed37";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-attach-square1 .path2:before {
  content: "\ed38";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-audio-square1 .path1:before {
  content: "\ed39";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-audio-square1 .path2:before {
  content: "\ed3a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-autobrightness1 .path1:before {
  content: "\ed3b";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-autobrightness1 .path2:before {
  content: "\ed3c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-autobrightness1 .path3:before {
  content: "\ed3d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-award1 .path1:before {
  content: "\ed3e";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-award1 .path2:before {
  content: "\ed3f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-award1 .path3:before {
  content: "\ed40";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-back-square1 .path1:before {
  content: "\ed41";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-back-square1 .path2:before {
  content: "\ed42";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-backward1 .path1:before {
  content: "\ed43";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-backward1 .path2:before {
  content: "\ed44";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-backward-5-seconds1 .path1:before {
  content: "\ed45";
  color: rgb(41, 45, 50);
}

.isax-backward-5-seconds1 .path2:before {
  content: "\ed46";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-backward-10-seconds1 .path1:before {
  content: "\ed47";
  color: rgb(41, 45, 50);
}

.isax-backward-10-seconds1 .path2:before {
  content: "\ed48";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-backward-10-seconds1 .path3:before {
  content: "\ed49";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-backward-15-seconds1 .path1:before {
  content: "\ed4a";
  color: rgb(41, 45, 50);
}

.isax-backward-15-seconds1 .path2:before {
  content: "\ed4b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-backward-15-seconds1 .path3:before {
  content: "\ed4c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-backward-item1 .path1:before {
  content: "\ed4d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-backward-item1 .path2:before {
  content: "\ed4e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-backward-item1 .path3:before {
  content: "\ed4f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bag1 .path1:before {
  content: "\ed50";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bag1 .path2:before {
  content: "\ed51";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bag-21 .path1:before {
  content: "\ed52";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bag-21 .path2:before {
  content: "\ed53";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bag-cross1 .path1:before {
  content: "\ed54";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bag-cross1 .path2:before {
  content: "\ed55";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bag-cross-11 .path1:before {
  content: "\ed56";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bag-cross-11 .path2:before {
  content: "\ed57";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bag-cross-11 .path3:before {
  content: "\ed58";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bag-cross-11 .path4:before {
  content: "\ed59";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bag-happy1 .path1:before {
  content: "\ed5a";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bag-happy1 .path2:before {
  content: "\ed5b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bag-tick1 .path1:before {
  content: "\ed5c";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bag-tick1 .path2:before {
  content: "\ed5d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bag-tick-21 .path1:before {
  content: "\ed5e";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bag-tick-21 .path2:before {
  content: "\ed5f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bag-tick-21 .path3:before {
  content: "\ed60";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bag-tick-21 .path4:before {
  content: "\ed61";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bag-timer1 .path1:before {
  content: "\ed62";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bag-timer1 .path2:before {
  content: "\ed63";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bag-timer1 .path3:before {
  content: "\ed64";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bag-timer1 .path4:before {
  content: "\ed65";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bank1 .path1:before {
  content: "\ed66";
  color: rgb(41, 45, 50);
}

.isax-bank1 .path2:before {
  content: "\ed67";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-bank1 .path3:before {
  content: "\ed68";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bank1 .path4:before {
  content: "\ed69";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-bank1 .path5:before {
  content: "\ed6a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bank1 .path6:before {
  content: "\ed6b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bank1 .path7:before {
  content: "\ed6c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-barcode1 .path1:before {
  content: "\ed6d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-barcode1 .path2:before {
  content: "\ed6e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-barcode1 .path3:before {
  content: "\ed6f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-barcode1 .path4:before {
  content: "\ed70";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-barcode1 .path5:before {
  content: "\ed71";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-barcode1 .path6:before {
  content: "\ed72";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-barcode1 .path7:before {
  content: "\ed73";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-barcode1 .path8:before {
  content: "\ed74";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-battery-3full1 .path1:before {
  content: "\ed75";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-battery-3full1 .path2:before {
  content: "\ed76";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-battery-3full1 .path3:before {
  content: "\ed77";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-battery-3full1 .path4:before {
  content: "\ed78";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-battery-charging1 .path1:before {
  content: "\ed79";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-battery-charging1 .path2:before {
  content: "\ed7a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-battery-charging1 .path3:before {
  content: "\ed7b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-battery-disable1 .path1:before {
  content: "\ed7c";
  color: rgb(41, 45, 50);
}

.isax-battery-disable1 .path2:before {
  content: "\ed7d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-battery-disable1 .path3:before {
  content: "\ed7e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-battery-disable1 .path4:before {
  content: "\ed7f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-battery-empty1 .path1:before {
  content: "\ed80";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-battery-empty1 .path2:before {
  content: "\ed81";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-battery-empty-11 .path1:before {
  content: "\ed82";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-battery-empty-11 .path2:before {
  content: "\ed83";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-battery-empty-11 .path3:before {
  content: "\ed84";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-battery-full1 .path1:before {
  content: "\ed85";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-battery-full1 .path2:before {
  content: "\ed86";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-battery-full1 .path3:before {
  content: "\ed87";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-battery-full1 .path4:before {
  content: "\ed88";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-battery-full1 .path5:before {
  content: "\ed89";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bezier1 .path1:before {
  content: "\ed8a";
  color: rgb(41, 45, 50);
}

.isax-bezier1 .path2:before {
  content: "\ed8b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bezier1 .path3:before {
  content: "\ed8c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bezier1 .path4:before {
  content: "\ed8d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bezier1 .path5:before {
  content: "\ed8e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bezier1 .path6:before {
  content: "\ed8f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.16;
}

.isax-bezier1 .path7:before {
  content: "\ed90";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.16;
}

.isax-bill1 .path1:before {
  content: "\ed91";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bill1 .path2:before {
  content: "\ed92";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bill1 .path3:before {
  content: "\ed93";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bill1 .path4:before {
  content: "\ed94";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bitcoin-card1 .path1:before {
  content: "\ed95";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bitcoin-card1 .path2:before {
  content: "\ed96";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bitcoin-card1 .path3:before {
  content: "\ed97";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bitcoin-convert1 .path1:before {
  content: "\ed98";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bitcoin-convert1 .path2:before {
  content: "\ed99";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bitcoin-convert1 .path3:before {
  content: "\ed9a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bitcoin-convert1 .path4:before {
  content: "\ed9b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bitcoin-convert1 .path5:before {
  content: "\ed9c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bitcoin-refresh1 .path1:before {
  content: "\ed9d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bitcoin-refresh1 .path2:before {
  content: "\ed9e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bitcoin-refresh1 .path3:before {
  content: "\ed9f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-blend1 .path1:before {
  content: "\eda0";
  color: rgb(41, 45, 50);
}

.isax-blend1 .path2:before {
  content: "\eda1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-blend-21 .path1:before {
  content: "\eda2";
  color: rgb(41, 45, 50);
}

.isax-blend-21 .path2:before {
  content: "\eda3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-blend-21 .path3:before {
  content: "\eda4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-blend-21 .path4:before {
  content: "\eda5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-blend-21 .path5:before {
  content: "\eda6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bluetooth1 .path1:before {
  content: "\eda7";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bluetooth1 .path2:before {
  content: "\eda8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bluetooth-21 .path1:before {
  content: "\eda9";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bluetooth-21 .path2:before {
  content: "\edaa";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bluetooth-21 .path3:before {
  content: "\edab";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bluetooth-21 .path4:before {
  content: "\edac";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bluetooth-circle1 .path1:before {
  content: "\edad";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bluetooth-circle1 .path2:before {
  content: "\edae";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bluetooth-rectangle1 .path1:before {
  content: "\edaf";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bluetooth-rectangle1 .path2:before {
  content: "\edb0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-blur1 .path1:before {
  content: "\edb1";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-blur1 .path2:before {
  content: "\edb2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-book1 .path1:before {
  content: "\edb3";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-book1 .path2:before {
  content: "\edb4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-book1 .path3:before {
  content: "\edb5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-book1 .path4:before {
  content: "\edb6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-book-11 .path1:before {
  content: "\edb7";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-book-11 .path2:before {
  content: "\edb8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-book-11 .path3:before {
  content: "\edb9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-book-11 .path4:before {
  content: "\edba";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bookmark1 .path1:before {
  content: "\edbb";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bookmark1 .path2:before {
  content: "\edbc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bookmark-21 .path1:before {
  content: "\edbd";
  color: rgb(41, 45, 50);
}

.isax-bookmark-21 .path2:before {
  content: "\edbe";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-book-saved1 .path1:before {
  content: "\edbf";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-book-saved1 .path2:before {
  content: "\edc0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-book-saved1 .path3:before {
  content: "\edc1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-book-square1 .path1:before {
  content: "\edc2";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-book-square1 .path2:before {
  content: "\edc3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-book-square1 .path3:before {
  content: "\edc4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-box1 .path1:before {
  content: "\edc5";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-box1 .path2:before {
  content: "\edc6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-box1 .path3:before {
  content: "\edc7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-box1 .path4:before {
  content: "\edc8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-box1 .path5:before {
  content: "\edc9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-box-11 .path1:before {
  content: "\edca";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-box-11 .path2:before {
  content: "\edcb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-box-11 .path3:before {
  content: "\edcc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-box-21 .path1:before {
  content: "\edcd";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-box-21 .path2:before {
  content: "\edce";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-box-21 .path3:before {
  content: "\edcf";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-box-21 .path4:before {
  content: "\edd0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-box-21 .path5:before {
  content: "\edd1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-box-21 .path6:before {
  content: "\edd2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-box-21 .path7:before {
  content: "\edd3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-box-add1 .path1:before {
  content: "\edd4";
  color: rgb(41, 45, 50);
}

.isax-box-add1 .path2:before {
  content: "\edd5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-box-add1 .path3:before {
  content: "\edd6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-box-add1 .path4:before {
  content: "\edd7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-box-remove1 .path1:before {
  content: "\edd8";
  color: rgb(41, 45, 50);
}

.isax-box-remove1 .path2:before {
  content: "\edd9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-box-remove1 .path3:before {
  content: "\edda";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-box-remove1 .path4:before {
  content: "\eddb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-box-search1 .path1:before {
  content: "\eddc";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-box-search1 .path2:before {
  content: "\eddd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-box-search1 .path3:before {
  content: "\edde";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-box-search1 .path4:before {
  content: "\eddf";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-box-tick1 .path1:before {
  content: "\ede0";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-box-tick1 .path2:before {
  content: "\ede1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-box-tick1 .path3:before {
  content: "\ede2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-box-tick1 .path4:before {
  content: "\ede3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-box-time1 .path1:before {
  content: "\ede4";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-box-time1 .path2:before {
  content: "\ede5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-box-time1 .path3:before {
  content: "\ede6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-box-time1 .path4:before {
  content: "\ede7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-briefcase1 .path1:before {
  content: "\ede8";
  color: rgb(41, 45, 50);
}

.isax-briefcase1 .path2:before {
  content: "\ede9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-brifecase-cross1 .path1:before {
  content: "\edea";
  color: rgb(41, 45, 50);
}

.isax-brifecase-cross1 .path2:before {
  content: "\edeb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-brifecase-cross1 .path3:before {
  content: "\edec";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-brifecase-tick1 .path1:before {
  content: "\eded";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-brifecase-tick1 .path2:before {
  content: "\edee";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-brifecase-tick1 .path3:before {
  content: "\edef";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-brifecase-timer1 .path1:before {
  content: "\edf0";
  color: rgb(41, 45, 50);
}

.isax-brifecase-timer1 .path2:before {
  content: "\edf1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-brifecase-timer1 .path3:before {
  content: "\edf2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-broom1 .path1:before {
  content: "\edf3";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-broom1 .path2:before {
  content: "\edf4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-broom1 .path3:before {
  content: "\edf5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-broom1 .path4:before {
  content: "\edf6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-broom1 .path5:before {
  content: "\edf7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-broom1 .path6:before {
  content: "\edf8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-brush1 .path1:before {
  content: "\edf9";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-brush1 .path2:before {
  content: "\edfa";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-brush1 .path3:before {
  content: "\edfb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-brush1 .path4:before {
  content: "\edfc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-brush-11 .path1:before {
  content: "\edfd";
  color: rgb(41, 45, 50);
}

.isax-brush-11 .path2:before {
  content: "\edfe";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-brush-21 .path1:before {
  content: "\edff";
  color: rgb(41, 45, 50);
}

.isax-brush-21 .path2:before {
  content: "\ee00";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-brush-21 .path3:before {
  content: "\ee01";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-brush-21 .path4:before {
  content: "\ee02";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-brush-31 .path1:before {
  content: "\ee03";
  color: rgb(41, 45, 50);
}

.isax-brush-31 .path2:before {
  content: "\ee04";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-brush-31 .path3:before {
  content: "\ee05";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-brush-41 .path1:before {
  content: "\ee06";
  color: rgb(41, 45, 50);
}

.isax-brush-41 .path2:before {
  content: "\ee07";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-brush-41 .path3:before {
  content: "\ee08";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bubble1 .path1:before {
  content: "\ee09";
  color: rgb(41, 45, 50);
}

.isax-bubble1 .path2:before {
  content: "\ee0a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bubble1 .path3:before {
  content: "\ee0b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bucket1 .path1:before {
  content: "\ee0c";
  color: rgb(41, 45, 50);
}

.isax-bucket1 .path2:before {
  content: "\ee0d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bucket1 .path3:before {
  content: "\ee0e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bucket1 .path4:before {
  content: "\ee0f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bucket-circle1 .path1:before {
  content: "\ee10";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bucket-circle1 .path2:before {
  content: "\ee11";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bucket-circle1 .path3:before {
  content: "\ee12";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bucket-square1 .path1:before {
  content: "\ee13";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bucket-square1 .path2:before {
  content: "\ee14";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bucket-square1 .path3:before {
  content: "\ee15";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-building1 .path1:before {
  content: "\ee16";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-building1 .path2:before {
  content: "\ee17";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-building1 .path3:before {
  content: "\ee18";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-building1 .path4:before {
  content: "\ee19";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-building1 .path5:before {
  content: "\ee1a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-building1 .path6:before {
  content: "\ee1b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-building-31 .path1:before {
  content: "\ee1c";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-building-31 .path2:before {
  content: "\ee1d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-building-31 .path3:before {
  content: "\ee1e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-building-31 .path4:before {
  content: "\ee1f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-building-31 .path5:before {
  content: "\ee20";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-building-41 .path1:before {
  content: "\ee21";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-building-41 .path2:before {
  content: "\ee22";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-building-41 .path3:before {
  content: "\ee23";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-building-41 .path4:before {
  content: "\ee24";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-building-41 .path5:before {
  content: "\ee25";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-buildings1 .path1:before {
  content: "\ee26";
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-buildings1 .path2:before {
  content: "\ee27";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-buildings1 .path3:before {
  content: "\ee28";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-buildings1 .path4:before {
  content: "\ee29";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-buildings1 .path5:before {
  content: "\ee2a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-buildings1 .path6:before {
  content: "\ee2b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-buildings-21 .path1:before {
  content: "\ee2c";
  color: rgb(41, 45, 50);
}

.isax-buildings-21 .path2:before {
  content: "\ee2d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-buildings-21 .path3:before {
  content: "\ee2e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-buildings-21 .path4:before {
  content: "\ee2f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-buildings-21 .path5:before {
  content: "\ee30";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-buildings-21 .path6:before {
  content: "\ee31";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-buliding1 .path1:before {
  content: "\ee32";
  color: rgb(41, 45, 50);
}

.isax-buliding1 .path2:before {
  content: "\ee33";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-buliding1 .path3:before {
  content: "\ee34";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-buliding1 .path4:before {
  content: "\ee35";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-buliding1 .path5:before {
  content: "\ee36";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-buliding1 .path6:before {
  content: "\ee37";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-buliding1 .path7:before {
  content: "\ee38";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-buliding1 .path8:before {
  content: "\ee39";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bus1 .path1:before {
  content: "\ee3a";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-bus1 .path2:before {
  content: "\ee3b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bus1 .path3:before {
  content: "\ee3c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bus1 .path4:before {
  content: "\ee3d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-bus1 .path5:before {
  content: "\ee3e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-buy-crypto1 .path1:before {
  content: "\ee3f";
  color: rgb(41, 45, 50);
}

.isax-buy-crypto1 .path2:before {
  content: "\ee40";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-buy-crypto1 .path3:before {
  content: "\ee41";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cake1 .path1:before {
  content: "\ee42";
  color: rgb(41, 45, 50);
}

.isax-cake1 .path2:before {
  content: "\ee43";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cake1 .path3:before {
  content: "\ee44";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cake1 .path4:before {
  content: "\ee45";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cake1 .path5:before {
  content: "\ee46";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cake1 .path6:before {
  content: "\ee47";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-calculator1 .path1:before {
  content: "\ee48";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-calculator1 .path2:before {
  content: "\ee49";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calculator1 .path3:before {
  content: "\ee4a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calculator1 .path4:before {
  content: "\ee4b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calculator1 .path5:before {
  content: "\ee4c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calculator1 .path6:before {
  content: "\ee4d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calculator1 .path7:before {
  content: "\ee4e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calculator1 .path8:before {
  content: "\ee4f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar1 .path1:before {
  content: "\ee50";
  color: rgb(41, 45, 50);
}

.isax-calendar1 .path2:before {
  content: "\ee51";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-calendar1 .path3:before {
  content: "\ee52";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar1 .path4:before {
  content: "\ee53";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar1 .path5:before {
  content: "\ee54";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar1 .path6:before {
  content: "\ee55";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar1 .path7:before {
  content: "\ee56";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar1 .path8:before {
  content: "\ee57";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar-11 .path1:before {
  content: "\ee58";
  color: rgb(41, 45, 50);
}

.isax-calendar-11 .path2:before {
  content: "\ee59";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar-11 .path3:before {
  content: "\ee5a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-calendar-11 .path4:before {
  content: "\ee5b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar-11 .path5:before {
  content: "\ee5c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar-21 .path1:before {
  content: "\ee5d";
  color: rgb(41, 45, 50);
}

.isax-calendar-21 .path2:before {
  content: "\ee5e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-calendar-21 .path3:before {
  content: "\ee5f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar-21 .path4:before {
  content: "\ee60";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar-21 .path5:before {
  content: "\ee61";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar-add1 .path1:before {
  content: "\ee62";
  color: rgb(41, 45, 50);
}

.isax-calendar-add1 .path2:before {
  content: "\ee63";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-calendar-add1 .path3:before {
  content: "\ee64";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar-add1 .path4:before {
  content: "\ee65";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar-add1 .path5:before {
  content: "\ee66";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar-add1 .path6:before {
  content: "\ee67";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar-circle1 .path1:before {
  content: "\ee68";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-calendar-circle1 .path2:before {
  content: "\ee69";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar-circle1 .path3:before {
  content: "\ee6a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar-edit1 .path1:before {
  content: "\ee6b";
  color: rgb(41, 45, 50);
}

.isax-calendar-edit1 .path2:before {
  content: "\ee6c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-calendar-edit1 .path3:before {
  content: "\ee6d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar-remove1 .path1:before {
  content: "\ee6e";
  color: rgb(41, 45, 50);
}

.isax-calendar-remove1 .path2:before {
  content: "\ee6f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-calendar-remove1 .path3:before {
  content: "\ee70";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar-remove1 .path4:before {
  content: "\ee71";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar-remove1 .path5:before {
  content: "\ee72";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar-remove1 .path6:before {
  content: "\ee73";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar-search1 .path1:before {
  content: "\ee74";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-calendar-search1 .path2:before {
  content: "\ee75";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar-search1 .path3:before {
  content: "\ee76";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar-tick1 .path1:before {
  content: "\ee77";
  color: rgb(41, 45, 50);
}

.isax-calendar-tick1 .path2:before {
  content: "\ee78";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-calendar-tick1 .path3:before {
  content: "\ee79";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar-tick1 .path4:before {
  content: "\ee7a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar-tick1 .path5:before {
  content: "\ee7b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-calendar-tick1 .path6:before {
  content: "\ee7c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-call1 .path1:before {
  content: "\ee7d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-call1 .path2:before {
  content: "\ee7e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-call-add1 .path1:before {
  content: "\ee7f";
  color: rgb(41, 45, 50);
}

.isax-call-add1 .path2:before {
  content: "\ee80";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-call-add1 .path3:before {
  content: "\ee81";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-call-calling1 .path1:before {
  content: "\ee82";
  color: rgb(41, 45, 50);
}

.isax-call-calling1 .path2:before {
  content: "\ee83";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-call-calling1 .path3:before {
  content: "\ee84";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-call-calling1 .path4:before {
  content: "\ee85";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-call-incoming1 .path1:before {
  content: "\ee86";
  color: rgb(41, 45, 50);
}

.isax-call-incoming1 .path2:before {
  content: "\ee87";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-call-incoming1 .path3:before {
  content: "\ee88";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-call-minus1 .path1:before {
  content: "\ee89";
  color: rgb(41, 45, 50);
}

.isax-call-minus1 .path2:before {
  content: "\ee8a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-call-minus1 .path3:before {
  content: "\ee8b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-call-outgoing1 .path1:before {
  content: "\ee8c";
  color: rgb(41, 45, 50);
}

.isax-call-outgoing1 .path2:before {
  content: "\ee8d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-call-outgoing1 .path3:before {
  content: "\ee8e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-call-received1 .path1:before {
  content: "\ee8f";
  color: rgb(41, 45, 50);
}

.isax-call-received1 .path2:before {
  content: "\ee90";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-call-received1 .path3:before {
  content: "\ee91";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-call-remove1 .path1:before {
  content: "\ee92";
  color: rgb(41, 45, 50);
}

.isax-call-remove1 .path2:before {
  content: "\ee93";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-call-remove1 .path3:before {
  content: "\ee94";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-call-slash1 .path1:before {
  content: "\ee95";
  color: rgb(41, 45, 50);
}

.isax-call-slash1 .path2:before {
  content: "\ee96";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-call-slash1 .path3:before {
  content: "\ee97";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-camera1 .path1:before {
  content: "\ee98";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-camera1 .path2:before {
  content: "\ee99";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-camera1 .path3:before {
  content: "\ee9a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-camera-slash1 .path1:before {
  content: "\ee9b";
  color: rgb(41, 45, 50);
}

.isax-camera-slash1 .path2:before {
  content: "\ee9c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-camera-slash1 .path3:before {
  content: "\ee9d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-camera-slash1 .path4:before {
  content: "\ee9e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-camera-slash1 .path5:before {
  content: "\ee9f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-camera-slash1 .path6:before {
  content: "\eea0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-candle1 .path1:before {
  content: "\eea1";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-candle1 .path2:before {
  content: "\eea2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-candle-21 .path1:before {
  content: "\eea3";
  color: rgb(41, 45, 50);
}

.isax-candle-21 .path2:before {
  content: "\eea4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-car1 .path1:before {
  content: "\eea5";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-car1 .path2:before {
  content: "\eea6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-car1 .path3:before {
  content: "\eea7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-car1 .path4:before {
  content: "\eea8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card1 .path1:before {
  content: "\eea9";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-card1 .path2:before {
  content: "\eeaa";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card1 .path3:before {
  content: "\eeab";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card1 .path4:before {
  content: "\eeac";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card-add1 .path1:before {
  content: "\eead";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-card-add1 .path2:before {
  content: "\eeae";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card-add1 .path3:before {
  content: "\eeaf";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card-coin1 .path1:before {
  content: "\eeb0";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-card-coin1 .path2:before {
  content: "\eeb1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card-coin1 .path3:before {
  content: "\eeb2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-card-coin1 .path4:before {
  content: "\eeb3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-card-coin1 .path5:before {
  content: "\eeb4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-card-coin1 .path6:before {
  content: "\eeb5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card-edit1 .path1:before {
  content: "\eeb6";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-card-edit1 .path2:before {
  content: "\eeb7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card-edit1 .path3:before {
  content: "\eeb8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card-pos1 .path1:before {
  content: "\eeb9";
  color: rgb(41, 45, 50);
}

.isax-card-pos1 .path2:before {
  content: "\eeba";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-card-pos1 .path3:before {
  content: "\eebb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card-pos1 .path4:before {
  content: "\eebc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card-pos1 .path5:before {
  content: "\eebd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card-receive1 .path1:before {
  content: "\eebe";
  color: rgb(41, 45, 50);
}

.isax-card-receive1 .path2:before {
  content: "\eebf";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-card-receive1 .path3:before {
  content: "\eec0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card-remove1 .path1:before {
  content: "\eec1";
  color: rgb(41, 45, 50);
}

.isax-card-remove1 .path2:before {
  content: "\eec2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card-remove1 .path3:before {
  content: "\eec3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-card-remove1 .path4:before {
  content: "\eec4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card-remove-11 .path1:before {
  content: "\eec5";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-card-remove-11 .path2:before {
  content: "\eec6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card-remove-11 .path3:before {
  content: "\eec7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cards1 .path1:before {
  content: "\eec8";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cards1 .path2:before {
  content: "\eec9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cards1 .path3:before {
  content: "\eeca";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cards1 .path4:before {
  content: "\eecb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cards1 .path5:before {
  content: "\eecc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card-send1 .path1:before {
  content: "\eecd";
  color: rgb(41, 45, 50);
}

.isax-card-send1 .path2:before {
  content: "\eece";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-card-send1 .path3:before {
  content: "\eecf";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card-slash1 .path1:before {
  content: "\eed0";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-card-slash1 .path2:before {
  content: "\eed1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-card-slash1 .path3:before {
  content: "\eed2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card-slash1 .path4:before {
  content: "\eed3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card-slash1 .path5:before {
  content: "\eed4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card-slash1 .path6:before {
  content: "\eed5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card-slash1 .path7:before {
  content: "\eed6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card-tick1 .path1:before {
  content: "\eed7";
  color: rgb(41, 45, 50);
}

.isax-card-tick1 .path2:before {
  content: "\eed8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card-tick1 .path3:before {
  content: "\eed9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-card-tick1 .path4:before {
  content: "\eeda";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card-tick-11 .path1:before {
  content: "\eedb";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-card-tick-11 .path2:before {
  content: "\eedc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-card-tick-11 .path3:before {
  content: "\eedd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-category1 .path1:before {
  content: "\eede";
  color: rgb(41, 45, 50);
}

.isax-category1 .path2:before {
  content: "\eedf";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-category1 .path3:before {
  content: "\eee0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-category1 .path4:before {
  content: "\eee1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-category-21 .path1:before {
  content: "\eee2";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-category-21 .path2:before {
  content: "\eee3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-category-21 .path3:before {
  content: "\eee4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-category-21 .path4:before {
  content: "\eee5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cd1 .path1:before {
  content: "\eee6";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cd1 .path2:before {
  content: "\eee7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-chart1 .path1:before {
  content: "\eee8";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-chart1 .path2:before {
  content: "\eee9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-chart1 .path3:before {
  content: "\eeea";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-chart1 .path4:before {
  content: "\eeeb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-chart-11 .path1:before {
  content: "\eeec";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-chart-11 .path2:before {
  content: "\eeed";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-chart-11 .path3:before {
  content: "\eeee";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-chart-11 .path4:before {
  content: "\eeef";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-chart-22 .path1:before {
  content: "\eef0";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-chart-22 .path2:before {
  content: "\eef1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-chart-22 .path3:before {
  content: "\eef2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-chart-31 .path1:before {
  content: "\eef3";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-chart-31 .path2:before {
  content: "\eef4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-chart-31 .path3:before {
  content: "\eef5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-chart-211 .path1:before {
  content: "\eef6";
  color: rgb(41, 45, 50);
}

.isax-chart-211 .path2:before {
  content: "\eef7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-chart-211 .path3:before {
  content: "\eef8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-chart-211 .path4:before {
  content: "\eef9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-chart-square1 .path1:before {
  content: "\eefa";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-chart-square1 .path2:before {
  content: "\eefb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-chart-square1 .path3:before {
  content: "\eefc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-chart-square1 .path4:before {
  content: "\eefd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-chart-success1 .path1:before {
  content: "\eefe";
  color: rgb(41, 45, 50);
}

.isax-chart-success1 .path2:before {
  content: "\eeff";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-chart-success1 .path3:before {
  content: "\ef00";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-chart-success1 .path4:before {
  content: "\ef01";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-chart-success1 .path5:before {
  content: "\ef02";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-check1 .path1:before {
  content: "\ef03";
  color: rgb(41, 45, 50);
}

.isax-check1 .path2:before {
  content: "\ef04";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-check1 .path3:before {
  content: "\ef05";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-check1 .path4:before {
  content: "\ef06";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-chrome1 .path1:before {
  content: "\ef07";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-chrome1 .path2:before {
  content: "\ef08";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-clipboard1 .path1:before {
  content: "\ef09";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-clipboard1 .path2:before {
  content: "\ef0a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-clipboard1 .path3:before {
  content: "\ef0b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-clipboard-close1 .path1:before {
  content: "\ef0c";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-clipboard-close1 .path2:before {
  content: "\ef0d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-clipboard-close1 .path3:before {
  content: "\ef0e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-clipboard-export1 .path1:before {
  content: "\ef0f";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-clipboard-export1 .path2:before {
  content: "\ef10";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-clipboard-export1 .path3:before {
  content: "\ef11";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-clipboard-import1 .path1:before {
  content: "\ef12";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-clipboard-import1 .path2:before {
  content: "\ef13";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-clipboard-import1 .path3:before {
  content: "\ef14";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-clipboard-text1 .path1:before {
  content: "\ef15";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-clipboard-text1 .path2:before {
  content: "\ef16";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-clipboard-text1 .path3:before {
  content: "\ef17";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-clipboard-text1 .path4:before {
  content: "\ef18";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-clipboard-tick1 .path1:before {
  content: "\ef19";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-clipboard-tick1 .path2:before {
  content: "\ef1a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-clipboard-tick1 .path3:before {
  content: "\ef1b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-clock1 .path1:before {
  content: "\ef1c";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-clock1 .path2:before {
  content: "\ef1d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-clock1 .path3:before {
  content: "\ef1e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-clock1 .path4:before {
  content: "\ef1f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-clock-11 .path1:before {
  content: "\ef20";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-clock-11 .path2:before {
  content: "\ef21";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-close-circle1 .path1:before {
  content: "\ef22";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-close-circle1 .path2:before {
  content: "\ef23";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-close-square1 .path1:before {
  content: "\ef24";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-close-square1 .path2:before {
  content: "\ef25";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cloud1 .path1:before {
  content: "\ef26";
  color: rgb(41, 45, 50);
}

.isax-cloud1 .path2:before {
  content: "\ef27";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cloud-add1 .path1:before {
  content: "\ef28";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cloud-add1 .path2:before {
  content: "\ef29";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cloud-change1 .path1:before {
  content: "\ef2a";
  color: rgb(41, 45, 50);
}

.isax-cloud-change1 .path2:before {
  content: "\ef2b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cloud-change1 .path3:before {
  content: "\ef2c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cloud-connection1 .path1:before {
  content: "\ef2d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cloud-connection1 .path2:before {
  content: "\ef2e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cloud-cross1 .path1:before {
  content: "\ef2f";
  color: rgb(41, 45, 50);
}

.isax-cloud-cross1 .path2:before {
  content: "\ef30";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cloud-drizzle1 .path1:before {
  content: "\ef31";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cloud-drizzle1 .path2:before {
  content: "\ef32";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cloud-fog1 .path1:before {
  content: "\ef33";
  color: rgb(41, 45, 50);
}

.isax-cloud-fog1 .path2:before {
  content: "\ef34";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cloud-fog1 .path3:before {
  content: "\ef35";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cloud-fog1 .path4:before {
  content: "\ef36";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cloud-lightning1 .path1:before {
  content: "\ef37";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cloud-lightning1 .path2:before {
  content: "\ef38";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cloud-minus1 .path1:before {
  content: "\ef39";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cloud-minus1 .path2:before {
  content: "\ef3a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cloud-notif1 .path1:before {
  content: "\ef3b";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cloud-notif1 .path2:before {
  content: "\ef3c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cloud-plus1 .path1:before {
  content: "\ef3d";
  color: rgb(41, 45, 50);
}

.isax-cloud-plus1 .path2:before {
  content: "\ef3e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cloud-remove1 .path1:before {
  content: "\ef3f";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cloud-remove1 .path2:before {
  content: "\ef40";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cloud-snow1 .path1:before {
  content: "\ef41";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cloud-snow1 .path2:before {
  content: "\ef42";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cloud-sunny1 .path1:before {
  content: "\ef43";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cloud-sunny1 .path2:before {
  content: "\ef44";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-code1 .path1:before {
  content: "\ef45";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-code1 .path2:before {
  content: "\ef46";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-code1 .path3:before {
  content: "\ef47";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-code-11 .path1:before {
  content: "\ef48";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-code-11 .path2:before {
  content: "\ef49";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-code-11 .path3:before {
  content: "\ef4a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-code-11 .path4:before {
  content: "\ef4b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-code-circle1 .path1:before {
  content: "\ef4c";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-code-circle1 .path2:before {
  content: "\ef4d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-code-circle1 .path3:before {
  content: "\ef4e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-code-circle1 .path4:before {
  content: "\ef4f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-coffee1 .path1:before {
  content: "\ef50";
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-coffee1 .path2:before {
  content: "\ef51";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-coffee1 .path3:before {
  content: "\ef52";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-coffee1 .path4:before {
  content: "\ef53";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-coffee1 .path5:before {
  content: "\ef54";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-coffee1 .path6:before {
  content: "\ef55";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-coin1 .path1:before {
  content: "\ef56";
  color: rgb(41, 45, 50);
}

.isax-coin1 .path2:before {
  content: "\ef57";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-coin1 .path3:before {
  content: "\ef58";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-coin-11 .path1:before {
  content: "\ef59";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-coin-11 .path2:before {
  content: "\ef5a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-coin-11 .path3:before {
  content: "\ef5b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-colorfilter1 .path1:before {
  content: "\ef5c";
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-colorfilter1 .path2:before {
  content: "\ef5d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-colorfilter1 .path3:before {
  content: "\ef5e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-colors-square1 .path1:before {
  content: "\ef5f";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-colors-square1 .path2:before {
  content: "\ef60";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-colors-square1 .path3:before {
  content: "\ef61";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-colors-square1 .path4:before {
  content: "\ef62";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-color-swatch1 .path1:before {
  content: "\ef63";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-color-swatch1 .path2:before {
  content: "\ef64";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-color-swatch1 .path3:before {
  content: "\ef65";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-command1 .path1:before {
  content: "\ef66";
  color: rgb(41, 45, 50);
}

.isax-command1 .path2:before {
  content: "\ef67";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-command1 .path3:before {
  content: "\ef68";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-command1 .path4:before {
  content: "\ef69";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-command1 .path5:before {
  content: "\ef6a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-command-square1 .path1:before {
  content: "\ef6b";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-command-square1 .path2:before {
  content: "\ef6c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-command-square1 .path3:before {
  content: "\ef6d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-command-square1 .path4:before {
  content: "\ef6e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-command-square1 .path5:before {
  content: "\ef6f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-command-square1 .path6:before {
  content: "\ef70";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-component1:before {
  content: "\ef71";
}

.isax-computing1 .path1:before {
  content: "\ef72";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-computing1 .path2:before {
  content: "\ef73";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-computing1 .path3:before {
  content: "\ef74";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-computing1 .path4:before {
  content: "\ef75";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-convert1 .path1:before {
  content: "\ef76";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-convert1 .path2:before {
  content: "\ef77";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-convert1 .path3:before {
  content: "\ef78";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-convert-3d-cube1 .path1:before {
  content: "\ef79";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-convert-3d-cube1 .path2:before {
  content: "\ef7a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-convert-3d-cube1 .path3:before {
  content: "\ef7b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-convert-3d-cube1 .path4:before {
  content: "\ef7c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-convert-3d-cube1 .path5:before {
  content: "\ef7d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-convert-3d-cube1 .path6:before {
  content: "\ef7e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-convert-3d-cube1 .path7:before {
  content: "\ef7f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-convert-3d-cube1 .path8:before {
  content: "\ef80";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-convert-card1 .path1:before {
  content: "\ef81";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-convert-card1 .path2:before {
  content: "\ef82";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-convert-card1 .path3:before {
  content: "\ef83";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-convert-card1 .path4:before {
  content: "\ef84";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-convert-card1 .path5:before {
  content: "\ef85";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-convert-card1 .path6:before {
  content: "\ef86";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-convertshape1 .path1:before {
  content: "\ef87";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-convertshape1 .path2:before {
  content: "\ef88";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-convertshape1 .path3:before {
  content: "\ef89";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-convertshape1 .path4:before {
  content: "\ef8a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-convertshape-21 .path1:before {
  content: "\ef8b";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-convertshape-21 .path2:before {
  content: "\ef8c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-convertshape-21 .path3:before {
  content: "\ef8d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-convertshape-21 .path4:before {
  content: "\ef8e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-copy1 .path1:before {
  content: "\ef8f";
  color: rgb(41, 45, 50);
}

.isax-copy1 .path2:before {
  content: "\ef90";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-copyright1 .path1:before {
  content: "\ef91";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-copyright1 .path2:before {
  content: "\ef92";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-copy-success1 .path1:before {
  content: "\ef93";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-copy-success1 .path2:before {
  content: "\ef94";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-courthouse1 .path1:before {
  content: "\ef95";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-courthouse1 .path2:before {
  content: "\ef96";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu1 .path1:before {
  content: "\ef97";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cpu1 .path2:before {
  content: "\ef98";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu1 .path3:before {
  content: "\ef99";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu1 .path4:before {
  content: "\ef9a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu1 .path5:before {
  content: "\ef9b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu1 .path6:before {
  content: "\ef9c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu1 .path7:before {
  content: "\ef9d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu1 .path8:before {
  content: "\ef9e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu1 .path9:before {
  content: "\ef9f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu1 .path10:before {
  content: "\efa0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu1 .path11:before {
  content: "\efa1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu1 .path12:before {
  content: "\efa2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu1 .path13:before {
  content: "\efa3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu1 .path14:before {
  content: "\efa4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu-charge1 .path1:before {
  content: "\efa5";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cpu-charge1 .path2:before {
  content: "\efa6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu-charge1 .path3:before {
  content: "\efa7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu-charge1 .path4:before {
  content: "\efa8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu-charge1 .path5:before {
  content: "\efa9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu-charge1 .path6:before {
  content: "\efaa";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu-charge1 .path7:before {
  content: "\efab";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu-charge1 .path8:before {
  content: "\efac";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu-charge1 .path9:before {
  content: "\efad";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu-charge1 .path10:before {
  content: "\efae";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu-charge1 .path11:before {
  content: "\efaf";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu-charge1 .path12:before {
  content: "\efb0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu-charge1 .path13:before {
  content: "\efb1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu-charge1 .path14:before {
  content: "\efb2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu-setting1 .path1:before {
  content: "\efb3";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cpu-setting1 .path2:before {
  content: "\efb4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu-setting1 .path3:before {
  content: "\efb5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu-setting1 .path4:before {
  content: "\efb6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu-setting1 .path5:before {
  content: "\efb7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu-setting1 .path6:before {
  content: "\efb8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu-setting1 .path7:before {
  content: "\efb9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu-setting1 .path8:before {
  content: "\efba";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu-setting1 .path9:before {
  content: "\efbb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu-setting1 .path10:before {
  content: "\efbc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cpu-setting1 .path11:before {
  content: "\efbd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cpu-setting1 .path12:before {
  content: "\efbe";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-creative-commons1 .path1:before {
  content: "\efbf";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-creative-commons1 .path2:before {
  content: "\efc0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-creative-commons1 .path3:before {
  content: "\efc1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-crop1 .path1:before {
  content: "\efc2";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-crop1 .path2:before {
  content: "\efc3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-crop1 .path3:before {
  content: "\efc4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-crown1 .path1:before {
  content: "\efc5";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-crown1 .path2:before {
  content: "\efc6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-crown1 .path3:before {
  content: "\efc7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-crown-11 .path1:before {
  content: "\efc8";
  color: rgb(41, 45, 50);
}

.isax-crown-11 .path2:before {
  content: "\efc9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cup1 .path1:before {
  content: "\efca";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cup1 .path2:before {
  content: "\efcb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cup1 .path3:before {
  content: "\efcc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-cup1 .path4:before {
  content: "\efcd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-cup1 .path5:before {
  content: "\efce";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-danger1 .path1:before {
  content: "\efcf";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-danger1 .path2:before {
  content: "\efd0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-danger1 .path3:before {
  content: "\efd1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-data1 .path1:before {
  content: "\efd2";
  color: rgb(41, 45, 50);
}

.isax-data1 .path2:before {
  content: "\efd3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-data1 .path3:before {
  content: "\efd4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-data1 .path4:before {
  content: "\efd5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-data1 .path5:before {
  content: "\efd6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-data-21 .path1:before {
  content: "\efd7";
  color: rgb(41, 45, 50);
}

.isax-data-21 .path2:before {
  content: "\efd8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-data-21 .path3:before {
  content: "\efd9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-data-21 .path4:before {
  content: "\efda";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.37;
}

.isax-data-21 .path5:before {
  content: "\efdb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-designtools1 .path1:before {
  content: "\efdc";
  color: rgb(41, 45, 50);
}

.isax-designtools1 .path2:before {
  content: "\efdd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-designtools1 .path3:before {
  content: "\efde";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-designtools1 .path4:before {
  content: "\efdf";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-designtools1 .path5:before {
  content: "\efe0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-device-message1 .path1:before {
  content: "\efe1";
  color: rgb(41, 45, 50);
}

.isax-device-message1 .path2:before {
  content: "\efe2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-device-message1 .path3:before {
  content: "\efe3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-device-message1 .path4:before {
  content: "\efe4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-device-message1 .path5:before {
  content: "\efe5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-device-message1 .path6:before {
  content: "\efe6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-devices1 .path1:before {
  content: "\efe7";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-devices1 .path2:before {
  content: "\efe8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-devices1 .path3:before {
  content: "\efe9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-devices1 .path4:before {
  content: "\efea";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-devices-11 .path1:before {
  content: "\efeb";
  color: rgb(41, 45, 50);
}

.isax-devices-11 .path2:before {
  content: "\efec";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-devices-11 .path3:before {
  content: "\efed";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-devices-11 .path4:before {
  content: "\efee";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-devices-11 .path5:before {
  content: "\efef";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-devices-11 .path6:before {
  content: "\eff0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-devices-11 .path7:before {
  content: "\eff1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-devices-11 .path8:before {
  content: "\eff2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-diagram1 .path1:before {
  content: "\eff3";
  color: rgb(41, 45, 50);
}

.isax-diagram1 .path2:before {
  content: "\eff4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-diamonds1 .path1:before {
  content: "\eff5";
  color: rgb(41, 45, 50);
}

.isax-diamonds1 .path2:before {
  content: "\eff6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-direct1 .path1:before {
  content: "\eff7";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-direct1 .path2:before {
  content: "\eff8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-direct1 .path3:before {
  content: "\eff9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-direct1 .path4:before {
  content: "\effa";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-directbox-default1 .path1:before {
  content: "\effb";
  color: rgb(41, 45, 50);
}

.isax-directbox-default1 .path2:before {
  content: "\effc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-directbox-default1 .path3:before {
  content: "\effd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-directbox-default1 .path4:before {
  content: "\effe";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-directbox-notif1 .path1:before {
  content: "\efff";
  color: rgb(41, 45, 50);
}

.isax-directbox-notif1 .path2:before {
  content: "\f000";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-directbox-notif1 .path3:before {
  content: "\f001";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-directbox-receive1 .path1:before {
  content: "\f002";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-directbox-receive1 .path2:before {
  content: "\f003";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-directbox-receive1 .path3:before {
  content: "\f004";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-directbox-receive1 .path4:before {
  content: "\f005";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-directbox-send1 .path1:before {
  content: "\f006";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-directbox-send1 .path2:before {
  content: "\f007";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-directbox-send1 .path3:before {
  content: "\f008";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-directbox-send1 .path4:before {
  content: "\f009";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-direct-down1 .path1:before {
  content: "\f00a";
  color: rgb(41, 45, 50);
}

.isax-direct-down1 .path2:before {
  content: "\f00b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-direct-inbox1 .path1:before {
  content: "\f00c";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-direct-inbox1 .path2:before {
  content: "\f00d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-direct-inbox1 .path3:before {
  content: "\f00e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-direct-left1 .path1:before {
  content: "\f00f";
  color: rgb(41, 45, 50);
}

.isax-direct-left1 .path2:before {
  content: "\f010";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-direct-normal1 .path1:before {
  content: "\f011";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-direct-normal1 .path2:before {
  content: "\f012";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-direct-notification1 .path1:before {
  content: "\f013";
  color: rgb(41, 45, 50);
}

.isax-direct-notification1 .path2:before {
  content: "\f014";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-direct-notification1 .path3:before {
  content: "\f015";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-direct-right1 .path1:before {
  content: "\f016";
  color: rgb(41, 45, 50);
}

.isax-direct-right1 .path2:before {
  content: "\f017";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-direct-send1 .path1:before {
  content: "\f018";
  color: rgb(41, 45, 50);
}

.isax-direct-send1 .path2:before {
  content: "\f019";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-direct-send1 .path3:before {
  content: "\f01a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-direct-up1 .path1:before {
  content: "\f01b";
  color: rgb(41, 45, 50);
}

.isax-direct-up1 .path2:before {
  content: "\f01c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-discount-circle1 .path1:before {
  content: "\f01d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-discount-circle1 .path2:before {
  content: "\f01e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-discount-circle1 .path3:before {
  content: "\f01f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-discount-circle1 .path4:before {
  content: "\f020";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-discount-shape1 .path1:before {
  content: "\f021";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-discount-shape1 .path2:before {
  content: "\f022";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-discount-shape1 .path3:before {
  content: "\f023";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-discount-shape1 .path4:before {
  content: "\f024";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-discover1 .path1:before {
  content: "\f025";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-discover1 .path2:before {
  content: "\f026";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-discover-11 .path1:before {
  content: "\f027";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-discover-11 .path2:before {
  content: "\f028";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-dislike1 .path1:before {
  content: "\f029";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-dislike1 .path2:before {
  content: "\f02a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document1 .path1:before {
  content: "\f02b";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-document1 .path2:before {
  content: "\f02c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-11 .path1:before {
  content: "\f02d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-document-11 .path2:before {
  content: "\f02e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-11 .path3:before {
  content: "\f02f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-cloud1 .path1:before {
  content: "\f030";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-document-cloud1 .path2:before {
  content: "\f031";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-cloud1 .path3:before {
  content: "\f032";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-code1 .path1:before {
  content: "\f033";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-document-code1 .path2:before {
  content: "\f034";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-code1 .path3:before {
  content: "\f035";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-code1 .path4:before {
  content: "\f036";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-code-21 .path1:before {
  content: "\f037";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-document-code-21 .path2:before {
  content: "\f038";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-code-21 .path3:before {
  content: "\f039";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-copy1 .path1:before {
  content: "\f03a";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-document-copy1 .path2:before {
  content: "\f03b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-copy1 .path3:before {
  content: "\f03c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-download1 .path1:before {
  content: "\f03d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-document-download1 .path2:before {
  content: "\f03e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-download1 .path3:before {
  content: "\f03f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-favorite1 .path1:before {
  content: "\f040";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-document-favorite1 .path2:before {
  content: "\f041";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-favorite1 .path3:before {
  content: "\f042";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-filter1 .path1:before {
  content: "\f043";
  color: rgb(41, 45, 50);
}

.isax-document-filter1 .path2:before {
  content: "\f044";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-document-filter1 .path3:before {
  content: "\f045";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-filter1 .path4:before {
  content: "\f046";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-forward1 .path1:before {
  content: "\f047";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-document-forward1 .path2:before {
  content: "\f048";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-forward1 .path3:before {
  content: "\f049";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-like1 .path1:before {
  content: "\f04a";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-document-like1 .path2:before {
  content: "\f04b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-like1 .path3:before {
  content: "\f04c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-normal1 .path1:before {
  content: "\f04d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-document-normal1 .path2:before {
  content: "\f04e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-previous1 .path1:before {
  content: "\f04f";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-document-previous1 .path2:before {
  content: "\f050";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-previous1 .path3:before {
  content: "\f051";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-sketch1 .path1:before {
  content: "\f052";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-document-sketch1 .path2:before {
  content: "\f053";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-sketch1 .path3:before {
  content: "\f054";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-text1 .path1:before {
  content: "\f055";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-document-text1 .path2:before {
  content: "\f056";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-text1 .path3:before {
  content: "\f057";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-text1 .path4:before {
  content: "\f058";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-text-11 .path1:before {
  content: "\f059";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-document-text-11 .path2:before {
  content: "\f05a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-text-11 .path3:before {
  content: "\f05b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-text-11 .path4:before {
  content: "\f05c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-upload1 .path1:before {
  content: "\f05d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-document-upload1 .path2:before {
  content: "\f05e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-document-upload1 .path3:before {
  content: "\f05f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-dollar-circle1 .path1:before {
  content: "\f060";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-dollar-circle1 .path2:before {
  content: "\f061";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-dollar-square1 .path1:before {
  content: "\f062";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-dollar-square1 .path2:before {
  content: "\f063";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-driver1 .path1:before {
  content: "\f064";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-driver1 .path2:before {
  content: "\f065";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-driver1 .path3:before {
  content: "\f066";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-driver1 .path4:before {
  content: "\f067";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-driver1 .path5:before {
  content: "\f068";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-driver1 .path6:before {
  content: "\f069";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-driver1 .path7:before {
  content: "\f06a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-driver1 .path8:before {
  content: "\f06b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-driver-21 .path1:before {
  content: "\f06c";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-driver-21 .path2:before {
  content: "\f06d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-driver-21 .path3:before {
  content: "\f06e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-driver-21 .path4:before {
  content: "\f06f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-driver-21 .path5:before {
  content: "\f070";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-driver-21 .path6:before {
  content: "\f071";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-driver-21 .path7:before {
  content: "\f072";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-driver-21 .path8:before {
  content: "\f073";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-driver-refresh1 .path1:before {
  content: "\f074";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-driver-refresh1 .path2:before {
  content: "\f075";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-driver-refresh1 .path3:before {
  content: "\f076";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-driver-refresh1 .path4:before {
  content: "\f077";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-driver-refresh1 .path5:before {
  content: "\f078";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-driver-refresh1 .path6:before {
  content: "\f079";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-driver-refresh1 .path7:before {
  content: "\f07a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-driving1 .path1:before {
  content: "\f07b";
  color: rgb(41, 45, 50);
}

.isax-driving1 .path2:before {
  content: "\f07c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-driving1 .path3:before {
  content: "\f07d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-driving1 .path4:before {
  content: "\f07e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-driving1 .path5:before {
  content: "\f07f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-driving1 .path6:before {
  content: "\f080";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-driving1 .path7:before {
  content: "\f081";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-driving1 .path8:before {
  content: "\f082";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-drop .path1:before {
  content: "\f083";
  color: rgb(41, 45, 50);
}

.isax-drop .path2:before {
  content: "\f084";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-edit1 .path1:before {
  content: "\f085";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-edit1 .path2:before {
  content: "\f086";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-edit1 .path3:before {
  content: "\f087";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-edit-21 .path1:before {
  content: "\f088";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-edit-21 .path2:before {
  content: "\f089";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-edit-21 .path3:before {
  content: "\f08a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-electricity1 .path1:before {
  content: "\f08b";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-electricity1 .path2:before {
  content: "\f08c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-electricity1 .path3:before {
  content: "\f08d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-electricity1 .path4:before {
  content: "\f08e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-element-1 .path1:before {
  content: "\f08f";
  color: rgb(41, 45, 50);
}

.isax-element-1 .path2:before {
  content: "\f090";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-element-1 .path3:before {
  content: "\f091";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-element-21 .path1:before {
  content: "\f092";
  color: rgb(41, 45, 50);
}

.isax-element-21 .path2:before {
  content: "\f093";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-element-21 .path3:before {
  content: "\f094";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-element-31 .path1:before {
  content: "\f095";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-element-31 .path2:before {
  content: "\f096";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-element-31 .path3:before {
  content: "\f097";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-element-31 .path4:before {
  content: "\f098";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-element-41 .path1:before {
  content: "\f099";
  color: rgb(41, 45, 50);
}

.isax-element-41 .path2:before {
  content: "\f09a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-element-41 .path3:before {
  content: "\f09b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-element-41 .path4:before {
  content: "\f09c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-element-equal1 .path1:before {
  content: "\f09d";
  color: rgb(41, 45, 50);
}

.isax-element-equal1 .path2:before {
  content: "\f09e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-element-equal1 .path3:before {
  content: "\f09f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-element-equal1 .path4:before {
  content: "\f0a0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-element-equal1 .path5:before {
  content: "\f0a1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-element-plus1 .path1:before {
  content: "\f0a2";
  color: rgb(41, 45, 50);
}

.isax-element-plus1 .path2:before {
  content: "\f0a3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-element-plus1 .path3:before {
  content: "\f0a4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-element-plus1 .path4:before {
  content: "\f0a5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-emoji-happy1 .path1:before {
  content: "\f0a6";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-emoji-happy1 .path2:before {
  content: "\f0a7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-emoji-happy1 .path3:before {
  content: "\f0a8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-emoji-happy1 .path4:before {
  content: "\f0a9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-emoji-normal1 .path1:before {
  content: "\f0aa";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-emoji-normal1 .path2:before {
  content: "\f0ab";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-emoji-normal1 .path3:before {
  content: "\f0ac";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-emoji-normal1 .path4:before {
  content: "\f0ad";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-emoji-sad1 .path1:before {
  content: "\f0ae";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-emoji-sad1 .path2:before {
  content: "\f0af";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-emoji-sad1 .path3:before {
  content: "\f0b0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-emoji-sad1 .path4:before {
  content: "\f0b1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-empty-wallet1 .path1:before {
  content: "\f0b2";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-empty-wallet1 .path2:before {
  content: "\f0b3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-empty-wallet1 .path3:before {
  content: "\f0b4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-empty-wallet1 .path4:before {
  content: "\f0b5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-empty-wallet-add1 .path1:before {
  content: "\f0b6";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-empty-wallet-add1 .path2:before {
  content: "\f0b7";
  margin-left: -1.0419921875em;
  color: rgb(41, 45, 50);
}

.isax-empty-wallet-add1 .path3:before {
  content: "\f0b8";
  margin-left: -1.0419921875em;
  color: rgb(41, 45, 50);
}

.isax-empty-wallet-add1 .path4:before {
  content: "\f0b9";
  margin-left: -1.0419921875em;
  color: rgb(41, 45, 50);
}

.isax-empty-wallet-add1 .path5:before {
  content: "\f0ba";
  margin-left: -1.0419921875em;
  color: rgb(41, 45, 50);
}

.isax-empty-wallet-change1 .path1:before {
  content: "\f0bb";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-empty-wallet-change1 .path2:before {
  content: "\f0bc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-empty-wallet-change1 .path3:before {
  content: "\f0bd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-empty-wallet-change1 .path4:before {
  content: "\f0be";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-empty-wallet-change1 .path5:before {
  content: "\f0bf";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-empty-wallet-remove1 .path1:before {
  content: "\f0c0";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-empty-wallet-remove1 .path2:before {
  content: "\f0c1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-empty-wallet-remove1 .path3:before {
  content: "\f0c2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-empty-wallet-remove1 .path4:before {
  content: "\f0c3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-empty-wallet-remove1 .path5:before {
  content: "\f0c4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-empty-wallet-tick1 .path1:before {
  content: "\f0c5";
  color: rgb(41, 45, 50);
}

.isax-empty-wallet-tick1 .path2:before {
  content: "\f0c6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-empty-wallet-tick1 .path3:before {
  content: "\f0c7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-empty-wallet-tick1 .path4:before {
  content: "\f0c8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-empty-wallet-tick1 .path5:before {
  content: "\f0c9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-empty-wallet-time1 .path1:before {
  content: "\f0ca";
  color: rgb(41, 45, 50);
}

.isax-empty-wallet-time1 .path2:before {
  content: "\f0cb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-empty-wallet-time1 .path3:before {
  content: "\f0cc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-empty-wallet-time1 .path4:before {
  content: "\f0cd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-empty-wallet-time1 .path5:before {
  content: "\f0ce";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-eraser1 .path1:before {
  content: "\f0cf";
  color: rgb(41, 45, 50);
}

.isax-eraser1 .path2:before {
  content: "\f0d0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-eraser1 .path3:before {
  content: "\f0d1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-eraser-11 .path1:before {
  content: "\f0d2";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-eraser-11 .path2:before {
  content: "\f0d3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-eraser-11 .path3:before {
  content: "\f0d4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-export1 .path1:before {
  content: "\f0d5";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-export1 .path2:before {
  content: "\f0d6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-export-11 .path1:before {
  content: "\f0d7";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-export-11 .path2:before {
  content: "\f0d8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-export-21 .path1:before {
  content: "\f0d9";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-export-21 .path2:before {
  content: "\f0da";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-export-31 .path1:before {
  content: "\f0db";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-export-31 .path2:before {
  content: "\f0dc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-external-drive1 .path1:before {
  content: "\f0dd";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-external-drive1 .path2:before {
  content: "\f0de";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-external-drive1 .path3:before {
  content: "\f0df";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-external-drive1 .path4:before {
  content: "\f0e0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-external-drive1 .path5:before {
  content: "\f0e1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-eye-slash1 .path1:before {
  content: "\f0e2";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-eye-slash1 .path2:before {
  content: "\f0e3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-eye-slash1 .path3:before {
  content: "\f0e4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-eye-slash1 .path4:before {
  content: "\f0e5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-eye-slash1 .path5:before {
  content: "\f0e6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-fatrows1 .path1:before {
  content: "\f0e7";
  color: rgb(41, 45, 50);
}

.isax-fatrows1 .path2:before {
  content: "\f0e8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-favorite-chart1 .path1:before {
  content: "\f0e9";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-favorite-chart1 .path2:before {
  content: "\f0ea";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-favorite-chart1 .path3:before {
  content: "\f0eb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-filter1 .path1:before {
  content: "\f0ec";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-filter1 .path2:before {
  content: "\f0ed";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-filter-add1 .path1:before {
  content: "\f0ee";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-filter-add1 .path2:before {
  content: "\f0ef";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-filter-edit1 .path1:before {
  content: "\f0f0";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-filter-edit1 .path2:before {
  content: "\f0f1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-filter-remove1 .path1:before {
  content: "\f0f2";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-filter-remove1 .path2:before {
  content: "\f0f3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-filter-search1 .path1:before {
  content: "\f0f4";
  color: rgb(41, 45, 50);
}

.isax-filter-search1 .path2:before {
  content: "\f0f5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-filter-square1 .path1:before {
  content: "\f0f6";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-filter-square1 .path2:before {
  content: "\f0f7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-filter-tick1 .path1:before {
  content: "\f0f8";
  color: rgb(41, 45, 50);
}

.isax-filter-tick1 .path2:before {
  content: "\f0f9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-finger-cricle1 .path1:before {
  content: "\f0fa";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-finger-cricle1 .path2:before {
  content: "\f0fb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-finger-cricle1 .path3:before {
  content: "\f0fc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-finger-scan1 .path1:before {
  content: "\f0fd";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-finger-scan1 .path2:before {
  content: "\f0fe";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-finger-scan1 .path3:before {
  content: "\f0ff";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-finger-scan1 .path4:before {
  content: "\f100";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-finger-scan1 .path5:before {
  content: "\f101";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-finger-scan1 .path6:before {
  content: "\f102";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-firstline1 .path1:before {
  content: "\f103";
  color: rgb(41, 45, 50);
}

.isax-firstline1 .path2:before {
  content: "\f104";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-firstline1 .path3:before {
  content: "\f105";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-firstline1 .path4:before {
  content: "\f106";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-firstline1 .path5:before {
  content: "\f107";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-flag1 .path1:before {
  content: "\f108";
  color: rgb(41, 45, 50);
}

.isax-flag1 .path2:before {
  content: "\f109";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-flag-21 .path1:before {
  content: "\f10a";
  color: rgb(41, 45, 50);
}

.isax-flag-21 .path2:before {
  content: "\f10b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-flash1 .path1:before {
  content: "\f10c";
  color: rgb(41, 45, 50);
}

.isax-flash1 .path2:before {
  content: "\f10d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-flash-11 .path1:before {
  content: "\f10e";
  color: rgb(41, 45, 50);
}

.isax-flash-11 .path2:before {
  content: "\f10f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-flash-11 .path3:before {
  content: "\f110";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-flash-11 .path4:before {
  content: "\f111";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-flash-circle1 .path1:before {
  content: "\f112";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-flash-circle1 .path2:before {
  content: "\f113";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-flash-circle-11 .path1:before {
  content: "\f114";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-flash-circle-11 .path2:before {
  content: "\f115";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-flash-slash1 .path1:before {
  content: "\f116";
  color: rgb(41, 45, 50);
}

.isax-flash-slash1 .path2:before {
  content: "\f117";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-flash-slash1 .path3:before {
  content: "\f118";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-folder1 .path1:before {
  content: "\f119";
  color: rgb(41, 45, 50);
}

.isax-folder1 .path2:before {
  content: "\f11a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-folder-21 .path1:before {
  content: "\f11b";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-folder-21 .path2:before {
  content: "\f11c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-folder-add1 .path1:before {
  content: "\f11d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-folder-add1 .path2:before {
  content: "\f11e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-folder-cloud1 .path1:before {
  content: "\f11f";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-folder-cloud1 .path2:before {
  content: "\f120";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-folder-connection1 .path1:before {
  content: "\f121";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-folder-connection1 .path2:before {
  content: "\f122";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-folder-cross1 .path1:before {
  content: "\f123";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-folder-cross1 .path2:before {
  content: "\f124";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-folder-favorite1 .path1:before {
  content: "\f125";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-folder-favorite1 .path2:before {
  content: "\f126";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-folder-minus1 .path1:before {
  content: "\f127";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-folder-minus1 .path2:before {
  content: "\f128";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-folder-open1 .path1:before {
  content: "\f129";
  color: rgb(41, 45, 50);
}

.isax-folder-open1 .path2:before {
  content: "\f12a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-forbidden1 .path1:before {
  content: "\f12b";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-forbidden1 .path2:before {
  content: "\f12c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-forbidden-21 .path1:before {
  content: "\f12d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-forbidden-21 .path2:before {
  content: "\f12e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-format-circle1 .path1:before {
  content: "\f12f";
  color: rgb(41, 45, 50);
}

.isax-format-circle1 .path2:before {
  content: "\f130";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-format-circle1 .path3:before {
  content: "\f131";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-format-circle1 .path4:before {
  content: "\f132";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-format-circle1 .path5:before {
  content: "\f133";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-format-square1 .path1:before {
  content: "\f134";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-format-square1 .path2:before {
  content: "\f135";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-format-square1 .path3:before {
  content: "\f136";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-format-square1 .path4:before {
  content: "\f137";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-format-square1 .path5:before {
  content: "\f138";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-forward1 .path1:before {
  content: "\f139";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-forward1 .path2:before {
  content: "\f13a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-forward-5-seconds1 .path1:before {
  content: "\f13b";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-forward-5-seconds1 .path2:before {
  content: "\f13c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-forward-10-seconds1 .path1:before {
  content: "\f13d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-forward-10-seconds1 .path2:before {
  content: "\f13e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-forward-10-seconds1 .path3:before {
  content: "\f13f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-forward-15-seconds1 .path1:before {
  content: "\f140";
  color: rgb(41, 45, 50);
}

.isax-forward-15-seconds1 .path2:before {
  content: "\f141";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-forward-15-seconds1 .path3:before {
  content: "\f142";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-forward-item1 .path1:before {
  content: "\f143";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-forward-item1 .path2:before {
  content: "\f144";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-forward-item1 .path3:before {
  content: "\f145";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-forward-square1 .path1:before {
  content: "\f146";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-forward-square1 .path2:before {
  content: "\f147";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-frame1 .path1:before {
  content: "\f148";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-frame1 .path2:before {
  content: "\f149";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-frame1 .path3:before {
  content: "\f14a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-frame1 .path4:before {
  content: "\f14b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-frame1 .path5:before {
  content: "\f14c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-frame-11 .path1:before {
  content: "\f14d";
  color: rgb(41, 45, 50);
}

.isax-frame-11 .path2:before {
  content: "\f14e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-frame-11 .path3:before {
  content: "\f14f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-frame-21 .path1:before {
  content: "\f150";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-frame-21 .path2:before {
  content: "\f151";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-frame-31 .path1:before {
  content: "\f152";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-frame-31 .path2:before {
  content: "\f153";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-frame-41 .path1:before {
  content: "\f154";
  color: rgb(41, 45, 50);
}

.isax-frame-41 .path2:before {
  content: "\f155";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-frame-41 .path3:before {
  content: "\f156";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-frame-41 .path4:before {
  content: "\f157";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gallery1 .path1:before {
  content: "\f158";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-gallery1 .path2:before {
  content: "\f159";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gallery1 .path3:before {
  content: "\f15a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gallery-add1 .path1:before {
  content: "\f15b";
  color: rgb(41, 45, 50);
}

.isax-gallery-add1 .path2:before {
  content: "\f15c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-gallery-add1 .path3:before {
  content: "\f15d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gallery-add1 .path4:before {
  content: "\f15e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gallery-edit1 .path1:before {
  content: "\f15f";
  color: rgb(41, 45, 50);
}

.isax-gallery-edit1 .path2:before {
  content: "\f160";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-gallery-edit1 .path3:before {
  content: "\f161";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gallery-edit1 .path4:before {
  content: "\f162";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gallery-favorite1 .path1:before {
  content: "\f163";
  color: rgb(41, 45, 50);
}

.isax-gallery-favorite1 .path2:before {
  content: "\f164";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gallery-favorite1 .path3:before {
  content: "\f165";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-gallery-favorite1 .path4:before {
  content: "\f166";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gallery-import1 .path1:before {
  content: "\f167";
  color: rgb(41, 45, 50);
}

.isax-gallery-import1 .path2:before {
  content: "\f168";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-gallery-import1 .path3:before {
  content: "\f169";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gallery-import1 .path4:before {
  content: "\f16a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gallery-remove1 .path1:before {
  content: "\f16b";
  color: rgb(41, 45, 50);
}

.isax-gallery-remove1 .path2:before {
  content: "\f16c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-gallery-remove1 .path3:before {
  content: "\f16d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gallery-remove1 .path4:before {
  content: "\f16e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gallery-slash1 .path1:before {
  content: "\f16f";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-gallery-slash1 .path2:before {
  content: "\f170";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-gallery-slash1 .path3:before {
  content: "\f171";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gallery-slash1 .path4:before {
  content: "\f172";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gallery-slash1 .path5:before {
  content: "\f173";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gallery-tick1 .path1:before {
  content: "\f174";
  color: rgb(41, 45, 50);
}

.isax-gallery-tick1 .path2:before {
  content: "\f175";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-gallery-tick1 .path3:before {
  content: "\f176";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gallery-tick1 .path4:before {
  content: "\f177";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-game1 .path1:before {
  content: "\f178";
  color: rgb(41, 45, 50);
}

.isax-game1 .path2:before {
  content: "\f179";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-game1 .path3:before {
  content: "\f17a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-game1 .path4:before {
  content: "\f17b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-game1 .path5:before {
  content: "\f17c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-game1 .path6:before {
  content: "\f17d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-game1 .path7:before {
  content: "\f17e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gameboy1 .path1:before {
  content: "\f17f";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-gameboy1 .path2:before {
  content: "\f180";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gameboy1 .path3:before {
  content: "\f181";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gameboy1 .path4:before {
  content: "\f182";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gameboy1 .path5:before {
  content: "\f183";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gas-station1 .path1:before {
  content: "\f184";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-gas-station1 .path2:before {
  content: "\f185";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gas-station1 .path3:before {
  content: "\f186";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gas-station1 .path4:before {
  content: "\f187";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gas-station1 .path5:before {
  content: "\f188";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gemini1 .path1:before {
  content: "\f189";
  color: rgb(41, 45, 50);
}

.isax-gemini1 .path2:before {
  content: "\f18a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-gemini1 .path3:before {
  content: "\f18b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-gemini1 .path4:before {
  content: "\f18c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-gemini1 .path5:before {
  content: "\f18d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-gemini-21 .path1:before {
  content: "\f18e";
  color: rgb(41, 45, 50);
}

.isax-gemini-21 .path2:before {
  content: "\f18f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-ghost1 .path1:before {
  content: "\f190";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-ghost1 .path2:before {
  content: "\f191";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-ghost1 .path3:before {
  content: "\f192";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gift1 .path1:before {
  content: "\f193";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-gift1 .path2:before {
  content: "\f194";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gift1 .path3:before {
  content: "\f195";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-gift1 .path4:before {
  content: "\f196";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-gift1 .path5:before {
  content: "\f197";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-glass1 .path1:before {
  content: "\f198";
  color: rgb(41, 45, 50);
}

.isax-glass1 .path2:before {
  content: "\f199";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-glass1 .path3:before {
  content: "\f19a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-glass1 .path4:before {
  content: "\f19b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-glass1 .path5:before {
  content: "\f19c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-glass-11 .path1:before {
  content: "\f19d";
  color: rgb(41, 45, 50);
}

.isax-glass-11 .path2:before {
  content: "\f19e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global1 .path1:before {
  content: "\f19f";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global1 .path2:before {
  content: "\f1a0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global1 .path3:before {
  content: "\f1a1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global1 .path4:before {
  content: "\f1a2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global1 .path5:before {
  content: "\f1a3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-global1 .path6:before {
  content: "\f1a4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-global1 .path7:before {
  content: "\f1a5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-global1 .path8:before {
  content: "\f1a6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-global1 .path9:before {
  content: "\f1a7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-global-edit1 .path1:before {
  content: "\f1a8";
  color: rgb(41, 45, 50);
}

.isax-global-edit1 .path2:before {
  content: "\f1a9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-global-edit1 .path3:before {
  content: "\f1aa";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global-edit1 .path4:before {
  content: "\f1ab";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global-edit1 .path5:before {
  content: "\f1ac";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global-edit1 .path6:before {
  content: "\f1ad";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global-edit1 .path7:before {
  content: "\f1ae";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global-edit1 .path8:before {
  content: "\f1af";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global-edit1 .path9:before {
  content: "\f1b0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global-edit1 .path10:before {
  content: "\f1b1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global-refresh1 .path1:before {
  content: "\f1b2";
  color: rgb(41, 45, 50);
}

.isax-global-refresh1 .path2:before {
  content: "\f1b3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global-refresh1 .path3:before {
  content: "\f1b4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global-refresh1 .path4:before {
  content: "\f1b5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global-refresh1 .path5:before {
  content: "\f1b6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global-refresh1 .path6:before {
  content: "\f1b7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global-refresh1 .path7:before {
  content: "\f1b8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global-refresh1 .path8:before {
  content: "\f1b9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global-refresh1 .path9:before {
  content: "\f1ba";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global-search1 .path1:before {
  content: "\f1bb";
  color: rgb(41, 45, 50);
}

.isax-global-search1 .path2:before {
  content: "\f1bc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global-search1 .path3:before {
  content: "\f1bd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global-search1 .path4:before {
  content: "\f1be";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global-search1 .path5:before {
  content: "\f1bf";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global-search1 .path6:before {
  content: "\f1c0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global-search1 .path7:before {
  content: "\f1c1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global-search1 .path8:before {
  content: "\f1c2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-global-search1 .path9:before {
  content: "\f1c3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-gps1 .path1:before {
  content: "\f1c4";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-gps1 .path2:before {
  content: "\f1c5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gps1 .path3:before {
  content: "\f1c6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gps1 .path4:before {
  content: "\f1c7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gps1 .path5:before {
  content: "\f1c8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gps1 .path6:before {
  content: "\f1c9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gps-slash1 .path1:before {
  content: "\f1ca";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-gps-slash1 .path2:before {
  content: "\f1cb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-gps-slash1 .path3:before {
  content: "\f1cc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gps-slash1 .path4:before {
  content: "\f1cd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gps-slash1 .path5:before {
  content: "\f1ce";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gps-slash1 .path6:before {
  content: "\f1cf";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gps-slash1 .path7:before {
  content: "\f1d0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-gps-slash1 .path8:before {
  content: "\f1d1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grammerly1 .path1:before {
  content: "\f1d2";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-grammerly1 .path2:before {
  content: "\f1d3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-graph1 .path1:before {
  content: "\f1d4";
  color: rgb(41, 45, 50);
}

.isax-graph1 .path2:before {
  content: "\f1d5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-grid-11 .path1:before {
  content: "\f1d6";
  color: rgb(41, 45, 50);
}

.isax-grid-11 .path2:before {
  content: "\f1d7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-11 .path3:before {
  content: "\f1d8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-11 .path4:before {
  content: "\f1d9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-11 .path5:before {
  content: "\f1da";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-grid-11 .path6:before {
  content: "\f1db";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-grid-11 .path7:before {
  content: "\f1dc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-11 .path8:before {
  content: "\f1dd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-grid-11 .path9:before {
  content: "\f1de";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-grid-21 .path1:before {
  content: "\f1df";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-grid-21 .path2:before {
  content: "\f1e0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-grid-21 .path3:before {
  content: "\f1e1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-21 .path4:before {
  content: "\f1e2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-31 .path1:before {
  content: "\f1e3";
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-grid-31 .path2:before {
  content: "\f1e4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-31 .path3:before {
  content: "\f1e5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-grid-31 .path4:before {
  content: "\f1e6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-grid-41 .path1:before {
  content: "\f1e7";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-grid-41 .path2:before {
  content: "\f1e8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-51 .path1:before {
  content: "\f1e9";
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-grid-51 .path2:before {
  content: "\f1ea";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-51 .path3:before {
  content: "\f1eb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-grid-61 .path1:before {
  content: "\f1ec";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-grid-61 .path2:before {
  content: "\f1ed";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-grid-61 .path3:before {
  content: "\f1ee";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-61 .path4:before {
  content: "\f1ef";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-grid-71 .path1:before {
  content: "\f1f0";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-grid-71 .path2:before {
  content: "\f1f1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-71 .path3:before {
  content: "\f1f2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-grid-81 .path1:before {
  content: "\f1f3";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-grid-81 .path2:before {
  content: "\f1f4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-81 .path3:before {
  content: "\f1f5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-81 .path4:before {
  content: "\f1f6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-grid-81 .path5:before {
  content: "\f1f7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-81 .path6:before {
  content: "\f1f8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-grid-91 .path1:before {
  content: "\f1f9";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-grid-91 .path2:before {
  content: "\f1fa";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-edit1 .path1:before {
  content: "\f1fb";
  color: rgb(41, 45, 50);
}

.isax-grid-edit1 .path2:before {
  content: "\f1fc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-edit1 .path3:before {
  content: "\f1fd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-edit1 .path4:before {
  content: "\f1fe";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-edit1 .path5:before {
  content: "\f1ff";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-grid-edit1 .path6:before {
  content: "\f200";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-edit1 .path7:before {
  content: "\f201";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-grid-eraser1 .path1:before {
  content: "\f202";
  color: rgb(41, 45, 50);
}

.isax-grid-eraser1 .path2:before {
  content: "\f203";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-eraser1 .path3:before {
  content: "\f204";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-eraser1 .path4:before {
  content: "\f205";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-grid-eraser1 .path5:before {
  content: "\f206";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-eraser1 .path6:before {
  content: "\f207";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-grid-eraser1 .path7:before {
  content: "\f208";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-grid-eraser1 .path8:before {
  content: "\f209";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-lock1 .path1:before {
  content: "\f20a";
  color: rgb(41, 45, 50);
}

.isax-grid-lock1 .path2:before {
  content: "\f20b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-lock1 .path3:before {
  content: "\f20c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-lock1 .path4:before {
  content: "\f20d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-lock1 .path5:before {
  content: "\f20e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-grid-lock1 .path6:before {
  content: "\f20f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-grid-lock1 .path7:before {
  content: "\f210";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-group .path1:before {
  content: "\f211";
  color: rgb(41, 45, 50);
}

.isax-group .path2:before {
  content: "\f212";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-group .path3:before {
  content: "\f213";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-group .path4:before {
  content: "\f214";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-group .path5:before {
  content: "\f215";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-group-1 .path1:before {
  content: "\f216";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-group-1 .path2:before {
  content: "\f217";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-group-1 .path3:before {
  content: "\f218";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-group-1 .path4:before {
  content: "\f219";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-group-1 .path5:before {
  content: "\f21a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-group-1 .path6:before {
  content: "\f21b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-group-1 .path7:before {
  content: "\f21c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-group-1 .path8:before {
  content: "\f21d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-happyemoji1 .path1:before {
  content: "\f21e";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-happyemoji1 .path2:before {
  content: "\f21f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-hashtag1 .path1:before {
  content: "\f220";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-hashtag1 .path2:before {
  content: "\f221";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-hashtag-11 .path1:before {
  content: "\f222";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-hashtag-11 .path2:before {
  content: "\f223";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-hashtag-down1 .path1:before {
  content: "\f224";
  color: rgb(41, 45, 50);
}

.isax-hashtag-down1 .path2:before {
  content: "\f225";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-hashtag-down1 .path3:before {
  content: "\f226";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-hashtag-up1 .path1:before {
  content: "\f227";
  color: rgb(41, 45, 50);
}

.isax-hashtag-up1 .path2:before {
  content: "\f228";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-hashtag-up1 .path3:before {
  content: "\f229";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-headphone1 .path1:before {
  content: "\f22a";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-headphone1 .path2:before {
  content: "\f22b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-headphone1 .path3:before {
  content: "\f22c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-headphones1 .path1:before {
  content: "\f22d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-headphones1 .path2:before {
  content: "\f22e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-headphones1 .path3:before {
  content: "\f22f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-headphones1 .path4:before {
  content: "\f230";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-headphones1 .path5:before {
  content: "\f231";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-headphones1 .path6:before {
  content: "\f232";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-headphones1 .path7:before {
  content: "\f233";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-headphones1 .path8:before {
  content: "\f234";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-health1 .path1:before {
  content: "\f235";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-health1 .path2:before {
  content: "\f236";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-health1 .path3:before {
  content: "\f237";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-heart1 .path1:before {
  content: "\f238";
  color: rgb(41, 45, 50);
}

.isax-heart1 .path2:before {
  content: "\f239";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-heart-add1 .path1:before {
  content: "\f23a";
  color: rgb(41, 45, 50);
}

.isax-heart-add1 .path2:before {
  content: "\f23b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-heart-circle1 .path1:before {
  content: "\f23c";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-heart-circle1 .path2:before {
  content: "\f23d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-heart-edit1 .path1:before {
  content: "\f23e";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-heart-edit1 .path2:before {
  content: "\f23f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-heart-remove1 .path1:before {
  content: "\f240";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-heart-remove1 .path2:before {
  content: "\f241";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-heart-search1 .path1:before {
  content: "\f242";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-heart-search1 .path2:before {
  content: "\f243";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-heart-slash1 .path1:before {
  content: "\f244";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-heart-slash1 .path2:before {
  content: "\f245";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-heart-tick1 .path1:before {
  content: "\f246";
  color: rgb(41, 45, 50);
}

.isax-heart-tick1 .path2:before {
  content: "\f247";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-hierarchy1 .path1:before {
  content: "\f248";
  color: rgb(41, 45, 50);
}

.isax-hierarchy1 .path2:before {
  content: "\f249";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-hierarchy1 .path3:before {
  content: "\f24a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-hierarchy1 .path4:before {
  content: "\f24b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-hierarchy-21 .path1:before {
  content: "\f24c";
  color: rgb(41, 45, 50);
}

.isax-hierarchy-21 .path2:before {
  content: "\f24d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-hierarchy-21 .path3:before {
  content: "\f24e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-hierarchy-21 .path4:before {
  content: "\f24f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-hierarchy-31 .path1:before {
  content: "\f250";
  color: rgb(41, 45, 50);
}

.isax-hierarchy-31 .path2:before {
  content: "\f251";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-hierarchy-31 .path3:before {
  content: "\f252";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-hierarchy-31 .path4:before {
  content: "\f253";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-hierarchy-square1 .path1:before {
  content: "\f254";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-hierarchy-square1 .path2:before {
  content: "\f255";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-hierarchy-square1 .path3:before {
  content: "\f256";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-hierarchy-square-21 .path1:before {
  content: "\f257";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-hierarchy-square-21 .path2:before {
  content: "\f258";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-hierarchy-square-31 .path1:before {
  content: "\f259";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-hierarchy-square-31 .path2:before {
  content: "\f25a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-home1 .path1:before {
  content: "\f25b";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-home1 .path2:before {
  content: "\f25c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-home-11 .path1:before {
  content: "\f25d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-home-11 .path2:before {
  content: "\f25e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-home-21 .path1:before {
  content: "\f25f";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-home-21 .path2:before {
  content: "\f260";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-home-hashtag1 .path1:before {
  content: "\f261";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-home-hashtag1 .path2:before {
  content: "\f262";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-home-trend-down1 .path1:before {
  content: "\f263";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-home-trend-down1 .path2:before {
  content: "\f264";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-home-trend-up1 .path1:before {
  content: "\f265";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-home-trend-up1 .path2:before {
  content: "\f266";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-home-wifi1 .path1:before {
  content: "\f267";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-home-wifi1 .path2:before {
  content: "\f268";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-home-wifi1 .path3:before {
  content: "\f269";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-home-wifi1 .path4:before {
  content: "\f26a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-hospital1 .path1:before {
  content: "\f26b";
  color: rgb(41, 45, 50);
}

.isax-hospital1 .path2:before {
  content: "\f26c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-hospital1 .path3:before {
  content: "\f26d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-hospital1 .path4:before {
  content: "\f26e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-house1 .path1:before {
  content: "\f26f";
  color: rgb(41, 45, 50);
}

.isax-house1 .path2:before {
  content: "\f270";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-house1 .path3:before {
  content: "\f271";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-house1 .path4:before {
  content: "\f272";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-house1 .path5:before {
  content: "\f273";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-house1 .path6:before {
  content: "\f274";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-house-21 .path1:before {
  content: "\f275";
  color: rgb(41, 45, 50);
}

.isax-house-21 .path2:before {
  content: "\f276";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-house-21 .path3:before {
  content: "\f277";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-house-21 .path4:before {
  content: "\f278";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-image1 .path1:before {
  content: "\f279";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-image1 .path2:before {
  content: "\f27a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-import1 .path1:before {
  content: "\f27b";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-import1 .path2:before {
  content: "\f27c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-import-11 .path1:before {
  content: "\f27d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-import-11 .path2:before {
  content: "\f27e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-import-21 .path1:before {
  content: "\f27f";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-import-21 .path2:before {
  content: "\f280";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-info-circle1 .path1:before {
  content: "\f281";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-info-circle1 .path2:before {
  content: "\f282";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-info-circle1 .path3:before {
  content: "\f283";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-information1 .path1:before {
  content: "\f284";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-information1 .path2:before {
  content: "\f285";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-information1 .path3:before {
  content: "\f286";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-instagram1 .path1:before {
  content: "\f287";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-instagram1 .path2:before {
  content: "\f288";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-instagram1 .path3:before {
  content: "\f289";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-judge1 .path1:before {
  content: "\f28a";
  color: rgb(41, 45, 50);
}

.isax-judge1 .path2:before {
  content: "\f28b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-judge1 .path3:before {
  content: "\f28c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-judge1 .path4:before {
  content: "\f28d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-kanban1 .path1:before {
  content: "\f28e";
  color: rgb(41, 45, 50);
}

.isax-kanban1 .path2:before {
  content: "\f28f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-key1 .path1:before {
  content: "\f290";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-key1 .path2:before {
  content: "\f291";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-keyboard1 .path1:before {
  content: "\f292";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-keyboard1 .path2:before {
  content: "\f293";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-keyboard1 .path3:before {
  content: "\f294";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-keyboard1 .path4:before {
  content: "\f295";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-keyboard1 .path5:before {
  content: "\f296";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-keyboard-open1 .path1:before {
  content: "\f297";
  color: rgb(41, 45, 50);
}

.isax-keyboard-open1 .path2:before {
  content: "\f298";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-keyboard-open1 .path3:before {
  content: "\f299";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-keyboard-open1 .path4:before {
  content: "\f29a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-keyboard-open1 .path5:before {
  content: "\f29b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-keyboard-open1 .path6:before {
  content: "\f29c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-key-square1 .path1:before {
  content: "\f29d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-key-square1 .path2:before {
  content: "\f29e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-lamp1 .path1:before {
  content: "\f29f";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-lamp1 .path2:before {
  content: "\f2a0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-lamp-11 .path1:before {
  content: "\f2a1";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-lamp-11 .path2:before {
  content: "\f2a2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-lamp-11 .path3:before {
  content: "\f2a3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-lamp-charge1 .path1:before {
  content: "\f2a4";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-lamp-charge1 .path2:before {
  content: "\f2a5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-lamp-charge1 .path3:before {
  content: "\f2a6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-lamp-on1 .path1:before {
  content: "\f2a7";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-lamp-on1 .path2:before {
  content: "\f2a8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-lamp-slash1 .path1:before {
  content: "\f2a9";
  color: rgb(41, 45, 50);
}

.isax-lamp-slash1 .path2:before {
  content: "\f2aa";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-lamp-slash1 .path3:before {
  content: "\f2ab";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-lamp-slash1 .path4:before {
  content: "\f2ac";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-language-circle1 .path1:before {
  content: "\f2ad";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-language-circle1 .path2:before {
  content: "\f2ae";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-language-square1 .path1:before {
  content: "\f2af";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-language-square1 .path2:before {
  content: "\f2b0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-layer1 .path1:before {
  content: "\f2b1";
  color: rgb(41, 45, 50);
}

.isax-layer1 .path2:before {
  content: "\f2b2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-layer1 .path3:before {
  content: "\f2b3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-level1 .path1:before {
  content: "\f2b4";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-level1 .path2:before {
  content: "\f2b5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-level1 .path3:before {
  content: "\f2b6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-level1 .path4:before {
  content: "\f2b7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-lifebuoy1 .path1:before {
  content: "\f2b8";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-lifebuoy1 .path2:before {
  content: "\f2b9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-like1 .path1:before {
  content: "\f2ba";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-like1 .path2:before {
  content: "\f2bb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-like-11 .path1:before {
  content: "\f2bc";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-like-11 .path2:before {
  content: "\f2bd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-like-dislike1 .path1:before {
  content: "\f2be";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-like-dislike1 .path2:before {
  content: "\f2bf";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-like-dislike1 .path3:before {
  content: "\f2c0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-like-dislike1 .path4:before {
  content: "\f2c1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-like-shapes1 .path1:before {
  content: "\f2c2";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-like-shapes1 .path2:before {
  content: "\f2c3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-like-tag1 .path1:before {
  content: "\f2c4";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-like-tag1 .path2:before {
  content: "\f2c5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-link1 .path1:before {
  content: "\f2c6";
  color: rgb(41, 45, 50);
}

.isax-link1 .path2:before {
  content: "\f2c7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-link-11 .path1:before {
  content: "\f2c8";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-link-11 .path2:before {
  content: "\f2c9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-link-11 .path3:before {
  content: "\f2ca";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-link-22 .path1:before {
  content: "\f2cb";
  color: rgb(41, 45, 50);
}

.isax-link-22 .path2:before {
  content: "\f2cc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-link-22 .path3:before {
  content: "\f2cd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-link-22 .path4:before {
  content: "\f2ce";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.5;
}

.isax-link-211 .path1:before {
  content: "\f2cf";
  color: rgb(41, 45, 50);
}

.isax-link-211 .path2:before {
  content: "\f2d0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-link-211 .path3:before {
  content: "\f2d1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-link-211 .path4:before {
  content: "\f2d2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.5;
}

.isax-link-circle1 .path1:before {
  content: "\f2d3";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-link-circle1 .path2:before {
  content: "\f2d4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-link-circle1 .path3:before {
  content: "\f2d5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-link-square1 .path1:before {
  content: "\f2d6";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-link-square1 .path2:before {
  content: "\f2d7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-link-square1 .path3:before {
  content: "\f2d8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-location1 .path1:before {
  content: "\f2d9";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-location1 .path2:before {
  content: "\f2da";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-location-add1 .path1:before {
  content: "\f2db";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-location-add1 .path2:before {
  content: "\f2dc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-location-cross1 .path1:before {
  content: "\f2dd";
  color: rgb(41, 45, 50);
}

.isax-location-cross1 .path2:before {
  content: "\f2de";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-location-minus1 .path1:before {
  content: "\f2df";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-location-minus1 .path2:before {
  content: "\f2e0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-location-slash1 .path1:before {
  content: "\f2e1";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-location-slash1 .path2:before {
  content: "\f2e2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-location-slash1 .path3:before {
  content: "\f2e3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-location-tick1 .path1:before {
  content: "\f2e4";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-location-tick1 .path2:before {
  content: "\f2e5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-lock1 .path1:before {
  content: "\f2e6";
  color: rgb(41, 45, 50);
}

.isax-lock1 .path2:before {
  content: "\f2e7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-lock1 .path3:before {
  content: "\f2e8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-lock1 .path4:before {
  content: "\f2e9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-lock1 .path5:before {
  content: "\f2ea";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-lock-11 .path1:before {
  content: "\f2eb";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-lock-11 .path2:before {
  content: "\f2ec";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-lock-11 .path3:before {
  content: "\f2ed";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-lock-circle1 .path1:before {
  content: "\f2ee";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-lock-circle1 .path2:before {
  content: "\f2ef";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-lock-slash1 .path1:before {
  content: "\f2f0";
  color: rgb(41, 45, 50);
}

.isax-lock-slash1 .path2:before {
  content: "\f2f1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-lock-slash1 .path3:before {
  content: "\f2f2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-lock-slash1 .path4:before {
  content: "\f2f3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-lock-slash1 .path5:before {
  content: "\f2f4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-login1 .path1:before {
  content: "\f2f5";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-login1 .path2:before {
  content: "\f2f6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-login-11 .path1:before {
  content: "\f2f7";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-login-11 .path2:before {
  content: "\f2f8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-logout1 .path1:before {
  content: "\f2f9";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-logout1 .path2:before {
  content: "\f2fa";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-logout-11 .path1:before {
  content: "\f2fb";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-logout-11 .path2:before {
  content: "\f2fc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-lovely1 .path1:before {
  content: "\f2fd";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-lovely1 .path2:before {
  content: "\f2fe";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-magicpen1 .path1:before {
  content: "\f2ff";
  color: rgb(41, 45, 50);
}

.isax-magicpen1 .path2:before {
  content: "\f300";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-magicpen1 .path3:before {
  content: "\f301";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-magicpen1 .path4:before {
  content: "\f302";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-magicpen1 .path5:before {
  content: "\f303";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-magic-star1 .path1:before {
  content: "\f304";
  color: rgb(41, 45, 50);
}

.isax-magic-star1 .path2:before {
  content: "\f305";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-main-component1 .path1:before {
  content: "\f306";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-main-component1 .path2:before {
  content: "\f307";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-man1 .path1:before {
  content: "\f308";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-man1 .path2:before {
  content: "\f309";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-map1 .path1:before {
  content: "\f30a";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-map1 .path2:before {
  content: "\f30b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-map1 .path3:before {
  content: "\f30c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-map1 .path4:before {
  content: "\f30d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-map1 .path5:before {
  content: "\f30e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-map-11 .path1:before {
  content: "\f30f";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-map-11 .path2:before {
  content: "\f310";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-map-11 .path3:before {
  content: "\f311";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-mask1 .path1:before {
  content: "\f312";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-mask1 .path2:before {
  content: "\f313";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-mask-11 .path1:before {
  content: "\f314";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-mask-11 .path2:before {
  content: "\f315";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-mask-21 .path1:before {
  content: "\f316";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-mask-21 .path2:before {
  content: "\f317";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-math1 .path1:before {
  content: "\f318";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-math1 .path2:before {
  content: "\f319";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-math1 .path3:before {
  content: "\f31a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-math1 .path4:before {
  content: "\f31b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-math1 .path5:before {
  content: "\f31c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-math1 .path6:before {
  content: "\f31d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-maximize1 .path1:before {
  content: "\f31e";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-maximize1 .path2:before {
  content: "\f31f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-maximize-11 .path1:before {
  content: "\f320";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-maximize-11 .path2:before {
  content: "\f321";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-maximize-11 .path3:before {
  content: "\f322";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-maximize-22 .path1:before {
  content: "\f323";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-maximize-22 .path2:before {
  content: "\f324";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-maximize-22 .path3:before {
  content: "\f325";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-maximize-22 .path4:before {
  content: "\f326";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-maximize-22 .path5:before {
  content: "\f327";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-maximize-31 .path1:before {
  content: "\f328";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-maximize-31 .path2:before {
  content: "\f329";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-maximize-41 .path1:before {
  content: "\f32a";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-maximize-41 .path2:before {
  content: "\f32b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-maximize-41 .path3:before {
  content: "\f32c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-maximize-211 .path1:before {
  content: "\f32d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-maximize-211 .path2:before {
  content: "\f32e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-medal1 .path1:before {
  content: "\f32f";
  color: rgb(41, 45, 50);
}

.isax-medal1 .path2:before {
  content: "\f330";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-medal-star1 .path1:before {
  content: "\f331";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-medal-star1 .path2:before {
  content: "\f332";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-medal-star1 .path3:before {
  content: "\f333";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-menu1 .path1:before {
  content: "\f334";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-menu1 .path2:before {
  content: "\f335";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-menu1 .path3:before {
  content: "\f336";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-menu1 .path4:before {
  content: "\f337";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-menu-11 .path1:before {
  content: "\f338";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-menu-11 .path2:before {
  content: "\f339";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-menu-11 .path3:before {
  content: "\f33a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-menu-11 .path4:before {
  content: "\f33b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-menu-board1 .path1:before {
  content: "\f33c";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-menu-board1 .path2:before {
  content: "\f33d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-menu-board1 .path3:before {
  content: "\f33e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-menu-board1 .path4:before {
  content: "\f33f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-menu-board1 .path5:before {
  content: "\f340";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-menu-board1 .path6:before {
  content: "\f341";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message1 .path1:before {
  content: "\f342";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-message1 .path2:before {
  content: "\f343";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message1 .path3:before {
  content: "\f344";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message1 .path4:before {
  content: "\f345";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-21 .path1:before {
  content: "\f346";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-message-21 .path2:before {
  content: "\f347";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-add1 .path1:before {
  content: "\f348";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-message-add1 .path2:before {
  content: "\f349";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-add1 .path3:before {
  content: "\f34a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-add-11 .path1:before {
  content: "\f34b";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-message-add-11 .path2:before {
  content: "\f34c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-circle1 .path1:before {
  content: "\f34d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-message-circle1 .path2:before {
  content: "\f34e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-edit1 .path1:before {
  content: "\f34f";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-message-edit1 .path2:before {
  content: "\f350";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-edit1 .path3:before {
  content: "\f351";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-favorite1 .path1:before {
  content: "\f352";
  color: rgb(41, 45, 50);
}

.isax-message-favorite1 .path2:before {
  content: "\f353";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-message-favorite1 .path3:before {
  content: "\f354";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-favorite1 .path4:before {
  content: "\f355";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-favorite1 .path5:before {
  content: "\f356";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-minus1 .path1:before {
  content: "\f357";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-message-minus1 .path2:before {
  content: "\f358";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-notif1 .path1:before {
  content: "\f359";
  color: rgb(41, 45, 50);
}

.isax-message-notif1 .path2:before {
  content: "\f35a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-message-notif1 .path3:before {
  content: "\f35b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-notif1 .path4:before {
  content: "\f35c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-notif1 .path5:before {
  content: "\f35d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-programming1 .path1:before {
  content: "\f35e";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-message-programming1 .path2:before {
  content: "\f35f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-programming1 .path3:before {
  content: "\f360";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-programming1 .path4:before {
  content: "\f361";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-question1 .path1:before {
  content: "\f362";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-message-question1 .path2:before {
  content: "\f363";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-question1 .path3:before {
  content: "\f364";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-remove1 .path1:before {
  content: "\f365";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-message-remove1 .path2:before {
  content: "\f366";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-remove1 .path3:before {
  content: "\f367";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-messages1 .path1:before {
  content: "\f368";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-messages1 .path2:before {
  content: "\f369";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-messages1 .path3:before {
  content: "\f36a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-messages-11 .path1:before {
  content: "\f36b";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-messages-11 .path2:before {
  content: "\f36c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-messages-11 .path3:before {
  content: "\f36d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-messages-11 .path4:before {
  content: "\f36e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-messages-11 .path5:before {
  content: "\f36f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-messages-21 .path1:before {
  content: "\f370";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-messages-21 .path2:before {
  content: "\f371";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-messages-31 .path1:before {
  content: "\f372";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-messages-31 .path2:before {
  content: "\f373";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-search1 .path1:before {
  content: "\f374";
  color: rgb(41, 45, 50);
}

.isax-message-search1 .path2:before {
  content: "\f375";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-message-search1 .path3:before {
  content: "\f376";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-search1 .path4:before {
  content: "\f377";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-search1 .path5:before {
  content: "\f378";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-square1 .path1:before {
  content: "\f379";
  color: rgb(41, 45, 50);
}

.isax-message-square1 .path2:before {
  content: "\f37a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-message-text1 .path1:before {
  content: "\f37b";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-message-text1 .path2:before {
  content: "\f37c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-text1 .path3:before {
  content: "\f37d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-text-11 .path1:before {
  content: "\f37e";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-message-text-11 .path2:before {
  content: "\f37f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-text-11 .path3:before {
  content: "\f380";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-tick1 .path1:before {
  content: "\f381";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-message-tick1 .path2:before {
  content: "\f382";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-tick1 .path3:before {
  content: "\f383";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-time1 .path1:before {
  content: "\f384";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-message-time1 .path2:before {
  content: "\f385";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-message-time1 .path3:before {
  content: "\f386";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-microphone1 .path1:before {
  content: "\f387";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-microphone1 .path2:before {
  content: "\f388";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-microphone-21 .path1:before {
  content: "\f389";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-microphone-21 .path2:before {
  content: "\f38a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-microphone-slash1 .path1:before {
  content: "\f38b";
  color: rgb(41, 45, 50);
}

.isax-microphone-slash1 .path2:before {
  content: "\f38c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-microphone-slash1 .path3:before {
  content: "\f38d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-microphone-slash1 .path4:before {
  content: "\f38e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-microphone-slash1 .path5:before {
  content: "\f38f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-microphone-slash-11 .path1:before {
  content: "\f390";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-microphone-slash-11 .path2:before {
  content: "\f391";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-microphone-slash-11 .path3:before {
  content: "\f392";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-microphone-slash-11 .path4:before {
  content: "\f393";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-microscope1 .path1:before {
  content: "\f394";
  color: rgb(41, 45, 50);
}

.isax-microscope1 .path2:before {
  content: "\f395";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-microscope1 .path3:before {
  content: "\f396";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-microscope1 .path4:before {
  content: "\f397";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-milk1 .path1:before {
  content: "\f398";
  color: rgb(41, 45, 50);
}

.isax-milk1 .path2:before {
  content: "\f399";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-milk1 .path3:before {
  content: "\f39a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-mini-music-sqaure1 .path1:before {
  content: "\f39b";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-mini-music-sqaure1 .path2:before {
  content: "\f39c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-mini-music-sqaure1 .path3:before {
  content: "\f39d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-minus1 .path1:before {
  content: "\f39e";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-minus1 .path2:before {
  content: "\f39f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-minus-cirlce1 .path1:before {
  content: "\f3a0";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-minus-cirlce1 .path2:before {
  content: "\f3a1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-minus-square1 .path1:before {
  content: "\f3a2";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-minus-square1 .path2:before {
  content: "\f3a3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-mirror1 .path1:before {
  content: "\f3a4";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-mirror1 .path2:before {
  content: "\f3a5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-mirroring-screen1 .path1:before {
  content: "\f3a6";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-mirroring-screen1 .path2:before {
  content: "\f3a7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-mirroring-screen1 .path3:before {
  content: "\f3a8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-mirroring-screen1 .path4:before {
  content: "\f3a9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-mobile1 .path1:before {
  content: "\f3aa";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-mobile1 .path2:before {
  content: "\f3ab";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-mobile1 .path3:before {
  content: "\f3ac";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-mobile-programming1 .path1:before {
  content: "\f3ad";
  color: rgb(41, 45, 50);
}

.isax-mobile-programming1 .path2:before {
  content: "\f3ae";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-mobile-programming1 .path3:before {
  content: "\f3af";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money1 .path1:before {
  content: "\f3b0";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-money1 .path2:before {
  content: "\f3b1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money1 .path3:before {
  content: "\f3b2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money1 .path4:before {
  content: "\f3b3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-21 .path1:before {
  content: "\f3b4";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-money-21 .path2:before {
  content: "\f3b5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-21 .path3:before {
  content: "\f3b6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-21 .path4:before {
  content: "\f3b7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-21 .path5:before {
  content: "\f3b8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-21 .path6:before {
  content: "\f3b9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-31 .path1:before {
  content: "\f3ba";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-money-31 .path2:before {
  content: "\f3bb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-31 .path3:before {
  content: "\f3bc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-31 .path4:before {
  content: "\f3bd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-41 .path1:before {
  content: "\f3be";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-money-41 .path2:before {
  content: "\f3bf";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-41 .path3:before {
  content: "\f3c0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-41 .path4:before {
  content: "\f3c1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-41 .path5:before {
  content: "\f3c2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-41 .path6:before {
  content: "\f3c3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-add1 .path1:before {
  content: "\f3c4";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-money-add1 .path2:before {
  content: "\f3c5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-add1 .path3:before {
  content: "\f3c6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-add1 .path4:before {
  content: "\f3c7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-change1 .path1:before {
  content: "\f3c8";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-money-change1 .path2:before {
  content: "\f3c9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-change1 .path3:before {
  content: "\f3ca";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-change1 .path4:before {
  content: "\f3cb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-forbidden1 .path1:before {
  content: "\f3cc";
  color: rgb(41, 45, 50);
}

.isax-money-forbidden1 .path2:before {
  content: "\f3cd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-forbidden1 .path3:before {
  content: "\f3ce";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-money-forbidden1 .path4:before {
  content: "\f3cf";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-forbidden1 .path5:before {
  content: "\f3d0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-recive1 .path1:before {
  content: "\f3d1";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-money-recive1 .path2:before {
  content: "\f3d2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-money-recive1 .path3:before {
  content: "\f3d3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-money-recive1 .path4:before {
  content: "\f3d4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-recive1 .path5:before {
  content: "\f3d5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-recive1 .path6:before {
  content: "\f3d6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-recive1 .path7:before {
  content: "\f3d7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-remove1 .path1:before {
  content: "\f3d8";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-money-remove1 .path2:before {
  content: "\f3d9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-remove1 .path3:before {
  content: "\f3da";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-remove1 .path4:before {
  content: "\f3db";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-moneys1 .path1:before {
  content: "\f3dc";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-moneys1 .path2:before {
  content: "\f3dd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-moneys1 .path3:before {
  content: "\f3de";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-moneys1 .path4:before {
  content: "\f3df";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-moneys1 .path5:before {
  content: "\f3e0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-send1 .path1:before {
  content: "\f3e1";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-money-send1 .path2:before {
  content: "\f3e2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-send1 .path3:before {
  content: "\f3e3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-tick1 .path1:before {
  content: "\f3e4";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-money-tick1 .path2:before {
  content: "\f3e5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-tick1 .path3:before {
  content: "\f3e6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-tick1 .path4:before {
  content: "\f3e7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-time1 .path1:before {
  content: "\f3e8";
  color: rgb(41, 45, 50);
}

.isax-money-time1 .path2:before {
  content: "\f3e9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-money-time1 .path3:before {
  content: "\f3ea";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-money-time1 .path4:before {
  content: "\f3eb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-monitor1 .path1:before {
  content: "\f3ec";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-monitor1 .path2:before {
  content: "\f3ed";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-monitor-mobbile1 .path1:before {
  content: "\f3ee";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-monitor-mobbile1 .path2:before {
  content: "\f3ef";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-monitor-mobbile1 .path3:before {
  content: "\f3f0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-monitor-recorder1 .path1:before {
  content: "\f3f1";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-monitor-recorder1 .path2:before {
  content: "\f3f2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-monitor-recorder1 .path3:before {
  content: "\f3f3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-moon1 .path1:before {
  content: "\f3f4";
  color: rgb(41, 45, 50);
}

.isax-moon1 .path2:before {
  content: "\f3f5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-more1 .path1:before {
  content: "\f3f6";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-more1 .path2:before {
  content: "\f3f7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-more1 .path3:before {
  content: "\f3f8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-more1 .path4:before {
  content: "\f3f9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-more-21 .path1:before {
  content: "\f3fa";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-more-21 .path2:before {
  content: "\f3fb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.97;
}

.isax-more-21 .path3:before {
  content: "\f3fc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.97;
}

.isax-more-21 .path4:before {
  content: "\f3fd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.97;
}

.isax-more-circle1 .path1:before {
  content: "\f3fe";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-more-circle1 .path2:before {
  content: "\f3ff";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-more-circle1 .path3:before {
  content: "\f400";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-more-circle1 .path4:before {
  content: "\f401";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-more-square1 .path1:before {
  content: "\f402";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-more-square1 .path2:before {
  content: "\f403";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-more-square1 .path3:before {
  content: "\f404";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-more-square1 .path4:before {
  content: "\f405";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-mouse1 .path1:before {
  content: "\f406";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-mouse1 .path2:before {
  content: "\f407";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-mouse-11 .path1:before {
  content: "\f408";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-mouse-11 .path2:before {
  content: "\f409";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-mouse-circle1 .path1:before {
  content: "\f40a";
  color: rgb(41, 45, 50);
}

.isax-mouse-circle1 .path2:before {
  content: "\f40b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-mouse-square1 .path1:before {
  content: "\f40c";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-mouse-square1 .path2:before {
  content: "\f40d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-music1 .path1:before {
  content: "\f40e";
  color: rgb(41, 45, 50);
}

.isax-music1 .path2:before {
  content: "\f40f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-music1 .path3:before {
  content: "\f410";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-music-circle1 .path1:before {
  content: "\f411";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-music-circle1 .path2:before {
  content: "\f412";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-music-circle1 .path3:before {
  content: "\f413";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-music-circle1 .path4:before {
  content: "\f414";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-music-circle1 .path5:before {
  content: "\f415";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-music-circle1 .path6:before {
  content: "\f416";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-music-dashboard1 .path1:before {
  content: "\f417";
  color: rgb(41, 45, 50);
}

.isax-music-dashboard1 .path2:before {
  content: "\f418";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-music-dashboard1 .path3:before {
  content: "\f419";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-music-filter1 .path1:before {
  content: "\f41a";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-music-filter1 .path2:before {
  content: "\f41b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-music-filter1 .path3:before {
  content: "\f41c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-music-filter1 .path4:before {
  content: "\f41d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-music-filter1 .path5:before {
  content: "\f41e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-music-library-21 .path1:before {
  content: "\f41f";
  color: rgb(41, 45, 50);
}

.isax-music-library-21 .path2:before {
  content: "\f420";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-music-library-21 .path3:before {
  content: "\f421";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-music-library-21 .path4:before {
  content: "\f422";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-musicnote1 .path1:before {
  content: "\f423";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-musicnote1 .path2:before {
  content: "\f424";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-music-play1 .path1:before {
  content: "\f425";
  color: rgb(41, 45, 50);
}

.isax-music-play1 .path2:before {
  content: "\f426";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-music-play1 .path3:before {
  content: "\f427";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-music-play1 .path4:before {
  content: "\f428";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-music-playlist1 .path1:before {
  content: "\f429";
  color: rgb(41, 45, 50);
}

.isax-music-playlist1 .path2:before {
  content: "\f42a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-music-playlist1 .path3:before {
  content: "\f42b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-music-playlist1 .path4:before {
  content: "\f42c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-music-square1 .path1:before {
  content: "\f42d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-music-square1 .path2:before {
  content: "\f42e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-music-square-add1 .path1:before {
  content: "\f42f";
  color: rgb(41, 45, 50);
}

.isax-music-square-add1 .path2:before {
  content: "\f430";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-music-square-add1 .path3:before {
  content: "\f431";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-music-square-remove1 .path1:before {
  content: "\f432";
  color: rgb(41, 45, 50);
}

.isax-music-square-remove1 .path2:before {
  content: "\f433";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-music-square-remove1 .path3:before {
  content: "\f434";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-music-square-search1 .path1:before {
  content: "\f435";
  color: rgb(41, 45, 50);
}

.isax-music-square-search1 .path2:before {
  content: "\f436";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-music-square-search1 .path3:before {
  content: "\f437";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-next1 .path1:before {
  content: "\f438";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-next1 .path2:before {
  content: "\f439";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-note1 .path1:before {
  content: "\f43a";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-note1 .path2:before {
  content: "\f43b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-note1 .path3:before {
  content: "\f43c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-note1 .path4:before {
  content: "\f43d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-note-11 .path1:before {
  content: "\f43e";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-note-11 .path2:before {
  content: "\f43f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-note-11 .path3:before {
  content: "\f440";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-note-11 .path4:before {
  content: "\f441";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-note-11 .path5:before {
  content: "\f442";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-note-22 .path1:before {
  content: "\f443";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-note-22 .path2:before {
  content: "\f444";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-note-22 .path3:before {
  content: "\f445";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-note-22 .path4:before {
  content: "\f446";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-note-211 .path1:before {
  content: "\f447";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-note-211 .path2:before {
  content: "\f448";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-note-add1 .path1:before {
  content: "\f449";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-note-add1 .path2:before {
  content: "\f44a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-note-add1 .path3:before {
  content: "\f44b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-note-add1 .path4:before {
  content: "\f44c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-note-favorite1 .path1:before {
  content: "\f44d";
  color: rgb(41, 45, 50);
}

.isax-note-favorite1 .path2:before {
  content: "\f44e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-note-favorite1 .path3:before {
  content: "\f44f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-note-favorite1 .path4:before {
  content: "\f450";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-note-favorite1 .path5:before {
  content: "\f451";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-note-favorite1 .path6:before {
  content: "\f452";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-note-remove1 .path1:before {
  content: "\f453";
  color: rgb(41, 45, 50);
}

.isax-note-remove1 .path2:before {
  content: "\f454";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-note-remove1 .path3:before {
  content: "\f455";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-note-remove1 .path4:before {
  content: "\f456";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-note-remove1 .path5:before {
  content: "\f457";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-note-square1 .path1:before {
  content: "\f458";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-note-square1 .path2:before {
  content: "\f459";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-note-text1 .path1:before {
  content: "\f45a";
  color: rgb(41, 45, 50);
}

.isax-note-text1 .path2:before {
  content: "\f45b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-note-text1 .path3:before {
  content: "\f45c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-note-text1 .path4:before {
  content: "\f45d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-note-text1 .path5:before {
  content: "\f45e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-notification1 .path1:before {
  content: "\f45f";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-notification1 .path2:before {
  content: "\f460";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-notification1 .path3:before {
  content: "\f461";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-notification-11 .path1:before {
  content: "\f462";
  color: rgb(41, 45, 50);
}

.isax-notification-11 .path2:before {
  content: "\f463";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-notification-bing1 .path1:before {
  content: "\f464";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-notification-bing1 .path2:before {
  content: "\f465";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-notification-bing1 .path3:before {
  content: "\f466";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-notification-circle1 .path1:before {
  content: "\f467";
  color: rgb(41, 45, 50);
}

.isax-notification-circle1 .path2:before {
  content: "\f468";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-notification-favorite1 .path1:before {
  content: "\f469";
  color: rgb(41, 45, 50);
}

.isax-notification-favorite1 .path2:before {
  content: "\f46a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-notification-favorite1 .path3:before {
  content: "\f46b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-notification-status1 .path1:before {
  content: "\f46c";
  color: rgb(41, 45, 50);
}

.isax-notification-status1 .path2:before {
  content: "\f46d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-notification-status1 .path3:before {
  content: "\f46e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-notification-status1 .path4:before {
  content: "\f46f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-omega-circle1 .path1:before {
  content: "\f470";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-omega-circle1 .path2:before {
  content: "\f471";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-omega-square1 .path1:before {
  content: "\f472";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-omega-square1 .path2:before {
  content: "\f473";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-paintbucket1 .path1:before {
  content: "\f474";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-paintbucket1 .path2:before {
  content: "\f475";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-paintbucket1 .path3:before {
  content: "\f476";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-paperclip1 .path1:before {
  content: "\f477";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-paperclip1 .path2:before {
  content: "\f478";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-paperclip-21 .path1:before {
  content: "\f479";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-paperclip-21 .path2:before {
  content: "\f47a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-password-check1 .path1:before {
  content: "\f47b";
  color: rgb(41, 45, 50);
}

.isax-password-check1 .path2:before {
  content: "\f47c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-password-check1 .path3:before {
  content: "\f47d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-password-check1 .path4:before {
  content: "\f47e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-password-check1 .path5:before {
  content: "\f47f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-path1 .path1:before {
  content: "\f480";
  color: rgb(41, 45, 50);
}

.isax-path1 .path2:before {
  content: "\f481";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-path1 .path3:before {
  content: "\f482";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-path-21 .path1:before {
  content: "\f483";
  color: rgb(41, 45, 50);
}

.isax-path-21 .path2:before {
  content: "\f484";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-path-21 .path3:before {
  content: "\f485";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-path-square1 .path1:before {
  content: "\f486";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-path-square1 .path2:before {
  content: "\f487";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-path-square1 .path3:before {
  content: "\f488";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-path-square1 .path4:before {
  content: "\f489";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pause1 .path1:before {
  content: "\f48a";
  color: rgb(41, 45, 50);
}

.isax-pause1 .path2:before {
  content: "\f48b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-pause-circle1 .path1:before {
  content: "\f48c";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-pause-circle1 .path2:before {
  content: "\f48d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pause-circle1 .path3:before {
  content: "\f48e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pen-add1 .path1:before {
  content: "\f48f";
  color: rgb(41, 45, 50);
}

.isax-pen-add1 .path2:before {
  content: "\f490";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-pen-add1 .path3:before {
  content: "\f491";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pen-add1 .path4:before {
  content: "\f492";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pen-close1 .path1:before {
  content: "\f493";
  color: rgb(41, 45, 50);
}

.isax-pen-close1 .path2:before {
  content: "\f494";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-pen-close1 .path3:before {
  content: "\f495";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pen-close1 .path4:before {
  content: "\f496";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pen-remove1 .path1:before {
  content: "\f497";
  color: rgb(41, 45, 50);
}

.isax-pen-remove1 .path2:before {
  content: "\f498";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pen-remove1 .path3:before {
  content: "\f499";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-pen-remove1 .path4:before {
  content: "\f49a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pen-tool1 .path1:before {
  content: "\f49b";
  color: rgb(41, 45, 50);
}

.isax-pen-tool1 .path2:before {
  content: "\f49c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pen-tool1 .path3:before {
  content: "\f49d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pen-tool1 .path4:before {
  content: "\f49e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pen-tool1 .path5:before {
  content: "\f49f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pen-tool1 .path6:before {
  content: "\f4a0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pen-tool1 .path7:before {
  content: "\f4a1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pen-tool1 .path8:before {
  content: "\f4a2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pen-tool1 .path9:before {
  content: "\f4a3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pen-tool1 .path10:before {
  content: "\f4a4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-pen-tool-21 .path1:before {
  content: "\f4a5";
  color: rgb(41, 45, 50);
}

.isax-pen-tool-21 .path2:before {
  content: "\f4a6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pen-tool-21 .path3:before {
  content: "\f4a7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pen-tool-21 .path4:before {
  content: "\f4a8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pen-tool-21 .path5:before {
  content: "\f4a9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pen-tool-21 .path6:before {
  content: "\f4aa";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pen-tool-21 .path7:before {
  content: "\f4ab";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-people1 .path1:before {
  content: "\f4ac";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-people1 .path2:before {
  content: "\f4ad";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-people1 .path3:before {
  content: "\f4ae";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-people1 .path4:before {
  content: "\f4af";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-people1 .path5:before {
  content: "\f4b0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-people1 .path6:before {
  content: "\f4b1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-percentage-circle1 .path1:before {
  content: "\f4b2";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-percentage-circle1 .path2:before {
  content: "\f4b3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-percentage-circle1 .path3:before {
  content: "\f4b4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-percentage-circle1 .path4:before {
  content: "\f4b5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-percentage-square1 .path1:before {
  content: "\f4b6";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-percentage-square1 .path2:before {
  content: "\f4b7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-percentage-square1 .path3:before {
  content: "\f4b8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-percentage-square1 .path4:before {
  content: "\f4b9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-personalcard1 .path1:before {
  content: "\f4ba";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-personalcard1 .path2:before {
  content: "\f4bb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-personalcard1 .path3:before {
  content: "\f4bc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-personalcard1 .path4:before {
  content: "\f4bd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-personalcard1 .path5:before {
  content: "\f4be";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-personalcard1 .path6:before {
  content: "\f4bf";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pet1 .path1:before {
  content: "\f4c0";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-pet1 .path2:before {
  content: "\f4c1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pet1 .path3:before {
  content: "\f4c2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pet1 .path4:before {
  content: "\f4c3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pet1 .path5:before {
  content: "\f4c4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-pharagraphspacing1 .path1:before {
  content: "\f4c5";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-pharagraphspacing1 .path2:before {
  content: "\f4c6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-pharagraphspacing1 .path3:before {
  content: "\f4c7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-picture-frame1 .path1:before {
  content: "\f4c8";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-picture-frame1 .path2:before {
  content: "\f4c9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-play1 .path1:before {
  content: "\f4ca";
  color: rgb(41, 45, 50);
}

.isax-play1 .path2:before {
  content: "\f4cb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-play-add1 .path1:before {
  content: "\f4cc";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-play-add1 .path2:before {
  content: "\f4cd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-play-add1 .path3:before {
  content: "\f4ce";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-play-circle1 .path1:before {
  content: "\f4cf";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-play-circle1 .path2:before {
  content: "\f4d0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-play-cricle1 .path1:before {
  content: "\f4d1";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-play-cricle1 .path2:before {
  content: "\f4d2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-play-cricle1 .path3:before {
  content: "\f4d3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-play-cricle1 .path4:before {
  content: "\f4d4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-play-cricle1 .path5:before {
  content: "\f4d5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-play-remove1 .path1:before {
  content: "\f4d6";
  color: rgb(41, 45, 50);
}

.isax-play-remove1 .path2:before {
  content: "\f4d7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-play-remove1 .path3:before {
  content: "\f4d8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-presention-chart1 .path1:before {
  content: "\f4d9";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-presention-chart1 .path2:before {
  content: "\f4da";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-presention-chart1 .path3:before {
  content: "\f4db";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-presention-chart1 .path4:before {
  content: "\f4dc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-previous1 .path1:before {
  content: "\f4dd";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-previous1 .path2:before {
  content: "\f4de";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-printer1 .path1:before {
  content: "\f4df";
  color: rgb(41, 45, 50);
}

.isax-printer1 .path2:before {
  content: "\f4e0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-printer1 .path3:before {
  content: "\f4e1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-printer1 .path4:before {
  content: "\f4e2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-printer1 .path5:before {
  content: "\f4e3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-printer-slash1 .path1:before {
  content: "\f4e4";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-printer-slash1 .path2:before {
  content: "\f4e5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-printer-slash1 .path3:before {
  content: "\f4e6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-printer-slash1 .path4:before {
  content: "\f4e7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-printer-slash1 .path5:before {
  content: "\f4e8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-printer-slash1 .path6:before {
  content: "\f4e9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-printer-slash1 .path7:before {
  content: "\f4ea";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-printer-slash1 .path8:before {
  content: "\f4eb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-profile .path1:before {
  content: "\f4ec";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-profile .path2:before {
  content: "\f4ed";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-profile-2user1 .path1:before {
  content: "\f4ee";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-profile-2user1 .path2:before {
  content: "\f4ef";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-profile-2user1 .path3:before {
  content: "\f4f0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-profile-2user1 .path4:before {
  content: "\f4f1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-profile-add1 .path1:before {
  content: "\f4f2";
  color: rgb(41, 45, 50);
}

.isax-profile-add1 .path2:before {
  content: "\f4f3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-profile-add1 .path3:before {
  content: "\f4f4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-profile-circle1 .path1:before {
  content: "\f4f5";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-profile-circle1 .path2:before {
  content: "\f4f6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-profile-circle1 .path3:before {
  content: "\f4f7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-profile-delete1 .path1:before {
  content: "\f4f8";
  color: rgb(41, 45, 50);
}

.isax-profile-delete1 .path2:before {
  content: "\f4f9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-profile-delete1 .path3:before {
  content: "\f4fa";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-profile-remove1 .path1:before {
  content: "\f4fb";
  color: rgb(41, 45, 50);
}

.isax-profile-remove1 .path2:before {
  content: "\f4fc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-profile-remove1 .path3:before {
  content: "\f4fd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-profile-tick1 .path1:before {
  content: "\f4fe";
  color: rgb(41, 45, 50);
}

.isax-profile-tick1 .path2:before {
  content: "\f4ff";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-profile-tick1 .path3:before {
  content: "\f500";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-programming-arrow1 .path1:before {
  content: "\f501";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-programming-arrow1 .path2:before {
  content: "\f502";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-programming-arrows1 .path1:before {
  content: "\f503";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-programming-arrows1 .path2:before {
  content: "\f504";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-programming-arrows1 .path3:before {
  content: "\f505";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-programming-arrows1 .path4:before {
  content: "\f506";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-quote-down1 .path1:before {
  content: "\f507";
  color: rgb(41, 45, 50);
}

.isax-quote-down1 .path2:before {
  content: "\f508";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-quote-down-circle1 .path1:before {
  content: "\f509";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-quote-down-circle1 .path2:before {
  content: "\f50a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-quote-down-circle1 .path3:before {
  content: "\f50b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-quote-down-square1 .path1:before {
  content: "\f50c";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-quote-down-square1 .path2:before {
  content: "\f50d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-quote-down-square1 .path3:before {
  content: "\f50e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-quote-up1 .path1:before {
  content: "\f50f";
  color: rgb(41, 45, 50);
}

.isax-quote-up1 .path2:before {
  content: "\f510";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-quote-up-circle1 .path1:before {
  content: "\f511";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-quote-up-circle1 .path2:before {
  content: "\f512";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-quote-up-circle1 .path3:before {
  content: "\f513";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-quote-up-square1 .path1:before {
  content: "\f514";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-quote-up-square1 .path2:before {
  content: "\f515";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-quote-up-square1 .path3:before {
  content: "\f516";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-radar1 .path1:before {
  content: "\f517";
  color: rgb(41, 45, 50);
}

.isax-radar1 .path2:before {
  content: "\f518";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-radar1 .path3:before {
  content: "\f519";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-radar1 .path4:before {
  content: "\f51a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-radar1 .path5:before {
  content: "\f51b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-radar-11 .path1:before {
  content: "\f51c";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-radar-11 .path2:before {
  content: "\f51d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-radar-21 .path1:before {
  content: "\f51e";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-radar-21 .path2:before {
  content: "\f51f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-radio1 .path1:before {
  content: "\f520";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-radio1 .path2:before {
  content: "\f521";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-radio1 .path3:before {
  content: "\f522";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-radio1 .path4:before {
  content: "\f523";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-radio1 .path5:before {
  content: "\f524";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-radio1 .path6:before {
  content: "\f525";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-ram1 .path1:before {
  content: "\f526";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-ram1 .path2:before {
  content: "\f527";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-ram1 .path3:before {
  content: "\f528";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-ram-21 .path1:before {
  content: "\f529";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-ram-21 .path2:before {
  content: "\f52a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-ram-21 .path3:before {
  content: "\f52b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-ram-21 .path4:before {
  content: "\f52c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-ram-21 .path5:before {
  content: "\f52d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-ranking1 .path1:before {
  content: "\f52e";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-ranking1 .path2:before {
  content: "\f52f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-ranking1 .path3:before {
  content: "\f530";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-ranking1 .path4:before {
  content: "\f531";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-ranking-11 .path1:before {
  content: "\f532";
  color: rgb(41, 45, 50);
}

.isax-ranking-11 .path2:before {
  content: "\f533";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-ranking-11 .path3:before {
  content: "\f534";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-ranking-11 .path4:before {
  content: "\f535";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-receipt1 .path1:before {
  content: "\f536";
  color: rgb(41, 45, 50);
}

.isax-receipt1 .path2:before {
  content: "\f537";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-receipt-11 .path1:before {
  content: "\f538";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-receipt-11 .path2:before {
  content: "\f539";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-receipt-11 .path3:before {
  content: "\f53a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-receipt-21 .path1:before {
  content: "\f53b";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-receipt-21 .path2:before {
  content: "\f53c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-receipt-21 .path3:before {
  content: "\f53d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-receipt-2-11 .path1:before {
  content: "\f53e";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-receipt-2-11 .path2:before {
  content: "\f53f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-receipt-2-11 .path3:before {
  content: "\f540";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-receipt-2-11 .path4:before {
  content: "\f541";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-receipt-2-11 .path5:before {
  content: "\f542";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-receipt-add1 .path1:before {
  content: "\f543";
  color: rgb(41, 45, 50);
}

.isax-receipt-add1 .path2:before {
  content: "\f544";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-receipt-add1 .path3:before {
  content: "\f545";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-receipt-discount1 .path1:before {
  content: "\f546";
  color: rgb(41, 45, 50);
}

.isax-receipt-discount1 .path2:before {
  content: "\f547";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-receipt-discount1 .path3:before {
  content: "\f548";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-receipt-discount1 .path4:before {
  content: "\f549";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-receipt-discount1 .path5:before {
  content: "\f54a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-receipt-disscount1 .path1:before {
  content: "\f54b";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-receipt-disscount1 .path2:before {
  content: "\f54c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-receipt-disscount1 .path3:before {
  content: "\f54d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-receipt-disscount1 .path4:before {
  content: "\f54e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-receipt-edit1 .path1:before {
  content: "\f54f";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-receipt-edit1 .path2:before {
  content: "\f550";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-receipt-item1 .path1:before {
  content: "\f551";
  color: rgb(41, 45, 50);
}

.isax-receipt-item1 .path2:before {
  content: "\f552";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-receipt-item1 .path3:before {
  content: "\f553";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-receipt-item1 .path4:before {
  content: "\f554";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-receipt-item1 .path5:before {
  content: "\f555";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-receipt-item1 .path6:before {
  content: "\f556";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-receipt-minus1 .path1:before {
  content: "\f557";
  color: rgb(41, 45, 50);
}

.isax-receipt-minus1 .path2:before {
  content: "\f558";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-receipt-minus1 .path3:before {
  content: "\f559";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-receipt-search1 .path1:before {
  content: "\f55a";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-receipt-search1 .path2:before {
  content: "\f55b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-receipt-square1 .path1:before {
  content: "\f55c";
  color: rgb(41, 45, 50);
}

.isax-receipt-square1 .path2:before {
  content: "\f55d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-receipt-text1 .path1:before {
  content: "\f55e";
  color: rgb(41, 45, 50);
}

.isax-receipt-text1 .path2:before {
  content: "\f55f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-receipt-text1 .path3:before {
  content: "\f560";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-receipt-text1 .path4:before {
  content: "\f561";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-received1 .path1:before {
  content: "\f562";
  color: rgb(41, 45, 50);
}

.isax-received1 .path2:before {
  content: "\f563";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-received1 .path3:before {
  content: "\f564";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-receive-square1 .path1:before {
  content: "\f565";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-receive-square1 .path2:before {
  content: "\f566";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-receive-square1 .path3:before {
  content: "\f567";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-receive-square-21 .path1:before {
  content: "\f568";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-receive-square-21 .path2:before {
  content: "\f569";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-receive-square-21 .path3:before {
  content: "\f56a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-record1 .path1:before {
  content: "\f56b";
  color: rgb(41, 45, 50);
}

.isax-record1 .path2:before {
  content: "\f56c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-record-circle1 .path1:before {
  content: "\f56d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-record-circle1 .path2:before {
  content: "\f56e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-recovery-convert1 .path1:before {
  content: "\f56f";
  color: rgb(41, 45, 50);
}

.isax-recovery-convert1 .path2:before {
  content: "\f570";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-recovery-convert1 .path3:before {
  content: "\f571";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-recovery-convert1 .path4:before {
  content: "\f572";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-redo1 .path1:before {
  content: "\f573";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-redo1 .path2:before {
  content: "\f574";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-refresh1 .path1:before {
  content: "\f575";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-refresh1 .path2:before {
  content: "\f576";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-refresh1 .path3:before {
  content: "\f577";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-refresh-21 .path1:before {
  content: "\f578";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-refresh-21 .path2:before {
  content: "\f579";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-refresh-circle1 .path1:before {
  content: "\f57a";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-refresh-circle1 .path2:before {
  content: "\f57b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-refresh-circle1 .path3:before {
  content: "\f57c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-refresh-left-square1 .path1:before {
  content: "\f57d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-refresh-left-square1 .path2:before {
  content: "\f57e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-refresh-right-square1 .path1:before {
  content: "\f57f";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-refresh-right-square1 .path2:before {
  content: "\f580";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-refresh-square-21 .path1:before {
  content: "\f581";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-refresh-square-21 .path2:before {
  content: "\f582";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-refresh-square-21 .path3:before {
  content: "\f583";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-repeat1 .path1:before {
  content: "\f584";
  color: rgb(41, 45, 50);
}

.isax-repeat1 .path2:before {
  content: "\f585";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-repeat-circle1 .path1:before {
  content: "\f586";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-repeat-circle1 .path2:before {
  content: "\f587";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-repeat-circle1 .path3:before {
  content: "\f588";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-repeate-music1 .path1:before {
  content: "\f589";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-repeate-music1 .path2:before {
  content: "\f58a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-repeate-music1 .path3:before {
  content: "\f58b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-repeate-one1 .path1:before {
  content: "\f58c";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-repeate-one1 .path2:before {
  content: "\f58d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-repeate-one1 .path3:before {
  content: "\f58e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-reserve1 .path1:before {
  content: "\f58f";
  color: rgb(41, 45, 50);
}

.isax-reserve1 .path2:before {
  content: "\f590";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-reserve1 .path3:before {
  content: "\f591";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-reserve1 .path4:before {
  content: "\f592";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-rotate-left1 .path1:before {
  content: "\f593";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-rotate-left1 .path2:before {
  content: "\f594";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-rotate-left-11 .path1:before {
  content: "\f595";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-rotate-left-11 .path2:before {
  content: "\f596";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-rotate-right1 .path1:before {
  content: "\f597";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-rotate-right1 .path2:before {
  content: "\f598";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-rotate-right-11 .path1:before {
  content: "\f599";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-rotate-right-11 .path2:before {
  content: "\f59a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-route-square1 .path1:before {
  content: "\f59b";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-route-square1 .path2:before {
  content: "\f59c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-routing1 .path1:before {
  content: "\f59d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-routing1 .path2:before {
  content: "\f59e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-routing1 .path3:before {
  content: "\f59f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-routing1 .path4:before {
  content: "\f5a0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-routing1 .path5:before {
  content: "\f5a1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-routing-21 .path1:before {
  content: "\f5a2";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-routing-21 .path2:before {
  content: "\f5a3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-routing-21 .path3:before {
  content: "\f5a4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-routing-21 .path4:before {
  content: "\f5a5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-routing-21 .path5:before {
  content: "\f5a6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-row-horizontal1 .path1:before {
  content: "\f5a7";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-row-horizontal1 .path2:before {
  content: "\f5a8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-row-vertical1 .path1:before {
  content: "\f5a9";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-row-vertical1 .path2:before {
  content: "\f5aa";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-rulerpen1 .path1:before {
  content: "\f5ab";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-rulerpen1 .path2:before {
  content: "\f5ac";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-rulerpen1 .path3:before {
  content: "\f5ad";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-rulerpen1 .path4:before {
  content: "\f5ae";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-rulerpen1 .path5:before {
  content: "\f5af";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-rulerpen1 .path6:before {
  content: "\f5b0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-rulerpen1 .path7:before {
  content: "\f5b1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-ruler1 .path1:before {
  content: "\f5b2";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-ruler1 .path2:before {
  content: "\f5b3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-ruler1 .path3:before {
  content: "\f5b4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-ruler1 .path4:before {
  content: "\f5b5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-ruler1 .path5:before {
  content: "\f5b6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-safe-home1 .path1:before {
  content: "\f5b7";
  color: rgb(41, 45, 50);
}

.isax-safe-home1 .path2:before {
  content: "\f5b8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-sagittarius1 .path1:before {
  content: "\f5b9";
  color: rgb(41, 45, 50);
}

.isax-sagittarius1 .path2:before {
  content: "\f5ba";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-save-21 .path1:before {
  content: "\f5bb";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-save-21 .path2:before {
  content: "\f5bc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-save-add1 .path1:before {
  content: "\f5bd";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-save-add1 .path2:before {
  content: "\f5be";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-save-add1 .path3:before {
  content: "\f5bf";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-save-minus1 .path1:before {
  content: "\f5c0";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-save-minus1 .path2:before {
  content: "\f5c1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-save-minus1 .path3:before {
  content: "\f5c2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-save-remove1 .path1:before {
  content: "\f5c3";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-save-remove1 .path2:before {
  content: "\f5c4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-save-remove1 .path3:before {
  content: "\f5c5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-scan1 .path1:before {
  content: "\f5c6";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-scan1 .path2:before {
  content: "\f5c7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-scan1 .path3:before {
  content: "\f5c8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-scan1 .path4:before {
  content: "\f5c9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-scan1 .path5:before {
  content: "\f5ca";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-scan1 .path6:before {
  content: "\f5cb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-scan1 .path7:before {
  content: "\f5cc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-scan-barcode1 .path1:before {
  content: "\f5cd";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-scan-barcode1 .path2:before {
  content: "\f5ce";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-scan-barcode1 .path3:before {
  content: "\f5cf";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-scan-barcode1 .path4:before {
  content: "\f5d0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-scan-barcode1 .path5:before {
  content: "\f5d1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-scan-barcode1 .path6:before {
  content: "\f5d2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-scan-barcode1 .path7:before {
  content: "\f5d3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-scan-barcode1 .path8:before {
  content: "\f5d4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-scanner1 .path1:before {
  content: "\f5d5";
  color: rgb(41, 45, 50);
}

.isax-scanner1 .path2:before {
  content: "\f5d6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-scanner1 .path3:before {
  content: "\f5d7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-scanner1 .path4:before {
  content: "\f5d8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-scanner1 .path5:before {
  content: "\f5d9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-scanning1 .path1:before {
  content: "\f5da";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-scanning1 .path2:before {
  content: "\f5db";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-scanning1 .path3:before {
  content: "\f5dc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-scanning1 .path4:before {
  content: "\f5dd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-scanning1 .path5:before {
  content: "\f5de";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-scanning1 .path6:before {
  content: "\f5df";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-scanning1 .path7:before {
  content: "\f5e0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-scanning1 .path8:before {
  content: "\f5e1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-scissor1 .path1:before {
  content: "\f5e2";
  color: rgb(41, 45, 50);
}

.isax-scissor1 .path2:before {
  content: "\f5e3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-scissor1 .path3:before {
  content: "\f5e4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-scissor-11 .path1:before {
  content: "\f5e5";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-scissor-11 .path2:before {
  content: "\f5e6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-screenmirroring1 .path1:before {
  content: "\f5e7";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-screenmirroring1 .path2:before {
  content: "\f5e8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-scroll1 .path1:before {
  content: "\f5e9";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-scroll1 .path2:before {
  content: "\f5ea";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-scroll1 .path3:before {
  content: "\f5eb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-search-favorite1 .path1:before {
  content: "\f5ec";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-search-favorite1 .path2:before {
  content: "\f5ed";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-search-favorite1 .path3:before {
  content: "\f5ee";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-search-favorite-11 .path1:before {
  content: "\f5ef";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-search-favorite-11 .path2:before {
  content: "\f5f0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-search-favorite-11 .path3:before {
  content: "\f5f1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-search-normal1 .path1:before {
  content: "\f5f2";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-search-normal1 .path2:before {
  content: "\f5f3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-search-normal-11 .path1:before {
  content: "\f5f4";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-search-normal-11 .path2:before {
  content: "\f5f5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-search-status1 .path1:before {
  content: "\f5f6";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-search-status1 .path2:before {
  content: "\f5f7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-search-status1 .path3:before {
  content: "\f5f8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-search-status1 .path4:before {
  content: "\f5f9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-search-status-11 .path1:before {
  content: "\f5fa";
  color: rgb(41, 45, 50);
}

.isax-search-status-11 .path2:before {
  content: "\f5fb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-search-status-11 .path3:before {
  content: "\f5fc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-search-status-11 .path4:before {
  content: "\f5fd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-search-zoom-in1 .path1:before {
  content: "\f5fe";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-search-zoom-in1 .path2:before {
  content: "\f5ff";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-search-zoom-in1 .path3:before {
  content: "\f600";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-search-zoom-in-11 .path1:before {
  content: "\f601";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-search-zoom-in-11 .path2:before {
  content: "\f602";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-search-zoom-in-11 .path3:before {
  content: "\f603";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-search-zoom-out1 .path1:before {
  content: "\f604";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-search-zoom-out1 .path2:before {
  content: "\f605";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-search-zoom-out1 .path3:before {
  content: "\f606";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-search-zoom-out-11 .path1:before {
  content: "\f607";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-search-zoom-out-11 .path2:before {
  content: "\f608";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-search-zoom-out-11 .path3:before {
  content: "\f609";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-security1 .path1:before {
  content: "\f60a";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-security1 .path2:before {
  content: "\f60b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-security-card1 .path1:before {
  content: "\f60c";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-security-card1 .path2:before {
  content: "\f60d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-security-card1 .path3:before {
  content: "\f60e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-security-safe1 .path1:before {
  content: "\f60f";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-security-safe1 .path2:before {
  content: "\f610";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-security-time1 .path1:before {
  content: "\f611";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-security-time1 .path2:before {
  content: "\f612";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-security-time1 .path3:before {
  content: "\f613";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-security-user1 .path1:before {
  content: "\f614";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-security-user1 .path2:before {
  content: "\f615";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-security-user1 .path3:before {
  content: "\f616";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-send1 .path1:before {
  content: "\f617";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-send1 .path2:before {
  content: "\f618";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-send-11 .path1:before {
  content: "\f619";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-send-11 .path2:before {
  content: "\f61a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-send-11 .path3:before {
  content: "\f61b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-send-21 .path1:before {
  content: "\f61c";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-send-21 .path2:before {
  content: "\f61d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-send-21 .path3:before {
  content: "\f61e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-send-sqaure-21 .path1:before {
  content: "\f61f";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-send-sqaure-21 .path2:before {
  content: "\f620";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-send-sqaure-21 .path3:before {
  content: "\f621";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-send-square1 .path1:before {
  content: "\f622";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-send-square1 .path2:before {
  content: "\f623";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-send-square1 .path3:before {
  content: "\f624";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-send-square1 .path4:before {
  content: "\f625";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-setting1 .path1:before {
  content: "\f626";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-setting1 .path2:before {
  content: "\f627";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-setting-21 .path1:before {
  content: "\f628";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-setting-21 .path2:before {
  content: "\f629";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-setting-31 .path1:before {
  content: "\f62a";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-setting-31 .path2:before {
  content: "\f62b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-setting-31 .path3:before {
  content: "\f62c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-setting-31 .path4:before {
  content: "\f62d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-setting-31 .path5:before {
  content: "\f62e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-setting-31 .path6:before {
  content: "\f62f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-setting-31 .path7:before {
  content: "\f630";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-setting-41 .path1:before {
  content: "\f631";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-setting-41 .path2:before {
  content: "\f632";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-setting-41 .path3:before {
  content: "\f633";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-setting-41 .path4:before {
  content: "\f634";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-setting-41 .path5:before {
  content: "\f635";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-setting-41 .path6:before {
  content: "\f636";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-setting-51 .path1:before {
  content: "\f637";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-setting-51 .path2:before {
  content: "\f638";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-setting-51 .path3:before {
  content: "\f639";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-setting-51 .path4:before {
  content: "\f63a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-setting-51 .path5:before {
  content: "\f63b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-setting-51 .path6:before {
  content: "\f63c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-settings1 .path1:before {
  content: "\f63d";
  color: rgb(41, 45, 50);
}

.isax-settings1 .path2:before {
  content: "\f63e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.16;
}

.isax-settings1 .path3:before {
  content: "\f63f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.16;
}

.isax-shapes1 .path1:before {
  content: "\f640";
  color: rgb(41, 45, 50);
}

.isax-shapes1 .path2:before {
  content: "\f641";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-shapes-11 .path1:before {
  content: "\f642";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-shapes-11 .path2:before {
  content: "\f643";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-share1 .path1:before {
  content: "\f644";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-share1 .path2:before {
  content: "\f645";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-share1 .path3:before {
  content: "\f646";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-share1 .path4:before {
  content: "\f647";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-share1 .path5:before {
  content: "\f648";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-share1 .path6:before {
  content: "\f649";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-shield1 .path1:before {
  content: "\f64a";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-shield1 .path2:before {
  content: "\f64b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-shield-cross1 .path1:before {
  content: "\f64c";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-shield-cross1 .path2:before {
  content: "\f64d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-shield-search1 .path1:before {
  content: "\f64e";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-shield-search1 .path2:before {
  content: "\f64f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-shield-search1 .path3:before {
  content: "\f650";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-shield-security .path1:before {
  content: "\f651";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-shield-security .path2:before {
  content: "\f652";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-shield-slash1 .path1:before {
  content: "\f653";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-shield-slash1 .path2:before {
  content: "\f654";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-shield-slash1 .path3:before {
  content: "\f655";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-shield-tick1 .path1:before {
  content: "\f656";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-shield-tick1 .path2:before {
  content: "\f657";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-ship1 .path1:before {
  content: "\f658";
  color: rgb(41, 45, 50);
}

.isax-ship1 .path2:before {
  content: "\f659";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-ship1 .path3:before {
  content: "\f65a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-shop1 .path1:before {
  content: "\f65b";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-shop1 .path2:before {
  content: "\f65c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-shop1 .path3:before {
  content: "\f65d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-shop1 .path4:before {
  content: "\f65e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-shop1 .path5:before {
  content: "\f65f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-shop-add1 .path1:before {
  content: "\f660";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-shop-add1 .path2:before {
  content: "\f661";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-shop-add1 .path3:before {
  content: "\f662";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-shop-add1 .path4:before {
  content: "\f663";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-shop-add1 .path5:before {
  content: "\f664";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-shopping-bag1 .path1:before {
  content: "\f665";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-shopping-bag1 .path2:before {
  content: "\f666";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-shopping-bag1 .path3:before {
  content: "\f667";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-shopping-cart1 .path1:before {
  content: "\f668";
  color: rgb(41, 45, 50);
}

.isax-shopping-cart1 .path2:before {
  content: "\f669";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-shopping-cart1 .path3:before {
  content: "\f66a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-shopping-cart1 .path4:before {
  content: "\f66b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-shop-remove1 .path1:before {
  content: "\f66c";
  color: rgb(41, 45, 50);
}

.isax-shop-remove1 .path2:before {
  content: "\f66d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-shop-remove1 .path3:before {
  content: "\f66e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-shop-remove1 .path4:before {
  content: "\f66f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-shop-remove1 .path5:before {
  content: "\f670";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-shuffle1 .path1:before {
  content: "\f671";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-shuffle1 .path2:before {
  content: "\f672";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-shuffle1 .path3:before {
  content: "\f673";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-sidebar-bottom1 .path1:before {
  content: "\f674";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-sidebar-bottom1 .path2:before {
  content: "\f675";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-sidebar-bottom1 .path3:before {
  content: "\f676";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-sidebar-left1 .path1:before {
  content: "\f677";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-sidebar-left1 .path2:before {
  content: "\f678";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-sidebar-left1 .path3:before {
  content: "\f679";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-sidebar-right1 .path1:before {
  content: "\f67a";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-sidebar-right1 .path2:before {
  content: "\f67b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-sidebar-right1 .path3:before {
  content: "\f67c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-sidebar-top1 .path1:before {
  content: "\f67d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-sidebar-top1 .path2:before {
  content: "\f67e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-sidebar-top1 .path3:before {
  content: "\f67f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-signpost1 .path1:before {
  content: "\f680";
  color: rgb(41, 45, 50);
}

.isax-signpost1 .path2:before {
  content: "\f681";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-signpost1 .path3:before {
  content: "\f682";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-signpost1 .path4:before {
  content: "\f683";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-simcard1 .path1:before {
  content: "\f684";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-simcard1 .path2:before {
  content: "\f685";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-simcard1 .path3:before {
  content: "\f686";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-simcard-11 .path1:before {
  content: "\f687";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-simcard-11 .path2:before {
  content: "\f688";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-simcard-11 .path3:before {
  content: "\f689";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-simcard-11 .path4:before {
  content: "\f68a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-simcard-11 .path5:before {
  content: "\f68b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-simcard-21 .path1:before {
  content: "\f68c";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-simcard-21 .path2:before {
  content: "\f68d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-size1 .path1:before {
  content: "\f68e";
  color: rgb(41, 45, 50);
}

.isax-size1 .path2:before {
  content: "\f68f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-slash1 .path1:before {
  content: "\f690";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-slash1 .path2:before {
  content: "\f691";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-slash1 .path3:before {
  content: "\f692";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-slider1 .path1:before {
  content: "\f693";
  color: rgb(41, 45, 50);
}

.isax-slider1 .path2:before {
  content: "\f694";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-slider1 .path3:before {
  content: "\f695";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-slider1 .path4:before {
  content: "\f696";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-slider-horizontal1 .path1:before {
  content: "\f697";
  color: rgb(41, 45, 50);
}

.isax-slider-horizontal1 .path2:before {
  content: "\f698";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-slider-horizontal1 .path3:before {
  content: "\f699";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-slider-horizontal-11 .path1:before {
  content: "\f69a";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-slider-horizontal-11 .path2:before {
  content: "\f69b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-slider-horizontal-11 .path3:before {
  content: "\f69c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-slider-vertical1 .path1:before {
  content: "\f69d";
  color: rgb(41, 45, 50);
}

.isax-slider-vertical1 .path2:before {
  content: "\f69e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-slider-vertical1 .path3:before {
  content: "\f69f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-slider-vertical-11 .path1:before {
  content: "\f6a0";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-slider-vertical-11 .path2:before {
  content: "\f6a1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-slider-vertical-11 .path3:before {
  content: "\f6a2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-smallcaps1 .path1:before {
  content: "\f6a3";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-smallcaps1 .path2:before {
  content: "\f6a4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-smallcaps1 .path3:before {
  content: "\f6a5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-smart-car1 .path1:before {
  content: "\f6a6";
  color: rgb(41, 45, 50);
}

.isax-smart-car1 .path2:before {
  content: "\f6a7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-smart-car1 .path3:before {
  content: "\f6a8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-smart-car1 .path4:before {
  content: "\f6a9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-smart-car1 .path5:before {
  content: "\f6aa";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-smart-car1 .path6:before {
  content: "\f6ab";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-smart-home1 .path1:before {
  content: "\f6ac";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-smart-home1 .path2:before {
  content: "\f6ad";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-smart-home1 .path3:before {
  content: "\f6ae";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-smart-home1 .path4:before {
  content: "\f6af";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-smileys1 .path1:before {
  content: "\f6b0";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-smileys1 .path2:before {
  content: "\f6b1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-smileys1 .path3:before {
  content: "\f6b2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-smileys1 .path4:before {
  content: "\f6b3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-smileys1 .path5:before {
  content: "\f6b4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-smileys1 .path6:before {
  content: "\f6b5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-sms1 .path1:before {
  content: "\f6b6";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-sms1 .path2:before {
  content: "\f6b7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-sms-edit1 .path1:before {
  content: "\f6b8";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-sms-edit1 .path2:before {
  content: "\f6b9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-sms-edit1 .path3:before {
  content: "\f6ba";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-sms-notification1 .path1:before {
  content: "\f6bb";
  color: rgb(41, 45, 50);
}

.isax-sms-notification1 .path2:before {
  content: "\f6bc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-sms-notification1 .path3:before {
  content: "\f6bd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-sms-search1 .path1:before {
  content: "\f6be";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-sms-search1 .path2:before {
  content: "\f6bf";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-sms-search1 .path3:before {
  content: "\f6c0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-sms-star1 .path1:before {
  content: "\f6c1";
  color: rgb(41, 45, 50);
}

.isax-sms-star1 .path2:before {
  content: "\f6c2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-sms-star1 .path3:before {
  content: "\f6c3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-sms-tracking1 .path1:before {
  content: "\f6c4";
  color: rgb(41, 45, 50);
}

.isax-sms-tracking1 .path2:before {
  content: "\f6c5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-sms-tracking1 .path3:before {
  content: "\f6c6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-sort1 .path1:before {
  content: "\f6c7";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-sort1 .path2:before {
  content: "\f6c8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-sort1 .path3:before {
  content: "\f6c9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-sort1 .path4:before {
  content: "\f6ca";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-sound1 .path1:before {
  content: "\f6cb";
  color: rgb(41, 45, 50);
}

.isax-sound1 .path2:before {
  content: "\f6cc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-sound1 .path3:before {
  content: "\f6cd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-sound1 .path4:before {
  content: "\f6ce";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-sound1 .path5:before {
  content: "\f6cf";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-speaker1 .path1:before {
  content: "\f6d0";
  color: rgb(41, 45, 50);
}

.isax-speaker1 .path2:before {
  content: "\f6d1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-speaker1 .path3:before {
  content: "\f6d2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-speedometer1 .path1:before {
  content: "\f6d3";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-speedometer1 .path2:before {
  content: "\f6d4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-speedometer1 .path3:before {
  content: "\f6d5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-star1 .path1:before {
  content: "\f6d6";
  color: rgb(41, 45, 50);
}

.isax-star1 .path2:before {
  content: "\f6d7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-star1 .path3:before {
  content: "\f6d8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-star1 .path4:before {
  content: "\f6d9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-star-11 .path1:before {
  content: "\f6da";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-star-11 .path2:before {
  content: "\f6db";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-star-slash1 .path1:before {
  content: "\f6dc";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-star-slash1 .path2:before {
  content: "\f6dd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-star-slash1 .path3:before {
  content: "\f6de";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-status1 .path1:before {
  content: "\f6df";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-status1 .path2:before {
  content: "\f6e0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-status1 .path3:before {
  content: "\f6e1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-status-up1 .path1:before {
  content: "\f6e2";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-status-up1 .path2:before {
  content: "\f6e3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-status-up1 .path3:before {
  content: "\f6e4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-status-up1 .path4:before {
  content: "\f6e5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-status-up1 .path5:before {
  content: "\f6e6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-sticker1 .path1:before {
  content: "\f6e7";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-sticker1 .path2:before {
  content: "\f6e8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-stickynote1 .path1:before {
  content: "\f6e9";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-stickynote1 .path2:before {
  content: "\f6ea";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-stickynote1 .path3:before {
  content: "\f6eb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-stickynote1 .path4:before {
  content: "\f6ec";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-stickynote1 .path5:before {
  content: "\f6ed";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-stickynote1 .path6:before {
  content: "\f6ee";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-stop1 .path1:before {
  content: "\f6ef";
  color: rgb(41, 45, 50);
}

.isax-stop1 .path2:before {
  content: "\f6f0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-stop-circle1 .path1:before {
  content: "\f6f1";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-stop-circle1 .path2:before {
  content: "\f6f2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-story1 .path1:before {
  content: "\f6f3";
  color: rgb(41, 45, 50);
}

.isax-story1 .path2:before {
  content: "\f6f4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-story1 .path3:before {
  content: "\f6f5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-story1 .path4:before {
  content: "\f6f6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-strongbox1 .path1:before {
  content: "\f6f7";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-strongbox1 .path2:before {
  content: "\f6f8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-strongbox-21 .path1:before {
  content: "\f6f9";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-strongbox-21 .path2:before {
  content: "\f6fa";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-strongbox-21 .path3:before {
  content: "\f6fb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-subtitle1 .path1:before {
  content: "\f6fc";
  color: rgb(41, 45, 50);
}

.isax-subtitle1 .path2:before {
  content: "\f6fd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-subtitle1 .path3:before {
  content: "\f6fe";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-subtitle1 .path4:before {
  content: "\f6ff";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-subtitle1 .path5:before {
  content: "\f700";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-sun1 .path1:before {
  content: "\f701";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-sun1 .path2:before {
  content: "\f702";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-sun1 .path3:before {
  content: "\f703";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-sun1 .path4:before {
  content: "\f704";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-sun1 .path5:before {
  content: "\f705";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-sun1 .path6:before {
  content: "\f706";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-sun1 .path7:before {
  content: "\f707";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-sun-11 .path1:before {
  content: "\f708";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-sun-11 .path2:before {
  content: "\f709";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-sun-fog1 .path1:before {
  content: "\f70a";
  color: rgb(41, 45, 50);
}

.isax-sun-fog1 .path2:before {
  content: "\f70b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-sun-fog1 .path3:before {
  content: "\f70c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-sun-fog1 .path4:before {
  content: "\f70d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-sun-fog1 .path5:before {
  content: "\f70e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-tag1 .path1:before {
  content: "\f70f";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-tag1 .path2:before {
  content: "\f710";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-tag-21 .path1:before {
  content: "\f711";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-tag-21 .path2:before {
  content: "\f712";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-tag-21 .path3:before {
  content: "\f713";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-tag-cross1 .path1:before {
  content: "\f714";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-tag-cross1 .path2:before {
  content: "\f715";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-tag-right1 .path1:before {
  content: "\f716";
  color: rgb(41, 45, 50);
}

.isax-tag-right1 .path2:before {
  content: "\f717";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-tag-user1 .path1:before {
  content: "\f718";
  color: rgb(41, 45, 50);
}

.isax-tag-user1 .path2:before {
  content: "\f719";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-tag-user1 .path3:before {
  content: "\f71a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-task1 .path1:before {
  content: "\f71b";
  color: rgb(41, 45, 50);
}

.isax-task1 .path2:before {
  content: "\f71c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-task1 .path3:before {
  content: "\f71d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-task1 .path4:before {
  content: "\f71e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-task1 .path5:before {
  content: "\f71f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-task1 .path6:before {
  content: "\f720";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-task-square1 .path1:before {
  content: "\f721";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-task-square1 .path2:before {
  content: "\f722";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-task-square1 .path3:before {
  content: "\f723";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-task-square1 .path4:before {
  content: "\f724";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-task-square1 .path5:before {
  content: "\f725";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-teacher1 .path1:before {
  content: "\f726";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-teacher1 .path2:before {
  content: "\f727";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-text1 .path1:before {
  content: "\f728";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-text1 .path2:before {
  content: "\f729";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-textalign-center1 .path1:before {
  content: "\f72a";
  color: rgb(41, 45, 50);
}

.isax-textalign-center1 .path2:before {
  content: "\f72b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-textalign-center1 .path3:before {
  content: "\f72c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-textalign-center1 .path4:before {
  content: "\f72d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-textalign-justifycenter1 .path1:before {
  content: "\f72e";
  color: rgb(41, 45, 50);
}

.isax-textalign-justifycenter1 .path2:before {
  content: "\f72f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-textalign-justifycenter1 .path3:before {
  content: "\f730";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-textalign-justifycenter1 .path4:before {
  content: "\f731";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-textalign-justifyleft1 .path1:before {
  content: "\f732";
  color: rgb(41, 45, 50);
}

.isax-textalign-justifyleft1 .path2:before {
  content: "\f733";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-textalign-justifyleft1 .path3:before {
  content: "\f734";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-textalign-justifyleft1 .path4:before {
  content: "\f735";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-textalign-justifyright1 .path1:before {
  content: "\f736";
  color: rgb(41, 45, 50);
}

.isax-textalign-justifyright1 .path2:before {
  content: "\f737";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-textalign-justifyright1 .path3:before {
  content: "\f738";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-textalign-justifyright1 .path4:before {
  content: "\f739";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-textalign-left1 .path1:before {
  content: "\f73a";
  color: rgb(41, 45, 50);
}

.isax-textalign-left1 .path2:before {
  content: "\f73b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-textalign-left1 .path3:before {
  content: "\f73c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-textalign-left1 .path4:before {
  content: "\f73d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-textalign-right1 .path1:before {
  content: "\f73e";
  color: rgb(41, 45, 50);
}

.isax-textalign-right1 .path2:before {
  content: "\f73f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-textalign-right1 .path3:before {
  content: "\f740";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-textalign-right1 .path4:before {
  content: "\f741";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-text-block1 .path1:before {
  content: "\f742";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-text-block1 .path2:before {
  content: "\f743";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-text-bold1 .path1:before {
  content: "\f744";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-text-bold1 .path2:before {
  content: "\f745";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-text-italic1 .path1:before {
  content: "\f746";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-text-italic1 .path2:before {
  content: "\f747";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-text-underline1 .path1:before {
  content: "\f748";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-text-underline1 .path2:before {
  content: "\f749";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-text-underline1 .path3:before {
  content: "\f74a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-tick-circle1 .path1:before {
  content: "\f74b";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-tick-circle1 .path2:before {
  content: "\f74c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-ticket1 .path1:before {
  content: "\f74d";
  color: rgb(41, 45, 50);
}

.isax-ticket1 .path2:before {
  content: "\f74e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-ticket-21 .path1:before {
  content: "\f74f";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-ticket-21 .path2:before {
  content: "\f750";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-ticket-21 .path3:before {
  content: "\f751";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-ticket-discount1 .path1:before {
  content: "\f752";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-ticket-discount1 .path2:before {
  content: "\f753";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-ticket-discount1 .path3:before {
  content: "\f754";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-ticket-discount1 .path4:before {
  content: "\f755";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-ticket-expired1 .path1:before {
  content: "\f756";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-ticket-expired1 .path2:before {
  content: "\f757";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-ticket-star1 .path1:before {
  content: "\f758";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-ticket-star1 .path2:before {
  content: "\f759";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-ticket-star1 .path3:before {
  content: "\f75a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-tick-square1 .path1:before {
  content: "\f75b";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-tick-square1 .path2:before {
  content: "\f75c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-timer1 .path1:before {
  content: "\f75d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-timer1 .path2:before {
  content: "\f75e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-timer1 .path3:before {
  content: "\f75f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-timer-11 .path1:before {
  content: "\f760";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-timer-11 .path2:before {
  content: "\f761";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-timer-11 .path3:before {
  content: "\f762";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-timer-pause1 .path1:before {
  content: "\f763";
  color: rgb(41, 45, 50);
}

.isax-timer-pause1 .path2:before {
  content: "\f764";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-timer-pause1 .path3:before {
  content: "\f765";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-timer-pause1 .path4:before {
  content: "\f766";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-timer-start1 .path1:before {
  content: "\f767";
  color: rgb(41, 45, 50);
}

.isax-timer-start1 .path2:before {
  content: "\f768";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-timer-start1 .path3:before {
  content: "\f769";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-timer-start1 .path4:before {
  content: "\f76a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-toggle-off1 .path1:before {
  content: "\f76b";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-toggle-off1 .path2:before {
  content: "\f76c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-toggle-off-circle1 .path1:before {
  content: "\f76d";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-toggle-off-circle1 .path2:before {
  content: "\f76e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-toggle-on1 .path1:before {
  content: "\f76f";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-toggle-on1 .path2:before {
  content: "\f770";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-toggle-on-circle1 .path1:before {
  content: "\f771";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-toggle-on-circle1 .path2:before {
  content: "\f772";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-trade1 .path1:before {
  content: "\f773";
  color: rgb(41, 45, 50);
}

.isax-trade1 .path2:before {
  content: "\f774";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-trade1 .path3:before {
  content: "\f775";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-trade1 .path4:before {
  content: "\f776";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-transaction-minus1 .path1:before {
  content: "\f777";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-transaction-minus1 .path2:before {
  content: "\f778";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-translate1 .path1:before {
  content: "\f779";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-translate1 .path2:before {
  content: "\f77a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-translate1 .path3:before {
  content: "\f77b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-translate1 .path4:before {
  content: "\f77c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-translate1 .path5:before {
  content: "\f77d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-translate1 .path6:before {
  content: "\f77e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-trash1 .path1:before {
  content: "\f77f";
  color: rgb(41, 45, 50);
}

.isax-trash1 .path2:before {
  content: "\f780";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.3991;
}

.isax-trash1 .path3:before {
  content: "\f781";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-trash1 .path4:before {
  content: "\f782";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-tree1 .path1:before {
  content: "\f783";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-tree1 .path2:before {
  content: "\f784";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-tree1 .path3:before {
  content: "\f785";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-trend-down1 .path1:before {
  content: "\f786";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-trend-down1 .path2:before {
  content: "\f787";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-trend-up1 .path1:before {
  content: "\f788";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-trend-up1 .path2:before {
  content: "\f789";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-triangle1 .path1:before {
  content: "\f78a";
  color: rgb(41, 45, 50);
}

.isax-triangle1 .path2:before {
  content: "\f78b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-triangle1 .path3:before {
  content: "\f78c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-truck-remove1 .path1:before {
  content: "\f78d";
  color: rgb(41, 45, 50);
}

.isax-truck-remove1 .path2:before {
  content: "\f78e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-truck-remove1 .path3:before {
  content: "\f78f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-truck-remove1 .path4:before {
  content: "\f790";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-truck-remove1 .path5:before {
  content: "\f791";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-truck-remove1 .path6:before {
  content: "\f792";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-truck-tick1 .path1:before {
  content: "\f793";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-truck-tick1 .path2:before {
  content: "\f794";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-truck-tick1 .path3:before {
  content: "\f795";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-truck-tick1 .path4:before {
  content: "\f796";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-truck-tick1 .path5:before {
  content: "\f797";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-truck-tick1 .path6:before {
  content: "\f798";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-truck-time1 .path1:before {
  content: "\f799";
  color: rgb(41, 45, 50);
}

.isax-truck-time1 .path2:before {
  content: "\f79a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-truck-time1 .path3:before {
  content: "\f79b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-truck-time1 .path4:before {
  content: "\f79c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-truck-time1 .path5:before {
  content: "\f79d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-truck-time1 .path6:before {
  content: "\f79e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-trush-square1 .path1:before {
  content: "\f79f";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-trush-square1 .path2:before {
  content: "\f7a0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-trush-square1 .path3:before {
  content: "\f7a1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-undo1 .path1:before {
  content: "\f7a2";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-undo1 .path2:before {
  content: "\f7a3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-unlimited1 .path1:before {
  content: "\f7a4";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-unlimited1 .path2:before {
  content: "\f7a5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-unlimited1 .path3:before {
  content: "\f7a6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-unlock1 .path1:before {
  content: "\f7a7";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-unlock1 .path2:before {
  content: "\f7a8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-unlock1 .path3:before {
  content: "\f7a9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-user1 .path1:before {
  content: "\f7aa";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-user1 .path2:before {
  content: "\f7ab";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-user-add1 .path1:before {
  content: "\f7ac";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-user-add1 .path2:before {
  content: "\f7ad";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-user-add1 .path3:before {
  content: "\f7ae";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-user-cirlce-add1 .path1:before {
  content: "\f7af";
  color: rgb(41, 45, 50);
}

.isax-user-cirlce-add1 .path2:before {
  content: "\f7b0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-user-cirlce-add1 .path3:before {
  content: "\f7b1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-user-cirlce-add1 .path4:before {
  content: "\f7b2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-user-edit1 .path1:before {
  content: "\f7b3";
  color: rgb(41, 45, 50);
}

.isax-user-edit1 .path2:before {
  content: "\f7b4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-user-edit1 .path3:before {
  content: "\f7b5";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-user-minus1 .path1:before {
  content: "\f7b6";
  color: rgb(41, 45, 50);
}

.isax-user-minus1 .path2:before {
  content: "\f7b7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-user-minus1 .path3:before {
  content: "\f7b8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-user-octagon1 .path1:before {
  content: "\f7b9";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-user-octagon1 .path2:before {
  content: "\f7ba";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-user-octagon1 .path3:before {
  content: "\f7bb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-user-remove1 .path1:before {
  content: "\f7bc";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-user-remove1 .path2:before {
  content: "\f7bd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-user-remove1 .path3:before {
  content: "\f7be";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-user-search1 .path1:before {
  content: "\f7bf";
  color: rgb(41, 45, 50);
}

.isax-user-search1 .path2:before {
  content: "\f7c0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-user-search1 .path3:before {
  content: "\f7c1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-user-square1 .path1:before {
  content: "\f7c2";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-user-square1 .path2:before {
  content: "\f7c3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-user-square1 .path3:before {
  content: "\f7c4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-user-tag1 .path1:before {
  content: "\f7c5";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-user-tag1 .path2:before {
  content: "\f7c6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-user-tag1 .path3:before {
  content: "\f7c7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-user-tick1 .path1:before {
  content: "\f7c8";
  color: rgb(41, 45, 50);
}

.isax-user-tick1 .path2:before {
  content: "\f7c9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-user-tick1 .path3:before {
  content: "\f7ca";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-verify1 .path1:before {
  content: "\f7cb";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-verify1 .path2:before {
  content: "\f7cc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-video1 .path1:before {
  content: "\f7cd";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-video1 .path2:before {
  content: "\f7ce";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-video1 .path3:before {
  content: "\f7cf";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-video-add1 .path1:before {
  content: "\f7d0";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-video-add1 .path2:before {
  content: "\f7d1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-video-add1 .path3:before {
  content: "\f7d2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-video-circle1 .path1:before {
  content: "\f7d3";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-video-circle1 .path2:before {
  content: "\f7d4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-video-horizontal1 .path1:before {
  content: "\f7d5";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-video-horizontal1 .path2:before {
  content: "\f7d6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-video-octagon1 .path1:before {
  content: "\f7d7";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-video-octagon1 .path2:before {
  content: "\f7d8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-video-play1 .path1:before {
  content: "\f7d9";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-video-play1 .path2:before {
  content: "\f7da";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-video-play1 .path3:before {
  content: "\f7db";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-video-remove1 .path1:before {
  content: "\f7dc";
  color: rgb(41, 45, 50);
}

.isax-video-remove1 .path2:before {
  content: "\f7dd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-video-remove1 .path3:before {
  content: "\f7de";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-video-slash1 .path1:before {
  content: "\f7df";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-video-slash1 .path2:before {
  content: "\f7e0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-video-slash1 .path3:before {
  content: "\f7e1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-video-slash1 .path4:before {
  content: "\f7e2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-video-slash1 .path5:before {
  content: "\f7e3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-video-slash1 .path6:before {
  content: "\f7e4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-video-square1 .path1:before {
  content: "\f7e5";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-video-square1 .path2:before {
  content: "\f7e6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-video-tick1 .path1:before {
  content: "\f7e7";
  color: rgb(41, 45, 50);
}

.isax-video-tick1 .path2:before {
  content: "\f7e8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-video-tick1 .path3:before {
  content: "\f7e9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-video-time1 .path1:before {
  content: "\f7ea";
  color: rgb(41, 45, 50);
}

.isax-video-time1 .path2:before {
  content: "\f7eb";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-video-time1 .path3:before {
  content: "\f7ec";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-video-vertical1 .path1:before {
  content: "\f7ed";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-video-vertical1 .path2:before {
  content: "\f7ee";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-voice-cricle1 .path1:before {
  content: "\f7ef";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-voice-cricle1 .path2:before {
  content: "\f7f0";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-voice-cricle1 .path3:before {
  content: "\f7f1";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-voice-cricle1 .path4:before {
  content: "\f7f2";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-voice-cricle1 .path5:before {
  content: "\f7f3";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-voice-cricle1 .path6:before {
  content: "\f7f4";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-voice-square1 .path1:before {
  content: "\f7f5";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-voice-square1 .path2:before {
  content: "\f7f6";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-voice-square1 .path3:before {
  content: "\f7f7";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-voice-square1 .path4:before {
  content: "\f7f8";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-voice-square1 .path5:before {
  content: "\f7f9";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-voice-square1 .path6:before {
  content: "\f7fa";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-volume-cross1 .path1:before {
  content: "\f7fb";
  color: rgb(41, 45, 50);
}

.isax-volume-cross1 .path2:before {
  content: "\f7fc";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-volume-cross1 .path3:before {
  content: "\f7fd";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-volume-high1 .path1:before {
  content: "\f7fe";
  color: rgb(41, 45, 50);
}

.isax-volume-high1 .path2:before {
  content: "\f7ff";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-volume-high1 .path3:before {
  content: "\f800";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-volume-high1 .path4:before {
  content: "\f801";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-volume-low1 .path1:before {
  content: "\f802";
  color: rgb(41, 45, 50);
}

.isax-volume-low1 .path2:before {
  content: "\f803";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-volume-low1 .path3:before {
  content: "\f804";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-volume-low-11 .path1:before {
  content: "\f805";
  color: rgb(41, 45, 50);
}

.isax-volume-low-11 .path2:before {
  content: "\f806";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-volume-low-11 .path3:before {
  content: "\f807";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-volume-mute1 .path1:before {
  content: "\f808";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-volume-mute1 .path2:before {
  content: "\f809";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-volume-slash1 .path1:before {
  content: "\f80a";
  color: rgb(41, 45, 50);
}

.isax-volume-slash1 .path2:before {
  content: "\f80b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-volume-slash1 .path3:before {
  content: "\f80c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-volume-slash1 .path4:before {
  content: "\f80d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-volume-slash1 .path5:before {
  content: "\f80e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-volume-up1 .path1:before {
  content: "\f80f";
  color: rgb(41, 45, 50);
}

.isax-volume-up1 .path2:before {
  content: "\f810";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-volume-up1 .path3:before {
  content: "\f811";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wallet1 .path1:before {
  content: "\f812";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-wallet1 .path2:before {
  content: "\f813";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wallet1 .path3:before {
  content: "\f814";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wallet-11 .path1:before {
  content: "\f815";
  color: rgb(41, 45, 50);
  opacity: 0.8;
}

.isax-wallet-11 .path2:before {
  content: "\f816";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wallet-11 .path3:before {
  content: "\f817";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-wallet-11 .path4:before {
  content: "\f818";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-wallet-11 .path5:before {
  content: "\f819";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-wallet-21 .path1:before {
  content: "\f81a";
  color: rgb(41, 45, 50);
}

.isax-wallet-21 .path2:before {
  content: "\f81b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-wallet-21 .path3:before {
  content: "\f81c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wallet-31 .path1:before {
  content: "\f81d";
  color: rgb(41, 45, 50);
}

.isax-wallet-31 .path2:before {
  content: "\f81e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-wallet-31 .path3:before {
  content: "\f81f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wallet-31 .path4:before {
  content: "\f820";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wallet-add1 .path1:before {
  content: "\f821";
  color: rgb(41, 45, 50);
}

.isax-wallet-add1 .path2:before {
  content: "\f822";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wallet-add1 .path3:before {
  content: "\f823";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-wallet-add1 .path4:before {
  content: "\f824";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wallet-add-11 .path1:before {
  content: "\f825";
  color: rgb(41, 45, 50);
  opacity: 0.8;
}

.isax-wallet-add-11 .path2:before {
  content: "\f826";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wallet-add-11 .path3:before {
  content: "\f827";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-wallet-add-11 .path4:before {
  content: "\f828";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-wallet-add-11 .path5:before {
  content: "\f829";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-wallet-add-11 .path6:before {
  content: "\f82a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wallet-check1 .path1:before {
  content: "\f82b";
  color: rgb(41, 45, 50);
}

.isax-wallet-check1 .path2:before {
  content: "\f82c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wallet-check1 .path3:before {
  content: "\f82d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-wallet-check1 .path4:before {
  content: "\f82e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wallet-minus1 .path1:before {
  content: "\f82f";
  color: rgb(41, 45, 50);
  opacity: 0.8;
}

.isax-wallet-minus1 .path2:before {
  content: "\f830";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wallet-minus1 .path3:before {
  content: "\f831";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-wallet-minus1 .path4:before {
  content: "\f832";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-wallet-minus1 .path5:before {
  content: "\f833";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.6;
}

.isax-wallet-minus1 .path6:before {
  content: "\f834";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wallet-money1 .path1:before {
  content: "\f835";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-wallet-money1 .path2:before {
  content: "\f836";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wallet-remove1 .path1:before {
  content: "\f837";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-wallet-remove1 .path2:before {
  content: "\f838";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wallet-remove1 .path3:before {
  content: "\f839";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wallet-remove1 .path4:before {
  content: "\f83a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wallet-search1 .path1:before {
  content: "\f83b";
  color: rgb(41, 45, 50);
}

.isax-wallet-search1 .path2:before {
  content: "\f83c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-wallet-search1 .path3:before {
  content: "\f83d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wallet-search1 .path4:before {
  content: "\f83e";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-warning-21 .path1:before {
  content: "\f83f";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-warning-21 .path2:before {
  content: "\f840";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-warning-21 .path3:before {
  content: "\f841";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-watch1 .path1:before {
  content: "\f842";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-watch1 .path2:before {
  content: "\f843";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-watch1 .path3:before {
  content: "\f844";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-watch1 .path4:before {
  content: "\f845";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-watch-status1 .path1:before {
  content: "\f846";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-watch-status1 .path2:before {
  content: "\f847";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-watch-status1 .path3:before {
  content: "\f848";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-watch-status1 .path4:before {
  content: "\f849";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-watch-status1 .path5:before {
  content: "\f84a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-watch-status1 .path6:before {
  content: "\f84b";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-weight1 .path1:before {
  content: "\f84c";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-weight1 .path2:before {
  content: "\f84d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-weight-11 .path1:before {
  content: "\f84e";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-weight-11 .path2:before {
  content: "\f84f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-weight-11 .path3:before {
  content: "\f850";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-weight-11 .path4:before {
  content: "\f851";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-weight-11 .path5:before {
  content: "\f852";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wifi1 .path1:before {
  content: "\f853";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-wifi1 .path2:before {
  content: "\f854";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wifi1 .path3:before {
  content: "\f855";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wifi1 .path4:before {
  content: "\f856";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-wifi-square1 .path1:before {
  content: "\f857";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-wifi-square1 .path2:before {
  content: "\f858";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wifi-square1 .path3:before {
  content: "\f859";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wifi-square1 .path4:before {
  content: "\f85a";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wind1 .path1:before {
  content: "\f85b";
  color: rgb(41, 45, 50);
}

.isax-wind1 .path2:before {
  content: "\f85c";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-wind1 .path3:before {
  content: "\f85d";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wind-21 .path1:before {
  content: "\f85e";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-wind-21 .path2:before {
  content: "\f85f";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-wind-21 .path3:before {
  content: "\f860";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-woman1 .path1:before {
  content: "\f861";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-woman1 .path2:before {
  content: "\f862";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-dcube2:before {
  content: "\f863";
}

.isax-d-cube-scan2:before {
  content: "\f864";
}

.isax-d-rotate2:before {
  content: "\f865";
}

.isax-d-square2:before {
  content: "\f866";
}

.isax-square2:before {
  content: "\f867";
}

.isax-support2:before {
  content: "\f868";
}

.isax-activity2:before {
  content: "\f869";
}

.isax-add2:before {
  content: "\f86a";
}

.isax-add-circle2:before {
  content: "\f86b";
}

.isax-additem2:before {
  content: "\f86c";
}

.isax-add-square2:before {
  content: "\f86d";
}

.isax-airdrop2:before {
  content: "\f86e";
}

.isax-airplane2:before {
  content: "\f86f";
}

.isax-airplane-square2:before {
  content: "\f870";
}

.isax-airpod2:before {
  content: "\f871";
}

.isax-airpods2:before {
  content: "\f872";
}

.isax-alarm2:before {
  content: "\f873";
}

.isax-align-bottom2:before {
  content: "\f874";
}

.isax-align-horizontally2:before {
  content: "\f875";
}

.isax-align-left2:before {
  content: "\f876";
}

.isax-align-right2:before {
  content: "\f877";
}

.isax-align-vertically2:before {
  content: "\f878";
}

.isax-aquarius2:before {
  content: "\f879";
}

.isax-archive2:before {
  content: "\f87a";
}

.isax-archive-12:before {
  content: "\f87b";
}

.isax-archive-22:before {
  content: "\f87c";
}

.isax-archive-add2:before {
  content: "\f87d";
}

.isax-archive-book2:before {
  content: "\f87e";
}

.isax-archive-minus2:before {
  content: "\f87f";
}

.isax-archive-slash2:before {
  content: "\f880";
}

.isax-archive-tick2:before {
  content: "\f881";
}

.isax-arrange-circle2:before {
  content: "\f882";
}

.isax-arrange-circle-22:before {
  content: "\f883";
}

.isax-arrange-square2:before {
  content: "\f884";
}

.isax-arrange-square-22:before {
  content: "\f885";
}

.isax-arrow2:before {
  content: "\f886";
}

.isax-arrow-22:before {
  content: "\f887";
}

.isax-arrow-32:before {
  content: "\f888";
}

.isax-arrow-bottom2:before {
  content: "\f889";
}

.isax-arrow-circle-down2:before {
  content: "\f88a";
}

.isax-arrow-circle-left2:before {
  content: "\f88b";
}

.isax-arrow-circle-right2:before {
  content: "\f88c";
}

.isax-arrow-circle-up2:before {
  content: "\f88d";
}

.isax-arrow-down2:before {
  content: "\f88e";
}

.isax-arrow-down-12:before {
  content: "\f88f";
}

.isax-arrow-down-22:before {
  content: "\f890";
}

.isax-arrow-left2:before {
  content: "\f891";
}

.isax-arrow-left-12:before {
  content: "\f892";
}

.isax-arrow-left-22:before {
  content: "\f893";
}

.isax-arrow-left-32:before {
  content: "\f894";
}

.isax-arrow-right2:before {
  content: "\f895";
}

.isax-arrow-right-12:before {
  content: "\f896";
}

.isax-arrow-right-22:before {
  content: "\f897";
}

.isax-arrow-right-32:before {
  content: "\f898";
}

.isax-arrow-square2:before {
  content: "\f899";
}

.isax-arrow-square-down2:before {
  content: "\f89a";
}

.isax-arrow-square-left2:before {
  content: "\f89b";
}

.isax-arrow-square-right1:before {
  content: "\f89c";
}

.isax-arrow-square-up2:before {
  content: "\f89d";
}

.isax-arrow-swap2:before {
  content: "\f89e";
}

.isax-arrow-swap-horizontal2:before {
  content: "\f89f";
}

.isax-arrow-up2:before {
  content: "\f8a0";
}

.isax-arrow-up-12:before {
  content: "\f8a1";
}

.isax-arrow-up-22:before {
  content: "\f8a2";
}

.isax-arrow-up-32:before {
  content: "\f8a3";
}

.isax-attach-circle2:before {
  content: "\f8a4";
}

.isax-attach-square2:before {
  content: "\f8a5";
}

.isax-audio-square2:before {
  content: "\f8a6";
}

.isax-autobrightness2:before {
  content: "\f8a7";
}

.isax-award2:before {
  content: "\f8a8";
}

.isax-back-square2:before {
  content: "\f8a9";
}

.isax-backward2:before {
  content: "\f8aa";
}

.isax-backward-5-seconds2:before {
  content: "\f8ab";
}

.isax-backward-10-seconds2:before {
  content: "\f8ac";
}

.isax-backward-15-seconds2:before {
  content: "\f8ad";
}

.isax-backward-item2:before {
  content: "\f8ae";
}

.isax-bag2:before {
  content: "\f8af";
}

.isax-bag-22:before {
  content: "\f8b0";
}

.isax-bag-cross2:before {
  content: "\f8b1";
}

.isax-bag-cross-12:before {
  content: "\f8b2";
}

.isax-bag-happy2:before {
  content: "\f8b3";
}

.isax-bag-tick2:before {
  content: "\f8b4";
}

.isax-bag-tick-22:before {
  content: "\f8b5";
}

.isax-bag-timer2:before {
  content: "\f8b6";
}

.isax-bank2:before {
  content: "\f8b7";
}

.isax-barcode2:before {
  content: "\f8b8";
}

.isax-battery-3full2:before {
  content: "\f8b9";
}

.isax-battery-charging2:before {
  content: "\f8ba";
}

.isax-battery-disable2:before {
  content: "\f8bb";
}

.isax-battery-empty2:before {
  content: "\f8bc";
}

.isax-battery-empty-12:before {
  content: "\f8bd";
}

.isax-battery-full2:before {
  content: "\f8be";
}

.isax-bezier2:before {
  content: "\f8bf";
}

.isax-bill2:before {
  content: "\f8c0";
}

.isax-bitcoin-card2:before {
  content: "\f8c1";
}

.isax-bitcoin-convert2:before {
  content: "\f8c2";
}

.isax-bitcoin-refresh2:before {
  content: "\f8c3";
}

.isax-blend2:before {
  content: "\f8c4";
}

.isax-blend-22:before {
  content: "\f8c5";
}

.isax-bluetooth2:before {
  content: "\f8c6";
}

.isax-bluetooth-22:before {
  content: "\f8c7";
}

.isax-bluetooth-circle2:before {
  content: "\f8c8";
}

.isax-bluetooth-rectangle2:before {
  content: "\f8c9";
}

.isax-blur2:before {
  content: "\f8ca";
}

.isax-book2:before {
  content: "\f8cb";
}

.isax-book-12:before {
  content: "\f8cc";
}

.isax-bookmark2:before {
  content: "\f8cd";
}

.isax-bookmark-22:before {
  content: "\f8ce";
}

.isax-book-saved2:before {
  content: "\f8cf";
}

.isax-book-square2:before {
  content: "\f8d0";
}

.isax-box2:before {
  content: "\f8d1";
}

.isax-box-12:before {
  content: "\f8d2";
}

.isax-box-22:before {
  content: "\f8d3";
}

.isax-box-add2:before {
  content: "\f8d4";
}

.isax-box-remove2:before {
  content: "\f8d5";
}

.isax-box-search2:before {
  content: "\f8d6";
}

.isax-box-tick2:before {
  content: "\f8d7";
}

.isax-box-time2:before {
  content: "\f8d8";
}

.isax-briefcase2:before {
  content: "\f8d9";
}

.isax-brifecase-cross2:before {
  content: "\f8da";
}

.isax-brifecase-tick2:before {
  content: "\f8db";
}

.isax-brifecase-timer2:before {
  content: "\f8dc";
}

.isax-broom2:before {
  content: "\f8dd";
}

.isax-brush2:before {
  content: "\f8de";
}

.isax-brush-12:before {
  content: "\f8df";
}

.isax-brush-22:before {
  content: "\f8e0";
}

.isax-brush-32:before {
  content: "\f8e1";
}

.isax-brush-42:before {
  content: "\f8e2";
}

.isax-bubble2:before {
  content: "\f8e3";
}

.isax-bucket2:before {
  content: "\f8e4";
}

.isax-bucket-circle2:before {
  content: "\f8e5";
}

.isax-bucket-square2:before {
  content: "\f8e6";
}

.isax-building2:before {
  content: "\f8e7";
}

.isax-building-32:before {
  content: "\f8e8";
}

.isax-building-42:before {
  content: "\f8e9";
}

.isax-buildings2:before {
  content: "\f8ea";
}

.isax-buildings-22:before {
  content: "\f8eb";
}

.isax-buliding2:before {
  content: "\f8ec";
}

.isax-bus2:before {
  content: "\f8ed";
}

.isax-buy-crypto2:before {
  content: "\f8ee";
}

.isax-cake2:before {
  content: "\f8ef";
}

.isax-calculator2:before {
  content: "\f8f0";
}

.isax-calendar2:before {
  content: "\f8f1";
}

.isax-calendar-12:before {
  content: "\f8f2";
}

.isax-calendar-22:before {
  content: "\f8f3";
}

.isax-calendar-add2:before {
  content: "\f8f4";
}

.isax-calendar-circle2:before {
  content: "\f8f5";
}

.isax-calendar-edit2:before {
  content: "\f8f6";
}

.isax-calendar-remove2:before {
  content: "\f8f7";
}

.isax-calendar-search2:before {
  content: "\f8f8";
}

.isax-calendar-tick2:before {
  content: "\f8f9";
}

.isax-call2:before {
  content: "\f8fa";
}

.isax-call-add2:before {
  content: "\f8fb";
}

.isax-call-calling2:before {
  content: "\f8fc";
}

.isax-call-incoming2:before {
  content: "\f8fd";
}

.isax-call-minus2:before {
  content: "\f8fe";
}

.isax-call-outgoing2:before {
  content: "\f8ff";
}

.isax-call-received2:before {
  content: "豈";
}

.isax-call-remove2:before {
  content: "更";
}

.isax-call-slash2:before {
  content: "車";
}

.isax-camera2:before {
  content: "賈";
}

.isax-camera-slash2:before {
  content: "滑";
}

.isax-candle2:before {
  content: "串";
}

.isax-candle-22:before {
  content: "句";
}

.isax-car2:before {
  content: "龜";
}

.isax-card2:before {
  content: "龜";
}

.isax-card-add2:before {
  content: "契";
}

.isax-card-coin2:before {
  content: "金";
}

.isax-card-edit2:before {
  content: "喇";
}

.isax-card-pos2:before {
  content: "奈";
}

.isax-card-receive2:before {
  content: "懶";
}

.isax-card-remove2:before {
  content: "癩";
}

.isax-card-remove-12:before {
  content: "羅";
}

.isax-cards2:before {
  content: "蘿";
}

.isax-card-send2:before {
  content: "螺";
}

.isax-card-slash2:before {
  content: "裸";
}

.isax-card-tick2:before {
  content: "邏";
}

.isax-card-tick-12:before {
  content: "樂";
}

.isax-category2:before {
  content: "洛";
}

.isax-category-22:before {
  content: "烙";
}

.isax-cd2:before {
  content: "珞";
}

.isax-chart2:before {
  content: "落";
}

.isax-chart-12:before {
  content: "酪";
}

.isax-chart-23:before {
  content: "駱";
}

.isax-chart-32:before {
  content: "亂";
}

.isax-chart-212:before {
  content: "卵";
}

.isax-chart-fail1:before {
  content: "欄";
}

.isax-chart-square2:before {
  content: "爛";
}

.isax-chart-success2:before {
  content: "蘭";
}

.isax-check2:before {
  content: "鸞";
}

.isax-chrome2:before {
  content: "嵐";
}

.isax-clipboard2:before {
  content: "濫";
}

.isax-clipboard-close2:before {
  content: "藍";
}

.isax-clipboard-export2:before {
  content: "襤";
}

.isax-clipboard-import2:before {
  content: "拉";
}

.isax-clipboard-text2:before {
  content: "臘";
}

.isax-clipboard-tick2:before {
  content: "蠟";
}

.isax-clock2:before {
  content: "廊";
}

.isax-clock-12:before {
  content: "朗";
}

.isax-close-circle2:before {
  content: "浪";
}

.isax-close-square2:before {
  content: "狼";
}

.isax-cloud2:before {
  content: "郎";
}

.isax-cloud-add2:before {
  content: "來";
}

.isax-cloud-change2:before {
  content: "冷";
}

.isax-cloud-connection2:before {
  content: "勞";
}

.isax-cloud-cross2:before {
  content: "擄";
}

.isax-cloud-drizzle2:before {
  content: "櫓";
}

.isax-cloud-fog2:before {
  content: "爐";
}

.isax-cloud-lightning2:before {
  content: "盧";
}

.isax-cloud-minus2:before {
  content: "老";
}

.isax-cloud-notif2:before {
  content: "蘆";
}

.isax-cloud-plus2:before {
  content: "虜";
}

.isax-cloud-remove2:before {
  content: "路";
}

.isax-cloud-snow2:before {
  content: "露";
}

.isax-cloud-sunny2:before {
  content: "魯";
}

.isax-code2:before {
  content: "鷺";
}

.isax-code-12:before {
  content: "碌";
}

.isax-code-circle2:before {
  content: "祿";
}

.isax-coffee2:before {
  content: "綠";
}

.isax-coin2:before {
  content: "菉";
}

.isax-coin-12:before {
  content: "錄";
}

.isax-colorfilter2:before {
  content: "鹿";
}

.isax-colors-square2:before {
  content: "論";
}

.isax-color-swatch2:before {
  content: "壟";
}

.isax-command2:before {
  content: "弄";
}

.isax-command-square2:before {
  content: "籠";
}

.isax-component2:before {
  content: "聾";
}

.isax-computing2:before {
  content: "牢";
}

.isax-convert2:before {
  content: "磊";
}

.isax-convert-3d-cube2:before {
  content: "賂";
}

.isax-convert-card2:before {
  content: "雷";
}

.isax-convertshape2:before {
  content: "壘";
}

.isax-convertshape-22:before {
  content: "屢";
}

.isax-copy2:before {
  content: "樓";
}

.isax-copyright2:before {
  content: "淚";
}

.isax-copy-success2:before {
  content: "漏";
}

.isax-courthouse2:before {
  content: "累";
}

.isax-cpu2:before {
  content: "縷";
}

.isax-cpu-charge2:before {
  content: "陋";
}

.isax-cpu-setting2:before {
  content: "勒";
}

.isax-creative-commons2:before {
  content: "肋";
}

.isax-crop2:before {
  content: "凜";
}

.isax-crown2:before {
  content: "凌";
}

.isax-crown-12:before {
  content: "稜";
}

.isax-cup2:before {
  content: "綾";
}

.isax-danger2:before {
  content: "菱";
}

.isax-data2:before {
  content: "陵";
}

.isax-data-22:before {
  content: "讀";
}

.isax-designtools2:before {
  content: "拏";
}

.isax-device-message2:before {
  content: "樂";
}

.isax-devices2:before {
  content: "諾";
}

.isax-devices-12:before {
  content: "丹";
}

.isax-diagram2:before {
  content: "寧";
}

.isax-diamonds2:before {
  content: "怒";
}

.isax-direct2:before {
  content: "率";
}

.isax-directbox-default2:before {
  content: "異";
}

.isax-directbox-notif2:before {
  content: "北";
}

.isax-directbox-receive2:before {
  content: "磻";
}

.isax-directbox-send2:before {
  content: "便";
}

.isax-direct-down2:before {
  content: "復";
}

.isax-direct-inbox2:before {
  content: "不";
}

.isax-direct-left2:before {
  content: "泌";
}

.isax-direct-normal2:before {
  content: "數";
}

.isax-direct-notification2:before {
  content: "索";
}

.isax-direct-right2:before {
  content: "參";
}

.isax-direct-send2:before {
  content: "塞";
}

.isax-direct-up2:before {
  content: "省";
}

.isax-discount-circle2:before {
  content: "葉";
}

.isax-discount-shape2:before {
  content: "說";
}

.isax-discover2:before {
  content: "殺";
}

.isax-discover-12:before {
  content: "辰";
}

.isax-dislike2:before {
  content: "沈";
}

.isax-document2:before {
  content: "拾";
}

.isax-document-12:before {
  content: "若";
}

.isax-document-cloud2:before {
  content: "掠";
}

.isax-document-code2:before {
  content: "略";
}

.isax-document-code-22:before {
  content: "亮";
}

.isax-document-copy2:before {
  content: "兩";
}

.isax-document-download2:before {
  content: "凉";
}

.isax-document-favorite2:before {
  content: "梁";
}

.isax-document-filter2:before {
  content: "糧";
}

.isax-document-forward2:before {
  content: "良";
}

.isax-document-like2:before {
  content: "諒";
}

.isax-document-normal2:before {
  content: "量";
}

.isax-document-previous2:before {
  content: "勵";
}

.isax-document-sketch2:before {
  content: "呂";
}

.isax-document-text2:before {
  content: "女";
}

.isax-document-text-12:before {
  content: "廬";
}

.isax-document-upload2:before {
  content: "旅";
}

.isax-dollar-square2:before {
  content: "濾";
}

.isax-driver2:before {
  content: "礪";
}

.isax-driver-22:before {
  content: "閭";
}

.isax-driver-refresh2:before {
  content: "驪";
}

.isax-driving2:before {
  content: "麗";
}

.isax-drop1:before {
  content: "黎";
}

.isax-edit2:before {
  content: "力";
}

.isax-edit-22:before {
  content: "曆";
}

.isax-electricity2:before {
  content: "歷";
}

.isax-element-22:before {
  content: "轢";
}

.isax-element-32:before {
  content: "年";
}

.isax-element-42:before {
  content: "憐";
}

.isax-element-equal2:before {
  content: "戀";
}

.isax-element-plus2:before {
  content: "撚";
}

.isax-emoji-happy2:before {
  content: "漣";
}

.isax-emoji-normal2:before {
  content: "煉";
}

.isax-emoji-sad2:before {
  content: "璉";
}

.isax-empty-wallet2:before {
  content: "秊";
}

.isax-empty-wallet-add2:before {
  content: "練";
}

.isax-empty-wallet-change2:before {
  content: "聯";
}

.isax-empty-wallet-remove2:before {
  content: "輦";
}

.isax-empty-wallet-tick2:before {
  content: "蓮";
}

.isax-empty-wallet-time2:before {
  content: "連";
}

.isax-eraser2:before {
  content: "鍊";
}

.isax-eraser-12:before {
  content: "列";
}

.isax-export2:before {
  content: "劣";
}

.isax-export-12:before {
  content: "咽";
}

.isax-export-22:before {
  content: "烈";
}

.isax-export-32:before {
  content: "裂";
}

.isax-external-drive2:before {
  content: "說";
}

.isax-eye1:before {
  content: "廉";
}

.isax-eye-slash2:before {
  content: "念";
}

.isax-fatrows2:before {
  content: "捻";
}

.isax-favorite-chart2:before {
  content: "殮";
}

.isax-filter2:before {
  content: "簾";
}

.isax-filter-add2:before {
  content: "獵";
}

.isax-filter-edit2:before {
  content: "令";
}

.isax-filter-remove2:before {
  content: "囹";
}

.isax-filter-search2:before {
  content: "寧";
}

.isax-filter-square2:before {
  content: "嶺";
}

.isax-filter-tick2:before {
  content: "怜";
}

.isax-finger-cricle2:before {
  content: "玲";
}

.isax-finger-scan2:before {
  content: "瑩";
}

.isax-firstline2:before {
  content: "羚";
}

.isax-flag2:before {
  content: "聆";
}

.isax-flag-22:before {
  content: "鈴";
}

.isax-flash2:before {
  content: "零";
}

.isax-flash-12:before {
  content: "靈";
}

.isax-flash-circle2:before {
  content: "領";
}

.isax-flash-circle-12:before {
  content: "例";
}

.isax-flash-slash2:before {
  content: "禮";
}

.isax-folder2:before {
  content: "醴";
}

.isax-folder-22:before {
  content: "隸";
}

.isax-folder-add2:before {
  content: "惡";
}

.isax-folder-cloud2:before {
  content: "了";
}

.isax-folder-connection2:before {
  content: "僚";
}

.isax-folder-cross2:before {
  content: "寮";
}

.isax-folder-favorite2:before {
  content: "尿";
}

.isax-folder-minus2:before {
  content: "料";
}

.isax-folder-open2:before {
  content: "樂";
}

.isax-forbidden2:before {
  content: "燎";
}

.isax-forbidden-22:before {
  content: "療";
}

.isax-format-circle2:before {
  content: "蓼";
}

.isax-format-square2:before {
  content: "遼";
}

.isax-forward2:before {
  content: "龍";
}

.isax-forward-5-seconds2:before {
  content: "暈";
}

.isax-forward-10-seconds2:before {
  content: "阮";
}

.isax-forward-15-seconds2:before {
  content: "劉";
}

.isax-forward-item2:before {
  content: "杻";
}

.isax-forward-square2:before {
  content: "柳";
}

.isax-frame2:before {
  content: "流";
}

.isax-frame-12:before {
  content: "溜";
}

.isax-frame-22:before {
  content: "琉";
}

.isax-frame-32:before {
  content: "留";
}

.isax-frame-42:before {
  content: "硫";
}

.isax-frame-5:before {
  content: "紐";
}

.isax-frame-6:before {
  content: "類";
}

.isax-frame-7:before {
  content: "六";
}

.isax-gallery2:before {
  content: "戮";
}

.isax-gallery-add2:before {
  content: "陸";
}

.isax-gallery-edit2:before {
  content: "倫";
}

.isax-gallery-export1:before {
  content: "崙";
}

.isax-gallery-favorite2:before {
  content: "淪";
}

.isax-gallery-import2:before {
  content: "輪";
}

.isax-gallery-remove2:before {
  content: "律";
}

.isax-gallery-slash2:before {
  content: "慄";
}

.isax-gallery-tick2:before {
  content: "栗";
}

.isax-game2:before {
  content: "率";
}

.isax-gameboy2:before {
  content: "隆";
}

.isax-gas-station2:before {
  content: "利";
}

.isax-gemini2:before {
  content: "吏";
}

.isax-gemini-22:before {
  content: "履";
}

.isax-ghost2:before {
  content: "易";
}

.isax-gift2:before {
  content: "李";
}

.isax-glass2:before {
  content: "梨";
}

.isax-glass-12:before {
  content: "泥";
}

.isax-global2:before {
  content: "理";
}

.isax-global-edit2:before {
  content: "痢";
}

.isax-global-refresh2:before {
  content: "罹";
}

.isax-global-search2:before {
  content: "裏";
}

.isax-gps2:before {
  content: "裡";
}

.isax-gps-slash2:before {
  content: "里";
}

.isax-grammerly2:before {
  content: "離";
}

.isax-graph2:before {
  content: "匿";
}

.isax-grid-12:before {
  content: "溺";
}

.isax-grid-22:before {
  content: "吝";
}

.isax-grid-32:before {
  content: "燐";
}

.isax-grid-42:before {
  content: "璘";
}

.isax-grid-52:before {
  content: "藺";
}

.isax-grid-62:before {
  content: "隣";
}

.isax-grid-72:before {
  content: "鱗";
}

.isax-grid-82:before {
  content: "麟";
}

.isax-grid-92:before {
  content: "林";
}

.isax-grid-edit2:before {
  content: "淋";
}

.isax-grid-eraser2:before {
  content: "臨";
}

.isax-grid-lock2:before {
  content: "立";
}

.isax-happyemoji2:before {
  content: "笠";
}

.isax-hashtag2:before {
  content: "粒";
}

.isax-hashtag-12:before {
  content: "狀";
}

.isax-hashtag-down2:before {
  content: "炙";
}

.isax-hashtag-up2:before {
  content: "識";
}

.isax-headphone2:before {
  content: "什";
}

.isax-headphones2:before {
  content: "茶";
}

.isax-health2:before {
  content: "刺";
}

.isax-heart2:before {
  content: "切";
}

.isax-heart-add2:before {
  content: "度";
}

.isax-heart-circle2:before {
  content: "拓";
}

.isax-heart-edit2:before {
  content: "糖";
}

.isax-heart-remove2:before {
  content: "宅";
}

.isax-heart-search2:before {
  content: "洞";
}

.isax-heart-slash2:before {
  content: "暴";
}

.isax-heart-tick2:before {
  content: "輻";
}

.isax-hierarchy2:before {
  content: "行";
}

.isax-hierarchy-22:before {
  content: "降";
}

.isax-hierarchy-32:before {
  content: "見";
}

.isax-hierarchy-square2:before {
  content: "廓";
}

.isax-hierarchy-square-22:before {
  content: "兀";
}

.isax-hierarchy-square-32:before {
  content: "嗀";
}

.isax-home2:before {
  content: "﨎";
}

.isax-home-12:before {
  content: "﨏";
}

.isax-home-22:before {
  content: "塚";
}

.isax-home-hashtag2:before {
  content: "﨑";
}

.isax-home-trend-down2:before {
  content: "晴";
}

.isax-home-trend-up2:before {
  content: "﨓";
}

.isax-home-wifi2:before {
  content: "﨔";
}

.isax-hospital2:before {
  content: "凞";
}

.isax-house2:before {
  content: "猪";
}

.isax-house-22:before {
  content: "益";
}

.isax-icon1:before {
  content: "礼";
}

.isax-icon-1:before {
  content: "神";
}

.isax-image2:before {
  content: "祥";
}

.isax-import2:before {
  content: "福";
}

.isax-import-12:before {
  content: "靖";
}

.isax-import-22:before {
  content: "精";
}

.isax-info-circle2:before {
  content: "羽";
}

.isax-information2:before {
  content: "﨟";
}

.isax-instagram2:before {
  content: "蘒";
}

.isax-judge2:before {
  content: "﨡";
}

.isax-key2:before {
  content: "諸";
}

.isax-keyboard2:before {
  content: "﨣";
}

.isax-keyboard-open2:before {
  content: "﨤";
}

.isax-key-square2:before {
  content: "逸";
}

.isax-lamp2:before {
  content: "都";
}

.isax-lamp-12:before {
  content: "﨧";
}

.isax-lamp-charge2:before {
  content: "﨨";
}

.isax-lamp-on2:before {
  content: "﨩";
}

.isax-lamp-slash2:before {
  content: "飯";
}

.isax-language-circle2:before {
  content: "飼";
}

.isax-language-square2:before {
  content: "館";
}

.isax-layer2:before {
  content: "鶴";
}

.isax-level2:before {
  content: "郞";
}

.isax-lifebuoy2:before {
  content: "隷";
}

.isax-like2:before {
  content: "侮";
}

.isax-like-12:before {
  content: "僧";
}

.isax-like-dislike2:before {
  content: "免";
}

.isax-like-shapes2:before {
  content: "勉";
}

.isax-like-tag2:before {
  content: "勤";
}

.isax-link2:before {
  content: "卑";
}

.isax-link-12:before {
  content: "喝";
}

.isax-link-23:before {
  content: "嘆";
}

.isax-link-212:before {
  content: "器";
}

.isax-link-circle2:before {
  content: "塀";
}

.isax-link-square2:before {
  content: "墨";
}

.isax-location2:before {
  content: "層";
}

.isax-location-add2:before {
  content: "屮";
}

.isax-location-cross2:before {
  content: "悔";
}

.isax-location-minus2:before {
  content: "慨";
}

.isax-location-slash2:before {
  content: "憎";
}

.isax-location-tick2:before {
  content: "懲";
}

.isax-lock2:before {
  content: "敏";
}

.isax-lock-12:before {
  content: "既";
}

.isax-lock-circle2:before {
  content: "暑";
}

.isax-lock-slash2:before {
  content: "梅";
}

.isax-login2:before {
  content: "海";
}

.isax-login-12:before {
  content: "渚";
}

.isax-logout2:before {
  content: "漢";
}

.isax-logout-12:before {
  content: "煮";
}

.isax-lovely2:before {
  content: "爫";
}

.isax-magicpen2:before {
  content: "琢";
}

.isax-magic-star2:before {
  content: "碑";
}

.isax-main-component2:before {
  content: "社";
}

.isax-man2:before {
  content: "祉";
}

.isax-map2:before {
  content: "祈";
}

.isax-map-12:before {
  content: "祐";
}

.isax-mask2:before {
  content: "祖";
}

.isax-mask-12:before {
  content: "祝";
}

.isax-mask-22:before {
  content: "禍";
}

.isax-math2:before {
  content: "禎";
}

.isax-maximize2:before {
  content: "穀";
}

.isax-maximize-12:before {
  content: "突";
}

.isax-maximize-23:before {
  content: "節";
}

.isax-maximize-32:before {
  content: "練";
}

.isax-maximize-42:before {
  content: "縉";
}

.isax-maximize-212:before {
  content: "繁";
}

.isax-maximize-circle1:before {
  content: "署";
}

.isax-medal2:before {
  content: "者";
}

.isax-medal-star2:before {
  content: "臭";
}

.isax-menu2:before {
  content: "艹";
}

.isax-menu-12:before {
  content: "艹";
}

.isax-menu-board2:before {
  content: "著";
}

.isax-message2:before {
  content: "褐";
}

.isax-message-22:before {
  content: "視";
}

.isax-message-add2:before {
  content: "謁";
}

.isax-message-add-12:before {
  content: "謹";
}

.isax-message-circle2:before {
  content: "賓";
}

.isax-message-edit2:before {
  content: "贈";
}

.isax-message-favorite2:before {
  content: "辶";
}

.isax-message-minus2:before {
  content: "逸";
}

.isax-message-notif2:before {
  content: "難";
}

.isax-message-programming2:before {
  content: "響";
}

.isax-message-question2:before {
  content: "頻";
}

.isax-message-remove2:before {
  content: "恵";
}

.isax-messages2:before {
  content: "𤋮";
}

.isax-messages-12:before {
  content: "舘";
}

.isax-messages-22:before {
  content: "﩮";
}

.isax-messages-32:before {
  content: "﩯";
}

.isax-message-search2:before {
  content: "並";
}

.isax-message-square2:before {
  content: "况";
}

.isax-message-text2:before {
  content: "全";
}

.isax-message-text-12:before {
  content: "侀";
}

.isax-message-tick2:before {
  content: "充";
}

.isax-message-time2:before {
  content: "冀";
}

.isax-microphone2:before {
  content: "勇";
}

.isax-microphone-22:before {
  content: "勺";
}

.isax-microphone-slash2:before {
  content: "喝";
}

.isax-microphone-slash-12:before {
  content: "啕";
}

.isax-microscope2:before {
  content: "喙";
}

.isax-milk2:before {
  content: "嗢";
}

.isax-mini-music-sqaure2:before {
  content: "塚";
}

.isax-minus2:before {
  content: "墳";
}

.isax-minus-cirlce2:before {
  content: "奄";
}

.isax-minus-square2:before {
  content: "奔";
}

.isax-mirror2:before {
  content: "婢";
}

.isax-mirroring-screen2:before {
  content: "嬨";
}

.isax-mobile2:before {
  content: "廒";
}

.isax-mobile-programming2:before {
  content: "廙";
}

.isax-money2:before {
  content: "彩";
}

.isax-money-22:before {
  content: "徭";
}

.isax-money-32:before {
  content: "惘";
}

.isax-money-42:before {
  content: "慎";
}

.isax-money-add2:before {
  content: "愈";
}

.isax-money-change2:before {
  content: "憎";
}

.isax-money-forbidden2:before {
  content: "慠";
}

.isax-money-recive2:before {
  content: "懲";
}

.isax-money-remove2:before {
  content: "戴";
}

.isax-moneys2:before {
  content: "揄";
}

.isax-money-send2:before {
  content: "搜";
}

.isax-money-tick2:before {
  content: "摒";
}

.isax-money-time2:before {
  content: "敖";
}

.isax-monitor2:before {
  content: "晴";
}

.isax-monitor-mobbile2:before {
  content: "朗";
}

.isax-monitor-recorder2:before {
  content: "望";
}

.isax-moon2:before {
  content: "杖";
}

.isax-more2:before {
  content: "歹";
}

.isax-more-22:before {
  content: "殺";
}

.isax-more-circle2:before {
  content: "流";
}

.isax-more-square2:before {
  content: "滛";
}

.isax-mouse2:before {
  content: "滋";
}

.isax-mouse-12:before {
  content: "漢";
}

.isax-mouse-circle2:before {
  content: "瀞";
}

.isax-mouse-square2:before {
  content: "煮";
}

.isax-music2:before {
  content: "瞧";
}

.isax-music-circle2:before {
  content: "爵";
}

.isax-music-dashboard2:before {
  content: "犯";
}

.isax-music-filter2:before {
  content: "猪";
}

.isax-music-library-22:before {
  content: "瑱";
}

.isax-musicnote2:before {
  content: "甆";
}

.isax-music-play2:before {
  content: "画";
}

.isax-music-playlist2:before {
  content: "瘝";
}

.isax-music-square2:before {
  content: "瘟";
}

.isax-music-square-add2:before {
  content: "益";
}

.isax-music-square-remove2:before {
  content: "盛";
}

.isax-music-square-search2:before {
  content: "直";
}

.isax-next2:before {
  content: "睊";
}

.isax-note2:before {
  content: "着";
}

.isax-note-12:before {
  content: "磌";
}

.isax-note-23:before {
  content: "窱";
}

.isax-note-212:before {
  content: "節";
}

.isax-note-add2:before {
  content: "类";
}

.isax-note-favorite2:before {
  content: "絛";
}

.isax-note-remove2:before {
  content: "練";
}

.isax-note-square2:before {
  content: "缾";
}

.isax-note-text2:before {
  content: "者";
}

.isax-notification2:before {
  content: "荒";
}

.isax-notification-12:before {
  content: "華";
}

.isax-notification-bing2:before {
  content: "蝹";
}

.isax-notification-circle2:before {
  content: "襁";
}

.isax-notification-favorite2:before {
  content: "覆";
}

.isax-notification-status2:before {
  content: "視";
}

.isax-omega-circle2:before {
  content: "調";
}

.isax-omega-square2:before {
  content: "諸";
}

.isax-paintbucket2:before {
  content: "請";
}

.isax-paperclip2:before {
  content: "謁";
}

.isax-paperclip-22:before {
  content: "諾";
}

.isax-password-check2:before {
  content: "諭";
}

.isax-path2:before {
  content: "謹";
}

.isax-path-22:before {
  content: "變";
}

.isax-path-square2:before {
  content: "贈";
}

.isax-pause2:before {
  content: "輸";
}

.isax-pause-circle2:before {
  content: "遲";
}

.isax-pen-add2:before {
  content: "醙";
}

.isax-pen-close2:before {
  content: "鉶";
}

.isax-pen-remove2:before {
  content: "陼";
}

.isax-pen-tool2:before {
  content: "難";
}

.isax-pen-tool-22:before {
  content: "靖";
}

.isax-people2:before {
  content: "韛";
}

.isax-percentage-circle2:before {
  content: "響";
}

.isax-percentage-square2:before {
  content: "頋";
}

.isax-personalcard2:before {
  content: "頻";
}

.isax-pet2:before {
  content: "鬒";
}

.isax-pharagraphspacing2:before {
  content: "龜";
}

.isax-picture-frame2:before {
  content: "𢡊";
}

.isax-play2:before {
  content: "𢡄";
}

.isax-play-add2:before {
  content: "𣏕";
}

.isax-play-circle2:before {
  content: "㮝";
}

.isax-play-cricle2:before {
  content: "䀘";
}

.isax-play-remove2:before {
  content: "䀹";
}

.isax-presention-chart2:before {
  content: "𥉉";
}

.isax-previous2:before {
  content: "𥳐";
}

.isax-printer2:before {
  content: "𧻓";
}

.isax-printer-slash2:before {
  content: "齃";
}

.isax-profile-2user2:before {
  content: "龎";
}

.isax-profile-add2:before {
  content: "﫚";
}

.isax-profile-circle2:before {
  content: "﫛";
}

.isax-profile-delete2:before {
  content: "﫜";
}

.isax-profile-remove2:before {
  content: "﫝";
}

.isax-profile-tick2:before {
  content: "﫞";
}

.isax-programming-arrow2:before {
  content: "﫟";
}

.isax-programming-arrows2:before {
  content: "﫠";
}

.isax-quote-down2:before {
  content: "﫡";
}

.isax-quote-down-circle2:before {
  content: "﫢";
}

.isax-quote-down-square2:before {
  content: "﫣";
}

.isax-quote-up2:before {
  content: "﫤";
}

.isax-quote-up-circle2:before {
  content: "﫥";
}

.isax-quote-up-square2:before {
  content: "﫦";
}

.isax-radar2:before {
  content: "﫧";
}

.isax-radar-12:before {
  content: "﫨";
}

.isax-radar-22:before {
  content: "﫩";
}

.isax-radio2:before {
  content: "﫪";
}

.isax-ram2:before {
  content: "﫫";
}

.isax-ram-22:before {
  content: "﫬";
}

.isax-ranking2:before {
  content: "﫭";
}

.isax-ranking-12:before {
  content: "﫮";
}

.isax-receipt2:before {
  content: "﫯";
}

.isax-receipt-12:before {
  content: "﫰";
}

.isax-receipt-22:before {
  content: "﫱";
}

.isax-receipt-2-12:before {
  content: "﫲";
}

.isax-receipt-add2:before {
  content: "﫳";
}

.isax-receipt-discount2:before {
  content: "﫴";
}

.isax-receipt-disscount2:before {
  content: "﫵";
}

.isax-receipt-edit2:before {
  content: "﫶";
}

.isax-receipt-item2:before {
  content: "﫷";
}

.isax-receipt-minus2:before {
  content: "﫸";
}

.isax-receipt-search2:before {
  content: "﫹";
}

.isax-receipt-square2:before {
  content: "﫺";
}

.isax-receipt-text2:before {
  content: "﫻";
}

.isax-received2:before {
  content: "﫼";
}

.isax-receive-square2:before {
  content: "﫽";
}

.isax-receive-square-22:before {
  content: "﫾";
}

.isax-record2:before {
  content: "﫿";
}

.isax-record-circle2:before {
  content: "ff";
}

.isax-recovery-convert2:before {
  content: "fi";
}

.isax-redo2:before {
  content: "fl";
}

.isax-refresh2:before {
  content: "ffi";
}

.isax-refresh-22:before {
  content: "ffl";
}

.isax-refresh-circle2:before {
  content: "ſt";
}

.isax-refresh-left-square2:before {
  content: "st";
}

.isax-refresh-right-square2:before {
  content: "﬇";
}

.isax-refresh-square-22:before {
  content: "﬈";
}

.isax-repeat2:before {
  content: "﬉";
}

.isax-repeat-circle2:before {
  content: "﬊";
}

.isax-repeate-music2:before {
  content: "﬋";
}

.isax-repeate-one2:before {
  content: "﬌";
}

.isax-reserve2:before {
  content: "﬍";
}

.isax-rotate-left2:before {
  content: "﬎";
}

.isax-rotate-left-12:before {
  content: "﬏";
}

.isax-rotate-right2:before {
  content: "﬐";
}

.isax-rotate-right-12:before {
  content: "﬑";
}

.isax-route-square2:before {
  content: "﬒";
}

.isax-routing2:before {
  content: "ﬓ";
}

.isax-routing-22:before {
  content: "ﬔ";
}

.isax-row-horizontal2:before {
  content: "ﬕ";
}

.isax-row-vertical2:before {
  content: "ﬖ";
}

.isax-rulerpen2:before {
  content: "ﬗ";
}

.isax-ruler2:before {
  content: "﬘";
}

.isax-safe-home2:before {
  content: "﬙";
}

.isax-sagittarius2:before {
  content: "﬚";
}

.isax-save-22:before {
  content: "﬛";
}

.isax-save-add2:before {
  content: "﬜";
}

.isax-save-minus2:before {
  content: "יִ";
}

.isax-save-remove2:before {
  content: "ﬞ";
}

.isax-scan2:before {
  content: "ײַ";
}

.isax-scan-barcode2:before {
  content: "ﬠ";
}

.isax-scanner2:before {
  content: "ﬡ";
}

.isax-scanning2:before {
  content: "ﬢ";
}

.isax-scissor2:before {
  content: "ﬣ";
}

.isax-scissor-12:before {
  content: "ﬤ";
}

.isax-screenmirroring2:before {
  content: "ﬥ";
}

.isax-scroll2:before {
  content: "ﬦ";
}

.isax-search-favorite2:before {
  content: "ﬧ";
}

.isax-search-favorite-12:before {
  content: "ﬨ";
}

.isax-search-normal2:before {
  content: "﬩";
}

.isax-search-normal-12:before {
  content: "שׁ";
}

.isax-search-status2:before {
  content: "שׂ";
}

.isax-search-status-12:before {
  content: "שּׁ";
}

.isax-search-zoom-in2:before {
  content: "שּׂ";
}

.isax-search-zoom-in-12:before {
  content: "אַ";
}

.isax-search-zoom-out2:before {
  content: "אָ";
}

.isax-search-zoom-out-12:before {
  content: "אּ";
}

.isax-security2:before {
  content: "בּ";
}

.isax-security-card2:before {
  content: "גּ";
}

.isax-security-safe2:before {
  content: "דּ";
}

.isax-security-time2:before {
  content: "הּ";
}

.isax-security-user2:before {
  content: "וּ";
}

.isax-send2:before {
  content: "זּ";
}

.isax-send-12:before {
  content: "﬷";
}

.isax-send-22:before {
  content: "טּ";
}

.isax-send-sqaure-22:before {
  content: "יּ";
}

.isax-send-square2:before {
  content: "ךּ";
}

.isax-setting2:before {
  content: "כּ";
}

.isax-setting-22:before {
  content: "לּ";
}

.isax-setting-32:before {
  content: "﬽";
}

.isax-setting-42:before {
  content: "מּ";
}

.isax-setting-52:before {
  content: "﬿";
}

.isax-settings2:before {
  content: "נּ";
}

.isax-shapes2:before {
  content: "סּ";
}

.isax-shapes-12:before {
  content: "﭂";
}

.isax-share2:before {
  content: "ףּ";
}

.isax-shield-cross2:before {
  content: "פּ";
}

.isax-shield-search2:before {
  content: "﭅";
}

.isax-shield-slash2:before {
  content: "צּ";
}

.isax-shield-tick2:before {
  content: "קּ";
}

.isax-ship2:before {
  content: "רּ";
}

.isax-shop2:before {
  content: "שּ";
}

.isax-shop-add2:before {
  content: "תּ";
}

.isax-shopping-bag2:before {
  content: "וֹ";
}

.isax-shopping-cart2:before {
  content: "בֿ";
}

.isax-shop-remove2:before {
  content: "כֿ";
}

.isax-shuffle2:before {
  content: "פֿ";
}

.isax-sidebar-bottom2:before {
  content: "ﭏ";
}

.isax-sidebar-left2:before {
  content: "ﭐ";
}

.isax-sidebar-right2:before {
  content: "ﭑ";
}

.isax-sidebar-top2:before {
  content: "ﭒ";
}

.isax-signpost2:before {
  content: "ﭓ";
}

.isax-simcard2:before {
  content: "ﭔ";
}

.isax-simcard-12:before {
  content: "ﭕ";
}

.isax-simcard-22:before {
  content: "ﭖ";
}

.isax-size2:before {
  content: "ﭗ";
}

.isax-slash2:before {
  content: "ﭘ";
}

.isax-slider2:before {
  content: "ﭙ";
}

.isax-slider-horizontal2:before {
  content: "ﭚ";
}

.isax-slider-horizontal-12:before {
  content: "ﭛ";
}

.isax-slider-vertical2:before {
  content: "ﭜ";
}

.isax-slider-vertical-12:before {
  content: "ﭝ";
}

.isax-smallcaps2:before {
  content: "ﭞ";
}

.isax-smart-car2:before {
  content: "ﭟ";
}

.isax-smart-home2:before {
  content: "ﭠ";
}

.isax-smileys2:before {
  content: "ﭡ";
}

.isax-sms2:before {
  content: "ﭢ";
}

.isax-sms-edit2:before {
  content: "ﭣ";
}

.isax-sms-notification2:before {
  content: "ﭤ";
}

.isax-sms-search2:before {
  content: "ﭥ";
}

.isax-sms-star2:before {
  content: "ﭦ";
}

.isax-sms-tracking2:before {
  content: "ﭧ";
}

.isax-sort2:before {
  content: "ﭨ";
}

.isax-sound2:before {
  content: "ﭩ";
}

.isax-speaker2:before {
  content: "ﭪ";
}

.isax-speedometer2:before {
  content: "ﭫ";
}

.isax-star2:before {
  content: "ﭬ";
}

.isax-star-12:before {
  content: "ﭭ";
}

.isax-star-slash2:before {
  content: "ﭮ";
}

.isax-status2:before {
  content: "ﭯ";
}

.isax-status-up2:before {
  content: "ﭰ";
}

.isax-sticker2:before {
  content: "ﭱ";
}

.isax-stickynote2:before {
  content: "ﭲ";
}

.isax-stop2:before {
  content: "ﭳ";
}

.isax-stop-circle2:before {
  content: "ﭴ";
}

.isax-story2:before {
  content: "ﭵ";
}

.isax-strongbox2:before {
  content: "ﭶ";
}

.isax-strongbox-22:before {
  content: "ﭷ";
}

.isax-subtitle2:before {
  content: "ﭸ";
}

.isax-sun2:before {
  content: "ﭹ";
}

.isax-sun-12:before {
  content: "ﭺ";
}

.isax-sun-fog2:before {
  content: "ﭻ";
}

.isax-tag2:before {
  content: "ﭼ";
}

.isax-tag-22:before {
  content: "ﭽ";
}

.isax-tag-cross2:before {
  content: "ﭾ";
}

.isax-tag-right2:before {
  content: "ﭿ";
}

.isax-tag-user2:before {
  content: "ﮀ";
}

.isax-task2:before {
  content: "ﮁ";
}

.isax-task-square2:before {
  content: "ﮂ";
}

.isax-teacher2:before {
  content: "ﮃ";
}

.isax-text2:before {
  content: "ﮄ";
}

.isax-textalign-center2:before {
  content: "ﮅ";
}

.isax-textalign-justifycenter2:before {
  content: "ﮆ";
}

.isax-textalign-justifyleft2:before {
  content: "ﮇ";
}

.isax-textalign-justifyright2:before {
  content: "ﮈ";
}

.isax-textalign-left2:before {
  content: "ﮉ";
}

.isax-textalign-right2:before {
  content: "ﮊ";
}

.isax-text-block2:before {
  content: "ﮋ";
}

.isax-text-bold2:before {
  content: "ﮌ";
}

.isax-text-italic2:before {
  content: "ﮍ";
}

.isax-text-underline2:before {
  content: "ﮎ";
}

.isax-tick-circle2:before {
  content: "ﮏ";
}

.isax-ticket2:before {
  content: "ﮐ";
}

.isax-ticket-22:before {
  content: "ﮑ";
}

.isax-ticket-discount2:before {
  content: "ﮒ";
}

.isax-ticket-expired2:before {
  content: "ﮓ";
}

.isax-ticket-star2:before {
  content: "ﮔ";
}

.isax-tick-square2:before {
  content: "ﮕ";
}

.isax-timer2:before {
  content: "ﮖ";
}

.isax-timer-12:before {
  content: "ﮗ";
}

.isax-timer-pause2:before {
  content: "ﮘ";
}

.isax-timer-start2:before {
  content: "ﮙ";
}

.isax-toggle-off2:before {
  content: "ﮚ";
}

.isax-toggle-off-circle2:before {
  content: "ﮛ";
}

.isax-toggle-on2:before {
  content: "ﮜ";
}

.isax-toggle-on-circle2:before {
  content: "ﮝ";
}

.isax-trade2:before {
  content: "ﮞ";
}

.isax-transaction-minus2:before {
  content: "ﮟ";
}

.isax-translate2:before {
  content: "ﮠ";
}

.isax-trash2:before {
  content: "ﮡ";
}

.isax-tree2:before {
  content: "ﮢ";
}

.isax-trend-down2:before {
  content: "ﮣ";
}

.isax-trend-up2:before {
  content: "ﮤ";
}

.isax-triangle2:before {
  content: "ﮥ";
}

.isax-truck1:before {
  content: "ﮦ";
}

.isax-truck-fast1:before {
  content: "ﮧ";
}

.isax-truck-tick2:before {
  content: "ﮨ";
}

.isax-trush-square2:before {
  content: "ﮩ";
}

.isax-undo2:before {
  content: "ﮪ";
}

.isax-unlimited2:before {
  content: "ﮫ";
}

.isax-unlock2:before {
  content: "ﮬ";
}

.isax-user2:before {
  content: "ﮭ";
}

.isax-user-add2:before {
  content: "ﮮ";
}

.isax-user-cirlce-add2:before {
  content: "ﮯ";
}

.isax-user-edit2:before {
  content: "ﮰ";
}

.isax-user-minus2:before {
  content: "ﮱ";
}

.isax-user-octagon2:before {
  content: "﮲";
}

.isax-user-remove2:before {
  content: "﮳";
}

.isax-user-search2:before {
  content: "﮴";
}

.isax-user-square2:before {
  content: "﮵";
}

.isax-user-tag2:before {
  content: "﮶";
}

.isax-user-tick2:before {
  content: "﮷";
}

.isax-verify2:before {
  content: "﮸";
}

.isax-video2:before {
  content: "﮹";
}

.isax-video-add2:before {
  content: "﮺";
}

.isax-video-circle2:before {
  content: "﮻";
}

.isax-video-horizontal2:before {
  content: "﮼";
}

.isax-video-octagon2:before {
  content: "﮽";
}

.isax-video-play2:before {
  content: "﮾";
}

.isax-video-remove2:before {
  content: "﮿";
}

.isax-video-slash2:before {
  content: "﯀";
}

.isax-video-square2:before {
  content: "﯁";
}

.isax-video-tick2:before {
  content: "﯂";
}

.isax-video-time2:before {
  content: "﯃";
}

.isax-video-vertical2:before {
  content: "﯄";
}

.isax-voice-cricle2:before {
  content: "﯅";
}

.isax-voice-square2:before {
  content: "﯆";
}

.isax-volume-cross2:before {
  content: "﯇";
}

.isax-volume-high2:before {
  content: "﯈";
}

.isax-volume-low2:before {
  content: "﯉";
}

.isax-volume-low-12:before {
  content: "﯊";
}

.isax-volume-mute2:before {
  content: "﯋";
}

.isax-volume-slash2:before {
  content: "﯌";
}

.isax-volume-up2:before {
  content: "﯍";
}

.isax-wallet2:before {
  content: "﯎";
}

.isax-wallet-12:before {
  content: "﯏";
}

.isax-wallet-22:before {
  content: "﯐";
}

.isax-wallet-32:before {
  content: "﯑";
}

.isax-wallet-add2:before {
  content: "﯒";
}

.isax-wallet-add-12:before {
  content: "ﯓ";
}

.isax-wallet-check2:before {
  content: "ﯔ";
}

.isax-wallet-minus2:before {
  content: "ﯕ";
}

.isax-wallet-money2:before {
  content: "ﯖ";
}

.isax-wallet-remove2:before {
  content: "ﯗ";
}

.isax-wallet-search2:before {
  content: "ﯘ";
}

.isax-warning-22:before {
  content: "ﯙ";
}

.isax-watch2:before {
  content: "ﯚ";
}

.isax-watch-status2:before {
  content: "ﯛ";
}

.isax-weight2:before {
  content: "ﯜ";
}

.isax-weight-12:before {
  content: "ﯝ";
}

.isax-wifi2:before {
  content: "ﯞ";
}

.isax-wifi-square2:before {
  content: "ﯟ";
}

.isax-wind2:before {
  content: "ﯠ";
}

.isax-wind-22:before {
  content: "ﯡ";
}

.isax-woman2:before {
  content: "ﯢ";
}

.isax-dcube3:before {
  content: "\e900";
}

.isax-d-cube-scan3:before {
  content: "ﯣ";
}

.isax-d-rotate3:before {
  content: "ﯤ";
}

.isax-d-square3:before {
  content: "ﯥ";
}

.isax-square3:before {
  content: "ﯦ";
}

.isax-support3:before {
  content: "ﯧ";
}

.isax-activity3:before {
  content: "ﯨ";
}

.isax-add3:before {
  content: "ﯩ";
}

.isax-add-circle3:before {
  content: "ﯪ";
}

.isax-additem3:before {
  content: "ﯫ";
}

.isax-add-square3:before {
  content: "ﯬ";
}

.isax-airdrop3:before {
  content: "ﯭ";
}

.isax-airplane3:before {
  content: "ﯮ";
}

.isax-airplane-square3:before {
  content: "ﯯ";
}

.isax-airpod3:before {
  content: "ﯰ";
}

.isax-airpods3:before {
  content: "ﯱ";
}

.isax-alarm3:before {
  content: "ﯲ";
}

.isax-align-bottom3:before {
  content: "ﯳ";
}

.isax-align-horizontally3:before {
  content: "ﯴ";
}

.isax-align-left3:before {
  content: "ﯵ";
}

.isax-align-right3:before {
  content: "ﯶ";
}

.isax-align-vertically3:before {
  content: "ﯷ";
}

.isax-aquarius3:before {
  content: "ﯸ";
}

.isax-archive3:before {
  content: "ﯹ";
}

.isax-archive-13:before {
  content: "ﯺ";
}

.isax-archive-add3:before {
  content: "ﯻ";
}

.isax-archive-book3:before {
  content: "ﯼ";
}

.isax-archive-minus3:before {
  content: "ﯽ";
}

.isax-archive-slash3:before {
  content: "ﯾ";
}

.isax-archive-tick3:before {
  content: "ﯿ";
}

.isax-arrange-circle3:before {
  content: "ﰀ";
}

.isax-arrange-circle-23:before {
  content: "ﰁ";
}

.isax-arrange-square3:before {
  content: "ﰂ";
}

.isax-arrange-square-23:before {
  content: "ﰃ";
}

.isax-arrow3:before {
  content: "ﰄ";
}

.isax-arrow-23:before {
  content: "ﰅ";
}

.isax-arrow-33:before {
  content: "ﰆ";
}

.isax-arrow-bottom3:before {
  content: "ﰇ";
}

.isax-arrow-circle-down3:before {
  content: "ﰈ";
}

.isax-arrow-circle-left3:before {
  content: "ﰉ";
}

.isax-arrow-circle-right3:before {
  content: "ﰊ";
}

.isax-arrow-down3:before {
  content: "ﰋ";
}

.isax-arrow-down-13:before {
  content: "ﰌ";
}

.isax-arrow-down-23:before {
  content: "ﰍ";
}

.isax-arrow-left3:before {
  content: "ﰎ";
}

.isax-arrow-left-13:before {
  content: "ﰏ";
}

.isax-arrow-left-23:before {
  content: "ﰐ";
}

.isax-arrow-left-33:before {
  content: "ﰑ";
}

.isax-arrow-right3:before {
  content: "ﰒ";
}

.isax-arrow-right-13:before {
  content: "ﰓ";
}

.isax-arrow-right-23:before {
  content: "ﰔ";
}

.isax-arrow-right-33:before {
  content: "ﰕ";
}

.isax-arrow-square3:before {
  content: "ﰖ";
}

.isax-arrow-square-down3:before {
  content: "ﰗ";
}

.isax-arrow-square-left3:before {
  content: "ﰘ";
}

.isax-arrow-square-right2:before {
  content: "ﰙ";
}

.isax-arrow-square-up3:before {
  content: "ﰚ";
}

.isax-arrow-swap-horizontal3:before {
  content: "ﰛ";
}

.isax-arrow-up3:before {
  content: "ﰜ";
}

.isax-arrow-up-13:before {
  content: "ﰝ";
}

.isax-arrow-up-23:before {
  content: "ﰞ";
}

.isax-arrow-up-33:before {
  content: "ﰟ";
}

.isax-attach-circle3:before {
  content: "ﰠ";
}

.isax-attach-square3:before {
  content: "ﰡ";
}

.isax-audio-square3:before {
  content: "ﰢ";
}

.isax-autobrightness3:before {
  content: "ﰣ";
}

.isax-award3:before {
  content: "ﰤ";
}

.isax-back-square3:before {
  content: "ﰥ";
}

.isax-backward3:before {
  content: "ﰦ";
}

.isax-backward-5-seconds3:before {
  content: "ﰧ";
}

.isax-backward-10-seconds3:before {
  content: "ﰨ";
}

.isax-backward-15-seconds3:before {
  content: "ﰩ";
}

.isax-backward-item3:before {
  content: "ﰪ";
}

.isax-bag3:before {
  content: "ﰫ";
}

.isax-bag-23:before {
  content: "ﰬ";
}

.isax-bag-cross3:before {
  content: "ﰭ";
}

.isax-bag-cross-13:before {
  content: "ﰮ";
}

.isax-bag-happy3:before {
  content: "ﰯ";
}

.isax-bag-tick3:before {
  content: "ﰰ";
}

.isax-bag-tick-23:before {
  content: "ﰱ";
}

.isax-bag-timer3:before {
  content: "ﰲ";
}

.isax-bank3:before {
  content: "ﰳ";
}

.isax-barcode3:before {
  content: "ﰴ";
}

.isax-battery-3full3:before {
  content: "ﰵ";
}

.isax-battery-charging3:before {
  content: "ﰶ";
}

.isax-battery-disable3:before {
  content: "ﰷ";
}

.isax-battery-empty3:before {
  content: "ﰸ";
}

.isax-battery-empty-13:before {
  content: "ﰹ";
}

.isax-battery-full3:before {
  content: "ﰺ";
}

.isax-bezier3:before {
  content: "ﰻ";
}

.isax-bill3:before {
  content: "ﰼ";
}

.isax-bitcoin-card3:before {
  content: "ﰽ";
}

.isax-bitcoin-convert3:before {
  content: "ﰾ";
}

.isax-bitcoin-refresh3:before {
  content: "ﰿ";
}

.isax-blend3:before {
  content: "ﱀ";
}

.isax-blend-23:before {
  content: "ﱁ";
}

.isax-bluetooth3:before {
  content: "ﱂ";
}

.isax-bluetooth-23:before {
  content: "ﱃ";
}

.isax-bluetooth-circle3:before {
  content: "ﱄ";
}

.isax-bluetooth-rectangle3:before {
  content: "ﱅ";
}

.isax-blur3:before {
  content: "ﱆ";
}

.isax-book3:before {
  content: "ﱇ";
}

.isax-book-13:before {
  content: "ﱈ";
}

.isax-bookmark3:before {
  content: "ﱉ";
}

.isax-bookmark-23:before {
  content: "ﱊ";
}

.isax-book-saved3:before {
  content: "ﱋ";
}

.isax-book-square3:before {
  content: "ﱌ";
}

.isax-box3:before {
  content: "ﱍ";
}

.isax-box-13:before {
  content: "ﱎ";
}

.isax-box-23:before {
  content: "ﱏ";
}

.isax-box-add3:before {
  content: "ﱐ";
}

.isax-box-remove3:before {
  content: "ﱑ";
}

.isax-box-search3:before {
  content: "ﱒ";
}

.isax-box-tick3:before {
  content: "ﱓ";
}

.isax-box-time3:before {
  content: "ﱔ";
}

.isax-briefcase3:before {
  content: "ﱕ";
}

.isax-brifecase-cross3:before {
  content: "ﱖ";
}

.isax-brifecase-tick3:before {
  content: "ﱗ";
}

.isax-brifecase-timer3:before {
  content: "ﱘ";
}

.isax-broom3:before {
  content: "ﱙ";
}

.isax-brush3:before {
  content: "ﱚ";
}

.isax-brush-13:before {
  content: "ﱛ";
}

.isax-brush-23:before {
  content: "ﱜ";
}

.isax-brush-33:before {
  content: "ﱝ";
}

.isax-brush-43:before {
  content: "ﱞ";
}

.isax-bubble3:before {
  content: "ﱟ";
}

.isax-bucket3:before {
  content: "ﱠ";
}

.isax-bucket-circle3:before {
  content: "ﱡ";
}

.isax-bucket-square3:before {
  content: "ﱢ";
}

.isax-building3:before {
  content: "ﱣ";
}

.isax-building-33:before {
  content: "ﱤ";
}

.isax-building-43:before {
  content: "ﱥ";
}

.isax-buildings3:before {
  content: "ﱦ";
}

.isax-buildings-23:before {
  content: "ﱧ";
}

.isax-buliding3:before {
  content: "ﱨ";
}

.isax-bus3:before {
  content: "ﱩ";
}

.isax-buy-crypto3:before {
  content: "ﱪ";
}

.isax-cake3:before {
  content: "ﱫ";
}

.isax-calculator3:before {
  content: "ﱬ";
}

.isax-calendar3:before {
  content: "ﱭ";
}

.isax-calendar-13:before {
  content: "ﱮ";
}

.isax-calendar-23:before {
  content: "ﱯ";
}

.isax-calendar-add3:before {
  content: "ﱰ";
}

.isax-calendar-circle3:before {
  content: "ﱱ";
}

.isax-calendar-edit3:before {
  content: "ﱲ";
}

.isax-calendar-remove3:before {
  content: "ﱳ";
}

.isax-calendar-search3:before {
  content: "ﱴ";
}

.isax-calendar-tick3:before {
  content: "ﱵ";
}

.isax-call3:before {
  content: "ﱶ";
}

.isax-call-add3:before {
  content: "ﱷ";
}

.isax-call-calling3:before {
  content: "ﱸ";
}

.isax-call-incoming3:before {
  content: "ﱹ";
}

.isax-call-minus3:before {
  content: "ﱺ";
}

.isax-call-outgoing3:before {
  content: "ﱻ";
}

.isax-call-received3:before {
  content: "ﱼ";
}

.isax-call-remove3:before {
  content: "ﱽ";
}

.isax-call-slash3:before {
  content: "ﱾ";
}

.isax-camera3:before {
  content: "ﱿ";
}

.isax-camera-slash3:before {
  content: "ﲀ";
}

.isax-candle3:before {
  content: "ﲁ";
}

.isax-candle-23:before {
  content: "ﲂ";
}

.isax-car3:before {
  content: "ﲃ";
}

.isax-card3:before {
  content: "ﲄ";
}

.isax-card-add3:before {
  content: "ﲅ";
}

.isax-card-coin3:before {
  content: "ﲆ";
}

.isax-card-edit3:before {
  content: "ﲇ";
}

.isax-card-pos3:before {
  content: "ﲈ";
}

.isax-card-receive3:before {
  content: "ﲉ";
}

.isax-card-remove3:before {
  content: "ﲊ";
}

.isax-card-remove-13:before {
  content: "ﲋ";
}

.isax-cards3:before {
  content: "ﲌ";
}

.isax-card-send3:before {
  content: "ﲍ";
}

.isax-card-slash3:before {
  content: "ﲎ";
}

.isax-card-tick3:before {
  content: "ﲏ";
}

.isax-card-tick-13:before {
  content: "ﲐ";
}

.isax-category3:before {
  content: "ﲑ";
}

.isax-category-23:before {
  content: "ﲒ";
}

.isax-cd3:before {
  content: "ﲓ";
}

.isax-chart3:before {
  content: "ﲔ";
}

.isax-chart-13:before {
  content: "ﲕ";
}

.isax-chart-24:before {
  content: "ﲖ";
}

.isax-chart-33:before {
  content: "ﲗ";
}

.isax-chart-213:before {
  content: "ﲘ";
}

.isax-chart-square3:before {
  content: "ﲙ";
}

.isax-chart-success3:before {
  content: "ﲚ";
}

.isax-check3:before {
  content: "ﲛ";
}

.isax-chrome3:before {
  content: "ﲜ";
}

.isax-clipboard3:before {
  content: "ﲝ";
}

.isax-clipboard-close3:before {
  content: "ﲞ";
}

.isax-clipboard-export3:before {
  content: "ﲟ";
}

.isax-clipboard-import3:before {
  content: "ﲠ";
}

.isax-clipboard-text3:before {
  content: "ﲡ";
}

.isax-clipboard-tick3:before {
  content: "ﲢ";
}

.isax-clock3:before {
  content: "ﲣ";
}

.isax-clock-13:before {
  content: "ﲤ";
}

.isax-close-circle3:before {
  content: "ﲥ";
}

.isax-close-square3:before {
  content: "ﲦ";
}

.isax-cloud3:before {
  content: "ﲧ";
}

.isax-cloud-add3:before {
  content: "ﲨ";
}

.isax-cloud-change3:before {
  content: "ﲩ";
}

.isax-cloud-connection3:before {
  content: "ﲪ";
}

.isax-cloud-cross3:before {
  content: "ﲫ";
}

.isax-cloud-drizzle3:before {
  content: "ﲬ";
}

.isax-cloud-fog3:before {
  content: "ﲭ";
}

.isax-cloud-lightning3:before {
  content: "ﲮ";
}

.isax-cloud-minus3:before {
  content: "ﲯ";
}

.isax-cloud-notif3:before {
  content: "ﲰ";
}

.isax-cloud-plus3:before {
  content: "ﲱ";
}

.isax-cloud-remove3:before {
  content: "ﲲ";
}

.isax-cloud-snow3:before {
  content: "ﲳ";
}

.isax-cloud-sunny3:before {
  content: "ﲴ";
}

.isax-code3:before {
  content: "ﲵ";
}

.isax-code-13:before {
  content: "ﲶ";
}

.isax-code-circle3:before {
  content: "ﲷ";
}

.isax-coffee3:before {
  content: "ﲸ";
}

.isax-coin3:before {
  content: "ﲹ";
}

.isax-coin-13:before {
  content: "ﲺ";
}

.isax-colorfilter3:before {
  content: "ﲻ";
}

.isax-colors-square3:before {
  content: "ﲼ";
}

.isax-color-swatch3:before {
  content: "ﲽ";
}

.isax-command3:before {
  content: "ﲾ";
}

.isax-command-square3:before {
  content: "ﲿ";
}

.isax-component3:before {
  content: "ﳀ";
}

.isax-computing3:before {
  content: "ﳁ";
}

.isax-convert3:before {
  content: "ﳂ";
}

.isax-convert-3d-cube3:before {
  content: "ﳃ";
}

.isax-convert-card3:before {
  content: "ﳄ";
}

.isax-convertshape3:before {
  content: "ﳅ";
}

.isax-convertshape-23:before {
  content: "ﳆ";
}

.isax-copy3:before {
  content: "ﳇ";
}

.isax-copyright3:before {
  content: "ﳈ";
}

.isax-copy-success3:before {
  content: "ﳉ";
}

.isax-courthouse3:before {
  content: "ﳊ";
}

.isax-cpu3:before {
  content: "ﳋ";
}

.isax-cpu-charge3:before {
  content: "ﳌ";
}

.isax-cpu-setting3:before {
  content: "ﳍ";
}

.isax-creative-commons3:before {
  content: "ﳎ";
}

.isax-crop3:before {
  content: "ﳏ";
}

.isax-crown3:before {
  content: "ﳐ";
}

.isax-crown-13:before {
  content: "ﳑ";
}

.isax-cup3:before {
  content: "ﳒ";
}

.isax-danger3:before {
  content: "ﳓ";
}

.isax-data3:before {
  content: "ﳔ";
}

.isax-data-23:before {
  content: "ﳕ";
}

.isax-designtools3:before {
  content: "ﳖ";
}

.isax-device-message3:before {
  content: "ﳗ";
}

.isax-devices3:before {
  content: "ﳘ";
}

.isax-diagram3:before {
  content: "ﳙ";
}

.isax-diamonds3:before {
  content: "ﳚ";
}

.isax-direct3:before {
  content: "ﳛ";
}

.isax-directbox-default3:before {
  content: "ﳜ";
}

.isax-directbox-notif3:before {
  content: "ﳝ";
}

.isax-directbox-receive3:before {
  content: "ﳞ";
}

.isax-directbox-send3:before {
  content: "ﳟ";
}

.isax-direct-down3:before {
  content: "ﳠ";
}

.isax-direct-inbox3:before {
  content: "ﳡ";
}

.isax-direct-left3:before {
  content: "ﳢ";
}

.isax-direct-normal3:before {
  content: "ﳣ";
}

.isax-direct-notification3:before {
  content: "ﳤ";
}

.isax-direct-right3:before {
  content: "ﳥ";
}

.isax-direct-send3:before {
  content: "ﳦ";
}

.isax-direct-up3:before {
  content: "ﳧ";
}

.isax-discount-circle3:before {
  content: "ﳨ";
}

.isax-discount-shape3:before {
  content: "ﳩ";
}

.isax-discover3:before {
  content: "ﳪ";
}

.isax-dislike3:before {
  content: "ﳫ";
}

.isax-document3:before {
  content: "ﳬ";
}

.isax-document-13:before {
  content: "ﳭ";
}

.isax-document-cloud3:before {
  content: "ﳮ";
}

.isax-document-code3:before {
  content: "ﳯ";
}

.isax-document-code-23:before {
  content: "ﳰ";
}

.isax-document-copy3:before {
  content: "ﳱ";
}

.isax-document-download3:before {
  content: "ﳲ";
}

.isax-document-favorite3:before {
  content: "ﳳ";
}

.isax-document-filter3:before {
  content: "ﳴ";
}

.isax-document-forward3:before {
  content: "ﳵ";
}

.isax-document-like3:before {
  content: "ﳶ";
}

.isax-document-previous3:before {
  content: "ﳷ";
}

.isax-document-sketch3:before {
  content: "ﳸ";
}

.isax-document-text3:before {
  content: "ﳹ";
}

.isax-document-text-13:before {
  content: "ﳺ";
}

.isax-document-upload3:before {
  content: "ﳻ";
}

.isax-dollar-circle2:before {
  content: "ﳼ";
}

.isax-dollar-square3:before {
  content: "ﳽ";
}

.isax-driver3:before {
  content: "ﳾ";
}

.isax-driver-23:before {
  content: "ﳿ";
}

.isax-driver-refresh3:before {
  content: "ﴀ";
}

.isax-driving3:before {
  content: "ﴁ";
}

.isax-drop2:before {
  content: "ﴂ";
}

.isax-edit3:before {
  content: "ﴃ";
}

.isax-edit-23:before {
  content: "ﴄ";
}

.isax-electricity3:before {
  content: "ﴅ";
}

.isax-element-11:before {
  content: "ﴆ";
}

.isax-element-23:before {
  content: "ﴇ";
}

.isax-element-33:before {
  content: "ﴈ";
}

.isax-element-43:before {
  content: "ﴉ";
}

.isax-element-equal3:before {
  content: "ﴊ";
}

.isax-element-plus3:before {
  content: "ﴋ";
}

.isax-emoji-happy3:before {
  content: "ﴌ";
}

.isax-emoji-normal3:before {
  content: "ﴍ";
}

.isax-emoji-sad3:before {
  content: "ﴎ";
}

.isax-empty-wallet3:before {
  content: "ﴏ";
}

.isax-empty-wallet-add3:before {
  content: "ﴐ";
}

.isax-empty-wallet-remove3:before {
  content: "ﴑ";
}

.isax-empty-wallet-tick3:before {
  content: "ﴒ";
}

.isax-eraser3:before {
  content: "ﴓ";
}

.isax-eraser-13:before {
  content: "ﴔ";
}

.isax-export3:before {
  content: "ﴕ";
}

.isax-export-13:before {
  content: "ﴖ";
}

.isax-export-23:before {
  content: "ﴗ";
}

.isax-export-33:before {
  content: "ﴘ";
}

.isax-external-drive3:before {
  content: "ﴙ";
}

.isax-eye2:before {
  content: "ﴚ";
}

.isax-eye-slash3:before {
  content: "ﴛ";
}

.isax-fatrows3:before {
  content: "ﴜ";
}

.isax-favorite-chart3:before {
  content: "ﴝ";
}

.isax-filter3:before {
  content: "ﴞ";
}

.isax-filter-add3:before {
  content: "ﴟ";
}

.isax-filter-edit3:before {
  content: "ﴠ";
}

.isax-filter-remove3:before {
  content: "ﴡ";
}

.isax-filter-search3:before {
  content: "ﴢ";
}

.isax-filter-square3:before {
  content: "ﴣ";
}

.isax-filter-tick3:before {
  content: "ﴤ";
}

.isax-finger-cricle3:before {
  content: "ﴥ";
}

.isax-finger-scan3:before {
  content: "ﴦ";
}

.isax-firstline3:before {
  content: "ﴧ";
}

.isax-flag3:before {
  content: "ﴨ";
}

.isax-flag-23:before {
  content: "ﴩ";
}

.isax-flash3:before {
  content: "ﴪ";
}

.isax-flash-13:before {
  content: "ﴫ";
}

.isax-flash-circle3:before {
  content: "ﴬ";
}

.isax-flash-circle-13:before {
  content: "ﴭ";
}

.isax-flash-slash3:before {
  content: "ﴮ";
}

.isax-folder3:before {
  content: "ﴯ";
}

.isax-folder-23:before {
  content: "ﴰ";
}

.isax-folder-add3:before {
  content: "ﴱ";
}

.isax-folder-cloud3:before {
  content: "ﴲ";
}

.isax-folder-connection3:before {
  content: "ﴳ";
}

.isax-folder-cross3:before {
  content: "ﴴ";
}

.isax-folder-favorite3:before {
  content: "ﴵ";
}

.isax-folder-minus3:before {
  content: "ﴶ";
}

.isax-folder-open3:before {
  content: "ﴷ";
}

.isax-forbidden3:before {
  content: "ﴸ";
}

.isax-forbidden-23:before {
  content: "ﴹ";
}

.isax-format-circle3:before {
  content: "ﴺ";
}

.isax-format-square3:before {
  content: "ﴻ";
}

.isax-forward3:before {
  content: "ﴼ";
}

.isax-forward-5-seconds3:before {
  content: "ﴽ";
}

.isax-forward-10-seconds3:before {
  content: "﴾";
}

.isax-forward-15-seconds3:before {
  content: "﴿";
}

.isax-forward-item3:before {
  content: "﵀";
}

.isax-forward-square3:before {
  content: "﵁";
}

.isax-frame3:before {
  content: "﵂";
}

.isax-frame-13:before {
  content: "﵃";
}

.isax-frame-23:before {
  content: "﵄";
}

.isax-frame-33:before {
  content: "﵅";
}

.isax-frame-43:before {
  content: "﵆";
}

.isax-frame-51:before {
  content: "﵇";
}

.isax-gallery3:before {
  content: "﵈";
}

.isax-gallery-add3:before {
  content: "﵉";
}

.isax-gallery-edit3:before {
  content: "﵊";
}

.isax-gallery-export2:before {
  content: "﵋";
}

.isax-gallery-favorite3:before {
  content: "﵌";
}

.isax-gallery-import3:before {
  content: "﵍";
}

.isax-gallery-remove3:before {
  content: "﵎";
}

.isax-gallery-slash3:before {
  content: "﵏";
}

.isax-gallery-tick3:before {
  content: "ﵐ";
}

.isax-game3:before {
  content: "ﵑ";
}

.isax-gameboy3:before {
  content: "ﵒ";
}

.isax-gemini3:before {
  content: "ﵓ";
}

.isax-gemini-23:before {
  content: "ﵔ";
}

.isax-ghost3:before {
  content: "ﵕ";
}

.isax-gift3:before {
  content: "ﵖ";
}

.isax-glass3:before {
  content: "ﵗ";
}

.isax-glass-13:before {
  content: "ﵘ";
}

.isax-global3:before {
  content: "ﵙ";
}

.isax-global-edit3:before {
  content: "ﵚ";
}

.isax-global-refresh3:before {
  content: "ﵛ";
}

.isax-global-search3:before {
  content: "ﵜ";
}

.isax-gps3:before {
  content: "ﵝ";
}

.isax-gps-slash3:before {
  content: "ﵞ";
}

.isax-grammerly3:before {
  content: "ﵟ";
}

.isax-graph3:before {
  content: "ﵠ";
}

.isax-grid-13:before {
  content: "ﵡ";
}

.isax-grid-23:before {
  content: "ﵢ";
}

.isax-grid-33:before {
  content: "ﵣ";
}

.isax-grid-43:before {
  content: "ﵤ";
}

.isax-grid-53:before {
  content: "ﵥ";
}

.isax-grid-63:before {
  content: "ﵦ";
}

.isax-grid-73:before {
  content: "ﵧ";
}

.isax-grid-83:before {
  content: "ﵨ";
}

.isax-grid-93:before {
  content: "ﵩ";
}

.isax-grid-edit3:before {
  content: "ﵪ";
}

.isax-grid-eraser3:before {
  content: "ﵫ";
}

.isax-grid-lock3:before {
  content: "ﵬ";
}

.isax-happyemoji3:before {
  content: "ﵭ";
}

.isax-hashtag3:before {
  content: "ﵮ";
}

.isax-hashtag-13:before {
  content: "ﵯ";
}

.isax-hashtag-down3:before {
  content: "ﵰ";
}

.isax-hashtag-up3:before {
  content: "ﵱ";
}

.isax-headphone3:before {
  content: "ﵲ";
}

.isax-headphones3:before {
  content: "ﵳ";
}

.isax-health3:before {
  content: "ﵴ";
}

.isax-heart3:before {
  content: "ﵵ";
}

.isax-heart-add3:before {
  content: "ﵶ";
}

.isax-heart-circle3:before {
  content: "ﵷ";
}

.isax-heart-edit3:before {
  content: "ﵸ";
}

.isax-heart-remove3:before {
  content: "ﵹ";
}

.isax-heart-search3:before {
  content: "ﵺ";
}

.isax-heart-slash3:before {
  content: "ﵻ";
}

.isax-heart-tick3:before {
  content: "ﵼ";
}

.isax-hierarchy3:before {
  content: "ﵽ";
}

.isax-hierarchy-23:before {
  content: "ﵾ";
}

.isax-hierarchy-33:before {
  content: "ﵿ";
}

.isax-hierarchy-square3:before {
  content: "ﶀ";
}

.isax-hierarchy-square-23:before {
  content: "ﶁ";
}

.isax-hierarchy-square-33:before {
  content: "ﶂ";
}

.isax-home3:before {
  content: "ﶃ";
}

.isax-home-13:before {
  content: "ﶄ";
}

.isax-home-23:before {
  content: "ﶅ";
}

.isax-home-hashtag3:before {
  content: "ﶆ";
}

.isax-home-trend-down3:before {
  content: "ﶇ";
}

.isax-home-trend-up3:before {
  content: "ﶈ";
}

.isax-home-wifi3:before {
  content: "ﶉ";
}

.isax-hospital3:before {
  content: "ﶊ";
}

.isax-house3:before {
  content: "ﶋ";
}

.isax-house-23:before {
  content: "ﶌ";
}

.isax-icon2:before {
  content: "ﶍ";
}

.isax-icon-11:before {
  content: "ﶎ";
}

.isax-icon-2:before {
  content: "ﶏ";
}

.isax-icon-3:before {
  content: "﶐";
}

.isax-image3:before {
  content: "﶑";
}

.isax-import3:before {
  content: "ﶒ";
}

.isax-import-13:before {
  content: "ﶓ";
}

.isax-import-23:before {
  content: "ﶔ";
}

.isax-info-circle3:before {
  content: "ﶕ";
}

.isax-information3:before {
  content: "ﶖ";
}

.isax-instagram3:before {
  content: "ﶗ";
}

.isax-judge3:before {
  content: "ﶘ";
}

.isax-kanban2:before {
  content: "ﶙ";
}

.isax-key3:before {
  content: "ﶚ";
}

.isax-keyboard3:before {
  content: "ﶛ";
}

.isax-keyboard-open3:before {
  content: "ﶜ";
}

.isax-key-square3:before {
  content: "ﶝ";
}

.isax-lamp3:before {
  content: "ﶞ";
}

.isax-lamp-13:before {
  content: "ﶟ";
}

.isax-lamp-charge3:before {
  content: "ﶠ";
}

.isax-lamp-on3:before {
  content: "ﶡ";
}

.isax-lamp-slash3:before {
  content: "ﶢ";
}

.isax-language-circle3:before {
  content: "ﶣ";
}

.isax-language-square3:before {
  content: "ﶤ";
}

.isax-layer3:before {
  content: "ﶥ";
}

.isax-level3:before {
  content: "ﶦ";
}

.isax-lifebuoy3:before {
  content: "ﶧ";
}

.isax-like3:before {
  content: "ﶨ";
}

.isax-like-13:before {
  content: "ﶩ";
}

.isax-like-dislike3:before {
  content: "ﶪ";
}

.isax-like-shapes3:before {
  content: "ﶫ";
}

.isax-like-tag3:before {
  content: "ﶬ";
}

.isax-link3:before {
  content: "ﶭ";
}

.isax-link-13:before {
  content: "ﶮ";
}

.isax-link-24:before {
  content: "ﶯ";
}

.isax-link-213:before {
  content: "ﶰ";
}

.isax-link-circle3:before {
  content: "ﶱ";
}

.isax-link-square3:before {
  content: "ﶲ";
}

.isax-location3:before {
  content: "ﶳ";
}

.isax-location-add3:before {
  content: "ﶴ";
}

.isax-location-cross3:before {
  content: "ﶵ";
}

.isax-location-minus3:before {
  content: "ﶶ";
}

.isax-location-slash3:before {
  content: "ﶷ";
}

.isax-location-tick3:before {
  content: "ﶸ";
}

.isax-lock3:before {
  content: "ﶹ";
}

.isax-lock-13:before {
  content: "ﶺ";
}

.isax-lock-circle3:before {
  content: "ﶻ";
}

.isax-lock-slash3:before {
  content: "ﶼ";
}

.isax-login3:before {
  content: "ﶽ";
}

.isax-login-13:before {
  content: "ﶾ";
}

.isax-logout3:before {
  content: "ﶿ";
}

.isax-logout-13:before {
  content: "ﷀ";
}

.isax-lovely3:before {
  content: "ﷁ";
}

.isax-magicpen3:before {
  content: "ﷂ";
}

.isax-magic-star3:before {
  content: "ﷃ";
}

.isax-main-component3:before {
  content: "ﷄ";
}

.isax-man3:before {
  content: "ﷅ";
}

.isax-map3:before {
  content: "ﷆ";
}

.isax-map-13:before {
  content: "ﷇ";
}

.isax-mask3:before {
  content: "﷈";
}

.isax-mask-13:before {
  content: "﷉";
}

.isax-mask-23:before {
  content: "﷊";
}

.isax-math3:before {
  content: "﷋";
}

.isax-maximize3:before {
  content: "﷌";
}

.isax-maximize-13:before {
  content: "﷍";
}

.isax-maximize-24:before {
  content: "﷎";
}

.isax-maximize-33:before {
  content: "﷏";
}

.isax-maximize-43:before {
  content: "﷐";
}

.isax-maximize-213:before {
  content: "﷑";
}

.isax-maximize-circle2 .path1:before {
  content: "﷒";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-maximize-circle2 .path2:before {
  content: "﷓";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-maximize-circle2 .path3:before {
  content: "﷔";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-maximize-circle2 .path4:before {
  content: "﷕";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-maximize-circle2 .path5:before {
  content: "﷖";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-maximize-circle2 .path6:before {
  content: "﷗";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-medal3:before {
  content: "﷘";
}

.isax-medal-star3:before {
  content: "﷙";
}

.isax-menu3:before {
  content: "﷚";
}

.isax-menu-13:before {
  content: "﷛";
}

.isax-menu-board3:before {
  content: "﷜";
}

.isax-message3:before {
  content: "﷝";
}

.isax-message-23:before {
  content: "﷞";
}

.isax-message-add3:before {
  content: "﷟";
}

.isax-message-add-13:before {
  content: "﷠";
}

.isax-message-circle3:before {
  content: "﷡";
}

.isax-message-edit3:before {
  content: "﷢";
}

.isax-message-favorite3:before {
  content: "﷣";
}

.isax-message-minus3:before {
  content: "﷤";
}

.isax-message-notif3:before {
  content: "﷥";
}

.isax-message-programming3:before {
  content: "﷦";
}

.isax-message-question3:before {
  content: "﷧";
}

.isax-message-remove3:before {
  content: "﷨";
}

.isax-messages3:before {
  content: "﷩";
}

.isax-messages-13:before {
  content: "﷪";
}

.isax-messages-23:before {
  content: "﷫";
}

.isax-messages-33:before {
  content: "﷬";
}

.isax-message-search3:before {
  content: "﷭";
}

.isax-message-square3:before {
  content: "﷮";
}

.isax-message-text3:before {
  content: "﷯";
}

.isax-message-text-13:before {
  content: "ﷰ";
}

.isax-message-tick3:before {
  content: "ﷱ";
}

.isax-message-time3:before {
  content: "ﷲ";
}

.isax-microphone3:before {
  content: "ﷳ";
}

.isax-microphone-23:before {
  content: "ﷴ";
}

.isax-microphone-slash3:before {
  content: "ﷵ";
}

.isax-microphone-slash-13:before {
  content: "ﷶ";
}

.isax-microscope3:before {
  content: "ﷷ";
}

.isax-milk3:before {
  content: "ﷸ";
}

.isax-mini-music-sqaure3:before {
  content: "ﷹ";
}

.isax-minus3:before {
  content: "ﷺ";
}

.isax-minus-cirlce3:before {
  content: "ﷻ";
}

.isax-minus-square3:before {
  content: "﷼";
}

.isax-mirror3:before {
  content: "﷽";
}

.isax-mirroring-screen3:before {
  content: "﷾";
}

.isax-mobile3:before {
  content: "﷿";
}

.isax-mobile-programming3:before {
  content: "︀";
}

.isax-money3:before {
  content: "︁";
}

.isax-money-23:before {
  content: "︂";
}

.isax-money-33:before {
  content: "︃";
}

.isax-money-43:before {
  content: "︄";
}

.isax-money-add3:before {
  content: "︅";
}

.isax-money-change3:before {
  content: "︆";
}

.isax-money-forbidden3:before {
  content: "︇";
}

.isax-money-recive3:before {
  content: "︈";
}

.isax-money-remove3:before {
  content: "︉";
}

.isax-moneys3:before {
  content: "︊";
}

.isax-money-send3:before {
  content: "︋";
}

.isax-money-tick3:before {
  content: "︌";
}

.isax-money-time3:before {
  content: "︍";
}

.isax-monitor3:before {
  content: "︎";
}

.isax-monitor-mobbile3:before {
  content: "️";
}

.isax-monitor-recorder3:before {
  content: "︐";
}

.isax-moon3:before {
  content: "︑";
}

.isax-more3:before {
  content: "︒";
}

.isax-more-23:before {
  content: "︓";
}

.isax-more-circle3:before {
  content: "︔";
}

.isax-more-square3:before {
  content: "︕";
}

.isax-mouse3:before {
  content: "︖";
}

.isax-mouse-13:before {
  content: "︗";
}

.isax-mouse-circle3:before {
  content: "︘";
}

.isax-mouse-square3:before {
  content: "︙";
}

.isax-music3:before {
  content: "︚";
}

.isax-music-circle3:before {
  content: "︛";
}

.isax-music-dashboard3:before {
  content: "︜";
}

.isax-music-filter3:before {
  content: "︝";
}

.isax-music-library-23:before {
  content: "︞";
}

.isax-musicnote3:before {
  content: "︟";
}

.isax-music-play3:before {
  content: "︠";
}

.isax-music-playlist3:before {
  content: "︡";
}

.isax-music-square3:before {
  content: "︢";
}

.isax-music-square-add3:before {
  content: "︣";
}

.isax-music-square-remove3:before {
  content: "︤";
}

.isax-music-square-search3:before {
  content: "︥";
}

.isax-next3:before {
  content: "︦";
}

.isax-note3:before {
  content: "︧";
}

.isax-note-13:before {
  content: "︨";
}

.isax-note-24:before {
  content: "︩";
}

.isax-note-213:before {
  content: "︪";
}

.isax-note-add3:before {
  content: "︫";
}

.isax-note-favorite3:before {
  content: "︬";
}

.isax-note-remove3:before {
  content: "︭";
}

.isax-note-square3:before {
  content: "︮";
}

.isax-note-text3:before {
  content: "︯";
}

.isax-notification3:before {
  content: "︰";
}

.isax-notification-13:before {
  content: "︱";
}

.isax-notification-bing3:before {
  content: "︲";
}

.isax-notification-circle3:before {
  content: "︳";
}

.isax-notification-favorite3:before {
  content: "︴";
}

.isax-notification-status3:before {
  content: "︵";
}

.isax-omega-circle3:before {
  content: "︶";
}

.isax-omega-square3:before {
  content: "︷";
}

.isax-paintbucket3:before {
  content: "︸";
}

.isax-paperclip3:before {
  content: "︹";
}

.isax-paperclip-23:before {
  content: "︺";
}

.isax-password-check3:before {
  content: "︻";
}

.isax-path3:before {
  content: "︼";
}

.isax-path-23:before {
  content: "︽";
}

.isax-path-square3:before {
  content: "︾";
}

.isax-pause3:before {
  content: "︿";
}

.isax-pause-circle3:before {
  content: "﹀";
}

.isax-pen-add3:before {
  content: "﹁";
}

.isax-pen-close3:before {
  content: "﹂";
}

.isax-pen-remove3:before {
  content: "﹃";
}

.isax-pen-tool3:before {
  content: "﹄";
}

.isax-pen-tool-23:before {
  content: "﹅";
}

.isax-people3:before {
  content: "﹆";
}

.isax-percentage-circle3:before {
  content: "﹇";
}

.isax-percentage-square3:before {
  content: "﹈";
}

.isax-personalcard3:before {
  content: "﹉";
}

.isax-pet3:before {
  content: "﹊";
}

.isax-pharagraphspacing3:before {
  content: "﹋";
}

.isax-picture-frame3:before {
  content: "﹌";
}

.isax-play3:before {
  content: "﹍";
}

.isax-play-add3:before {
  content: "﹎";
}

.isax-play-circle3:before {
  content: "﹏";
}

.isax-play-cricle3:before {
  content: "﹐";
}

.isax-play-remove3:before {
  content: "﹑";
}

.isax-presention-chart3:before {
  content: "﹒";
}

.isax-previous3:before {
  content: "﹓";
}

.isax-printer3:before {
  content: "﹔";
}

.isax-printer-slash3:before {
  content: "﹕";
}

.isax-profile1:before {
  content: "﹖";
}

.isax-profile-2user3:before {
  content: "﹗";
}

.isax-profile-add3:before {
  content: "﹘";
}

.isax-profile-circle3:before {
  content: "﹙";
}

.isax-profile-delete3:before {
  content: "﹚";
}

.isax-profile-remove3:before {
  content: "﹛";
}

.isax-profile-tick3:before {
  content: "﹜";
}

.isax-programming-arrow3:before {
  content: "﹝";
}

.isax-programming-arrows3:before {
  content: "﹞";
}

.isax-quote-down3:before {
  content: "﹟";
}

.isax-quote-down-circle3:before {
  content: "﹠";
}

.isax-quote-down-square3:before {
  content: "﹡";
}

.isax-quote-up3:before {
  content: "﹢";
}

.isax-quote-up-circle3:before {
  content: "﹣";
}

.isax-quote-up-square3:before {
  content: "﹤";
}

.isax-radar3:before {
  content: "﹥";
}

.isax-radar-13:before {
  content: "﹦";
}

.isax-radar-23:before {
  content: "﹧";
}

.isax-radio3:before {
  content: "﹨";
}

.isax-ram3:before {
  content: "﹩";
}

.isax-ram-23:before {
  content: "﹪";
}

.isax-ranking3:before {
  content: "﹫";
}

.isax-ranking-13:before {
  content: "﹬";
}

.isax-receipt3:before {
  content: "﹭";
}

.isax-receipt-13:before {
  content: "﹮";
}

.isax-receipt-23:before {
  content: "﹯";
}

.isax-receipt-2-13:before {
  content: "ﹰ";
}

.isax-receipt-add3:before {
  content: "ﹱ";
}

.isax-receipt-discount3:before {
  content: "ﹲ";
}

.isax-receipt-disscount3:before {
  content: "ﹳ";
}

.isax-receipt-edit3:before {
  content: "ﹴ";
}

.isax-receipt-item3:before {
  content: "﹵";
}

.isax-receipt-minus3:before {
  content: "ﹶ";
}

.isax-receipt-search3:before {
  content: "ﹷ";
}

.isax-receipt-square3:before {
  content: "ﹸ";
}

.isax-receipt-text3:before {
  content: "ﹹ";
}

.isax-received3:before {
  content: "ﹺ";
}

.isax-receive-square3:before {
  content: "ﹻ";
}

.isax-receive-square-23:before {
  content: "ﹼ";
}

.isax-record3:before {
  content: "ﹽ";
}

.isax-record-circle3:before {
  content: "ﹾ";
}

.isax-recovery-convert3:before {
  content: "ﹿ";
}

.isax-redo3:before {
  content: "ﺀ";
}

.isax-refresh3:before {
  content: "ﺁ";
}

.isax-refresh-23:before {
  content: "ﺂ";
}

.isax-refresh-circle3:before {
  content: "ﺃ";
}

.isax-refresh-left-square3:before {
  content: "ﺄ";
}

.isax-refresh-right-square3:before {
  content: "ﺅ";
}

.isax-refresh-square-23:before {
  content: "ﺆ";
}

.isax-repeat3:before {
  content: "ﺇ";
}

.isax-repeat-circle3:before {
  content: "ﺈ";
}

.isax-repeate-music3:before {
  content: "ﺉ";
}

.isax-repeate-one3:before {
  content: "ﺊ";
}

.isax-reserve3:before {
  content: "ﺋ";
}

.isax-rotate-left3:before {
  content: "ﺌ";
}

.isax-rotate-left-13:before {
  content: "ﺍ";
}

.isax-rotate-right3:before {
  content: "ﺎ";
}

.isax-rotate-right-13:before {
  content: "ﺏ";
}

.isax-route-square3:before {
  content: "ﺐ";
}

.isax-routing3:before {
  content: "ﺑ";
}

.isax-routing-23:before {
  content: "ﺒ";
}

.isax-row-horizontal3:before {
  content: "ﺓ";
}

.isax-row-vertical3:before {
  content: "ﺔ";
}

.isax-rulerpen3:before {
  content: "ﺕ";
}

.isax-ruler3:before {
  content: "ﺖ";
}

.isax-safe-home3:before {
  content: "ﺗ";
}

.isax-sagittarius3:before {
  content: "ﺘ";
}

.isax-save-23:before {
  content: "ﺙ";
}

.isax-save-add3:before {
  content: "ﺚ";
}

.isax-save-minus3:before {
  content: "ﺛ";
}

.isax-save-remove3:before {
  content: "ﺜ";
}

.isax-scan3:before {
  content: "ﺝ";
}

.isax-scan-barcode3:before {
  content: "ﺞ";
}

.isax-scanner3:before {
  content: "ﺟ";
}

.isax-scanning3:before {
  content: "ﺠ";
}

.isax-scissor3:before {
  content: "ﺡ";
}

.isax-scissor-13:before {
  content: "ﺢ";
}

.isax-screenmirroring3:before {
  content: "ﺣ";
}

.isax-scroll3:before {
  content: "ﺤ";
}

.isax-search-favorite3:before {
  content: "ﺥ";
}

.isax-search-favorite-13:before {
  content: "ﺦ";
}

.isax-search-normal3:before {
  content: "ﺧ";
}

.isax-search-normal-13:before {
  content: "ﺨ";
}

.isax-search-status3:before {
  content: "ﺩ";
}

.isax-search-status-13:before {
  content: "ﺪ";
}

.isax-search-zoom-in3:before {
  content: "ﺫ";
}

.isax-search-zoom-in-13:before {
  content: "ﺬ";
}

.isax-search-zoom-out3:before {
  content: "ﺭ";
}

.isax-search-zoom-out-13:before {
  content: "ﺮ";
}

.isax-security3:before {
  content: "ﺯ";
}

.isax-security-card3:before {
  content: "ﺰ";
}

.isax-security-safe3:before {
  content: "ﺱ";
}

.isax-security-time3:before {
  content: "ﺲ";
}

.isax-security-user3:before {
  content: "ﺳ";
}

.isax-send3:before {
  content: "ﺴ";
}

.isax-send-13:before {
  content: "ﺵ";
}

.isax-send-23:before {
  content: "ﺶ";
}

.isax-send-sqaure-23:before {
  content: "ﺷ";
}

.isax-send-square3:before {
  content: "ﺸ";
}

.isax-setting3:before {
  content: "ﺹ";
}

.isax-setting-23:before {
  content: "ﺺ";
}

.isax-setting-33:before {
  content: "ﺻ";
}

.isax-setting-43:before {
  content: "ﺼ";
}

.isax-setting-53:before {
  content: "ﺽ";
}

.isax-settings3:before {
  content: "ﺾ";
}

.isax-shapes3:before {
  content: "ﺿ";
}

.isax-shapes-13:before {
  content: "ﻀ";
}

.isax-share3:before {
  content: "ﻁ";
}

.isax-shield2:before {
  content: "ﻂ";
}

.isax-shield-cross3:before {
  content: "ﻃ";
}

.isax-shield-search3:before {
  content: "ﻄ";
}

.isax-shield-security1:before {
  content: "ﻅ";
}

.isax-shield-slash3:before {
  content: "ﻆ";
}

.isax-shield-tick3:before {
  content: "ﻇ";
}

.isax-ship3:before {
  content: "ﻈ";
}

.isax-shop3:before {
  content: "ﻉ";
}

.isax-shop-add3:before {
  content: "ﻊ";
}

.isax-shopping-bag3:before {
  content: "ﻋ";
}

.isax-shopping-cart3:before {
  content: "ﻌ";
}

.isax-shop-remove3:before {
  content: "ﻍ";
}

.isax-shuffle3:before {
  content: "ﻎ";
}

.isax-sidebar-bottom3:before {
  content: "ﻏ";
}

.isax-sidebar-left3:before {
  content: "ﻐ";
}

.isax-sidebar-right3:before {
  content: "ﻑ";
}

.isax-sidebar-top3:before {
  content: "ﻒ";
}

.isax-signpost3:before {
  content: "ﻓ";
}

.isax-simcard3:before {
  content: "ﻔ";
}

.isax-simcard-13:before {
  content: "ﻕ";
}

.isax-simcard-23:before {
  content: "ﻖ";
}

.isax-size3:before {
  content: "ﻗ";
}

.isax-slash3:before {
  content: "ﻘ";
}

.isax-slider3:before {
  content: "ﻙ";
}

.isax-slider-horizontal3:before {
  content: "ﻚ";
}

.isax-slider-horizontal-13:before {
  content: "ﻛ";
}

.isax-slider-vertical3:before {
  content: "ﻜ";
}

.isax-slider-vertical-13:before {
  content: "ﻝ";
}

.isax-smallcaps3:before {
  content: "ﻞ";
}

.isax-smart-car3:before {
  content: "ﻟ";
}

.isax-smart-home3:before {
  content: "ﻠ";
}

.isax-smileys3:before {
  content: "ﻡ";
}

.isax-sms3:before {
  content: "ﻢ";
}

.isax-sms-edit3:before {
  content: "ﻣ";
}

.isax-sms-notification3:before {
  content: "ﻤ";
}

.isax-sms-search3:before {
  content: "ﻥ";
}

.isax-sms-star3:before {
  content: "ﻦ";
}

.isax-sms-tracking3:before {
  content: "ﻧ";
}

.isax-sort3:before {
  content: "ﻨ";
}

.isax-sound3:before {
  content: "ﻩ";
}

.isax-speaker3:before {
  content: "ﻪ";
}

.isax-speedometer3:before {
  content: "ﻫ";
}

.isax-star3:before {
  content: "ﻬ";
}

.isax-star-13:before {
  content: "ﻭ";
}

.isax-star-slash3:before {
  content: "ﻮ";
}

.isax-status3:before {
  content: "ﻯ";
}

.isax-status-up3:before {
  content: "ﻰ";
}

.isax-sticker3:before {
  content: "ﻱ";
}

.isax-stickynote3:before {
  content: "ﻲ";
}

.isax-stop3:before {
  content: "ﻳ";
}

.isax-stop-circle3:before {
  content: "ﻴ";
}

.isax-story3:before {
  content: "ﻵ";
}

.isax-strongbox3:before {
  content: "ﻶ";
}

.isax-strongbox-23:before {
  content: "ﻷ";
}

.isax-subtitle3:before {
  content: "ﻸ";
}

.isax-sun3:before {
  content: "ﻹ";
}

.isax-sun-13:before {
  content: "ﻺ";
}

.isax-sun-fog3:before {
  content: "ﻻ";
}

.isax-tag3:before {
  content: "ﻼ";
}

.isax-tag-23:before {
  content: "﻽";
}

.isax-tag-cross3:before {
  content: "﻾";
}

.isax-tag-right3:before {
  content: "";
}

.isax-tag-user3:before {
  content: "＀";
}

.isax-task3:before {
  content: "！";
}

.isax-task-square3:before {
  content: "＂";
}

.isax-teacher3:before {
  content: "＃";
}

.isax-text3:before {
  content: "＄";
}

.isax-textalign-center3:before {
  content: "％";
}

.isax-textalign-justifycenter3:before {
  content: "＆";
}

.isax-textalign-justifyleft3:before {
  content: "＇";
}

.isax-textalign-justifyright3:before {
  content: "（";
}

.isax-textalign-left3:before {
  content: "）";
}

.isax-textalign-right3:before {
  content: "＊";
}

.isax-text-block3:before {
  content: "＋";
}

.isax-text-bold3:before {
  content: "，";
}

.isax-text-italic3:before {
  content: "－";
}

.isax-text-underline3:before {
  content: "．";
}

.isax-tick-circle3:before {
  content: "／";
}

.isax-ticket3:before {
  content: "０";
}

.isax-ticket-23:before {
  content: "１";
}

.isax-ticket-discount3:before {
  content: "２";
}

.isax-ticket-expired3:before {
  content: "３";
}

.isax-ticket-star3:before {
  content: "４";
}

.isax-tick-square3:before {
  content: "５";
}

.isax-timer3:before {
  content: "６";
}

.isax-timer-13:before {
  content: "７";
}

.isax-timer-pause3:before {
  content: "８";
}

.isax-timer-start3:before {
  content: "９";
}

.isax-toggle-off3:before {
  content: "：";
}

.isax-toggle-off-circle3:before {
  content: "；";
}

.isax-toggle-on3:before {
  content: "＜";
}

.isax-toggle-on-circle3:before {
  content: "＝";
}

.isax-trade3:before {
  content: "＞";
}

.isax-transaction-minus3:before {
  content: "？";
}

.isax-translate3:before {
  content: "＠";
}

.isax-trash3:before {
  content: "Ａ";
}

.isax-tree3:before {
  content: "Ｂ";
}

.isax-trend-down3:before {
  content: "Ｃ";
}

.isax-trend-up3:before {
  content: "Ｄ";
}

.isax-triangle3:before {
  content: "Ｅ";
}

.isax-truck2:before {
  content: "Ｆ";
}

.isax-truck-fast2:before {
  content: "Ｇ";
}

.isax-truck-tick3:before {
  content: "Ｈ";
}

.isax-trush-square3:before {
  content: "Ｉ";
}

.isax-undo3:before {
  content: "Ｊ";
}

.isax-unlimited3:before {
  content: "Ｋ";
}

.isax-unlock3:before {
  content: "Ｌ";
}

.isax-user3:before {
  content: "Ｍ";
}

.isax-user-add3:before {
  content: "Ｎ";
}

.isax-user-cirlce-add3:before {
  content: "Ｏ";
}

.isax-user-edit3:before {
  content: "Ｐ";
}

.isax-user-minus3:before {
  content: "Ｑ";
}

.isax-user-octagon3:before {
  content: "Ｒ";
}

.isax-user-remove3:before {
  content: "Ｓ";
}

.isax-user-search3:before {
  content: "Ｔ";
}

.isax-user-square3:before {
  content: "Ｕ";
}

.isax-user-tag3:before {
  content: "Ｖ";
}

.isax-user-tick3:before {
  content: "Ｗ";
}

.isax-verify3:before {
  content: "Ｘ";
}

.isax-video3:before {
  content: "Ｙ";
}

.isax-video-add3:before {
  content: "Ｚ";
}

.isax-video-circle3:before {
  content: "［";
}

.isax-video-horizontal3:before {
  content: "＼";
}

.isax-video-octagon3:before {
  content: "］";
}

.isax-video-play3:before {
  content: "＾";
}

.isax-video-remove3:before {
  content: "＿";
}

.isax-video-slash3:before {
  content: "｀";
}

.isax-video-square3:before {
  content: "ａ";
}

.isax-video-tick3:before {
  content: "ｂ";
}

.isax-video-time3:before {
  content: "ｃ";
}

.isax-video-vertical3:before {
  content: "ｄ";
}

.isax-voice-cricle3:before {
  content: "ｅ";
}

.isax-voice-square3:before {
  content: "ｆ";
}

.isax-volume:before {
  content: "ｇ";
}

.isax-volume-cross3:before {
  content: "ｈ";
}

.isax-volume-high3:before {
  content: "ｉ";
}

.isax-volume-low3:before {
  content: "ｊ";
}

.isax-volume-low-13:before {
  content: "ｋ";
}

.isax-volume-mute3:before {
  content: "ｌ";
}

.isax-volume-slash3:before {
  content: "ｍ";
}

.isax-volume-up3:before {
  content: "ｎ";
}

.isax-wallet3:before {
  content: "ｏ";
}

.isax-wallet-13:before {
  content: "ｐ";
}

.isax-wallet-23:before {
  content: "ｑ";
}

.isax-wallet-33:before {
  content: "ｒ";
}

.isax-wallet-add3:before {
  content: "ｓ";
}

.isax-wallet-add-13:before {
  content: "ｔ";
}

.isax-wallet-add-2:before {
  content: "ｕ";
}

.isax-wallet-check3:before {
  content: "ｖ";
}

.isax-wallet-minus3:before {
  content: "ｗ";
}

.isax-wallet-money3:before {
  content: "ｘ";
}

.isax-wallet-remove3:before {
  content: "ｙ";
}

.isax-wallet-search3:before {
  content: "ｚ";
}

.isax-warning-23:before {
  content: "｛";
}

.isax-watch3:before {
  content: "｜";
}

.isax-watch-status3:before {
  content: "｝";
}

.isax-weight3:before {
  content: "～";
}

.isax-weight-13:before {
  content: "｟";
}

.isax-wifi3:before {
  content: "｠";
}

.isax-wifi-square3:before {
  content: "｡";
}

.isax-wind3:before {
  content: "｢";
}

.isax-wind-23:before {
  content: "｣";
}

.isax-woman3:before {
  content: "､";
}

.isax-d-cube-scan4:before {
  content: "･";
}

.isax-d-rotate4:before {
  content: "ｦ";
}

.isax-d-square4:before {
  content: "ｧ";
}

.isax-square4:before {
  content: "ｨ";
}

.isax-support4:before {
  content: "ｩ";
}

.isax-activity4:before {
  content: "ｪ";
}

.isax-add4:before {
  content: "ｫ";
}

.isax-add-circle4:before {
  content: "ｬ";
}

.isax-additem4:before {
  content: "ｭ";
}

.isax-add-square4:before {
  content: "ｮ";
}

.isax-airdrop4:before {
  content: "ｯ";
}

.isax-airplane4:before {
  content: "ｰ";
}

.isax-airplane-square4:before {
  content: "ｱ";
}

.isax-airpod4:before {
  content: "ｲ";
}

.isax-airpods4:before {
  content: "ｳ";
}

.isax-alarm4:before {
  content: "ｴ";
}

.isax-align-bottom4:before {
  content: "ｵ";
}

.isax-align-horizontally4:before {
  content: "ｶ";
}

.isax-align-left4:before {
  content: "ｷ";
}

.isax-align-right4:before {
  content: "ｸ";
}

.isax-align-vertically4:before {
  content: "ｹ";
}

.isax-aquarius4:before {
  content: "ｺ";
}

.isax-archive4:before {
  content: "ｻ";
}

.isax-archive-14:before {
  content: "ｼ";
}

.isax-archive-23:before {
  content: "ｽ";
}

.isax-archive-add4:before {
  content: "ｾ";
}

.isax-archive-book4:before {
  content: "ｿ";
}

.isax-archive-minus4:before {
  content: "ﾀ";
}

.isax-archive-slash4:before {
  content: "ﾁ";
}

.isax-archive-tick4:before {
  content: "ﾂ";
}

.isax-arrange-circle4:before {
  content: "ﾃ";
}

.isax-arrange-circle-24:before {
  content: "ﾄ";
}

.isax-arrange-square4:before {
  content: "ﾅ";
}

.isax-arrange-square-24:before {
  content: "ﾆ";
}

.isax-arrow4:before {
  content: "ﾇ";
}

.isax-arrow-24:before {
  content: "ﾈ";
}

.isax-arrow-34:before {
  content: "ﾉ";
}

.isax-arrow-bottom4:before {
  content: "ﾊ";
}

.isax-arrow-circle-down4:before {
  content: "ﾋ";
}

.isax-arrow-circle-left4:before {
  content: "ﾌ";
}

.isax-arrow-circle-right4:before {
  content: "ﾍ";
}

.isax-arrow-circle-up3:before {
  content: "ﾎ";
}

.isax-arrow-down4:before {
  content: "ﾏ";
}

.isax-arrow-down-14:before {
  content: "ﾐ";
}

.isax-arrow-down-24:before {
  content: "ﾑ";
}

.isax-arrow-left4:before {
  content: "ﾒ";
}

.isax-arrow-left-14:before {
  content: "ﾓ";
}

.isax-arrow-left-24:before {
  content: "ﾔ";
}

.isax-arrow-left-34:before {
  content: "ﾕ";
}

.isax-arrow-right4:before {
  content: "ﾖ";
}

.isax-arrow-right-14:before {
  content: "ﾗ";
}

.isax-arrow-right-24:before {
  content: "ﾘ";
}

.isax-arrow-right-34:before {
  content: "ﾙ";
}

.isax-arrow-right-41:before {
  content: "ﾚ";
}

.isax-arrow-square4:before {
  content: "ﾛ";
}

.isax-arrow-square-down4:before {
  content: "ﾜ";
}

.isax-arrow-square-left4:before {
  content: "ﾝ";
}

.isax-arrow-square-up4:before {
  content: "ﾞ";
}

.isax-arrow-swap3:before {
  content: "ﾟ";
}

.isax-arrow-swap-horizontal4:before {
  content: "ﾠ";
}

.isax-arrow-up4:before {
  content: "ﾡ";
}

.isax-arrow-up-14:before {
  content: "ﾢ";
}

.isax-arrow-up-24:before {
  content: "ﾣ";
}

.isax-arrow-up-34:before {
  content: "ﾤ";
}

.isax-attach-circle4:before {
  content: "ﾥ";
}

.isax-attach-square4:before {
  content: "ﾦ";
}

.isax-audio-square4:before {
  content: "ﾧ";
}

.isax-autobrightness4:before {
  content: "ﾨ";
}

.isax-award4:before {
  content: "ﾩ";
}

.isax-back-square4:before {
  content: "ﾪ";
}

.isax-backward4:before {
  content: "ﾫ";
}

.isax-backward-5-seconds4:before {
  content: "ﾬ";
}

.isax-backward-10-seconds4:before {
  content: "ﾭ";
}

.isax-backward-15-seconds4:before {
  content: "ﾮ";
}

.isax-backward-item4:before {
  content: "ﾯ";
}

.isax-bag4:before {
  content: "ﾰ";
}

.isax-bag-24:before {
  content: "ﾱ";
}

.isax-bag-cross4:before {
  content: "ﾲ";
}

.isax-bag-cross-14:before {
  content: "ﾳ";
}

.isax-bag-happy4:before {
  content: "ﾴ";
}

.isax-bag-tick4:before {
  content: "ﾵ";
}

.isax-bag-tick-24:before {
  content: "ﾶ";
}

.isax-bag-timer4:before {
  content: "ﾷ";
}

.isax-bank4:before {
  content: "ﾸ";
}

.isax-barcode4:before {
  content: "ﾹ";
}

.isax-battery-3full4:before {
  content: "ﾺ";
}

.isax-battery-charging4:before {
  content: "ﾻ";
}

.isax-battery-disable4:before {
  content: "ﾼ";
}

.isax-battery-empty4:before {
  content: "ﾽ";
}

.isax-battery-empty-14:before {
  content: "ﾾ";
}

.isax-battery-full4:before {
  content: "﾿";
}

.isax-bezier4:before {
  content: "￀";
}

.isax-bill4:before {
  content: "￁";
}

.isax-bitcoin-card4:before {
  content: "ￂ";
}

.isax-bitcoin-convert4:before {
  content: "ￃ";
}

.isax-bitcoin-refresh4:before {
  content: "ￄ";
}

.isax-blend4:before {
  content: "ￅ";
}

.isax-blend-24:before {
  content: "ￆ";
}

.isax-bluetooth4:before {
  content: "ￇ";
}

.isax-bluetooth-24:before {
  content: "￈";
}

.isax-bluetooth-circle4:before {
  content: "￉";
}

.isax-bluetooth-rectangle4:before {
  content: "ￊ";
}

.isax-blur4:before {
  content: "ￋ";
}

.isax-book4:before {
  content: "ￌ";
}

.isax-book-14:before {
  content: "ￍ";
}

.isax-bookmark4:before {
  content: "ￎ";
}

.isax-bookmark-24:before {
  content: "ￏ";
}

.isax-book-saved4:before {
  content: "￐";
}

.isax-book-square4:before {
  content: "￑";
}

.isax-box4:before {
  content: "ￒ";
}

.isax-box-14:before {
  content: "ￓ";
}

.isax-box-24:before {
  content: "ￔ";
}

.isax-box-add4:before {
  content: "ￕ";
}

.isax-box-remove4:before {
  content: "ￖ";
}

.isax-box-search4:before {
  content: "ￗ";
}

.isax-box-tick4:before {
  content: "￘";
}

.isax-box-time4:before {
  content: "￙";
}

.isax-briefcase4:before {
  content: "ￚ";
}

.isax-brifecase-cross4:before {
  content: "ￛ";
}

.isax-brifecase-tick4:before {
  content: "ￜ";
}

.isax-brifecase-timer4:before {
  content: "￝";
}

.isax-broom4:before {
  content: "￞";
}

.isax-brush4:before {
  content: "￟";
}

.isax-brush-14:before {
  content: "￠";
}

.isax-brush-24:before {
  content: "￡";
}

.isax-brush-34:before {
  content: "￢";
}

.isax-brush-44:before {
  content: "￣";
}

.isax-bubble4:before {
  content: "￤";
}

.isax-bucket4:before {
  content: "￥";
}

.isax-bucket-circle4:before {
  content: "￦";
}

.isax-bucket-square4:before {
  content: "￧";
}

.isax-building4:before {
  content: "￨";
}

.isax-building-34:before {
  content: "￩";
}

.isax-building-44:before {
  content: "￪";
}

.isax-buildings4:before {
  content: "￫";
}

.isax-buildings-24:before {
  content: "￬";
}

.isax-buliding4:before {
  content: "￭";
}

.isax-bus4:before {
  content: "￮";
}

.isax-buy-crypto4:before {
  content: "￯";
}

.isax-cake4:before {
  content: "￰";
}

.isax-calculator4:before {
  content: "￱";
}

.isax-calendar4:before {
  content: "￲";
}

.isax-calendar-14:before {
  content: "￳";
}

.isax-calendar-24:before {
  content: "￴";
}

.isax-calendar-add4:before {
  content: "￵";
}

.isax-calendar-circle4:before {
  content: "￶";
}

.isax-calendar-edit4:before {
  content: "￷";
}

.isax-calendar-remove4:before {
  content: "￸";
}

.isax-calendar-search4:before {
  content: "";
}

.isax-calendar-tick4:before {
  content: "";
}

.isax-call4:before {
  content: "";
}

.isax-call-add4:before {
  content: "";
}

.isax-call-calling4:before {
  content: "�";
}

.isax-call-incoming4:before {
  content: "￾";
}

.isax-call-minus4:before {
  content: "�";
}

.isax-call-outgoing4:before {
  content: "\1";
}

.isax-call-received4:before {
  content: "\2";
}

.isax-call-remove4:before {
  content: "\3";
}

.isax-call-slash4:before {
  content: "\4";
}

.isax-camera4:before {
  content: "\5";
}

.isax-camera-slash4:before {
  content: "\6";
}

.isax-candle4:before {
  content: "\7";
}

.isax-candle-24:before {
  content: "\8";
}

.isax-car4:before {
  content: "	";
}

.isax-card4:before {
  content: "\a";
}

.isax-card-add4:before {
  content: "\b";
}

.isax-card-coin4:before {
  content: "\c";
}

.isax-card-edit4:before {
  content: "\d";
}

.isax-card-pos4:before {
  content: "\e";
}

.isax-card-receive4:before {
  content: "\f";
}

.isax-card-remove4:before {
  content: "\10";
}

.isax-card-remove-14:before {
  content: "\11";
}

.isax-cards4:before {
  content: "\12";
}

.isax-card-send4:before {
  content: "\13";
}

.isax-card-slash4:before {
  content: "\14";
}

.isax-card-tick4:before {
  content: "\15";
}

.isax-card-tick-14:before {
  content: "\16";
}

.isax-category4:before {
  content: "\17";
}

.isax-category-24:before {
  content: "\18";
}

.isax-cd4:before {
  content: "\19";
}

.isax-chart4:before {
  content: "\1a";
}

.isax-chart-14:before {
  content: "\1b";
}

.isax-chart-25:before {
  content: "\1c";
}

.isax-chart-34:before {
  content: "\1d";
}

.isax-chart-214:before {
  content: "\1e";
}

.isax-chart-fail2:before {
  content: "\1f";
}

.isax-chart-square4:before {
  content: " ";
}

.isax-chart-success4:before {
  content: "!";
}

.isax-check4:before {
  content: '"';
}

.isax-chrome4:before {
  content: "#";
}

.isax-clipboard4:before {
  content: "$";
}

.isax-clipboard-close4:before {
  content: "%";
}

.isax-clipboard-export4:before {
  content: "&";
}

.isax-clipboard-import4:before {
  content: "'";
}

.isax-clipboard-text4:before {
  content: "(";
}

.isax-clipboard-tick4:before {
  content: ")";
}

.isax-clock4:before {
  content: "*";
}

.isax-clock-14:before {
  content: "+";
}

.isax-close-circle4:before {
  content: ",";
}

.isax-close-square4:before {
  content: "-";
}

.isax-cloud4:before {
  content: ".";
}

.isax-cloud-add4:before {
  content: "/";
}

.isax-cloud-change4:before {
  content: "0";
}

.isax-cloud-connection4:before {
  content: "1";
}

.isax-cloud-cross4:before {
  content: "2";
}

.isax-cloud-drizzle4:before {
  content: "3";
}

.isax-cloud-fog4:before {
  content: "4";
}

.isax-cloud-lightning4:before {
  content: "5";
}

.isax-cloud-minus4:before {
  content: "6";
}

.isax-cloud-notif4:before {
  content: "7";
}

.isax-cloud-plus4:before {
  content: "8";
}

.isax-cloud-remove4:before {
  content: "9";
}

.isax-cloud-snow4:before {
  content: ":";
}

.isax-cloud-sunny4:before {
  content: ";";
}

.isax-code4:before {
  content: "<";
}

.isax-code-14:before {
  content: "=";
}

.isax-code-circle4:before {
  content: ">";
}

.isax-coffee4:before {
  content: "?";
}

.isax-coin4:before {
  content: "@";
}

.isax-coin-14:before {
  content: "A";
}

.isax-colorfilter4:before {
  content: "B";
}

.isax-colors-square4:before {
  content: "C";
}

.isax-color-swatch4:before {
  content: "D";
}

.isax-command4:before {
  content: "E";
}

.isax-command-square4:before {
  content: "F";
}

.isax-component4:before {
  content: "G";
}

.isax-computing4:before {
  content: "H";
}

.isax-convert4:before {
  content: "I";
}

.isax-convert-3d-cube4:before {
  content: "J";
}

.isax-convert-card4:before {
  content: "K";
}

.isax-convertshape4:before {
  content: "L";
}

.isax-convertshape-24:before {
  content: "M";
}

.isax-copy4:before {
  content: "N";
}

.isax-copyright4:before {
  content: "O";
}

.isax-copy-success4:before {
  content: "P";
}

.isax-courthouse4:before {
  content: "Q";
}

.isax-cpu4:before {
  content: "R";
}

.isax-cpu-charge4:before {
  content: "S";
}

.isax-cpu-setting4:before {
  content: "T";
}

.isax-creative-commons4:before {
  content: "U";
}

.isax-crop4:before {
  content: "V";
}

.isax-crown4:before {
  content: "W";
}

.isax-crown-14:before {
  content: "X";
}

.isax-cup4:before {
  content: "Y";
}

.isax-danger4:before {
  content: "Z";
}

.isax-data4:before {
  content: "[";
}

.isax-data-24 .path1:before {
  content: "\\";
  color: rgb(41, 45, 50);
}

.isax-data-24 .path2:before {
  content: "٦";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-data-24 .path3:before {
  content: "٧";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-data-24 .path4:before {
  content: "٨";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-data-24 .path5:before {
  content: "٩";
  margin-left: -1em;
  color: rgb(255, 255, 255);
}

.isax-data-24 .path6:before {
  content: "٪";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-data-24 .path7:before {
  content: "٫";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-data-24 .path8:before {
  content: "٬";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-designtools4:before {
  content: "]";
}

.isax-device-message4:before {
  content: "^";
}

.isax-devices4:before {
  content: "_";
}

.isax-devices-13:before {
  content: "`";
}

.isax-diagram4:before {
  content: "a";
}

.isax-diamonds4:before {
  content: "b";
}

.isax-direct4:before {
  content: "c";
}

.isax-directbox-default4:before {
  content: "d";
}

.isax-directbox-notif4:before {
  content: "e";
}

.isax-directbox-receive4:before {
  content: "f";
}

.isax-directbox-send4:before {
  content: "g";
}

.isax-direct-down4:before {
  content: "h";
}

.isax-direct-inbox4:before {
  content: "i";
}

.isax-direct-left4:before {
  content: "j";
}

.isax-direct-normal4:before {
  content: "k";
}

.isax-direct-notification4:before {
  content: "l";
}

.isax-direct-right4:before {
  content: "m";
}

.isax-direct-send4:before {
  content: "n";
}

.isax-direct-up4:before {
  content: "o";
}

.isax-discount-circle4:before {
  content: "p";
}

.isax-discount-shape4:before {
  content: "q";
}

.isax-discover4:before {
  content: "r";
}

.isax-discover-13:before {
  content: "s";
}

.isax-dislike4:before {
  content: "t";
}

.isax-document4:before {
  content: "u";
}

.isax-document-14:before {
  content: "v";
}

.isax-document-cloud4:before {
  content: "w";
}

.isax-document-code4:before {
  content: "x";
}

.isax-document-code-24:before {
  content: "y";
}

.isax-document-copy4:before {
  content: "z";
}

.isax-document-download4:before {
  content: "{";
}

.isax-document-favorite4:before {
  content: "|";
}

.isax-document-filter4:before {
  content: "}";
}

.isax-document-forward4:before {
  content: "~";
}

.isax-document-like4:before {
  content: "";
}

.isax-document-normal3:before {
  content: "€";
}

.isax-document-previous4:before {
  content: "";
}

.isax-document-sketch4:before {
  content: "‚";
}

.isax-document-text4:before {
  content: "ƒ";
}

.isax-document-text-14:before {
  content: "„";
}

.isax-document-upload4:before {
  content: "…";
}

.isax-dollar-circle3:before {
  content: "†";
}

.isax-dollar-square4:before {
  content: "‡";
}

.isax-driver4:before {
  content: "ˆ";
}

.isax-driver-24:before {
  content: "‰";
}

.isax-driver-refresh4:before {
  content: "Š";
}

.isax-driving4:before {
  content: "‹";
}

.isax-edit4:before {
  content: "Œ";
}

.isax-edit-24:before {
  content: "";
}

.isax-electricity4:before {
  content: "Ž";
}

.isax-element-24:before {
  content: "";
}

.isax-element-34:before {
  content: "";
}

.isax-element-44:before {
  content: "‘";
}

.isax-element-equal4:before {
  content: "’";
}

.isax-element-plus4:before {
  content: "“";
}

.isax-emoji-happy4:before {
  content: "”";
}

.isax-emoji-normal4:before {
  content: "•";
}

.isax-emoji-sad4:before {
  content: "–";
}

.isax-empty-wallet4:before {
  content: "—";
}

.isax-empty-wallet-add4:before {
  content: "˜";
}

.isax-empty-wallet-change3:before {
  content: "™";
}

.isax-empty-wallet-remove4:before {
  content: "š";
}

.isax-empty-wallet-tick4:before {
  content: "›";
}

.isax-empty-wallet-time3:before {
  content: "œ";
}

.isax-eraser4:before {
  content: "";
}

.isax-eraser-14:before {
  content: "ž";
}

.isax-export4:before {
  content: "Ÿ";
}

.isax-export-14:before {
  content: " ";
}

.isax-export-24:before {
  content: "¡";
}

.isax-export-34:before {
  content: "¢";
}

.isax-external-drive4:before {
  content: "£";
}

.isax-eye3:before {
  content: "¤";
}

.isax-eye-slash4:before {
  content: "¥";
}

.isax-fatrows4:before {
  content: "¦";
}

.isax-favorite-chart4:before {
  content: "§";
}

.isax-filter4:before {
  content: "¨";
}

.isax-filter-add4:before {
  content: "©";
}

.isax-filter-edit4:before {
  content: "ª";
}

.isax-filter-remove4:before {
  content: "«";
}

.isax-filter-search4:before {
  content: "¬";
}

.isax-filter-square4:before {
  content: "­";
}

.isax-filter-tick4:before {
  content: "®";
}

.isax-finger-cricle4:before {
  content: "¯";
}

.isax-finger-scan4:before {
  content: "°";
}

.isax-firstline4:before {
  content: "±";
}

.isax-flag4:before {
  content: "²";
}

.isax-flag-24:before {
  content: "³";
}

.isax-flash4:before {
  content: "´";
}

.isax-flash-14:before {
  content: "µ";
}

.isax-flash-circle4:before {
  content: "¶";
}

.isax-flash-circle-14:before {
  content: "·";
}

.isax-flash-slash4:before {
  content: "¸";
}

.isax-folder4:before {
  content: "¹";
}

.isax-folder-24:before {
  content: "º";
}

.isax-folder-add4:before {
  content: "»";
}

.isax-folder-cloud4:before {
  content: "¼";
}

.isax-folder-connection4:before {
  content: "½";
}

.isax-folder-cross4:before {
  content: "¾";
}

.isax-folder-favorite4:before {
  content: "¿";
}

.isax-folder-minus4:before {
  content: "À";
}

.isax-folder-open4:before {
  content: "Á";
}

.isax-forbidden4:before {
  content: "Â";
}

.isax-forbidden-24:before {
  content: "Ã";
}

.isax-format-circle4:before {
  content: "Ä";
}

.isax-format-square4:before {
  content: "Å";
}

.isax-forward4:before {
  content: "Æ";
}

.isax-forward-5-seconds4:before {
  content: "Ç";
}

.isax-forward-10-seconds4:before {
  content: "È";
}

.isax-forward-15-seconds4:before {
  content: "É";
}

.isax-forward-item4:before {
  content: "Ê";
}

.isax-forward-square4:before {
  content: "Ë";
}

.isax-frame4:before {
  content: "Ì";
}

.isax-frame-14:before {
  content: "Í";
}

.isax-frame-24:before {
  content: "Î";
}

.isax-frame-34:before {
  content: "Ï";
}

.isax-frame-44:before {
  content: "Ð";
}

.isax-gallery4:before {
  content: "Ñ";
}

.isax-gallery-add4:before {
  content: "Ò";
}

.isax-gallery-edit4:before {
  content: "Ó";
}

.isax-gallery-export3:before {
  content: "Ô";
}

.isax-gallery-favorite4:before {
  content: "Õ";
}

.isax-gallery-import4:before {
  content: "Ö";
}

.isax-gallery-remove4:before {
  content: "×";
}

.isax-gallery-slash4:before {
  content: "Ø";
}

.isax-gallery-tick4:before {
  content: "Ù";
}

.isax-game4:before {
  content: "Ú";
}

.isax-gameboy4:before {
  content: "Û";
}

.isax-gas-station3:before {
  content: "Ü";
}

.isax-gemini4:before {
  content: "Ý";
}

.isax-gemini-24:before {
  content: "Þ";
}

.isax-ghost4:before {
  content: "ß";
}

.isax-gift4:before {
  content: "à";
}

.isax-glass4:before {
  content: "á";
}

.isax-glass-14:before {
  content: "â";
}

.isax-global4:before {
  content: "ã";
}

.isax-global-edit4:before {
  content: "ä";
}

.isax-global-refresh4:before {
  content: "å";
}

.isax-global-search4:before {
  content: "æ";
}

.isax-gps4:before {
  content: "ç";
}

.isax-gps-slash4:before {
  content: "è";
}

.isax-grammerly4:before {
  content: "é";
}

.isax-graph4:before {
  content: "ê";
}

.isax-grid-14:before {
  content: "ë";
}

.isax-grid-24:before {
  content: "ì";
}

.isax-grid-34:before {
  content: "í";
}

.isax-grid-44:before {
  content: "î";
}

.isax-grid-54:before {
  content: "ï";
}

.isax-grid-64:before {
  content: "ð";
}

.isax-grid-74:before {
  content: "ñ";
}

.isax-grid-84:before {
  content: "ò";
}

.isax-grid-94:before {
  content: "ó";
}

.isax-grid-edit4:before {
  content: "ô";
}

.isax-grid-eraser4:before {
  content: "õ";
}

.isax-grid-lock4:before {
  content: "ö";
}

.isax-happyemoji4:before {
  content: "÷";
}

.isax-hashtag4:before {
  content: "ø";
}

.isax-hashtag-14:before {
  content: "ù";
}

.isax-hashtag-down4:before {
  content: "ú";
}

.isax-hashtag-up4:before {
  content: "û";
}

.isax-headphone4:before {
  content: "ü";
}

.isax-headphones4:before {
  content: "ý";
}

.isax-health4:before {
  content: "þ";
}

.isax-heart4:before {
  content: "ÿ";
}

.isax-heart-add4:before {
  content: "Ā";
}

.isax-heart-circle4:before {
  content: "ā";
}

.isax-heart-edit4:before {
  content: "Ă";
}

.isax-heart-remove4:before {
  content: "ă";
}

.isax-heart-search4:before {
  content: "Ą";
}

.isax-heart-slash4:before {
  content: "ą";
}

.isax-heart-tick4:before {
  content: "Ć";
}

.isax-hierarchy4:before {
  content: "ć";
}

.isax-hierarchy-24:before {
  content: "Ĉ";
}

.isax-hierarchy-34:before {
  content: "ĉ";
}

.isax-hierarchy-square4:before {
  content: "Ċ";
}

.isax-hierarchy-square-24:before {
  content: "ċ";
}

.isax-hierarchy-square-34:before {
  content: "Č";
}

.isax-home4:before {
  content: "č";
}

.isax-home-14:before {
  content: "Ď";
}

.isax-home-24:before {
  content: "ď";
}

.isax-home-hashtag4:before {
  content: "Đ";
}

.isax-home-trend-down4:before {
  content: "đ";
}

.isax-home-trend-up4:before {
  content: "Ē";
}

.isax-home-wifi4:before {
  content: "ē";
}

.isax-hospital4:before {
  content: "Ĕ";
}

.isax-house4:before {
  content: "ĕ";
}

.isax-house-24:before {
  content: "Ė";
}

.isax-icon3:before {
  content: "ė";
}

.isax-image4:before {
  content: "Ę";
}

.isax-import4:before {
  content: "ę";
}

.isax-import-14:before {
  content: "Ě";
}

.isax-import-24:before {
  content: "ě";
}

.isax-info-circle4:before {
  content: "Ĝ";
}

.isax-information4:before {
  content: "ĝ";
}

.isax-instagram4:before {
  content: "Ğ";
}

.isax-judge4:before {
  content: "ğ";
}

.isax-kanban3:before {
  content: "Ġ";
}

.isax-key4:before {
  content: "ġ";
}

.isax-keyboard4:before {
  content: "Ģ";
}

.isax-keyboard-open4:before {
  content: "ģ";
}

.isax-key-square4:before {
  content: "Ĥ";
}

.isax-lamp4:before {
  content: "ĥ";
}

.isax-lamp-14:before {
  content: "Ħ";
}

.isax-lamp-charge4:before {
  content: "ħ";
}

.isax-lamp-on4:before {
  content: "Ĩ";
}

.isax-lamp-slash4:before {
  content: "ĩ";
}

.isax-language-circle4:before {
  content: "Ī";
}

.isax-language-square4:before {
  content: "ī";
}

.isax-layer4:before {
  content: "Ĭ";
}

.isax-level4:before {
  content: "ĭ";
}

.isax-lifebuoy4:before {
  content: "Į";
}

.isax-like4:before {
  content: "į";
}

.isax-like-14:before {
  content: "İ";
}

.isax-like-dislike4:before {
  content: "ı";
}

.isax-like-shapes4:before {
  content: "IJ";
}

.isax-like-tag4:before {
  content: "ij";
}

.isax-link4:before {
  content: "Ĵ";
}

.isax-link-14:before {
  content: "ĵ";
}

.isax-link-25:before {
  content: "Ķ";
}

.isax-link-214:before {
  content: "ķ";
}

.isax-link-circle4:before {
  content: "ĸ";
}

.isax-link-square4:before {
  content: "Ĺ";
}

.isax-location4:before {
  content: "ĺ";
}

.isax-location-add4:before {
  content: "Ļ";
}

.isax-location-cross4:before {
  content: "ļ";
}

.isax-location-minus4:before {
  content: "Ľ";
}

.isax-location-slash4:before {
  content: "ľ";
}

.isax-location-tick4:before {
  content: "Ŀ";
}

.isax-lock4:before {
  content: "ŀ";
}

.isax-lock-14:before {
  content: "Ł";
}

.isax-lock-circle4:before {
  content: "ł";
}

.isax-lock-slash4:before {
  content: "Ń";
}

.isax-login4:before {
  content: "ń";
}

.isax-login-14:before {
  content: "Ņ";
}

.isax-logout4:before {
  content: "ņ";
}

.isax-logout-14:before {
  content: "Ň";
}

.isax-lovely4:before {
  content: "ň";
}

.isax-magicpen4:before {
  content: "ʼn";
}

.isax-magic-star4:before {
  content: "Ŋ";
}

.isax-main-component4:before {
  content: "ŋ";
}

.isax-man4:before {
  content: "Ō";
}

.isax-map4:before {
  content: "ō";
}

.isax-map-14:before {
  content: "Ŏ";
}

.isax-mask4:before {
  content: "ŏ";
}

.isax-mask-14:before {
  content: "Ő";
}

.isax-mask-24:before {
  content: "ő";
}

.isax-math4:before {
  content: "Œ";
}

.isax-maximize4:before {
  content: "œ";
}

.isax-maximize-14:before {
  content: "Ŕ";
}

.isax-maximize-25:before {
  content: "ŕ";
}

.isax-maximize-34:before {
  content: "Ŗ";
}

.isax-maximize-44:before {
  content: "ŗ";
}

.isax-maximize-214:before {
  content: "Ř";
}

.isax-maximize-circle3:before {
  content: "ř";
}

.isax-medal4:before {
  content: "Ś";
}

.isax-medal-star4:before {
  content: "ś";
}

.isax-menu4:before {
  content: "Ŝ";
}

.isax-menu-14:before {
  content: "ŝ";
}

.isax-menu-board4:before {
  content: "Ş";
}

.isax-message4:before {
  content: "ş";
}

.isax-message-24:before {
  content: "Š";
}

.isax-message-add4:before {
  content: "š";
}

.isax-message-add-14:before {
  content: "Ţ";
}

.isax-message-circle4:before {
  content: "ţ";
}

.isax-message-edit4:before {
  content: "Ť";
}

.isax-message-favorite4:before {
  content: "ť";
}

.isax-message-minus4:before {
  content: "Ŧ";
}

.isax-message-notif4:before {
  content: "ŧ";
}

.isax-message-programming4:before {
  content: "Ũ";
}

.isax-message-question4:before {
  content: "ũ";
}

.isax-message-remove4:before {
  content: "Ū";
}

.isax-messages4:before {
  content: "ū";
}

.isax-messages-14:before {
  content: "Ŭ";
}

.isax-messages-24:before {
  content: "ŭ";
}

.isax-messages-34:before {
  content: "Ů";
}

.isax-message-search4:before {
  content: "ů";
}

.isax-message-square4:before {
  content: "Ű";
}

.isax-message-text4:before {
  content: "ű";
}

.isax-message-text-14:before {
  content: "Ų";
}

.isax-message-tick4:before {
  content: "ų";
}

.isax-message-time4:before {
  content: "Ŵ";
}

.isax-microphone4:before {
  content: "ŵ";
}

.isax-microphone-24:before {
  content: "Ŷ";
}

.isax-microphone-slash4:before {
  content: "ŷ";
}

.isax-microphone-slash-14:before {
  content: "Ÿ";
}

.isax-microscope4:before {
  content: "Ź";
}

.isax-milk4:before {
  content: "ź";
}

.isax-mini-music-sqaure4:before {
  content: "Ż";
}

.isax-minus4:before {
  content: "ż";
}

.isax-minus-cirlce4:before {
  content: "Ž";
}

.isax-minus-square4:before {
  content: "ž";
}

.isax-mirror4:before {
  content: "ſ";
}

.isax-mirroring-screen4:before {
  content: "ƀ";
}

.isax-mobile4:before {
  content: "Ɓ";
}

.isax-mobile-programming4:before {
  content: "Ƃ";
}

.isax-money4:before {
  content: "ƃ";
}

.isax-money-24:before {
  content: "Ƅ";
}

.isax-money-34:before {
  content: "ƅ";
}

.isax-money-44:before {
  content: "Ɔ";
}

.isax-money-add4:before {
  content: "Ƈ";
}

.isax-money-change4:before {
  content: "ƈ";
}

.isax-money-forbidden4:before {
  content: "Ɖ";
}

.isax-money-recive4:before {
  content: "Ɗ";
}

.isax-money-remove4:before {
  content: "Ƌ";
}

.isax-moneys4:before {
  content: "ƌ";
}

.isax-money-send4:before {
  content: "ƍ";
}

.isax-money-tick4:before {
  content: "Ǝ";
}

.isax-money-time4:before {
  content: "Ə";
}

.isax-monitor4:before {
  content: "Ɛ";
}

.isax-monitor-mobbile4:before {
  content: "Ƒ";
}

.isax-monitor-recorder4:before {
  content: "ƒ";
}

.isax-moon4:before {
  content: "Ɠ";
}

.isax-more4:before {
  content: "Ɣ";
}

.isax-more-24:before {
  content: "ƕ";
}

.isax-more-circle4:before {
  content: "Ɩ";
}

.isax-more-square4:before {
  content: "Ɨ";
}

.isax-mouse4:before {
  content: "Ƙ";
}

.isax-mouse-14:before {
  content: "ƙ";
}

.isax-mouse-circle4:before {
  content: "ƚ";
}

.isax-mouse-square4:before {
  content: "ƛ";
}

.isax-music4:before {
  content: "Ɯ";
}

.isax-music-circle4:before {
  content: "Ɲ";
}

.isax-music-dashboard4:before {
  content: "ƞ";
}

.isax-music-filter4:before {
  content: "Ɵ";
}

.isax-music-library-24:before {
  content: "Ơ";
}

.isax-musicnote4:before {
  content: "ơ";
}

.isax-music-play4:before {
  content: "Ƣ";
}

.isax-music-playlist4:before {
  content: "ƣ";
}

.isax-music-square4:before {
  content: "Ƥ";
}

.isax-music-square-add4:before {
  content: "ƥ";
}

.isax-music-square-remove4:before {
  content: "Ʀ";
}

.isax-music-square-search4:before {
  content: "Ƨ";
}

.isax-next4:before {
  content: "ƨ";
}

.isax-note4:before {
  content: "Ʃ";
}

.isax-note-14:before {
  content: "ƪ";
}

.isax-note-25:before {
  content: "ƫ";
}

.isax-note-214:before {
  content: "Ƭ";
}

.isax-note-add4:before {
  content: "ƭ";
}

.isax-note-favorite4:before {
  content: "Ʈ";
}

.isax-note-remove4:before {
  content: "Ư";
}

.isax-note-square4:before {
  content: "ư";
}

.isax-note-text4:before {
  content: "Ʊ";
}

.isax-notification4:before {
  content: "Ʋ";
}

.isax-notification-14:before {
  content: "Ƴ";
}

.isax-notification-bing4:before {
  content: "ƴ";
}

.isax-notification-circle4:before {
  content: "Ƶ";
}

.isax-notification-favorite4:before {
  content: "ƶ";
}

.isax-notification-status4:before {
  content: "Ʒ";
}

.isax-omega-circle4:before {
  content: "Ƹ";
}

.isax-omega-square4:before {
  content: "ƹ";
}

.isax-paintbucket4:before {
  content: "ƺ";
}

.isax-paperclip4:before {
  content: "ƻ";
}

.isax-paperclip-24:before {
  content: "Ƽ";
}

.isax-password-check4:before {
  content: "ƽ";
}

.isax-path4:before {
  content: "ƾ";
}

.isax-path-24:before {
  content: "ƿ";
}

.isax-path-square4:before {
  content: "ǀ";
}

.isax-pause4:before {
  content: "ǁ";
}

.isax-pause-circle4:before {
  content: "ǂ";
}

.isax-pen-add4:before {
  content: "ǃ";
}

.isax-pen-close4:before {
  content: "DŽ";
}

.isax-pen-remove4:before {
  content: "Dž";
}

.isax-pen-tool4:before {
  content: "dž";
}

.isax-pen-tool-24:before {
  content: "LJ";
}

.isax-people4:before {
  content: "Lj";
}

.isax-percentage-circle4:before {
  content: "lj";
}

.isax-percentage-square4:before {
  content: "NJ";
}

.isax-personalcard4:before {
  content: "Nj";
}

.isax-pet4:before {
  content: "nj";
}

.isax-pharagraphspacing4:before {
  content: "Ǎ";
}

.isax-picture-frame4:before {
  content: "ǎ";
}

.isax-play4:before {
  content: "Ǐ";
}

.isax-play-add4:before {
  content: "ǐ";
}

.isax-play-circle4:before {
  content: "Ǒ";
}

.isax-play-cricle4:before {
  content: "ǒ";
}

.isax-play-remove4:before {
  content: "Ǔ";
}

.isax-presention-chart4:before {
  content: "ǔ";
}

.isax-previous4:before {
  content: "Ǖ";
}

.isax-printer4:before {
  content: "ǖ";
}

.isax-printer-slash4:before {
  content: "Ǘ";
}

.isax-profile-2user4:before {
  content: "ǘ";
}

.isax-profile-add4:before {
  content: "Ǚ";
}

.isax-profile-circle4:before {
  content: "ǚ";
}

.isax-profile-delete4:before {
  content: "Ǜ";
}

.isax-profile-remove4:before {
  content: "ǜ";
}

.isax-profile-tick4:before {
  content: "ǝ";
}

.isax-programming-arrow4:before {
  content: "Ǟ";
}

.isax-programming-arrows4:before {
  content: "ǟ";
}

.isax-quote-down4:before {
  content: "Ǡ";
}

.isax-quote-down-circle4:before {
  content: "ǡ";
}

.isax-quote-down-square4:before {
  content: "Ǣ";
}

.isax-quote-up4:before {
  content: "ǣ";
}

.isax-quote-up-circle4:before {
  content: "Ǥ";
}

.isax-quote-up-square4:before {
  content: "ǥ";
}

.isax-radar4:before {
  content: "Ǧ";
}

.isax-radar-14:before {
  content: "ǧ";
}

.isax-radar-24:before {
  content: "Ǩ";
}

.isax-radio4:before {
  content: "ǩ";
}

.isax-ram4:before {
  content: "Ǫ";
}

.isax-ram-24:before {
  content: "ǫ";
}

.isax-ranking4:before {
  content: "Ǭ";
}

.isax-ranking-14:before {
  content: "ǭ";
}

.isax-receipt4:before {
  content: "Ǯ";
}

.isax-receipt-14:before {
  content: "ǯ";
}

.isax-receipt-24:before {
  content: "ǰ";
}

.isax-receipt-2-14:before {
  content: "DZ";
}

.isax-receipt-add4:before {
  content: "Dz";
}

.isax-receipt-discount4:before {
  content: "dz";
}

.isax-receipt-disscount4:before {
  content: "Ǵ";
}

.isax-receipt-edit4:before {
  content: "ǵ";
}

.isax-receipt-item4:before {
  content: "Ƕ";
}

.isax-receipt-minus4:before {
  content: "Ƿ";
}

.isax-receipt-search4:before {
  content: "Ǹ";
}

.isax-receipt-square4:before {
  content: "ǹ";
}

.isax-receipt-text4:before {
  content: "Ǻ";
}

.isax-received4:before {
  content: "ǻ";
}

.isax-receive-square4:before {
  content: "Ǽ";
}

.isax-receive-square-24:before {
  content: "ǽ";
}

.isax-record4:before {
  content: "Ǿ";
}

.isax-record-circle4:before {
  content: "ǿ";
}

.isax-recovery-convert4:before {
  content: "Ȁ";
}

.isax-redo4:before {
  content: "ȁ";
}

.isax-refresh4:before {
  content: "Ȃ";
}

.isax-refresh-24:before {
  content: "ȃ";
}

.isax-refresh-circle4:before {
  content: "Ȅ";
}

.isax-refresh-left-square4:before {
  content: "ȅ";
}

.isax-refresh-right-square4:before {
  content: "Ȇ";
}

.isax-refresh-square-24:before {
  content: "ȇ";
}

.isax-repeat4:before {
  content: "Ȉ";
}

.isax-repeat-circle4:before {
  content: "ȉ";
}

.isax-repeate-music4:before {
  content: "Ȋ";
}

.isax-repeate-one4:before {
  content: "ȋ";
}

.isax-reserve4:before {
  content: "Ȍ";
}

.isax-rotate-left4:before {
  content: "ȍ";
}

.isax-rotate-left-14:before {
  content: "Ȏ";
}

.isax-rotate-right4:before {
  content: "ȏ";
}

.isax-rotate-right-14:before {
  content: "Ȑ";
}

.isax-route-square4:before {
  content: "ȑ";
}

.isax-routing4:before {
  content: "Ȓ";
}

.isax-routing-24:before {
  content: "ȓ";
}

.isax-row-horizontal4:before {
  content: "Ȕ";
}

.isax-row-vertical4:before {
  content: "ȕ";
}

.isax-rulerpen4:before {
  content: "Ȗ";
}

.isax-ruler4:before {
  content: "ȗ";
}

.isax-safe-home4:before {
  content: "Ș";
}

.isax-sagittarius4:before {
  content: "ș";
}

.isax-save-24:before {
  content: "Ț";
}

.isax-save-add4:before {
  content: "ț";
}

.isax-save-minus4:before {
  content: "Ȝ";
}

.isax-save-remove4:before {
  content: "ȝ";
}

.isax-scan4:before {
  content: "Ȟ";
}

.isax-scan-barcode4:before {
  content: "ȟ";
}

.isax-scanner4:before {
  content: "Ƞ";
}

.isax-scanning4:before {
  content: "ȡ";
}

.isax-scissor4:before {
  content: "Ȣ";
}

.isax-scissor-14:before {
  content: "ȣ";
}

.isax-screenmirroring4:before {
  content: "Ȥ";
}

.isax-scroll4:before {
  content: "ȥ";
}

.isax-search-favorite4:before {
  content: "Ȧ";
}

.isax-search-favorite-14:before {
  content: "ȧ";
}

.isax-search-normal4:before {
  content: "Ȩ";
}

.isax-search-normal-14:before {
  content: "ȩ";
}

.isax-search-status4:before {
  content: "Ȫ";
}

.isax-search-status-14:before {
  content: "ȫ";
}

.isax-search-zoom-in4:before {
  content: "Ȭ";
}

.isax-search-zoom-in-14:before {
  content: "ȭ";
}

.isax-search-zoom-out4:before {
  content: "Ȯ";
}

.isax-search-zoom-out-14:before {
  content: "ȯ";
}

.isax-security4:before {
  content: "Ȱ";
}

.isax-security-card4:before {
  content: "ȱ";
}

.isax-security-safe4:before {
  content: "Ȳ";
}

.isax-security-time4:before {
  content: "ȳ";
}

.isax-security-user4:before {
  content: "ȴ";
}

.isax-send4:before {
  content: "ȵ";
}

.isax-send-14:before {
  content: "ȶ";
}

.isax-send-24:before {
  content: "ȷ";
}

.isax-send-sqaure-24:before {
  content: "ȸ";
}

.isax-send-square4:before {
  content: "ȹ";
}

.isax-setting4:before {
  content: "Ⱥ";
}

.isax-setting-24:before {
  content: "Ȼ";
}

.isax-setting-34:before {
  content: "ȼ";
}

.isax-setting-44:before {
  content: "Ƚ";
}

.isax-setting-54:before {
  content: "Ⱦ";
}

.isax-settings4:before {
  content: "ȿ";
}

.isax-shapes4:before {
  content: "ɀ";
}

.isax-shapes-14:before {
  content: "Ɂ";
}

.isax-share4:before {
  content: "ɂ";
}

.isax-shield3:before {
  content: "Ƀ";
}

.isax-shield-cross4:before {
  content: "Ʉ";
}

.isax-shield-search4:before {
  content: "Ʌ";
}

.isax-shield-slash4:before {
  content: "Ɇ";
}

.isax-shield-tick4:before {
  content: "ɇ";
}

.isax-ship4:before {
  content: "Ɉ";
}

.isax-shop4:before {
  content: "ɉ";
}

.isax-shop-add4:before {
  content: "Ɋ";
}

.isax-shopping-bag4:before {
  content: "ɋ";
}

.isax-shopping-cart4:before {
  content: "Ɍ";
}

.isax-shop-remove4:before {
  content: "ɍ";
}

.isax-shuffle4:before {
  content: "Ɏ";
}

.isax-sidebar-bottom4:before {
  content: "ɏ";
}

.isax-sidebar-left4:before {
  content: "ɐ";
}

.isax-sidebar-right4:before {
  content: "ɑ";
}

.isax-sidebar-top4:before {
  content: "ɒ";
}

.isax-signpost4:before {
  content: "ɓ";
}

.isax-simcard4:before {
  content: "ɔ";
}

.isax-simcard-14:before {
  content: "ɕ";
}

.isax-simcard-24:before {
  content: "ɖ";
}

.isax-size4:before {
  content: "ɗ";
}

.isax-slash4:before {
  content: "ɘ";
}

.isax-slider4:before {
  content: "ə";
}

.isax-slider-horizontal4:before {
  content: "ɚ";
}

.isax-slider-horizontal-14:before {
  content: "ɛ";
}

.isax-slider-vertical4:before {
  content: "ɜ";
}

.isax-slider-vertical-14:before {
  content: "ɝ";
}

.isax-smallcaps4:before {
  content: "ɞ";
}

.isax-smart-car4:before {
  content: "ɟ";
}

.isax-smart-home4:before {
  content: "ɠ";
}

.isax-smileys4:before {
  content: "ɡ";
}

.isax-sms4:before {
  content: "ɢ";
}

.isax-sms-edit4:before {
  content: "ɣ";
}

.isax-sms-notification4:before {
  content: "ɤ";
}

.isax-sms-search4:before {
  content: "ɥ";
}

.isax-sms-star4:before {
  content: "ɦ";
}

.isax-sms-tracking4:before {
  content: "ɧ";
}

.isax-sort4:before {
  content: "ɨ";
}

.isax-sound4:before {
  content: "ɩ";
}

.isax-speaker4:before {
  content: "ɪ";
}

.isax-speedometer4:before {
  content: "ɫ";
}

.isax-star4:before {
  content: "ɬ";
}

.isax-star-14:before {
  content: "ɭ";
}

.isax-star-slash4:before {
  content: "ɮ";
}

.isax-status4:before {
  content: "ɯ";
}

.isax-status-up4:before {
  content: "ɰ";
}

.isax-sticker4:before {
  content: "ɱ";
}

.isax-stickynote4:before {
  content: "ɲ";
}

.isax-stop4:before {
  content: "ɳ";
}

.isax-stop-circle4:before {
  content: "ɴ";
}

.isax-story4:before {
  content: "ɵ";
}

.isax-strongbox4:before {
  content: "ɶ";
}

.isax-strongbox-24:before {
  content: "ɷ";
}

.isax-subtitle4:before {
  content: "ɸ";
}

.isax-sun4:before {
  content: "ɹ";
}

.isax-sun-14:before {
  content: "ɺ";
}

.isax-sun-fog4:before {
  content: "ɻ";
}

.isax-tag4:before {
  content: "ɼ";
}

.isax-tag-24:before {
  content: "ɽ";
}

.isax-tag-cross4:before {
  content: "ɾ";
}

.isax-tag-right4:before {
  content: "ɿ";
}

.isax-tag-user4:before {
  content: "ʀ";
}

.isax-task4:before {
  content: "ʁ";
}

.isax-task-square4:before {
  content: "ʂ";
}

.isax-teacher4:before {
  content: "ʃ";
}

.isax-text4:before {
  content: "ʄ";
}

.isax-textalign-center4:before {
  content: "ʅ";
}

.isax-textalign-justifycenter4:before {
  content: "ʆ";
}

.isax-textalign-justifyleft4:before {
  content: "ʇ";
}

.isax-textalign-justifyright4:before {
  content: "ʈ";
}

.isax-textalign-left4:before {
  content: "ʉ";
}

.isax-textalign-right4:before {
  content: "ʊ";
}

.isax-text-block4:before {
  content: "ʋ";
}

.isax-text-bold4:before {
  content: "ʌ";
}

.isax-text-italic4:before {
  content: "ʍ";
}

.isax-text-underline4:before {
  content: "ʎ";
}

.isax-tick-circle4:before {
  content: "ʏ";
}

.isax-ticket4:before {
  content: "ʐ";
}

.isax-ticket-24:before {
  content: "ʑ";
}

.isax-ticket-discount4:before {
  content: "ʒ";
}

.isax-ticket-expired4:before {
  content: "ʓ";
}

.isax-ticket-star4:before {
  content: "ʔ";
}

.isax-tick-square4:before {
  content: "ʕ";
}

.isax-timer4:before {
  content: "ʖ";
}

.isax-timer-14:before {
  content: "ʗ";
}

.isax-timer-pause4:before {
  content: "ʘ";
}

.isax-timer-start4:before {
  content: "ʙ";
}

.isax-toggle-off4:before {
  content: "ʚ";
}

.isax-toggle-off-circle4:before {
  content: "ʛ";
}

.isax-toggle-on4:before {
  content: "ʜ";
}

.isax-toggle-on-circle4:before {
  content: "ʝ";
}

.isax-trade4:before {
  content: "ʞ";
}

.isax-transaction-minus4:before {
  content: "ʟ";
}

.isax-translate4:before {
  content: "ʠ";
}

.isax-trash4:before {
  content: "ʡ";
}

.isax-tree4:before {
  content: "ʢ";
}

.isax-trend-down4:before {
  content: "ʣ";
}

.isax-trend-up4:before {
  content: "ʤ";
}

.isax-triangle4:before {
  content: "ʥ";
}

.isax-truck3:before {
  content: "ʦ";
}

.isax-truck-fast3:before {
  content: "ʧ";
}

.isax-truck-remove2:before {
  content: "ʨ";
}

.isax-truck-tick4:before {
  content: "ʩ";
}

.isax-truck-time2:before {
  content: "ʪ";
}

.isax-trush-square4:before {
  content: "ʫ";
}

.isax-undo4:before {
  content: "ʬ";
}

.isax-unlimited4:before {
  content: "ʭ";
}

.isax-unlock4:before {
  content: "ʮ";
}

.isax-user4:before {
  content: "ʯ";
}

.isax-user-add4:before {
  content: "ʰ";
}

.isax-user-cirlce-add4:before {
  content: "ʱ";
}

.isax-user-edit4:before {
  content: "ʲ";
}

.isax-user-minus4:before {
  content: "ʳ";
}

.isax-user-octagon4:before {
  content: "ʴ";
}

.isax-user-remove4:before {
  content: "ʵ";
}

.isax-user-search4:before {
  content: "ʶ";
}

.isax-user-square4:before {
  content: "ʷ";
}

.isax-user-tag4:before {
  content: "ʸ";
}

.isax-user-tick4:before {
  content: "ʹ";
}

.isax-verify4:before {
  content: "ʺ";
}

.isax-video4:before {
  content: "ʻ";
}

.isax-video-add4:before {
  content: "ʼ";
}

.isax-video-circle4:before {
  content: "ʽ";
}

.isax-video-horizontal4:before {
  content: "ʾ";
}

.isax-video-octagon4:before {
  content: "ʿ";
}

.isax-video-play4:before {
  content: "ˀ";
}

.isax-video-remove4:before {
  content: "ˁ";
}

.isax-video-slash4:before {
  content: "˂";
}

.isax-video-square4:before {
  content: "˃";
}

.isax-video-tick4:before {
  content: "˄";
}

.isax-video-time4:before {
  content: "˅";
}

.isax-video-vertical4:before {
  content: "ˆ";
}

.isax-voice-cricle4:before {
  content: "ˇ";
}

.isax-voice-square4:before {
  content: "ˈ";
}

.isax-volume-cross4:before {
  content: "ˉ";
}

.isax-volume-high4:before {
  content: "ˊ";
}

.isax-volume-low4:before {
  content: "ˋ";
}

.isax-volume-low-14:before {
  content: "ˌ";
}

.isax-volume-mute4:before {
  content: "ˍ";
}

.isax-volume-slash4:before {
  content: "ˎ";
}

.isax-volume-up4:before {
  content: "ˏ";
}

.isax-wallet4:before {
  content: "ː";
}

.isax-wallet-14:before {
  content: "ˑ";
}

.isax-wallet-24:before {
  content: "˒";
}

.isax-wallet-34:before {
  content: "˓";
}

.isax-wallet-add4:before {
  content: "˔";
}

.isax-wallet-add-14:before {
  content: "˕";
}

.isax-wallet-check4:before {
  content: "˖";
}

.isax-wallet-minus4:before {
  content: "˗";
}

.isax-wallet-money4:before {
  content: "˘";
}

.isax-wallet-remove4:before {
  content: "˙";
}

.isax-wallet-search4:before {
  content: "˚";
}

.isax-warning-24:before {
  content: "˛";
}

.isax-watch4:before {
  content: "˜";
}

.isax-watch-status4:before {
  content: "˝";
}

.isax-weight4:before {
  content: "˞";
}

.isax-weight-14:before {
  content: "˟";
}

.isax-wifi4:before {
  content: "ˠ";
}

.isax-wifi-square4:before {
  content: "ˡ";
}

.isax-wind4:before {
  content: "ˢ";
}

.isax-wind-24:before {
  content: "ˣ";
}

.isax-woman4:before {
  content: "ˤ";
}

.isax-dcube4:before {
  content: "˥";
}

.isax-dcube5:before {
  content: "˦";
}

.isax-d-cube-scan5:before {
  content: "˧";
}

.isax-d-rotate5:before {
  content: "˨";
}

.isax-d-square5:before {
  content: "˩";
}

.isax-square5:before {
  content: "˪";
}

.isax-support5:before {
  content: "˫";
}

.isax-activity5:before {
  content: "ˬ";
}

.isax-add5:before {
  content: "˭";
}

.isax-add-circle5:before {
  content: "ˮ";
}

.isax-additem5:before {
  content: "˯";
}

.isax-add-square5:before {
  content: "˰";
}

.isax-airdrop5:before {
  content: "˱";
}

.isax-airplane5:before {
  content: "˲";
}

.isax-airplane-square5:before {
  content: "˳";
}

.isax-airpod5:before {
  content: "˴";
}

.isax-airpods5:before {
  content: "˵";
}

.isax-alarm5:before {
  content: "˶";
}

.isax-align-bottom5:before {
  content: "˷";
}

.isax-align-horizontally5:before {
  content: "˸";
}

.isax-align-left5:before {
  content: "˹";
}

.isax-align-right5:before {
  content: "˺";
}

.isax-align-vertically5:before {
  content: "˻";
}

.isax-aquarius5:before {
  content: "˼";
}

.isax-archive5:before {
  content: "˽";
}

.isax-archive-15:before {
  content: "˾";
}

.isax-archive-24:before {
  content: "˿";
}

.isax-archive-add5:before {
  content: "̀";
}

.isax-archive-book5:before {
  content: "́";
}

.isax-archive-minus5:before {
  content: "̂";
}

.isax-archive-slash5:before {
  content: "̃";
}

.isax-archive-tick5:before {
  content: "̄";
}

.isax-arrange-circle5:before {
  content: "̅";
}

.isax-arrange-circle-25:before {
  content: "̆";
}

.isax-arrange-square5:before {
  content: "̇";
}

.isax-arrange-square-25:before {
  content: "̈";
}

.isax-arrow5:before {
  content: "̉";
}

.isax-arrow-25:before {
  content: "̊";
}

.isax-arrow-35:before {
  content: "̋";
}

.isax-arrow-bottom5:before {
  content: "̌";
}

.isax-arrow-circle-down5:before {
  content: "̍";
}

.isax-arrow-circle-left5:before {
  content: "̎";
}

.isax-arrow-circle-right5:before {
  content: "̏";
}

.isax-arrow-circle-up4:before {
  content: "̐";
}

.isax-arrow-down5:before {
  content: "̑";
}

.isax-arrow-down-15:before {
  content: "̒";
}

.isax-arrow-down-25:before {
  content: "̓";
}

.isax-arrow-left5:before {
  content: "̔";
}

.isax-arrow-left-15:before {
  content: "̕";
}

.isax-arrow-left-25:before {
  content: "̖";
}

.isax-arrow-left-35:before {
  content: "̗";
}

.isax-arrow-right5:before {
  content: "̘";
}

.isax-arrow-right-15:before {
  content: "̙";
}

.isax-arrow-right-25:before {
  content: "̚";
}

.isax-arrow-right-35:before {
  content: "̛";
}

.isax-arrow-square5:before {
  content: "̜";
}

.isax-arrow-square-down5:before {
  content: "̝";
}

.isax-arrow-square-left5:before {
  content: "̞";
}

.isax-arrow-square-right3:before {
  content: "̟";
}

.isax-arrow-square-up5:before {
  content: "̠";
}

.isax-arrow-swap4:before {
  content: "̡";
}

.isax-arrow-swap-horizontal5:before {
  content: "̢";
}

.isax-arrow-up5:before {
  content: "̣";
}

.isax-arrow-up-15:before {
  content: "̤";
}

.isax-arrow-up-25:before {
  content: "̥";
}

.isax-arrow-up-35:before {
  content: "̦";
}

.isax-attach-circle5:before {
  content: "̧";
}

.isax-attach-square5:before {
  content: "̨";
}

.isax-audio-square5:before {
  content: "̩";
}

.isax-autobrightness5:before {
  content: "̪";
}

.isax-award5:before {
  content: "̫";
}

.isax-back-square5:before {
  content: "̬";
}

.isax-backward5:before {
  content: "̭";
}

.isax-backward-5-seconds5:before {
  content: "̮";
}

.isax-backward-10-seconds5:before {
  content: "̯";
}

.isax-backward-15-seconds5:before {
  content: "̰";
}

.isax-backward-item5:before {
  content: "̱";
}

.isax-bag5:before {
  content: "̲";
}

.isax-bag-25:before {
  content: "̳";
}

.isax-bag-cross5:before {
  content: "̴";
}

.isax-bag-cross-15:before {
  content: "̵";
}

.isax-bag-happy5:before {
  content: "̶";
}

.isax-bag-tick5:before {
  content: "̷";
}

.isax-bag-tick-25:before {
  content: "̸";
}

.isax-bag-timer5:before {
  content: "̹";
}

.isax-bank5:before {
  content: "̺";
}

.isax-barcode5:before {
  content: "̻";
}

.isax-battery-3full5:before {
  content: "̼";
}

.isax-battery-charging5:before {
  content: "̽";
}

.isax-battery-disable5:before {
  content: "̾";
}

.isax-battery-empty5:before {
  content: "̿";
}

.isax-battery-empty-15:before {
  content: "̀";
}

.isax-battery-full5:before {
  content: "́";
}

.isax-bezier5:before {
  content: "͂";
}

.isax-bill5:before {
  content: "̓";
}

.isax-bitcoin-card5:before {
  content: "̈́";
}

.isax-bitcoin-convert5:before {
  content: "ͅ";
}

.isax-bitcoin-refresh5:before {
  content: "͆";
}

.isax-blend5:before {
  content: "͇";
}

.isax-blend-25:before {
  content: "͈";
}

.isax-bluetooth5:before {
  content: "͉";
}

.isax-bluetooth-25:before {
  content: "͊";
}

.isax-bluetooth-circle5:before {
  content: "͋";
}

.isax-bluetooth-rectangle5:before {
  content: "͌";
}

.isax-blur5:before {
  content: "͍";
}

.isax-book5:before {
  content: "͎";
}

.isax-book-15:before {
  content: "͏";
}

.isax-bookmark5:before {
  content: "͐";
}

.isax-bookmark-25:before {
  content: "͑";
}

.isax-book-saved5:before {
  content: "͒";
}

.isax-book-square5:before {
  content: "͓";
}

.isax-box5:before {
  content: "͔";
}

.isax-box-15:before {
  content: "͕";
}

.isax-box-25:before {
  content: "͖";
}

.isax-box-add5:before {
  content: "͗";
}

.isax-box-remove5:before {
  content: "͘";
}

.isax-box-search5:before {
  content: "͙";
}

.isax-box-tick5:before {
  content: "͚";
}

.isax-box-time5:before {
  content: "͛";
}

.isax-briefcase5:before {
  content: "͜";
}

.isax-brifecase-cross5:before {
  content: "͝";
}

.isax-brifecase-tick5:before {
  content: "͞";
}

.isax-brifecase-timer5:before {
  content: "͟";
}

.isax-broom5:before {
  content: "͠";
}

.isax-brush5:before {
  content: "͡";
}

.isax-brush-15:before {
  content: "͢";
}

.isax-brush-25:before {
  content: "ͣ";
}

.isax-brush-35:before {
  content: "ͤ";
}

.isax-brush-45:before {
  content: "ͥ";
}

.isax-bubble5:before {
  content: "ͦ";
}

.isax-bucket5:before {
  content: "ͧ";
}

.isax-bucket-circle5:before {
  content: "ͨ";
}

.isax-bucket-square5:before {
  content: "ͩ";
}

.isax-building5:before {
  content: "ͪ";
}

.isax-building-35:before {
  content: "ͫ";
}

.isax-building-45:before {
  content: "ͬ";
}

.isax-buildings5:before {
  content: "ͭ";
}

.isax-buildings-25:before {
  content: "ͮ";
}

.isax-buliding5:before {
  content: "ͯ";
}

.isax-bus5:before {
  content: "Ͱ";
}

.isax-buy-crypto5:before {
  content: "ͱ";
}

.isax-cake5:before {
  content: "Ͳ";
}

.isax-calculator5:before {
  content: "ͳ";
}

.isax-calendar5:before {
  content: "ʹ";
}

.isax-calendar-15:before {
  content: "͵";
}

.isax-calendar-25:before {
  content: "Ͷ";
}

.isax-calendar-add5:before {
  content: "ͷ";
}

.isax-calendar-circle5:before {
  content: "͸";
}

.isax-calendar-edit5:before {
  content: "͹";
}

.isax-calendar-remove5:before {
  content: "ͺ";
}

.isax-calendar-search5:before {
  content: "ͻ";
}

.isax-calendar-tick5:before {
  content: "ͼ";
}

.isax-call5:before {
  content: "ͽ";
}

.isax-call-add5:before {
  content: ";";
}

.isax-call-calling5:before {
  content: "Ϳ";
}

.isax-call-incoming5:before {
  content: "΀";
}

.isax-call-minus5:before {
  content: "΁";
}

.isax-call-outgoing5:before {
  content: "΂";
}

.isax-call-received5:before {
  content: "΃";
}

.isax-call-remove5:before {
  content: "΄";
}

.isax-call-slash5:before {
  content: "΅";
}

.isax-camera5:before {
  content: "Ά";
}

.isax-camera-slash5:before {
  content: "·";
}

.isax-candle5:before {
  content: "Έ";
}

.isax-candle-25:before {
  content: "Ή";
}

.isax-car5:before {
  content: "Ί";
}

.isax-card5:before {
  content: "΋";
}

.isax-card-add5:before {
  content: "Ό";
}

.isax-card-coin5:before {
  content: "΍";
}

.isax-card-edit5:before {
  content: "Ύ";
}

.isax-card-pos5:before {
  content: "Ώ";
}

.isax-card-receive5:before {
  content: "ΐ";
}

.isax-card-remove5:before {
  content: "Α";
}

.isax-card-remove-15:before {
  content: "Β";
}

.isax-cards5:before {
  content: "Γ";
}

.isax-card-send5:before {
  content: "Δ";
}

.isax-card-slash5:before {
  content: "Ε";
}

.isax-card-tick5:before {
  content: "Ζ";
}

.isax-card-tick-15:before {
  content: "Η";
}

.isax-category5:before {
  content: "Θ";
}

.isax-category-25:before {
  content: "Ι";
}

.isax-cd5:before {
  content: "Κ";
}

.isax-chart5:before {
  content: "Λ";
}

.isax-chart-15:before {
  content: "Μ";
}

.isax-chart-26:before {
  content: "Ν";
}

.isax-chart-35:before {
  content: "Ξ";
}

.isax-chart-215:before {
  content: "Ο";
}

.isax-chart-fail3:before {
  content: "Π";
}

.isax-chart-square5:before {
  content: "Ρ";
}

.isax-chart-success5:before {
  content: "΢";
}

.isax-check5:before {
  content: "Σ";
}

.isax-chrome5:before {
  content: "Τ";
}

.isax-clipboard5:before {
  content: "Υ";
}

.isax-clipboard-close5:before {
  content: "Φ";
}

.isax-clipboard-export5:before {
  content: "Χ";
}

.isax-clipboard-import5:before {
  content: "Ψ";
}

.isax-clipboard-text5:before {
  content: "Ω";
}

.isax-clipboard-tick5:before {
  content: "Ϊ";
}

.isax-clock5:before {
  content: "Ϋ";
}

.isax-clock-15:before {
  content: "ά";
}

.isax-close-circle5:before {
  content: "έ";
}

.isax-close-square5:before {
  content: "ή";
}

.isax-cloud5:before {
  content: "ί";
}

.isax-cloud-add5:before {
  content: "ΰ";
}

.isax-cloud-change5:before {
  content: "α";
}

.isax-cloud-connection5:before {
  content: "β";
}

.isax-cloud-cross5:before {
  content: "γ";
}

.isax-cloud-drizzle5:before {
  content: "δ";
}

.isax-cloud-fog5:before {
  content: "ε";
}

.isax-cloud-lightning5:before {
  content: "ζ";
}

.isax-cloud-minus5:before {
  content: "η";
}

.isax-cloud-notif5:before {
  content: "θ";
}

.isax-cloud-plus5:before {
  content: "ι";
}

.isax-cloud-remove5:before {
  content: "κ";
}

.isax-cloud-snow5:before {
  content: "λ";
}

.isax-cloud-sunny5:before {
  content: "μ";
}

.isax-code5:before {
  content: "ν";
}

.isax-code-15:before {
  content: "ξ";
}

.isax-code-circle5:before {
  content: "ο";
}

.isax-coffee5:before {
  content: "π";
}

.isax-coin5:before {
  content: "ρ";
}

.isax-coin-15:before {
  content: "ς";
}

.isax-colorfilter5:before {
  content: "σ";
}

.isax-colors-square5:before {
  content: "τ";
}

.isax-color-swatch5:before {
  content: "υ";
}

.isax-command5:before {
  content: "φ";
}

.isax-command-square5:before {
  content: "χ";
}

.isax-component5:before {
  content: "ψ";
}

.isax-computing5:before {
  content: "ω";
}

.isax-convert5:before {
  content: "ϊ";
}

.isax-convert-3d-cube5:before {
  content: "ϋ";
}

.isax-convert-card5:before {
  content: "ό";
}

.isax-convertshape5:before {
  content: "ύ";
}

.isax-convertshape-25:before {
  content: "ώ";
}

.isax-copy5:before {
  content: "Ϗ";
}

.isax-copyright5:before {
  content: "ϐ";
}

.isax-copy-success5:before {
  content: "ϑ";
}

.isax-courthouse5:before {
  content: "ϒ";
}

.isax-cpu5:before {
  content: "ϓ";
}

.isax-cpu-charge5:before {
  content: "ϔ";
}

.isax-cpu-setting5:before {
  content: "ϕ";
}

.isax-creative-commons5:before {
  content: "ϖ";
}

.isax-crop5:before {
  content: "ϗ";
}

.isax-crown5:before {
  content: "Ϙ";
}

.isax-crown-15:before {
  content: "ϙ";
}

.isax-cup5:before {
  content: "Ϛ";
}

.isax-danger5:before {
  content: "ϛ";
}

.isax-data5:before {
  content: "Ϝ";
}

.isax-data-25 .path1:before {
  content: "ϝ";
  color: rgb(41, 45, 50);
}

.isax-data-25 .path2:before {
  content: "٭";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-data-25 .path3:before {
  content: "ٮ";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-data-25 .path4:before {
  content: "ٯ";
  margin-left: -1em;
  color: rgb(41, 45, 50);
  opacity: 0.96;
}

.isax-data-25 .path5:before {
  content: "ٰ";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-designtools5:before {
  content: "Ϟ";
}

.isax-device-message5:before {
  content: "ϟ";
}

.isax-devices5:before {
  content: "Ϡ";
}

.isax-devices-14:before {
  content: "ϡ";
}

.isax-diagram5:before {
  content: "Ϣ";
}

.isax-diamonds5:before {
  content: "ϣ";
}

.isax-direct5:before {
  content: "Ϥ";
}

.isax-directbox-default5:before {
  content: "ϥ";
}

.isax-directbox-notif5:before {
  content: "Ϧ";
}

.isax-directbox-receive5:before {
  content: "ϧ";
}

.isax-directbox-send5:before {
  content: "Ϩ";
}

.isax-direct-down5:before {
  content: "ϩ";
}

.isax-direct-inbox5:before {
  content: "Ϫ";
}

.isax-direct-left5:before {
  content: "ϫ";
}

.isax-direct-normal5:before {
  content: "Ϭ";
}

.isax-direct-notification5:before {
  content: "ϭ";
}

.isax-direct-right5:before {
  content: "Ϯ";
}

.isax-direct-send5:before {
  content: "ϯ";
}

.isax-direct-up5:before {
  content: "ϰ";
}

.isax-discount-circle5:before {
  content: "ϱ";
}

.isax-discount-shape5:before {
  content: "ϲ";
}

.isax-discover5:before {
  content: "ϳ";
}

.isax-discover-14:before {
  content: "ϴ";
}

.isax-dislike5:before {
  content: "ϵ";
}

.isax-document5:before {
  content: "϶";
}

.isax-document-15:before {
  content: "Ϸ";
}

.isax-document-cloud5:before {
  content: "ϸ";
}

.isax-document-code5:before {
  content: "Ϲ";
}

.isax-document-code-25:before {
  content: "Ϻ";
}

.isax-document-copy5:before {
  content: "ϻ";
}

.isax-document-download5:before {
  content: "ϼ";
}

.isax-document-favorite5:before {
  content: "Ͻ";
}

.isax-document-filter5:before {
  content: "Ͼ";
}

.isax-document-forward5:before {
  content: "Ͽ";
}

.isax-document-like5:before {
  content: "Ѐ";
}

.isax-document-normal4:before {
  content: "Ё";
}

.isax-document-previous5:before {
  content: "Ђ";
}

.isax-document-sketch5:before {
  content: "Ѓ";
}

.isax-document-text5:before {
  content: "Є";
}

.isax-document-text-15:before {
  content: "Ѕ";
}

.isax-document-upload5:before {
  content: "І";
}

.isax-dollar-circle4:before {
  content: "Ї";
}

.isax-dollar-square5:before {
  content: "Ј";
}

.isax-driver5:before {
  content: "Љ";
}

.isax-driver-25:before {
  content: "Њ";
}

.isax-driver-refresh5:before {
  content: "Ћ";
}

.isax-driving5:before {
  content: "Ќ";
}

.isax-drop3:before {
  content: "Ѝ";
}

.isax-edit5:before {
  content: "Ў";
}

.isax-edit-25:before {
  content: "Џ";
}

.isax-electricity5:before {
  content: "А";
}

.isax-element-25:before {
  content: "Б";
}

.isax-element-35:before {
  content: "В";
}

.isax-element-45:before {
  content: "Г";
}

.isax-element-equal5:before {
  content: "Д";
}

.isax-element-plus5:before {
  content: "Е";
}

.isax-emoji-happy5:before {
  content: "Ж";
}

.isax-emoji-normal5:before {
  content: "З";
}

.isax-emoji-sad5:before {
  content: "И";
}

.isax-empty-wallet5:before {
  content: "Й";
}

.isax-empty-wallet-add5:before {
  content: "К";
}

.isax-empty-wallet-change4:before {
  content: "Л";
}

.isax-empty-wallet-remove5:before {
  content: "М";
}

.isax-empty-wallet-tick5:before {
  content: "Н";
}

.isax-empty-wallet-time4:before {
  content: "О";
}

.isax-eraser5:before {
  content: "П";
}

.isax-eraser-15:before {
  content: "Р";
}

.isax-export5:before {
  content: "С";
}

.isax-export-15:before {
  content: "Т";
}

.isax-export-25:before {
  content: "У";
}

.isax-export-35:before {
  content: "Ф";
}

.isax-external-drive5:before {
  content: "Х";
}

.isax-eye4:before {
  content: "Ц";
}

.isax-eye-slash5:before {
  content: "Ч";
}

.isax-fatrows5:before {
  content: "Ш";
}

.isax-favorite-chart5:before {
  content: "Щ";
}

.isax-filter5:before {
  content: "Ъ";
}

.isax-filter-add5:before {
  content: "Ы";
}

.isax-filter-edit5:before {
  content: "Ь";
}

.isax-filter-remove5:before {
  content: "Э";
}

.isax-filter-search5:before {
  content: "Ю";
}

.isax-filter-square5:before {
  content: "Я";
}

.isax-filter-tick5:before {
  content: "а";
}

.isax-finger-cricle5:before {
  content: "б";
}

.isax-finger-scan5:before {
  content: "в";
}

.isax-firstline5:before {
  content: "г";
}

.isax-flag5:before {
  content: "д";
}

.isax-flag-25:before {
  content: "е";
}

.isax-flash5:before {
  content: "ж";
}

.isax-flash-15:before {
  content: "з";
}

.isax-flash-circle5:before {
  content: "и";
}

.isax-flash-circle-15:before {
  content: "й";
}

.isax-flash-slash5:before {
  content: "к";
}

.isax-folder5:before {
  content: "л";
}

.isax-folder-25:before {
  content: "м";
}

.isax-folder-add5:before {
  content: "н";
}

.isax-folder-cloud5:before {
  content: "о";
}

.isax-folder-connection5:before {
  content: "п";
}

.isax-folder-cross5:before {
  content: "р";
}

.isax-folder-favorite5:before {
  content: "с";
}

.isax-folder-minus5:before {
  content: "т";
}

.isax-folder-open5:before {
  content: "у";
}

.isax-forbidden5:before {
  content: "ф";
}

.isax-forbidden-25:before {
  content: "х";
}

.isax-format-circle5:before {
  content: "ц";
}

.isax-format-square5:before {
  content: "ч";
}

.isax-forward5:before {
  content: "ш";
}

.isax-forward-5-seconds5:before {
  content: "щ";
}

.isax-forward-10-seconds5:before {
  content: "ъ";
}

.isax-forward-15-seconds5:before {
  content: "ы";
}

.isax-forward-item5:before {
  content: "ь";
}

.isax-forward-square5:before {
  content: "э";
}

.isax-frame5:before {
  content: "ю";
}

.isax-frame-15:before {
  content: "я";
}

.isax-frame-25:before {
  content: "ѐ";
}

.isax-frame-35:before {
  content: "ё";
}

.isax-frame-45:before {
  content: "ђ";
}

.isax-gallery5:before {
  content: "ѓ";
}

.isax-gallery-add5:before {
  content: "є";
}

.isax-gallery-edit5:before {
  content: "ѕ";
}

.isax-gallery-export4:before {
  content: "і";
}

.isax-gallery-favorite5:before {
  content: "ї";
}

.isax-gallery-import5:before {
  content: "ј";
}

.isax-gallery-remove5:before {
  content: "љ";
}

.isax-gallery-slash5:before {
  content: "њ";
}

.isax-gallery-tick5:before {
  content: "ћ";
}

.isax-game5:before {
  content: "ќ";
}

.isax-gameboy5:before {
  content: "ѝ";
}

.isax-gas-station4:before {
  content: "ў";
}

.isax-gemini5:before {
  content: "џ";
}

.isax-gemini-25:before {
  content: "Ѡ";
}

.isax-ghost5:before {
  content: "ѡ";
}

.isax-gift5:before {
  content: "Ѣ";
}

.isax-glass5:before {
  content: "ѣ";
}

.isax-glass-15:before {
  content: "Ѥ";
}

.isax-global5:before {
  content: "ѥ";
}

.isax-global-edit5:before {
  content: "Ѧ";
}

.isax-global-refresh5:before {
  content: "ѧ";
}

.isax-global-search5:before {
  content: "Ѩ";
}

.isax-gps5:before {
  content: "ѩ";
}

.isax-gps-slash5:before {
  content: "Ѫ";
}

.isax-grammerly5:before {
  content: "ѫ";
}

.isax-graph5:before {
  content: "Ѭ";
}

.isax-grid-15:before {
  content: "ѭ";
}

.isax-grid-25:before {
  content: "Ѯ";
}

.isax-grid-35:before {
  content: "ѯ";
}

.isax-grid-45:before {
  content: "Ѱ";
}

.isax-grid-55:before {
  content: "ѱ";
}

.isax-grid-65:before {
  content: "Ѳ";
}

.isax-grid-75:before {
  content: "ѳ";
}

.isax-grid-85:before {
  content: "Ѵ";
}

.isax-grid-95:before {
  content: "ѵ";
}

.isax-grid-edit5:before {
  content: "Ѷ";
}

.isax-grid-eraser5:before {
  content: "ѷ";
}

.isax-grid-lock5:before {
  content: "Ѹ";
}

.isax-happyemoji5:before {
  content: "ѹ";
}

.isax-hashtag5:before {
  content: "Ѻ";
}

.isax-hashtag-15:before {
  content: "ѻ";
}

.isax-hashtag-down5:before {
  content: "Ѽ";
}

.isax-hashtag-up5:before {
  content: "ѽ";
}

.isax-headphone5:before {
  content: "Ѿ";
}

.isax-headphones5:before {
  content: "ѿ";
}

.isax-health5:before {
  content: "Ҁ";
}

.isax-heart5:before {
  content: "ҁ";
}

.isax-heart-add5:before {
  content: "҂";
}

.isax-heart-circle5:before {
  content: "҃";
}

.isax-heart-edit5:before {
  content: "҄";
}

.isax-heart-remove5:before {
  content: "҅";
}

.isax-heart-search5:before {
  content: "҆";
}

.isax-heart-slash5:before {
  content: "҇";
}

.isax-heart-tick5:before {
  content: "҈";
}

.isax-hierarchy5:before {
  content: "҉";
}

.isax-hierarchy-25:before {
  content: "Ҋ";
}

.isax-hierarchy-35:before {
  content: "ҋ";
}

.isax-hierarchy-square5:before {
  content: "Ҍ";
}

.isax-hierarchy-square-25:before {
  content: "ҍ";
}

.isax-hierarchy-square-35:before {
  content: "Ҏ";
}

.isax-home5:before {
  content: "ҏ";
}

.isax-home-15:before {
  content: "Ґ";
}

.isax-home-25:before {
  content: "ґ";
}

.isax-home-hashtag5:before {
  content: "Ғ";
}

.isax-home-trend-down5:before {
  content: "ғ";
}

.isax-home-trend-up5:before {
  content: "Ҕ";
}

.isax-home-wifi5:before {
  content: "ҕ";
}

.isax-hospital5:before {
  content: "Җ";
}

.isax-house5:before {
  content: "җ";
}

.isax-house-25:before {
  content: "Ҙ";
}

.isax-image5:before {
  content: "ҙ";
}

.isax-import5:before {
  content: "Қ";
}

.isax-import-15:before {
  content: "қ";
}

.isax-import-25:before {
  content: "Ҝ";
}

.isax-import-3:before {
  content: "ҝ";
}

.isax-info-circle5:before {
  content: "Ҟ";
}

.isax-information5:before {
  content: "ҟ";
}

.isax-instagram5:before {
  content: "Ҡ";
}

.isax-judge5:before {
  content: "ҡ";
}

.isax-kanban4:before {
  content: "Ң";
}

.isax-key5:before {
  content: "ң";
}

.isax-keyboard5:before {
  content: "Ҥ";
}

.isax-keyboard-open5:before {
  content: "ҥ";
}

.isax-key-square5:before {
  content: "Ҧ";
}

.isax-lamp5:before {
  content: "ҧ";
}

.isax-lamp-15:before {
  content: "Ҩ";
}

.isax-lamp-charge5:before {
  content: "ҩ";
}

.isax-lamp-on5:before {
  content: "Ҫ";
}

.isax-lamp-slash5:before {
  content: "ҫ";
}

.isax-language-circle5:before {
  content: "Ҭ";
}

.isax-language-square5:before {
  content: "ҭ";
}

.isax-layer5:before {
  content: "Ү";
}

.isax-level5:before {
  content: "ү";
}

.isax-lifebuoy5:before {
  content: "Ұ";
}

.isax-like5:before {
  content: "ұ";
}

.isax-like-15:before {
  content: "Ҳ";
}

.isax-like-dislike5:before {
  content: "ҳ";
}

.isax-like-shapes5:before {
  content: "Ҵ";
}

.isax-like-tag5:before {
  content: "ҵ";
}

.isax-link5:before {
  content: "Ҷ";
}

.isax-link-15:before {
  content: "ҷ";
}

.isax-link-26:before {
  content: "Ҹ";
}

.isax-link-215:before {
  content: "ҹ";
}

.isax-link-circle5:before {
  content: "Һ";
}

.isax-link-square5:before {
  content: "һ";
}

.isax-location5:before {
  content: "Ҽ";
}

.isax-location-add5:before {
  content: "ҽ";
}

.isax-location-cross5:before {
  content: "Ҿ";
}

.isax-location-minus5:before {
  content: "ҿ";
}

.isax-location-slash5:before {
  content: "Ӏ";
}

.isax-location-tick5:before {
  content: "Ӂ";
}

.isax-lock5:before {
  content: "ӂ";
}

.isax-lock-15:before {
  content: "Ӄ";
}

.isax-lock-circle5:before {
  content: "ӄ";
}

.isax-lock-slash5:before {
  content: "Ӆ";
}

.isax-login5:before {
  content: "ӆ";
}

.isax-login-15:before {
  content: "Ӈ";
}

.isax-logout5:before {
  content: "ӈ";
}

.isax-logout-15:before {
  content: "Ӊ";
}

.isax-lovely5:before {
  content: "ӊ";
}

.isax-magicpen5:before {
  content: "Ӌ";
}

.isax-magic-star5:before {
  content: "ӌ";
}

.isax-main-component5:before {
  content: "Ӎ";
}

.isax-man5:before {
  content: "ӎ";
}

.isax-map5:before {
  content: "ӏ";
}

.isax-map-15:before {
  content: "Ӑ";
}

.isax-mask5:before {
  content: "ӑ";
}

.isax-mask-15:before {
  content: "Ӓ";
}

.isax-mask-25:before {
  content: "ӓ";
}

.isax-math5:before {
  content: "Ӕ";
}

.isax-maximize5:before {
  content: "ӕ";
}

.isax-maximize-15:before {
  content: "Ӗ";
}

.isax-maximize-26:before {
  content: "ӗ";
}

.isax-maximize-35:before {
  content: "Ә";
}

.isax-maximize-45:before {
  content: "ә";
}

.isax-maximize-215:before {
  content: "Ӛ";
}

.isax-maximize-circle4:before {
  content: "ӛ";
}

.isax-medal5:before {
  content: "Ӝ";
}

.isax-medal-star5:before {
  content: "ӝ";
}

.isax-menu5:before {
  content: "Ӟ";
}

.isax-menu-15:before {
  content: "ӟ";
}

.isax-menu-board5:before {
  content: "Ӡ";
}

.isax-message5:before {
  content: "ӡ";
}

.isax-message-25:before {
  content: "Ӣ";
}

.isax-message-add5:before {
  content: "ӣ";
}

.isax-message-add-15:before {
  content: "Ӥ";
}

.isax-message-circle5:before {
  content: "ӥ";
}

.isax-message-edit5:before {
  content: "Ӧ";
}

.isax-message-favorite5:before {
  content: "ӧ";
}

.isax-message-minus5:before {
  content: "Ө";
}

.isax-message-notif5:before {
  content: "ө";
}

.isax-message-programming5:before {
  content: "Ӫ";
}

.isax-message-question5:before {
  content: "ӫ";
}

.isax-message-remove5:before {
  content: "Ӭ";
}

.isax-messages5:before {
  content: "ӭ";
}

.isax-messages-15:before {
  content: "Ӯ";
}

.isax-messages-25:before {
  content: "ӯ";
}

.isax-messages-35:before {
  content: "Ӱ";
}

.isax-message-search5:before {
  content: "ӱ";
}

.isax-message-square5:before {
  content: "Ӳ";
}

.isax-message-text5:before {
  content: "ӳ";
}

.isax-message-text-15:before {
  content: "Ӵ";
}

.isax-message-tick5:before {
  content: "ӵ";
}

.isax-message-time5:before {
  content: "Ӷ";
}

.isax-microphone5:before {
  content: "ӷ";
}

.isax-microphone-25:before {
  content: "Ӹ";
}

.isax-microphone-slash5:before {
  content: "ӹ";
}

.isax-microphone-slash-15:before {
  content: "Ӻ";
}

.isax-microscope5:before {
  content: "ӻ";
}

.isax-milk5:before {
  content: "Ӽ";
}

.isax-mini-music-sqaure5 .path1:before {
  content: "ӽ";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-mini-music-sqaure5 .path2:before {
  content: "ٱ";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-mini-music-sqaure5 .path3:before {
  content: "ٲ";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-minus5:before {
  content: "Ӿ";
}

.isax-minus-cirlce5:before {
  content: "ӿ";
}

.isax-minus-square5:before {
  content: "Ԁ";
}

.isax-mirror5:before {
  content: "ԁ";
}

.isax-mirroring-screen5:before {
  content: "Ԃ";
}

.isax-mobile5:before {
  content: "ԃ";
}

.isax-mobile-programming5:before {
  content: "Ԅ";
}

.isax-money5:before {
  content: "ԅ";
}

.isax-money-25:before {
  content: "Ԇ";
}

.isax-money-35:before {
  content: "ԇ";
}

.isax-money-45:before {
  content: "Ԉ";
}

.isax-money-add5:before {
  content: "ԉ";
}

.isax-money-change5:before {
  content: "Ԋ";
}

.isax-money-forbidden5:before {
  content: "ԋ";
}

.isax-money-recive5:before {
  content: "Ԍ";
}

.isax-money-remove5:before {
  content: "ԍ";
}

.isax-moneys5:before {
  content: "Ԏ";
}

.isax-money-send5:before {
  content: "ԏ";
}

.isax-money-tick5:before {
  content: "Ԑ";
}

.isax-money-time5:before {
  content: "ԑ";
}

.isax-monitor5:before {
  content: "Ԓ";
}

.isax-monitor-mobbile5:before {
  content: "ԓ";
}

.isax-monitor-recorder5:before {
  content: "Ԕ";
}

.isax-moon5:before {
  content: "ԕ";
}

.isax-more5:before {
  content: "Ԗ";
}

.isax-more-25:before {
  content: "ԗ";
}

.isax-more-circle5:before {
  content: "Ԙ";
}

.isax-more-square5:before {
  content: "ԙ";
}

.isax-mouse5:before {
  content: "Ԛ";
}

.isax-mouse-15:before {
  content: "ԛ";
}

.isax-mouse-circle5:before {
  content: "Ԝ";
}

.isax-mouse-square5:before {
  content: "ԝ";
}

.isax-music5:before {
  content: "Ԟ";
}

.isax-music-circle5:before {
  content: "ԟ";
}

.isax-music-dashboard5:before {
  content: "Ԡ";
}

.isax-music-filter5:before {
  content: "ԡ";
}

.isax-music-library-25:before {
  content: "Ԣ";
}

.isax-musicnote5:before {
  content: "ԣ";
}

.isax-music-play5:before {
  content: "Ԥ";
}

.isax-music-playlist5:before {
  content: "ԥ";
}

.isax-music-square5:before {
  content: "Ԧ";
}

.isax-music-square-add5:before {
  content: "ԧ";
}

.isax-music-square-remove5:before {
  content: "Ԩ";
}

.isax-music-square-search5:before {
  content: "ԩ";
}

.isax-next5:before {
  content: "Ԫ";
}

.isax-note5:before {
  content: "ԫ";
}

.isax-note-15:before {
  content: "Ԭ";
}

.isax-note-26:before {
  content: "ԭ";
}

.isax-note-215:before {
  content: "Ԯ";
}

.isax-note-add5:before {
  content: "ԯ";
}

.isax-note-favorite5:before {
  content: "԰";
}

.isax-note-remove5:before {
  content: "Ա";
}

.isax-note-square5:before {
  content: "Բ";
}

.isax-note-text5:before {
  content: "Գ";
}

.isax-notification5:before {
  content: "Դ";
}

.isax-notification-15:before {
  content: "Ե";
}

.isax-notification-bing5:before {
  content: "Զ";
}

.isax-notification-favorite5:before {
  content: "Է";
}

.isax-notification-status5:before {
  content: "Ը";
}

.isax-omega-circle5:before {
  content: "Թ";
}

.isax-omega-square5:before {
  content: "Ժ";
}

.isax-paintbucket5:before {
  content: "Ի";
}

.isax-paperclip5:before {
  content: "Լ";
}

.isax-paperclip-25:before {
  content: "Խ";
}

.isax-password-check5:before {
  content: "Ծ";
}

.isax-path5:before {
  content: "Կ";
}

.isax-path-25:before {
  content: "Հ";
}

.isax-path-square5:before {
  content: "Ձ";
}

.isax-pause5:before {
  content: "Ղ";
}

.isax-pause-circle5:before {
  content: "Ճ";
}

.isax-pen-add5:before {
  content: "Մ";
}

.isax-pen-close5:before {
  content: "Յ";
}

.isax-pen-remove5:before {
  content: "Ն";
}

.isax-pen-tool5:before {
  content: "Շ";
}

.isax-pen-tool-25:before {
  content: "Ո";
}

.isax-people5:before {
  content: "Չ";
}

.isax-percentage-circle5:before {
  content: "Պ";
}

.isax-percentage-square5:before {
  content: "Ջ";
}

.isax-personalcard5:before {
  content: "Ռ";
}

.isax-pet5:before {
  content: "Ս";
}

.isax-pharagraphspacing5:before {
  content: "Վ";
}

.isax-picture-frame5:before {
  content: "Տ";
}

.isax-play5:before {
  content: "Ր";
}

.isax-play-add5:before {
  content: "Ց";
}

.isax-play-circle5:before {
  content: "Ւ";
}

.isax-play-cricle5:before {
  content: "Փ";
}

.isax-play-remove5:before {
  content: "Ք";
}

.isax-presention-chart5:before {
  content: "Օ";
}

.isax-previous5:before {
  content: "Ֆ";
}

.isax-printer5:before {
  content: "՗";
}

.isax-printer-slash5:before {
  content: "՘";
}

.isax-profile-2user5:before {
  content: "ՙ";
}

.isax-profile-add5:before {
  content: "՚";
}

.isax-profile-circle5:before {
  content: "՛";
}

.isax-profile-delete5:before {
  content: "՜";
}

.isax-profile-remove5:before {
  content: "՝";
}

.isax-profile-tick5:before {
  content: "՞";
}

.isax-programming-arrow5:before {
  content: "՟";
}

.isax-programming-arrows5:before {
  content: "ՠ";
}

.isax-quote-down5:before {
  content: "ա";
}

.isax-quote-down-circle5:before {
  content: "բ";
}

.isax-quote-down-square5:before {
  content: "գ";
}

.isax-quote-up5:before {
  content: "դ";
}

.isax-quote-up-circle5:before {
  content: "ե";
}

.isax-quote-up-square5:before {
  content: "զ";
}

.isax-radar5:before {
  content: "է";
}

.isax-radar-15:before {
  content: "ը";
}

.isax-radar-25:before {
  content: "թ";
}

.isax-radio5:before {
  content: "ժ";
}

.isax-ram5:before {
  content: "ի";
}

.isax-ram-25:before {
  content: "լ";
}

.isax-ranking5:before {
  content: "խ";
}

.isax-ranking-15:before {
  content: "ծ";
}

.isax-receipt5:before {
  content: "կ";
}

.isax-receipt-15:before {
  content: "հ";
}

.isax-receipt-25:before {
  content: "ձ";
}

.isax-receipt-2-15:before {
  content: "ղ";
}

.isax-receipt-add5:before {
  content: "ճ";
}

.isax-receipt-discount5:before {
  content: "մ";
}

.isax-receipt-disscount5:before {
  content: "յ";
}

.isax-receipt-edit5:before {
  content: "ն";
}

.isax-receipt-item5:before {
  content: "շ";
}

.isax-receipt-minus5:before {
  content: "ո";
}

.isax-receipt-search5:before {
  content: "չ";
}

.isax-receipt-square5:before {
  content: "պ";
}

.isax-receipt-text5:before {
  content: "ջ";
}

.isax-received5:before {
  content: "ռ";
}

.isax-receive-square5:before {
  content: "ս";
}

.isax-receive-square-25:before {
  content: "վ";
}

.isax-record5:before {
  content: "տ";
}

.isax-record-circle5:before {
  content: "ր";
}

.isax-recovery-convert5:before {
  content: "ց";
}

.isax-redo5:before {
  content: "ւ";
}

.isax-refresh5:before {
  content: "փ";
}

.isax-refresh-25:before {
  content: "ք";
}

.isax-refresh-circle5:before {
  content: "օ";
}

.isax-refresh-left-square5:before {
  content: "ֆ";
}

.isax-refresh-right-square5:before {
  content: "և";
}

.isax-refresh-square-25:before {
  content: "ֈ";
}

.isax-repeat5:before {
  content: "։";
}

.isax-repeat-circle5:before {
  content: "֊";
}

.isax-repeate-music5:before {
  content: "֋";
}

.isax-repeate-one5:before {
  content: "֌";
}

.isax-reserve5:before {
  content: "֍";
}

.isax-rotate-left5:before {
  content: "֎";
}

.isax-rotate-left-15:before {
  content: "֏";
}

.isax-rotate-right5:before {
  content: "֐";
}

.isax-rotate-right-15:before {
  content: "֑";
}

.isax-route-square5:before {
  content: "֒";
}

.isax-routing5:before {
  content: "֓";
}

.isax-routing-25:before {
  content: "֔";
}

.isax-row-horizontal5:before {
  content: "֕";
}

.isax-row-vertical5:before {
  content: "֖";
}

.isax-rulerpen5:before {
  content: "֗";
}

.isax-ruler5:before {
  content: "֘";
}

.isax-safe-home5:before {
  content: "֙";
}

.isax-sagittarius5:before {
  content: "֚";
}

.isax-save-25:before {
  content: "֛";
}

.isax-save-add5:before {
  content: "֜";
}

.isax-save-minus5:before {
  content: "֝";
}

.isax-save-remove5:before {
  content: "֞";
}

.isax-scan5:before {
  content: "֟";
}

.isax-scan-barcode5:before {
  content: "֠";
}

.isax-scanner5:before {
  content: "֡";
}

.isax-scanning5:before {
  content: "֢";
}

.isax-scissor5:before {
  content: "֣";
}

.isax-scissor-15:before {
  content: "֤";
}

.isax-screenmirroring5:before {
  content: "֥";
}

.isax-scroll5:before {
  content: "֦";
}

.isax-search-favorite5:before {
  content: "֧";
}

.isax-search-favorite-15:before {
  content: "֨";
}

.isax-search-normal5:before {
  content: "֩";
}

.isax-search-normal-15:before {
  content: "֪";
}

.isax-search-status5:before {
  content: "֫";
}

.isax-search-status-15:before {
  content: "֬";
}

.isax-search-zoom-in5:before {
  content: "֭";
}

.isax-search-zoom-in-15:before {
  content: "֮";
}

.isax-search-zoom-out5:before {
  content: "֯";
}

.isax-search-zoom-out-15:before {
  content: "ְ";
}

.isax-security5:before {
  content: "ֱ";
}

.isax-security-card5:before {
  content: "ֲ";
}

.isax-security-safe5:before {
  content: "ֳ";
}

.isax-security-time5:before {
  content: "ִ";
}

.isax-security-user5:before {
  content: "ֵ";
}

.isax-send5:before {
  content: "ֶ";
}

.isax-send-15:before {
  content: "ַ";
}

.isax-send-25:before {
  content: "ָ";
}

.isax-send-sqaure-25:before {
  content: "ֹ";
}

.isax-send-square5:before {
  content: "ֺ";
}

.isax-setting5:before {
  content: "ֻ";
}

.isax-setting-25:before {
  content: "ּ";
}

.isax-setting-35:before {
  content: "ֽ";
}

.isax-setting-45:before {
  content: "־";
}

.isax-setting-55:before {
  content: "ֿ";
}

.isax-settings5:before {
  content: "׀";
}

.isax-shapes5:before {
  content: "ׁ";
}

.isax-shapes-15:before {
  content: "ׂ";
}

.isax-share5:before {
  content: "׃";
}

.isax-shield-cross5:before {
  content: "ׄ";
}

.isax-shield-search5:before {
  content: "ׅ";
}

.isax-shield-security2:before {
  content: "׆";
}

.isax-shield-slash5:before {
  content: "ׇ";
}

.isax-shield-tick5:before {
  content: "׈";
}

.isax-ship5:before {
  content: "׉";
}

.isax-shop5:before {
  content: "׊";
}

.isax-shop-add5:before {
  content: "׋";
}

.isax-shopping-bag5:before {
  content: "׌";
}

.isax-shopping-cart5:before {
  content: "׍";
}

.isax-shop-remove5:before {
  content: "׎";
}

.isax-shuffle5:before {
  content: "׏";
}

.isax-sidebar-bottom5:before {
  content: "א";
}

.isax-sidebar-left5:before {
  content: "ב";
}

.isax-sidebar-right5:before {
  content: "ג";
}

.isax-sidebar-top5:before {
  content: "ד";
}

.isax-signpost5:before {
  content: "ה";
}

.isax-simcard5:before {
  content: "ו";
}

.isax-simcard-15:before {
  content: "ז";
}

.isax-simcard-25:before {
  content: "ח";
}

.isax-size5:before {
  content: "ט";
}

.isax-slash5:before {
  content: "י";
}

.isax-slider5:before {
  content: "ך";
}

.isax-slider-horizontal5:before {
  content: "כ";
}

.isax-slider-horizontal-15:before {
  content: "ל";
}

.isax-slider-vertical5:before {
  content: "ם";
}

.isax-slider-vertical-15:before {
  content: "מ";
}

.isax-smallcaps5:before {
  content: "ן";
}

.isax-smart-car5:before {
  content: "נ";
}

.isax-smart-home5:before {
  content: "ס";
}

.isax-smileys5:before {
  content: "ע";
}

.isax-sms5:before {
  content: "ף";
}

.isax-sms-edit5:before {
  content: "פ";
}

.isax-sms-notification5:before {
  content: "ץ";
}

.isax-sms-search5:before {
  content: "צ";
}

.isax-sms-star5:before {
  content: "ק";
}

.isax-sms-tracking5:before {
  content: "ר";
}

.isax-sort5:before {
  content: "ש";
}

.isax-sound5:before {
  content: "ת";
}

.isax-speaker5:before {
  content: "׫";
}

.isax-speedometer5:before {
  content: "׬";
}

.isax-star5:before {
  content: "׭";
}

.isax-star-15:before {
  content: "׮";
}

.isax-star-slash5:before {
  content: "ׯ";
}

.isax-status5:before {
  content: "װ";
}

.isax-status-up5:before {
  content: "ױ";
}

.isax-sticker5:before {
  content: "ײ";
}

.isax-stickynote5:before {
  content: "׳";
}

.isax-stop5:before {
  content: "״";
}

.isax-stop-circle5:before {
  content: "׵";
}

.isax-story5:before {
  content: "׶";
}

.isax-strongbox5:before {
  content: "׷";
}

.isax-strongbox-25:before {
  content: "׸";
}

.isax-subtitle5:before {
  content: "׹";
}

.isax-sun5:before {
  content: "׺";
}

.isax-sun-15:before {
  content: "׻";
}

.isax-sun-fog5:before {
  content: "׼";
}

.isax-tag5:before {
  content: "׽";
}

.isax-tag-25:before {
  content: "׾";
}

.isax-tag-cross5:before {
  content: "׿";
}

.isax-tag-right5:before {
  content: "؀";
}

.isax-tag-user5:before {
  content: "؁";
}

.isax-task5:before {
  content: "؂";
}

.isax-task-square5:before {
  content: "؃";
}

.isax-teacher5:before {
  content: "؄";
}

.isax-text5:before {
  content: "؅";
}

.isax-textalign-center5:before {
  content: "؆";
}

.isax-textalign-justifycenter5:before {
  content: "؇";
}

.isax-textalign-justifyleft5:before {
  content: "؈";
}

.isax-textalign-justifyright5:before {
  content: "؉";
}

.isax-textalign-left5:before {
  content: "؊";
}

.isax-textalign-right5:before {
  content: "؋";
}

.isax-text-block5:before {
  content: "،";
}

.isax-text-bold5:before {
  content: "؍";
}

.isax-text-italic5:before {
  content: "؎";
}

.isax-text-underline5:before {
  content: "؏";
}

.isax-tick-circle5:before {
  content: "ؐ";
}

.isax-ticket5:before {
  content: "ؑ";
}

.isax-ticket-25:before {
  content: "ؒ";
}

.isax-ticket-discount5:before {
  content: "ؓ";
}

.isax-ticket-expired5:before {
  content: "ؔ";
}

.isax-ticket-star5:before {
  content: "ؕ";
}

.isax-tick-square5:before {
  content: "ؖ";
}

.isax-timer5:before {
  content: "ؗ";
}

.isax-timer-15:before {
  content: "ؘ";
}

.isax-timer-pause5:before {
  content: "ؙ";
}

.isax-timer-start5:before {
  content: "ؚ";
}

.isax-toggle-off5:before {
  content: "؛";
}

.isax-toggle-off-circle5:before {
  content: "؜";
}

.isax-toggle-on5:before {
  content: "؝";
}

.isax-toggle-on-circle5:before {
  content: "؞";
}

.isax-trade5:before {
  content: "؟";
}

.isax-transaction-minus5:before {
  content: "ؠ";
}

.isax-translate5:before {
  content: "ء";
}

.isax-trash5:before {
  content: "آ";
}

.isax-tree5:before {
  content: "أ";
}

.isax-trend-down5:before {
  content: "ؤ";
}

.isax-trend-up5:before {
  content: "إ";
}

.isax-triangle5:before {
  content: "ئ";
}

.isax-truck4:before {
  content: "ا";
}

.isax-truck-fast4:before {
  content: "ب";
}

.isax-truck-remove3:before {
  content: "ة";
}

.isax-truck-tick5:before {
  content: "ت";
}

.isax-truck-time3:before {
  content: "ث";
}

.isax-trush-square5:before {
  content: "ج";
}

.isax-undo5:before {
  content: "ح";
}

.isax-unlimited5:before {
  content: "خ";
}

.isax-unlock5:before {
  content: "د";
}

.isax-user5:before {
  content: "ذ";
}

.isax-user-add5:before {
  content: "ر";
}

.isax-user-cirlce-add5:before {
  content: "ز";
}

.isax-user-edit5:before {
  content: "س";
}

.isax-user-minus5:before {
  content: "ش";
}

.isax-user-octagon5:before {
  content: "ص";
}

.isax-user-remove5:before {
  content: "ض";
}

.isax-user-search5:before {
  content: "ط";
}

.isax-user-square5:before {
  content: "ظ";
}

.isax-user-tag5:before {
  content: "ع";
}

.isax-user-tick5:before {
  content: "غ";
}

.isax-verify5:before {
  content: "ػ";
}

.isax-video5:before {
  content: "ؼ";
}

.isax-video-add5:before {
  content: "ؽ";
}

.isax-video-circle5:before {
  content: "ؾ";
}

.isax-video-horizontal5:before {
  content: "ؿ";
}

.isax-video-octagon5:before {
  content: "ـ";
}

.isax-video-play5:before {
  content: "ف";
}

.isax-video-remove5:before {
  content: "ق";
}

.isax-video-slash5 .path1:before {
  content: "ك";
  color: rgb(41, 45, 50);
  opacity: 0.4;
}

.isax-video-slash5 .path2:before {
  content: "ٳ";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-video-slash5 .path3:before {
  content: "ٴ";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-video-slash5 .path4:before {
  content: "ٵ";
  margin-left: -1em;
  color: rgb(41, 45, 50);
}

.isax-video-square5:before {
  content: "ل";
}

.isax-video-tick5:before {
  content: "م";
}

.isax-video-time5:before {
  content: "ن";
}

.isax-video-vertical5:before {
  content: "ه";
}

.isax-voice-cricle5:before {
  content: "و";
}

.isax-voice-square5:before {
  content: "ى";
}

.isax-volume-cross5:before {
  content: "ي";
}

.isax-volume-high5:before {
  content: "ً";
}

.isax-volume-low5:before {
  content: "ٌ";
}

.isax-volume-low-15:before {
  content: "ٍ";
}

.isax-volume-mute5:before {
  content: "َ";
}

.isax-volume-slash5:before {
  content: "ُ";
}

.isax-volume-up5:before {
  content: "ِ";
}

.isax-wallet5:before {
  content: "ّ";
}

.isax-wallet-15:before {
  content: "ْ";
}

.isax-wallet-25:before {
  content: "ٓ";
}

.isax-wallet-35:before {
  content: "ٔ";
}

.isax-wallet-add5:before {
  content: "ٕ";
}

.isax-wallet-add-15:before {
  content: "ٖ";
}

.isax-wallet-check5:before {
  content: "ٗ";
}

.isax-wallet-minus5:before {
  content: "٘";
}

.isax-wallet-money5:before {
  content: "ٙ";
}

.isax-wallet-remove5:before {
  content: "ٚ";
}

.isax-wallet-search5:before {
  content: "ٛ";
}

.isax-warning-25:before {
  content: "ٜ";
}

.isax-watch5:before {
  content: "ٝ";
}

.isax-watch-status5:before {
  content: "ٞ";
}

.isax-weight5:before {
  content: "ٟ";
}

.isax-weight-15:before {
  content: "٠";
}

.isax-wifi5:before {
  content: "١";
}

.isax-wifi-square5:before {
  content: "٢";
}

.isax-wind5:before {
  content: "٣";
}

.isax-wind-25:before {
  content: "٤";
}

.isax-woman5:before {
  content: "٥";
}

/*!
  Ionicons, v2.0.0
  Created by Ben Sperry for the Ionic Framework, http://ionicons.com/
  https://twitter.com/benjsperry  https://twitter.com/ionicframework
  MIT License: https://github.com/driftyco/ionicons

  Android-style icons originally built by Google’s
  Material Design Icons: https://github.com/google/material-design-icons
  used under CC BY http://creativecommons.org/licenses/by/4.0/
  Modified icons to fit ionicon’s grid from original.
*/
@font-face {
  font-family: "Ionicons";
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/ionicons/ionicons.eot?v=2.0.0");
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/ionicons/ionicons.eot?v=2.0.0#iefix") format("embedded-opentype"), url("/bitrix/templates/webdelivery/assets/css/../fonts/ionicons/ionicons.ttf?v=2.0.0") format("truetype"), url("/bitrix/templates/webdelivery/assets/css/../fonts/ionicons/ionicons.woff?v=2.0.0") format("woff"), url("/bitrix/templates/webdelivery/assets/css/../fonts/ionicons/ionicons.svg?v=2.0.0#Ionicons") format("svg");
  font-weight: normal;
  font-style: normal;
}
.ion, .ionicons, .ion-alert:before, .ion-alert-circled:before, .ion-android-add:before, .ion-android-add-circle:before, .ion-android-alarm-clock:before, .ion-android-alert:before, .ion-android-apps:before, .ion-android-archive:before, .ion-android-arrow-back:before, .ion-android-arrow-down:before, .ion-android-arrow-dropdown:before, .ion-android-arrow-dropdown-circle:before, .ion-android-arrow-dropleft:before, .ion-android-arrow-dropleft-circle:before, .ion-android-arrow-dropright:before, .ion-android-arrow-dropright-circle:before, .ion-android-arrow-dropup:before, .ion-android-arrow-dropup-circle:before, .ion-android-arrow-forward:before, .ion-android-arrow-up:before, .ion-android-attach:before, .ion-android-bar:before, .ion-android-bicycle:before, .ion-android-boat:before, .ion-android-bookmark:before, .ion-android-bulb:before, .ion-android-bus:before, .ion-android-calendar:before, .ion-android-call:before, .ion-android-camera:before, .ion-android-cancel:before, .ion-android-car:before, .ion-android-cart:before, .ion-android-chat:before, .ion-android-checkbox:before, .ion-android-checkbox-blank:before, .ion-android-checkbox-outline:before, .ion-android-checkbox-outline-blank:before, .ion-android-checkmark-circle:before, .ion-android-clipboard:before, .ion-android-close:before, .ion-android-cloud:before, .ion-android-cloud-circle:before, .ion-android-cloud-done:before, .ion-android-cloud-outline:before, .ion-android-color-palette:before, .ion-android-compass:before, .ion-android-contact:before, .ion-android-contacts:before, .ion-android-contract:before, .ion-android-create:before, .ion-android-delete:before, .ion-android-desktop:before, .ion-android-document:before, .ion-android-done:before, .ion-android-done-all:before, .ion-android-download:before, .ion-android-drafts:before, .ion-android-exit:before, .ion-android-expand:before, .ion-android-favorite:before, .ion-android-favorite-outline:before, .ion-android-film:before, .ion-android-folder:before, .ion-android-folder-open:before, .ion-android-funnel:before, .ion-android-globe:before, .ion-android-hand:before, .ion-android-hangout:before, .ion-android-happy:before, .ion-android-home:before, .ion-android-image:before, .ion-android-laptop:before, .ion-android-list:before, .ion-android-locate:before, .ion-android-lock:before, .ion-android-mail:before, .ion-android-map:before, .ion-android-menu:before, .ion-android-microphone:before, .ion-android-microphone-off:before, .ion-android-more-horizontal:before, .ion-android-more-vertical:before, .ion-android-navigate:before, .ion-android-notifications:before, .ion-android-notifications-none:before, .ion-android-notifications-off:before, .ion-android-open:before, .ion-android-options:before, .ion-android-people:before, .ion-android-person:before, .ion-android-person-add:before, .ion-android-phone-landscape:before, .ion-android-phone-portrait:before, .ion-android-pin:before, .ion-android-plane:before, .ion-android-playstore:before, .ion-android-print:before, .ion-android-radio-button-off:before, .ion-android-radio-button-on:before, .ion-android-refresh:before, .ion-android-remove:before, .ion-android-remove-circle:before, .ion-android-restaurant:before, .ion-android-sad:before, .ion-android-search:before, .ion-android-send:before, .ion-android-settings:before, .ion-android-share:before, .ion-android-share-alt:before, .ion-android-star:before, .ion-android-star-half:before, .ion-android-star-outline:before, .ion-android-stopwatch:before, .ion-android-subway:before, .ion-android-sunny:before, .ion-android-sync:before, .ion-android-textsms:before, .ion-android-time:before, .ion-android-train:before, .ion-android-unlock:before, .ion-android-upload:before, .ion-android-volume-down:before, .ion-android-volume-mute:before, .ion-android-volume-off:before, .ion-android-volume-up:before, .ion-android-walk:before, .ion-android-warning:before, .ion-android-watch:before, .ion-android-wifi:before, .ion-aperture:before, .ion-archive:before, .ion-arrow-down-a:before, .ion-arrow-down-b:before, .ion-arrow-down-c:before, .ion-arrow-expand:before, .ion-arrow-graph-down-left:before, .ion-arrow-graph-down-right:before, .ion-arrow-graph-up-left:before, .ion-arrow-graph-up-right:before, .ion-arrow-left-a:before, .ion-arrow-left-b:before, .ion-arrow-left-c:before, .ion-arrow-move:before, .ion-arrow-resize:before, .ion-arrow-return-left:before, .ion-arrow-return-right:before, .ion-arrow-right-a:before, .ion-arrow-right-b:before, .ion-arrow-right-c:before, .ion-arrow-shrink:before, .ion-arrow-swap:before, .ion-arrow-up-a:before, .ion-arrow-up-b:before, .ion-arrow-up-c:before, .ion-asterisk:before, .ion-at:before, .ion-backspace:before, .ion-backspace-outline:before, .ion-bag:before, .ion-battery-charging:before, .ion-battery-empty:before, .ion-battery-full:before, .ion-battery-half:before, .ion-battery-low:before, .ion-beaker:before, .ion-beer:before, .ion-bluetooth:before, .ion-bonfire:before, .ion-bookmark:before, .ion-bowtie:before, .ion-briefcase:before, .ion-bug:before, .ion-calculator:before, .ion-calendar:before, .ion-camera:before, .ion-card:before, .ion-cash:before, .ion-chatbox:before, .ion-chatbox-working:before, .ion-chatboxes:before, .ion-chatbubble:before, .ion-chatbubble-working:before, .ion-chatbubbles:before, .ion-checkmark:before, .ion-checkmark-circled:before, .ion-checkmark-round:before, .ion-chevron-down:before, .ion-chevron-left:before, .ion-chevron-right:before, .ion-chevron-up:before, .ion-clipboard:before, .ion-clock:before, .ion-close:before, .ion-close-circled:before, .ion-close-round:before, .ion-closed-captioning:before, .ion-cloud:before, .ion-code:before, .ion-code-download:before, .ion-code-working:before, .ion-coffee:before, .ion-compass:before, .ion-compose:before, .ion-connection-bars:before, .ion-contrast:before, .ion-crop:before, .ion-cube:before, .ion-disc:before, .ion-document:before, .ion-document-text:before, .ion-drag:before, .ion-earth:before, .ion-easel:before, .ion-edit:before, .ion-egg:before, .ion-eject:before, .ion-email:before, .ion-email-unread:before, .ion-erlenmeyer-flask:before, .ion-erlenmeyer-flask-bubbles:before, .ion-eye:before, .ion-eye-disabled:before, .ion-female:before, .ion-filing:before, .ion-film-marker:before, .ion-fireball:before, .ion-flag:before, .ion-flame:before, .ion-flash:before, .ion-flash-off:before, .ion-folder:before, .ion-fork:before, .ion-fork-repo:before, .ion-forward:before, .ion-funnel:before, .ion-gear-a:before, .ion-gear-b:before, .ion-grid:before, .ion-hammer:before, .ion-happy:before, .ion-happy-outline:before, .ion-headphone:before, .ion-heart:before, .ion-heart-broken:before, .ion-help:before, .ion-help-buoy:before, .ion-help-circled:before, .ion-home:before, .ion-icecream:before, .ion-image:before, .ion-images:before, .ion-information:before, .ion-information-circled:before, .ion-ionic:before, .ion-ios-alarm:before, .ion-ios-alarm-outline:before, .ion-ios-albums:before, .ion-ios-albums-outline:before, .ion-ios-americanfootball:before, .ion-ios-americanfootball-outline:before, .ion-ios-analytics:before, .ion-ios-analytics-outline:before, .ion-ios-arrow-back:before, .ion-ios-arrow-down:before, .ion-ios-arrow-forward:before, .ion-ios-arrow-left:before, .ion-ios-arrow-right:before, .ion-ios-arrow-thin-down:before, .ion-ios-arrow-thin-left:before, .ion-ios-arrow-thin-right:before, .ion-ios-arrow-thin-up:before, .ion-ios-arrow-up:before, .ion-ios-at:before, .ion-ios-at-outline:before, .ion-ios-barcode:before, .ion-ios-barcode-outline:before, .ion-ios-baseball:before, .ion-ios-baseball-outline:before, .ion-ios-basketball:before, .ion-ios-basketball-outline:before, .ion-ios-bell:before, .ion-ios-bell-outline:before, .ion-ios-body:before, .ion-ios-body-outline:before, .ion-ios-bolt:before, .ion-ios-bolt-outline:before, .ion-ios-book:before, .ion-ios-book-outline:before, .ion-ios-bookmarks:before, .ion-ios-bookmarks-outline:before, .ion-ios-box:before, .ion-ios-box-outline:before, .ion-ios-briefcase:before, .ion-ios-briefcase-outline:before, .ion-ios-browsers:before, .ion-ios-browsers-outline:before, .ion-ios-calculator:before, .ion-ios-calculator-outline:before, .ion-ios-calendar:before, .ion-ios-calendar-outline:before, .ion-ios-camera:before, .ion-ios-camera-outline:before, .ion-ios-cart:before, .ion-ios-cart-outline:before, .ion-ios-chatboxes:before, .ion-ios-chatboxes-outline:before, .ion-ios-chatbubble:before, .ion-ios-chatbubble-outline:before, .ion-ios-checkmark:before, .ion-ios-checkmark-empty:before, .ion-ios-checkmark-outline:before, .ion-ios-circle-filled:before, .ion-ios-circle-outline:before, .ion-ios-clock:before, .ion-ios-clock-outline:before, .ion-ios-close:before, .ion-ios-close-empty:before, .ion-ios-close-outline:before, .ion-ios-cloud:before, .ion-ios-cloud-download:before, .ion-ios-cloud-download-outline:before, .ion-ios-cloud-outline:before, .ion-ios-cloud-upload:before, .ion-ios-cloud-upload-outline:before, .ion-ios-cloudy:before, .ion-ios-cloudy-night:before, .ion-ios-cloudy-night-outline:before, .ion-ios-cloudy-outline:before, .ion-ios-cog:before, .ion-ios-cog-outline:before, .ion-ios-color-filter:before, .ion-ios-color-filter-outline:before, .ion-ios-color-wand:before, .ion-ios-color-wand-outline:before, .ion-ios-compose:before, .ion-ios-compose-outline:before, .ion-ios-contact:before, .ion-ios-contact-outline:before, .ion-ios-copy:before, .ion-ios-copy-outline:before, .ion-ios-crop:before, .ion-ios-crop-strong:before, .ion-ios-download:before, .ion-ios-download-outline:before, .ion-ios-drag:before, .ion-ios-email:before, .ion-ios-email-outline:before, .ion-ios-eye:before, .ion-ios-eye-outline:before, .ion-ios-fastforward:before, .ion-ios-fastforward-outline:before, .ion-ios-filing:before, .ion-ios-filing-outline:before, .ion-ios-film:before, .ion-ios-film-outline:before, .ion-ios-flag:before, .ion-ios-flag-outline:before, .ion-ios-flame:before, .ion-ios-flame-outline:before, .ion-ios-flask:before, .ion-ios-flask-outline:before, .ion-ios-flower:before, .ion-ios-flower-outline:before, .ion-ios-folder:before, .ion-ios-folder-outline:before, .ion-ios-football:before, .ion-ios-football-outline:before, .ion-ios-game-controller-a:before, .ion-ios-game-controller-a-outline:before, .ion-ios-game-controller-b:before, .ion-ios-game-controller-b-outline:before, .ion-ios-gear:before, .ion-ios-gear-outline:before, .ion-ios-glasses:before, .ion-ios-glasses-outline:before, .ion-ios-grid-view:before, .ion-ios-grid-view-outline:before, .ion-ios-heart:before, .ion-ios-heart-outline:before, .ion-ios-help:before, .ion-ios-help-empty:before, .ion-ios-help-outline:before, .ion-ios-home:before, .ion-ios-home-outline:before, .ion-ios-infinite:before, .ion-ios-infinite-outline:before, .ion-ios-information:before, .ion-ios-information-empty:before, .ion-ios-information-outline:before, .ion-ios-ionic-outline:before, .ion-ios-keypad:before, .ion-ios-keypad-outline:before, .ion-ios-lightbulb:before, .ion-ios-lightbulb-outline:before, .ion-ios-list:before, .ion-ios-list-outline:before, .ion-ios-location:before, .ion-ios-location-outline:before, .ion-ios-locked:before, .ion-ios-locked-outline:before, .ion-ios-loop:before, .ion-ios-loop-strong:before, .ion-ios-medical:before, .ion-ios-medical-outline:before, .ion-ios-medkit:before, .ion-ios-medkit-outline:before, .ion-ios-mic:before, .ion-ios-mic-off:before, .ion-ios-mic-outline:before, .ion-ios-minus:before, .ion-ios-minus-empty:before, .ion-ios-minus-outline:before, .ion-ios-monitor:before, .ion-ios-monitor-outline:before, .ion-ios-moon:before, .ion-ios-moon-outline:before, .ion-ios-more:before, .ion-ios-more-outline:before, .ion-ios-musical-note:before, .ion-ios-musical-notes:before, .ion-ios-navigate:before, .ion-ios-navigate-outline:before, .ion-ios-nutrition:before, .ion-ios-nutrition-outline:before, .ion-ios-paper:before, .ion-ios-paper-outline:before, .ion-ios-paperplane:before, .ion-ios-paperplane-outline:before, .ion-ios-partlysunny:before, .ion-ios-partlysunny-outline:before, .ion-ios-pause:before, .ion-ios-pause-outline:before, .ion-ios-paw:before, .ion-ios-paw-outline:before, .ion-ios-people:before, .ion-ios-people-outline:before, .ion-ios-person:before, .ion-ios-person-outline:before, .ion-ios-personadd:before, .ion-ios-personadd-outline:before, .ion-ios-photos:before, .ion-ios-photos-outline:before, .ion-ios-pie:before, .ion-ios-pie-outline:before, .ion-ios-pint:before, .ion-ios-pint-outline:before, .ion-ios-play:before, .ion-ios-play-outline:before, .ion-ios-plus:before, .ion-ios-plus-empty:before, .ion-ios-plus-outline:before, .ion-ios-pricetag:before, .ion-ios-pricetag-outline:before, .ion-ios-pricetags:before, .ion-ios-pricetags-outline:before, .ion-ios-printer:before, .ion-ios-printer-outline:before, .ion-ios-pulse:before, .ion-ios-pulse-strong:before, .ion-ios-rainy:before, .ion-ios-rainy-outline:before, .ion-ios-recording:before, .ion-ios-recording-outline:before, .ion-ios-redo:before, .ion-ios-redo-outline:before, .ion-ios-refresh:before, .ion-ios-refresh-empty:before, .ion-ios-refresh-outline:before, .ion-ios-reload:before, .ion-ios-reverse-camera:before, .ion-ios-reverse-camera-outline:before, .ion-ios-rewind:before, .ion-ios-rewind-outline:before, .ion-ios-rose:before, .ion-ios-rose-outline:before, .ion-ios-search:before, .ion-ios-search-strong:before, .ion-ios-settings:before, .ion-ios-settings-strong:before, .ion-ios-shuffle:before, .ion-ios-shuffle-strong:before, .ion-ios-skipbackward:before, .ion-ios-skipbackward-outline:before, .ion-ios-skipforward:before, .ion-ios-skipforward-outline:before, .ion-ios-snowy:before, .ion-ios-speedometer:before, .ion-ios-speedometer-outline:before, .ion-ios-star:before, .ion-ios-star-half:before, .ion-ios-star-outline:before, .ion-ios-stopwatch:before, .ion-ios-stopwatch-outline:before, .ion-ios-sunny:before, .ion-ios-sunny-outline:before, .ion-ios-telephone:before, .ion-ios-telephone-outline:before, .ion-ios-tennisball:before, .ion-ios-tennisball-outline:before, .ion-ios-thunderstorm:before, .ion-ios-thunderstorm-outline:before, .ion-ios-time:before, .ion-ios-time-outline:before, .ion-ios-timer:before, .ion-ios-timer-outline:before, .ion-ios-toggle:before, .ion-ios-toggle-outline:before, .ion-ios-trash:before, .ion-ios-trash-outline:before, .ion-ios-undo:before, .ion-ios-undo-outline:before, .ion-ios-unlocked:before, .ion-ios-unlocked-outline:before, .ion-ios-upload:before, .ion-ios-upload-outline:before, .ion-ios-videocam:before, .ion-ios-videocam-outline:before, .ion-ios-volume-high:before, .ion-ios-volume-low:before, .ion-ios-wineglass:before, .ion-ios-wineglass-outline:before, .ion-ios-world:before, .ion-ios-world-outline:before, .ion-ipad:before, .ion-iphone:before, .ion-ipod:before, .ion-jet:before, .ion-key:before, .ion-knife:before, .ion-laptop:before, .ion-leaf:before, .ion-levels:before, .ion-lightbulb:before, .ion-link:before, .ion-load-a:before, .ion-load-b:before, .ion-load-c:before, .ion-load-d:before, .ion-location:before, .ion-lock-combination:before, .ion-locked:before, .ion-log-in:before, .ion-log-out:before, .ion-loop:before, .ion-magnet:before, .ion-male:before, .ion-man:before, .ion-map:before, .ion-medkit:before, .ion-merge:before, .ion-mic-a:before, .ion-mic-b:before, .ion-mic-c:before, .ion-minus:before, .ion-minus-circled:before, .ion-minus-round:before, .ion-model-s:before, .ion-monitor:before, .ion-more:before, .ion-mouse:before, .ion-music-note:before, .ion-navicon:before, .ion-navicon-round:before, .ion-navigate:before, .ion-network:before, .ion-no-smoking:before, .ion-nuclear:before, .ion-outlet:before, .ion-paintbrush:before, .ion-paintbucket:before, .ion-paper-airplane:before, .ion-paperclip:before, .ion-pause:before, .ion-person:before, .ion-person-add:before, .ion-person-stalker:before, .ion-pie-graph:before, .ion-pin:before, .ion-pinpoint:before, .ion-pizza:before, .ion-plane:before, .ion-planet:before, .ion-play:before, .ion-playstation:before, .ion-plus:before, .ion-plus-circled:before, .ion-plus-round:before, .ion-podium:before, .ion-pound:before, .ion-power:before, .ion-pricetag:before, .ion-pricetags:before, .ion-printer:before, .ion-pull-request:before, .ion-qr-scanner:before, .ion-quote:before, .ion-radio-waves:before, .ion-record:before, .ion-refresh:before, .ion-reply:before, .ion-reply-all:before, .ion-ribbon-a:before, .ion-ribbon-b:before, .ion-sad:before, .ion-sad-outline:before, .ion-scissors:before, .ion-search:before, .ion-settings:before, .ion-share:before, .ion-shuffle:before, .ion-skip-backward:before, .ion-skip-forward:before, .ion-social-android:before, .ion-social-android-outline:before, .ion-social-angular:before, .ion-social-angular-outline:before, .ion-social-apple:before, .ion-social-apple-outline:before, .ion-social-bitcoin:before, .ion-social-bitcoin-outline:before, .ion-social-buffer:before, .ion-social-buffer-outline:before, .ion-social-chrome:before, .ion-social-chrome-outline:before, .ion-social-codepen:before, .ion-social-codepen-outline:before, .ion-social-css3:before, .ion-social-css3-outline:before, .ion-social-designernews:before, .ion-social-designernews-outline:before, .ion-social-dribbble:before, .ion-social-dribbble-outline:before, .ion-social-dropbox:before, .ion-social-dropbox-outline:before, .ion-social-euro:before, .ion-social-euro-outline:before, .ion-social-facebook:before, .ion-social-facebook-outline:before, .ion-social-foursquare:before, .ion-social-foursquare-outline:before, .ion-social-freebsd-devil:before, .ion-social-github:before, .ion-social-github-outline:before, .ion-social-google:before, .ion-social-google-outline:before, .ion-social-googleplus:before, .ion-social-googleplus-outline:before, .ion-social-hackernews:before, .ion-social-hackernews-outline:before, .ion-social-html5:before, .ion-social-html5-outline:before, .ion-social-instagram:before, .ion-social-instagram-outline:before, .ion-social-javascript:before, .ion-social-javascript-outline:before, .ion-social-linkedin:before, .ion-social-linkedin-outline:before, .ion-social-markdown:before, .ion-social-nodejs:before, .ion-social-octocat:before, .ion-social-pinterest:before, .ion-social-pinterest-outline:before, .ion-social-python:before, .ion-social-reddit:before, .ion-social-reddit-outline:before, .ion-social-rss:before, .ion-social-rss-outline:before, .ion-social-sass:before, .ion-social-skype:before, .ion-social-skype-outline:before, .ion-social-snapchat:before, .ion-social-snapchat-outline:before, .ion-social-tumblr:before, .ion-social-tumblr-outline:before, .ion-social-tux:before, .ion-social-twitch:before, .ion-social-twitch-outline:before, .ion-social-twitter:before, .ion-social-twitter-outline:before, .ion-social-usd:before, .ion-social-usd-outline:before, .ion-social-vimeo:before, .ion-social-vimeo-outline:before, .ion-social-whatsapp:before, .ion-social-whatsapp-outline:before, .ion-social-windows:before, .ion-social-windows-outline:before, .ion-social-wordpress:before, .ion-social-wordpress-outline:before, .ion-social-yahoo:before, .ion-social-yahoo-outline:before, .ion-social-yen:before, .ion-social-yen-outline:before, .ion-social-youtube:before, .ion-social-youtube-outline:before, .ion-soup-can:before, .ion-soup-can-outline:before, .ion-speakerphone:before, .ion-speedometer:before, .ion-spoon:before, .ion-star:before, .ion-stats-bars:before, .ion-steam:before, .ion-stop:before, .ion-thermometer:before, .ion-thumbsdown:before, .ion-thumbsup:before, .ion-toggle:before, .ion-toggle-filled:before, .ion-transgender:before, .ion-trash-a:before, .ion-trash-b:before, .ion-trophy:before, .ion-tshirt:before, .ion-tshirt-outline:before, .ion-umbrella:before, .ion-university:before, .ion-unlocked:before, .ion-upload:before, .ion-usb:before, .ion-videocamera:before, .ion-volume-high:before, .ion-volume-low:before, .ion-volume-medium:before, .ion-volume-mute:before, .ion-wand:before, .ion-waterdrop:before, .ion-wifi:before, .ion-wineglass:before, .ion-woman:before, .ion-wrench:before, .ion-xbox:before {
  display: inline-block;
  font-family: "ionicons";
  speak: none;
  font-style: normal;
  font-weight: normal;
  font-variant: normal;
  text-transform: none;
  text-rendering: auto;
  line-height: 1;
  -webkit-font-smoothing: antialiased;
  -moz-osx-font-smoothing: grayscale;
}

.ion-alert:before {
  content: "\f101";
}

.ion-alert-circled:before {
  content: "\f100";
}

.ion-android-add:before {
  content: "\f2c7";
}

.ion-android-add-circle:before {
  content: "\f359";
}

.ion-android-alarm-clock:before {
  content: "\f35a";
}

.ion-android-alert:before {
  content: "\f35b";
}

.ion-android-apps:before {
  content: "\f35c";
}

.ion-android-archive:before {
  content: "\f2c9";
}

.ion-android-arrow-back:before {
  content: "\f2ca";
}

.ion-android-arrow-down:before {
  content: "\f35d";
}

.ion-android-arrow-dropdown:before {
  content: "\f35f";
}

.ion-android-arrow-dropdown-circle:before {
  content: "\f35e";
}

.ion-android-arrow-dropleft:before {
  content: "\f361";
}

.ion-android-arrow-dropleft-circle:before {
  content: "\f360";
}

.ion-android-arrow-dropright:before {
  content: "\f363";
}

.ion-android-arrow-dropright-circle:before {
  content: "\f362";
}

.ion-android-arrow-dropup:before {
  content: "\f365";
}

.ion-android-arrow-dropup-circle:before {
  content: "\f364";
}

.ion-android-arrow-forward:before {
  content: "\f30f";
}

.ion-android-arrow-up:before {
  content: "\f366";
}

.ion-android-attach:before {
  content: "\f367";
}

.ion-android-bar:before {
  content: "\f368";
}

.ion-android-bicycle:before {
  content: "\f369";
}

.ion-android-boat:before {
  content: "\f36a";
}

.ion-android-bookmark:before {
  content: "\f36b";
}

.ion-android-bulb:before {
  content: "\f36c";
}

.ion-android-bus:before {
  content: "\f36d";
}

.ion-android-calendar:before {
  content: "\f2d1";
}

.ion-android-call:before {
  content: "\f2d2";
}

.ion-android-camera:before {
  content: "\f2d3";
}

.ion-android-cancel:before {
  content: "\f36e";
}

.ion-android-car:before {
  content: "\f36f";
}

.ion-android-cart:before {
  content: "\f370";
}

.ion-android-chat:before {
  content: "\f2d4";
}

.ion-android-checkbox:before {
  content: "\f374";
}

.ion-android-checkbox-blank:before {
  content: "\f371";
}

.ion-android-checkbox-outline:before {
  content: "\f373";
}

.ion-android-checkbox-outline-blank:before {
  content: "\f372";
}

.ion-android-checkmark-circle:before {
  content: "\f375";
}

.ion-android-clipboard:before {
  content: "\f376";
}

.ion-android-close:before {
  content: "\f2d7";
}

.ion-android-cloud:before {
  content: "\f37a";
}

.ion-android-cloud-circle:before {
  content: "\f377";
}

.ion-android-cloud-done:before {
  content: "\f378";
}

.ion-android-cloud-outline:before {
  content: "\f379";
}

.ion-android-color-palette:before {
  content: "\f37b";
}

.ion-android-compass:before {
  content: "\f37c";
}

.ion-android-contact:before {
  content: "\f2d8";
}

.ion-android-contacts:before {
  content: "\f2d9";
}

.ion-android-contract:before {
  content: "\f37d";
}

.ion-android-create:before {
  content: "\f37e";
}

.ion-android-delete:before {
  content: "\f37f";
}

.ion-android-desktop:before {
  content: "\f380";
}

.ion-android-document:before {
  content: "\f381";
}

.ion-android-done:before {
  content: "\f383";
}

.ion-android-done-all:before {
  content: "\f382";
}

.ion-android-download:before {
  content: "\f2dd";
}

.ion-android-drafts:before {
  content: "\f384";
}

.ion-android-exit:before {
  content: "\f385";
}

.ion-android-expand:before {
  content: "\f386";
}

.ion-android-favorite:before {
  content: "\f388";
}

.ion-android-favorite-outline:before {
  content: "\f387";
}

.ion-android-film:before {
  content: "\f389";
}

.ion-android-folder:before {
  content: "\f2e0";
}

.ion-android-folder-open:before {
  content: "\f38a";
}

.ion-android-funnel:before {
  content: "\f38b";
}

.ion-android-globe:before {
  content: "\f38c";
}

.ion-android-hand:before {
  content: "\f2e3";
}

.ion-android-hangout:before {
  content: "\f38d";
}

.ion-android-happy:before {
  content: "\f38e";
}

.ion-android-home:before {
  content: "\f38f";
}

.ion-android-image:before {
  content: "\f2e4";
}

.ion-android-laptop:before {
  content: "\f390";
}

.ion-android-list:before {
  content: "\f391";
}

.ion-android-locate:before {
  content: "\f2e9";
}

.ion-android-lock:before {
  content: "\f392";
}

.ion-android-mail:before {
  content: "\f2eb";
}

.ion-android-map:before {
  content: "\f393";
}

.ion-android-menu:before {
  content: "\f394";
}

.ion-android-microphone:before {
  content: "\f2ec";
}

.ion-android-microphone-off:before {
  content: "\f395";
}

.ion-android-more-horizontal:before {
  content: "\f396";
}

.ion-android-more-vertical:before {
  content: "\f397";
}

.ion-android-navigate:before {
  content: "\f398";
}

.ion-android-notifications:before {
  content: "\f39b";
}

.ion-android-notifications-none:before {
  content: "\f399";
}

.ion-android-notifications-off:before {
  content: "\f39a";
}

.ion-android-open:before {
  content: "\f39c";
}

.ion-android-options:before {
  content: "\f39d";
}

.ion-android-people:before {
  content: "\f39e";
}

.ion-android-person:before {
  content: "\f3a0";
}

.ion-android-person-add:before {
  content: "\f39f";
}

.ion-android-phone-landscape:before {
  content: "\f3a1";
}

.ion-android-phone-portrait:before {
  content: "\f3a2";
}

.ion-android-pin:before {
  content: "\f3a3";
}

.ion-android-plane:before {
  content: "\f3a4";
}

.ion-android-playstore:before {
  content: "\f2f0";
}

.ion-android-print:before {
  content: "\f3a5";
}

.ion-android-radio-button-off:before {
  content: "\f3a6";
}

.ion-android-radio-button-on:before {
  content: "\f3a7";
}

.ion-android-refresh:before {
  content: "\f3a8";
}

.ion-android-remove:before {
  content: "\f2f4";
}

.ion-android-remove-circle:before {
  content: "\f3a9";
}

.ion-android-restaurant:before {
  content: "\f3aa";
}

.ion-android-sad:before {
  content: "\f3ab";
}

.ion-android-search:before {
  content: "\f2f5";
}

.ion-android-send:before {
  content: "\f2f6";
}

.ion-android-settings:before {
  content: "\f2f7";
}

.ion-android-share:before {
  content: "\f2f8";
}

.ion-android-share-alt:before {
  content: "\f3ac";
}

.ion-android-star:before {
  content: "\f2fc";
}

.ion-android-star-half:before {
  content: "\f3ad";
}

.ion-android-star-outline:before {
  content: "\f3ae";
}

.ion-android-stopwatch:before {
  content: "\f2fd";
}

.ion-android-subway:before {
  content: "\f3af";
}

.ion-android-sunny:before {
  content: "\f3b0";
}

.ion-android-sync:before {
  content: "\f3b1";
}

.ion-android-textsms:before {
  content: "\f3b2";
}

.ion-android-time:before {
  content: "\f3b3";
}

.ion-android-train:before {
  content: "\f3b4";
}

.ion-android-unlock:before {
  content: "\f3b5";
}

.ion-android-upload:before {
  content: "\f3b6";
}

.ion-android-volume-down:before {
  content: "\f3b7";
}

.ion-android-volume-mute:before {
  content: "\f3b8";
}

.ion-android-volume-off:before {
  content: "\f3b9";
}

.ion-android-volume-up:before {
  content: "\f3ba";
}

.ion-android-walk:before {
  content: "\f3bb";
}

.ion-android-warning:before {
  content: "\f3bc";
}

.ion-android-watch:before {
  content: "\f3bd";
}

.ion-android-wifi:before {
  content: "\f305";
}

.ion-aperture:before {
  content: "\f313";
}

.ion-archive:before {
  content: "\f102";
}

.ion-arrow-down-a:before {
  content: "\f103";
}

.ion-arrow-down-b:before {
  content: "\f104";
}

.ion-arrow-down-c:before {
  content: "\f105";
}

.ion-arrow-expand:before {
  content: "\f25e";
}

.ion-arrow-graph-down-left:before {
  content: "\f25f";
}

.ion-arrow-graph-down-right:before {
  content: "\f260";
}

.ion-arrow-graph-up-left:before {
  content: "\f261";
}

.ion-arrow-graph-up-right:before {
  content: "\f262";
}

.ion-arrow-left-a:before {
  content: "\f106";
}

.ion-arrow-left-b:before {
  content: "\f107";
}

.ion-arrow-left-c:before {
  content: "\f108";
}

.ion-arrow-move:before {
  content: "\f263";
}

.ion-arrow-resize:before {
  content: "\f264";
}

.ion-arrow-return-left:before {
  content: "\f265";
}

.ion-arrow-return-right:before {
  content: "\f266";
}

.ion-arrow-right-a:before {
  content: "\f109";
}

.ion-arrow-right-b:before {
  content: "\f10a";
}

.ion-arrow-right-c:before {
  content: "\f10b";
}

.ion-arrow-shrink:before {
  content: "\f267";
}

.ion-arrow-swap:before {
  content: "\f268";
}

.ion-arrow-up-a:before {
  content: "\f10c";
}

.ion-arrow-up-b:before {
  content: "\f10d";
}

.ion-arrow-up-c:before {
  content: "\f10e";
}

.ion-asterisk:before {
  content: "\f314";
}

.ion-at:before {
  content: "\f10f";
}

.ion-backspace:before {
  content: "\f3bf";
}

.ion-backspace-outline:before {
  content: "\f3be";
}

.ion-bag:before {
  content: "\f110";
}

.ion-battery-charging:before {
  content: "\f111";
}

.ion-battery-empty:before {
  content: "\f112";
}

.ion-battery-full:before {
  content: "\f113";
}

.ion-battery-half:before {
  content: "\f114";
}

.ion-battery-low:before {
  content: "\f115";
}

.ion-beaker:before {
  content: "\f269";
}

.ion-beer:before {
  content: "\f26a";
}

.ion-bluetooth:before {
  content: "\f116";
}

.ion-bonfire:before {
  content: "\f315";
}

.ion-bookmark:before {
  content: "\f26b";
}

.ion-bowtie:before {
  content: "\f3c0";
}

.ion-briefcase:before {
  content: "\f26c";
}

.ion-bug:before {
  content: "\f2be";
}

.ion-calculator:before {
  content: "\f26d";
}

.ion-calendar:before {
  content: "\f117";
}

.ion-camera:before {
  content: "\f118";
}

.ion-card:before {
  content: "\f119";
}

.ion-cash:before {
  content: "\f316";
}

.ion-chatbox:before {
  content: "\f11b";
}

.ion-chatbox-working:before {
  content: "\f11a";
}

.ion-chatboxes:before {
  content: "\f11c";
}

.ion-chatbubble:before {
  content: "\f11e";
}

.ion-chatbubble-working:before {
  content: "\f11d";
}

.ion-chatbubbles:before {
  content: "\f11f";
}

.ion-checkmark:before {
  content: "\f122";
}

.ion-checkmark-circled:before {
  content: "\f120";
}

.ion-checkmark-round:before {
  content: "\f121";
}

.ion-chevron-down:before {
  content: "\f123";
}

.ion-chevron-left:before {
  content: "\f124";
}

.ion-chevron-right:before {
  content: "\f125";
}

.ion-chevron-up:before {
  content: "\f126";
}

.ion-clipboard:before {
  content: "\f127";
}

.ion-clock:before {
  content: "\f26e";
}

.ion-close:before {
  content: "\f12a";
}

.ion-close-circled:before {
  content: "\f128";
}

.ion-close-round:before {
  content: "\f129";
}

.ion-closed-captioning:before {
  content: "\f317";
}

.ion-cloud:before {
  content: "\f12b";
}

.ion-code:before {
  content: "\f271";
}

.ion-code-download:before {
  content: "\f26f";
}

.ion-code-working:before {
  content: "\f270";
}

.ion-coffee:before {
  content: "\f272";
}

.ion-compass:before {
  content: "\f273";
}

.ion-compose:before {
  content: "\f12c";
}

.ion-connection-bars:before {
  content: "\f274";
}

.ion-contrast:before {
  content: "\f275";
}

.ion-crop:before {
  content: "\f3c1";
}

.ion-cube:before {
  content: "\f318";
}

.ion-disc:before {
  content: "\f12d";
}

.ion-document:before {
  content: "\f12f";
}

.ion-document-text:before {
  content: "\f12e";
}

.ion-drag:before {
  content: "\f130";
}

.ion-earth:before {
  content: "\f276";
}

.ion-easel:before {
  content: "\f3c2";
}

.ion-edit:before {
  content: "\f2bf";
}

.ion-egg:before {
  content: "\f277";
}

.ion-eject:before {
  content: "\f131";
}

.ion-email:before {
  content: "\f132";
}

.ion-email-unread:before {
  content: "\f3c3";
}

.ion-erlenmeyer-flask:before {
  content: "\f3c5";
}

.ion-erlenmeyer-flask-bubbles:before {
  content: "\f3c4";
}

.ion-eye:before {
  content: "\f133";
}

.ion-eye-disabled:before {
  content: "\f306";
}

.ion-female:before {
  content: "\f278";
}

.ion-filing:before {
  content: "\f134";
}

.ion-film-marker:before {
  content: "\f135";
}

.ion-fireball:before {
  content: "\f319";
}

.ion-flag:before {
  content: "\f279";
}

.ion-flame:before {
  content: "\f31a";
}

.ion-flash:before {
  content: "\f137";
}

.ion-flash-off:before {
  content: "\f136";
}

.ion-folder:before {
  content: "\f139";
}

.ion-fork:before {
  content: "\f27a";
}

.ion-fork-repo:before {
  content: "\f2c0";
}

.ion-forward:before {
  content: "\f13a";
}

.ion-funnel:before {
  content: "\f31b";
}

.ion-gear-a:before {
  content: "\f13d";
}

.ion-gear-b:before {
  content: "\f13e";
}

.ion-grid:before {
  content: "\f13f";
}

.ion-hammer:before {
  content: "\f27b";
}

.ion-happy:before {
  content: "\f31c";
}

.ion-happy-outline:before {
  content: "\f3c6";
}

.ion-headphone:before {
  content: "\f140";
}

.ion-heart:before {
  content: "\f141";
}

.ion-heart-broken:before {
  content: "\f31d";
}

.ion-help:before {
  content: "\f143";
}

.ion-help-buoy:before {
  content: "\f27c";
}

.ion-help-circled:before {
  content: "\f142";
}

.ion-home:before {
  content: "\f144";
}

.ion-icecream:before {
  content: "\f27d";
}

.ion-image:before {
  content: "\f147";
}

.ion-images:before {
  content: "\f148";
}

.ion-information:before {
  content: "\f14a";
}

.ion-information-circled:before {
  content: "\f149";
}

.ion-ionic:before {
  content: "\f14b";
}

.ion-ios-alarm:before {
  content: "\f3c8";
}

.ion-ios-alarm-outline:before {
  content: "\f3c7";
}

.ion-ios-albums:before {
  content: "\f3ca";
}

.ion-ios-albums-outline:before {
  content: "\f3c9";
}

.ion-ios-americanfootball:before {
  content: "\f3cc";
}

.ion-ios-americanfootball-outline:before {
  content: "\f3cb";
}

.ion-ios-analytics:before {
  content: "\f3ce";
}

.ion-ios-analytics-outline:before {
  content: "\f3cd";
}

.ion-ios-arrow-back:before {
  content: "\f3cf";
}

.ion-ios-arrow-down:before {
  content: "\f3d0";
}

.ion-ios-arrow-forward:before {
  content: "\f3d1";
}

.ion-ios-arrow-left:before {
  content: "\f3d2";
}

.ion-ios-arrow-right:before {
  content: "\f3d3";
}

.ion-ios-arrow-thin-down:before {
  content: "\f3d4";
}

.ion-ios-arrow-thin-left:before {
  content: "\f3d5";
}

.ion-ios-arrow-thin-right:before {
  content: "\f3d6";
}

.ion-ios-arrow-thin-up:before {
  content: "\f3d7";
}

.ion-ios-arrow-up:before {
  content: "\f3d8";
}

.ion-ios-at:before {
  content: "\f3da";
}

.ion-ios-at-outline:before {
  content: "\f3d9";
}

.ion-ios-barcode:before {
  content: "\f3dc";
}

.ion-ios-barcode-outline:before {
  content: "\f3db";
}

.ion-ios-baseball:before {
  content: "\f3de";
}

.ion-ios-baseball-outline:before {
  content: "\f3dd";
}

.ion-ios-basketball:before {
  content: "\f3e0";
}

.ion-ios-basketball-outline:before {
  content: "\f3df";
}

.ion-ios-bell:before {
  content: "\f3e2";
}

.ion-ios-bell-outline:before {
  content: "\f3e1";
}

.ion-ios-body:before {
  content: "\f3e4";
}

.ion-ios-body-outline:before {
  content: "\f3e3";
}

.ion-ios-bolt:before {
  content: "\f3e6";
}

.ion-ios-bolt-outline:before {
  content: "\f3e5";
}

.ion-ios-book:before {
  content: "\f3e8";
}

.ion-ios-book-outline:before {
  content: "\f3e7";
}

.ion-ios-bookmarks:before {
  content: "\f3ea";
}

.ion-ios-bookmarks-outline:before {
  content: "\f3e9";
}

.ion-ios-box:before {
  content: "\f3ec";
}

.ion-ios-box-outline:before {
  content: "\f3eb";
}

.ion-ios-briefcase:before {
  content: "\f3ee";
}

.ion-ios-briefcase-outline:before {
  content: "\f3ed";
}

.ion-ios-browsers:before {
  content: "\f3f0";
}

.ion-ios-browsers-outline:before {
  content: "\f3ef";
}

.ion-ios-calculator:before {
  content: "\f3f2";
}

.ion-ios-calculator-outline:before {
  content: "\f3f1";
}

.ion-ios-calendar:before {
  content: "\f3f4";
}

.ion-ios-calendar-outline:before {
  content: "\f3f3";
}

.ion-ios-camera:before {
  content: "\f3f6";
}

.ion-ios-camera-outline:before {
  content: "\f3f5";
}

.ion-ios-cart:before {
  content: "\f3f8";
}

.ion-ios-cart-outline:before {
  content: "\f3f7";
}

.ion-ios-chatboxes:before {
  content: "\f3fa";
}

.ion-ios-chatboxes-outline:before {
  content: "\f3f9";
}

.ion-ios-chatbubble:before {
  content: "\f3fc";
}

.ion-ios-chatbubble-outline:before {
  content: "\f3fb";
}

.ion-ios-checkmark:before {
  content: "\f3ff";
}

.ion-ios-checkmark-empty:before {
  content: "\f3fd";
}

.ion-ios-checkmark-outline:before {
  content: "\f3fe";
}

.ion-ios-circle-filled:before {
  content: "\f400";
}

.ion-ios-circle-outline:before {
  content: "\f401";
}

.ion-ios-clock:before {
  content: "\f403";
}

.ion-ios-clock-outline:before {
  content: "\f402";
}

.ion-ios-close:before {
  content: "\f406";
}

.ion-ios-close-empty:before {
  content: "\f404";
}

.ion-ios-close-outline:before {
  content: "\f405";
}

.ion-ios-cloud:before {
  content: "\f40c";
}

.ion-ios-cloud-download:before {
  content: "\f408";
}

.ion-ios-cloud-download-outline:before {
  content: "\f407";
}

.ion-ios-cloud-outline:before {
  content: "\f409";
}

.ion-ios-cloud-upload:before {
  content: "\f40b";
}

.ion-ios-cloud-upload-outline:before {
  content: "\f40a";
}

.ion-ios-cloudy:before {
  content: "\f410";
}

.ion-ios-cloudy-night:before {
  content: "\f40e";
}

.ion-ios-cloudy-night-outline:before {
  content: "\f40d";
}

.ion-ios-cloudy-outline:before {
  content: "\f40f";
}

.ion-ios-cog:before {
  content: "\f412";
}

.ion-ios-cog-outline:before {
  content: "\f411";
}

.ion-ios-color-filter:before {
  content: "\f414";
}

.ion-ios-color-filter-outline:before {
  content: "\f413";
}

.ion-ios-color-wand:before {
  content: "\f416";
}

.ion-ios-color-wand-outline:before {
  content: "\f415";
}

.ion-ios-compose:before {
  content: "\f418";
}

.ion-ios-compose-outline:before {
  content: "\f417";
}

.ion-ios-contact:before {
  content: "\f41a";
}

.ion-ios-contact-outline:before {
  content: "\f419";
}

.ion-ios-copy:before {
  content: "\f41c";
}

.ion-ios-copy-outline:before {
  content: "\f41b";
}

.ion-ios-crop:before {
  content: "\f41e";
}

.ion-ios-crop-strong:before {
  content: "\f41d";
}

.ion-ios-download:before {
  content: "\f420";
}

.ion-ios-download-outline:before {
  content: "\f41f";
}

.ion-ios-drag:before {
  content: "\f421";
}

.ion-ios-email:before {
  content: "\f423";
}

.ion-ios-email-outline:before {
  content: "\f422";
}

.ion-ios-eye:before {
  content: "\f425";
}

.ion-ios-eye-outline:before {
  content: "\f424";
}

.ion-ios-fastforward:before {
  content: "\f427";
}

.ion-ios-fastforward-outline:before {
  content: "\f426";
}

.ion-ios-filing:before {
  content: "\f429";
}

.ion-ios-filing-outline:before {
  content: "\f428";
}

.ion-ios-film:before {
  content: "\f42b";
}

.ion-ios-film-outline:before {
  content: "\f42a";
}

.ion-ios-flag:before {
  content: "\f42d";
}

.ion-ios-flag-outline:before {
  content: "\f42c";
}

.ion-ios-flame:before {
  content: "\f42f";
}

.ion-ios-flame-outline:before {
  content: "\f42e";
}

.ion-ios-flask:before {
  content: "\f431";
}

.ion-ios-flask-outline:before {
  content: "\f430";
}

.ion-ios-flower:before {
  content: "\f433";
}

.ion-ios-flower-outline:before {
  content: "\f432";
}

.ion-ios-folder:before {
  content: "\f435";
}

.ion-ios-folder-outline:before {
  content: "\f434";
}

.ion-ios-football:before {
  content: "\f437";
}

.ion-ios-football-outline:before {
  content: "\f436";
}

.ion-ios-game-controller-a:before {
  content: "\f439";
}

.ion-ios-game-controller-a-outline:before {
  content: "\f438";
}

.ion-ios-game-controller-b:before {
  content: "\f43b";
}

.ion-ios-game-controller-b-outline:before {
  content: "\f43a";
}

.ion-ios-gear:before {
  content: "\f43d";
}

.ion-ios-gear-outline:before {
  content: "\f43c";
}

.ion-ios-glasses:before {
  content: "\f43f";
}

.ion-ios-glasses-outline:before {
  content: "\f43e";
}

.ion-ios-grid-view:before {
  content: "\f441";
}

.ion-ios-grid-view-outline:before {
  content: "\f440";
}

.ion-ios-heart:before {
  content: "\f443";
}

.ion-ios-heart-outline:before {
  content: "\f442";
}

.ion-ios-help:before {
  content: "\f446";
}

.ion-ios-help-empty:before {
  content: "\f444";
}

.ion-ios-help-outline:before {
  content: "\f445";
}

.ion-ios-home:before {
  content: "\f448";
}

.ion-ios-home-outline:before {
  content: "\f447";
}

.ion-ios-infinite:before {
  content: "\f44a";
}

.ion-ios-infinite-outline:before {
  content: "\f449";
}

.ion-ios-information:before {
  content: "\f44d";
}

.ion-ios-information-empty:before {
  content: "\f44b";
}

.ion-ios-information-outline:before {
  content: "\f44c";
}

.ion-ios-ionic-outline:before {
  content: "\f44e";
}

.ion-ios-keypad:before {
  content: "\f450";
}

.ion-ios-keypad-outline:before {
  content: "\f44f";
}

.ion-ios-lightbulb:before {
  content: "\f452";
}

.ion-ios-lightbulb-outline:before {
  content: "\f451";
}

.ion-ios-list:before {
  content: "\f454";
}

.ion-ios-list-outline:before {
  content: "\f453";
}

.ion-ios-location:before {
  content: "\f456";
}

.ion-ios-location-outline:before {
  content: "\f455";
}

.ion-ios-locked:before {
  content: "\f458";
}

.ion-ios-locked-outline:before {
  content: "\f457";
}

.ion-ios-loop:before {
  content: "\f45a";
}

.ion-ios-loop-strong:before {
  content: "\f459";
}

.ion-ios-medical:before {
  content: "\f45c";
}

.ion-ios-medical-outline:before {
  content: "\f45b";
}

.ion-ios-medkit:before {
  content: "\f45e";
}

.ion-ios-medkit-outline:before {
  content: "\f45d";
}

.ion-ios-mic:before {
  content: "\f461";
}

.ion-ios-mic-off:before {
  content: "\f45f";
}

.ion-ios-mic-outline:before {
  content: "\f460";
}

.ion-ios-minus:before {
  content: "\f464";
}

.ion-ios-minus-empty:before {
  content: "\f462";
}

.ion-ios-minus-outline:before {
  content: "\f463";
}

.ion-ios-monitor:before {
  content: "\f466";
}

.ion-ios-monitor-outline:before {
  content: "\f465";
}

.ion-ios-moon:before {
  content: "\f468";
}

.ion-ios-moon-outline:before {
  content: "\f467";
}

.ion-ios-more:before {
  content: "\f46a";
}

.ion-ios-more-outline:before {
  content: "\f469";
}

.ion-ios-musical-note:before {
  content: "\f46b";
}

.ion-ios-musical-notes:before {
  content: "\f46c";
}

.ion-ios-navigate:before {
  content: "\f46e";
}

.ion-ios-navigate-outline:before {
  content: "\f46d";
}

.ion-ios-nutrition:before {
  content: "\f470";
}

.ion-ios-nutrition-outline:before {
  content: "\f46f";
}

.ion-ios-paper:before {
  content: "\f472";
}

.ion-ios-paper-outline:before {
  content: "\f471";
}

.ion-ios-paperplane:before {
  content: "\f474";
}

.ion-ios-paperplane-outline:before {
  content: "\f473";
}

.ion-ios-partlysunny:before {
  content: "\f476";
}

.ion-ios-partlysunny-outline:before {
  content: "\f475";
}

.ion-ios-pause:before {
  content: "\f478";
}

.ion-ios-pause-outline:before {
  content: "\f477";
}

.ion-ios-paw:before {
  content: "\f47a";
}

.ion-ios-paw-outline:before {
  content: "\f479";
}

.ion-ios-people:before {
  content: "\f47c";
}

.ion-ios-people-outline:before {
  content: "\f47b";
}

.ion-ios-person:before {
  content: "\f47e";
}

.ion-ios-person-outline:before {
  content: "\f47d";
}

.ion-ios-personadd:before {
  content: "\f480";
}

.ion-ios-personadd-outline:before {
  content: "\f47f";
}

.ion-ios-photos:before {
  content: "\f482";
}

.ion-ios-photos-outline:before {
  content: "\f481";
}

.ion-ios-pie:before {
  content: "\f484";
}

.ion-ios-pie-outline:before {
  content: "\f483";
}

.ion-ios-pint:before {
  content: "\f486";
}

.ion-ios-pint-outline:before {
  content: "\f485";
}

.ion-ios-play:before {
  content: "\f488";
}

.ion-ios-play-outline:before {
  content: "\f487";
}

.ion-ios-plus:before {
  content: "\f48b";
}

.ion-ios-plus-empty:before {
  content: "\f489";
}

.ion-ios-plus-outline:before {
  content: "\f48a";
}

.ion-ios-pricetag:before {
  content: "\f48d";
}

.ion-ios-pricetag-outline:before {
  content: "\f48c";
}

.ion-ios-pricetags:before {
  content: "\f48f";
}

.ion-ios-pricetags-outline:before {
  content: "\f48e";
}

.ion-ios-printer:before {
  content: "\f491";
}

.ion-ios-printer-outline:before {
  content: "\f490";
}

.ion-ios-pulse:before {
  content: "\f493";
}

.ion-ios-pulse-strong:before {
  content: "\f492";
}

.ion-ios-rainy:before {
  content: "\f495";
}

.ion-ios-rainy-outline:before {
  content: "\f494";
}

.ion-ios-recording:before {
  content: "\f497";
}

.ion-ios-recording-outline:before {
  content: "\f496";
}

.ion-ios-redo:before {
  content: "\f499";
}

.ion-ios-redo-outline:before {
  content: "\f498";
}

.ion-ios-refresh:before {
  content: "\f49c";
}

.ion-ios-refresh-empty:before {
  content: "\f49a";
}

.ion-ios-refresh-outline:before {
  content: "\f49b";
}

.ion-ios-reload:before {
  content: "\f49d";
}

.ion-ios-reverse-camera:before {
  content: "\f49f";
}

.ion-ios-reverse-camera-outline:before {
  content: "\f49e";
}

.ion-ios-rewind:before {
  content: "\f4a1";
}

.ion-ios-rewind-outline:before {
  content: "\f4a0";
}

.ion-ios-rose:before {
  content: "\f4a3";
}

.ion-ios-rose-outline:before {
  content: "\f4a2";
}

.ion-ios-search:before {
  content: "\f4a5";
}

.ion-ios-search-strong:before {
  content: "\f4a4";
}

.ion-ios-settings:before {
  content: "\f4a7";
}

.ion-ios-settings-strong:before {
  content: "\f4a6";
}

.ion-ios-shuffle:before {
  content: "\f4a9";
}

.ion-ios-shuffle-strong:before {
  content: "\f4a8";
}

.ion-ios-skipbackward:before {
  content: "\f4ab";
}

.ion-ios-skipbackward-outline:before {
  content: "\f4aa";
}

.ion-ios-skipforward:before {
  content: "\f4ad";
}

.ion-ios-skipforward-outline:before {
  content: "\f4ac";
}

.ion-ios-snowy:before {
  content: "\f4ae";
}

.ion-ios-speedometer:before {
  content: "\f4b0";
}

.ion-ios-speedometer-outline:before {
  content: "\f4af";
}

.ion-ios-star:before {
  content: "\f4b3";
}

.ion-ios-star-half:before {
  content: "\f4b1";
}

.ion-ios-star-outline:before {
  content: "\f4b2";
}

.ion-ios-stopwatch:before {
  content: "\f4b5";
}

.ion-ios-stopwatch-outline:before {
  content: "\f4b4";
}

.ion-ios-sunny:before {
  content: "\f4b7";
}

.ion-ios-sunny-outline:before {
  content: "\f4b6";
}

.ion-ios-telephone:before {
  content: "\f4b9";
}

.ion-ios-telephone-outline:before {
  content: "\f4b8";
}

.ion-ios-tennisball:before {
  content: "\f4bb";
}

.ion-ios-tennisball-outline:before {
  content: "\f4ba";
}

.ion-ios-thunderstorm:before {
  content: "\f4bd";
}

.ion-ios-thunderstorm-outline:before {
  content: "\f4bc";
}

.ion-ios-time:before {
  content: "\f4bf";
}

.ion-ios-time-outline:before {
  content: "\f4be";
}

.ion-ios-timer:before {
  content: "\f4c1";
}

.ion-ios-timer-outline:before {
  content: "\f4c0";
}

.ion-ios-toggle:before {
  content: "\f4c3";
}

.ion-ios-toggle-outline:before {
  content: "\f4c2";
}

.ion-ios-trash:before {
  content: "\f4c5";
}

.ion-ios-trash-outline:before {
  content: "\f4c4";
}

.ion-ios-undo:before {
  content: "\f4c7";
}

.ion-ios-undo-outline:before {
  content: "\f4c6";
}

.ion-ios-unlocked:before {
  content: "\f4c9";
}

.ion-ios-unlocked-outline:before {
  content: "\f4c8";
}

.ion-ios-upload:before {
  content: "\f4cb";
}

.ion-ios-upload-outline:before {
  content: "\f4ca";
}

.ion-ios-videocam:before {
  content: "\f4cd";
}

.ion-ios-videocam-outline:before {
  content: "\f4cc";
}

.ion-ios-volume-high:before {
  content: "\f4ce";
}

.ion-ios-volume-low:before {
  content: "\f4cf";
}

.ion-ios-wineglass:before {
  content: "\f4d1";
}

.ion-ios-wineglass-outline:before {
  content: "\f4d0";
}

.ion-ios-world:before {
  content: "\f4d3";
}

.ion-ios-world-outline:before {
  content: "\f4d2";
}

.ion-ipad:before {
  content: "\f1f9";
}

.ion-iphone:before {
  content: "\f1fa";
}

.ion-ipod:before {
  content: "\f1fb";
}

.ion-jet:before {
  content: "\f295";
}

.ion-key:before {
  content: "\f296";
}

.ion-knife:before {
  content: "\f297";
}

.ion-laptop:before {
  content: "\f1fc";
}

.ion-leaf:before {
  content: "\f1fd";
}

.ion-levels:before {
  content: "\f298";
}

.ion-lightbulb:before {
  content: "\f299";
}

.ion-link:before {
  content: "\f1fe";
}

.ion-load-a:before {
  content: "\f29a";
}

.ion-load-b:before {
  content: "\f29b";
}

.ion-load-c:before {
  content: "\f29c";
}

.ion-load-d:before {
  content: "\f29d";
}

.ion-location:before {
  content: "\f1ff";
}

.ion-lock-combination:before {
  content: "\f4d4";
}

.ion-locked:before {
  content: "\f200";
}

.ion-log-in:before {
  content: "\f29e";
}

.ion-log-out:before {
  content: "\f29f";
}

.ion-loop:before {
  content: "\f201";
}

.ion-magnet:before {
  content: "\f2a0";
}

.ion-male:before {
  content: "\f2a1";
}

.ion-man:before {
  content: "\f202";
}

.ion-map:before {
  content: "\f203";
}

.ion-medkit:before {
  content: "\f2a2";
}

.ion-merge:before {
  content: "\f33f";
}

.ion-mic-a:before {
  content: "\f204";
}

.ion-mic-b:before {
  content: "\f205";
}

.ion-mic-c:before {
  content: "\f206";
}

.ion-minus:before {
  content: "\f209";
}

.ion-minus-circled:before {
  content: "\f207";
}

.ion-minus-round:before {
  content: "\f208";
}

.ion-model-s:before {
  content: "\f2c1";
}

.ion-monitor:before {
  content: "\f20a";
}

.ion-more:before {
  content: "\f20b";
}

.ion-mouse:before {
  content: "\f340";
}

.ion-music-note:before {
  content: "\f20c";
}

.ion-navicon:before {
  content: "\f20e";
}

.ion-navicon-round:before {
  content: "\f20d";
}

.ion-navigate:before {
  content: "\f2a3";
}

.ion-network:before {
  content: "\f341";
}

.ion-no-smoking:before {
  content: "\f2c2";
}

.ion-nuclear:before {
  content: "\f2a4";
}

.ion-outlet:before {
  content: "\f342";
}

.ion-paintbrush:before {
  content: "\f4d5";
}

.ion-paintbucket:before {
  content: "\f4d6";
}

.ion-paper-airplane:before {
  content: "\f2c3";
}

.ion-paperclip:before {
  content: "\f20f";
}

.ion-pause:before {
  content: "\f210";
}

.ion-person:before {
  content: "\f213";
}

.ion-person-add:before {
  content: "\f211";
}

.ion-person-stalker:before {
  content: "\f212";
}

.ion-pie-graph:before {
  content: "\f2a5";
}

.ion-pin:before {
  content: "\f2a6";
}

.ion-pinpoint:before {
  content: "\f2a7";
}

.ion-pizza:before {
  content: "\f2a8";
}

.ion-plane:before {
  content: "\f214";
}

.ion-planet:before {
  content: "\f343";
}

.ion-play:before {
  content: "\f215";
}

.ion-playstation:before {
  content: "\f30a";
}

.ion-plus:before {
  content: "\f218";
}

.ion-plus-circled:before {
  content: "\f216";
}

.ion-plus-round:before {
  content: "\f217";
}

.ion-podium:before {
  content: "\f344";
}

.ion-pound:before {
  content: "\f219";
}

.ion-power:before {
  content: "\f2a9";
}

.ion-pricetag:before {
  content: "\f2aa";
}

.ion-pricetags:before {
  content: "\f2ab";
}

.ion-printer:before {
  content: "\f21a";
}

.ion-pull-request:before {
  content: "\f345";
}

.ion-qr-scanner:before {
  content: "\f346";
}

.ion-quote:before {
  content: "\f347";
}

.ion-radio-waves:before {
  content: "\f2ac";
}

.ion-record:before {
  content: "\f21b";
}

.ion-refresh:before {
  content: "\f21c";
}

.ion-reply:before {
  content: "\f21e";
}

.ion-reply-all:before {
  content: "\f21d";
}

.ion-ribbon-a:before {
  content: "\f348";
}

.ion-ribbon-b:before {
  content: "\f349";
}

.ion-sad:before {
  content: "\f34a";
}

.ion-sad-outline:before {
  content: "\f4d7";
}

.ion-scissors:before {
  content: "\f34b";
}

.ion-search:before {
  content: "\f21f";
}

.ion-settings:before {
  content: "\f2ad";
}

.ion-share:before {
  content: "\f220";
}

.ion-shuffle:before {
  content: "\f221";
}

.ion-skip-backward:before {
  content: "\f222";
}

.ion-skip-forward:before {
  content: "\f223";
}

.ion-social-android:before {
  content: "\f225";
}

.ion-social-android-outline:before {
  content: "\f224";
}

.ion-social-angular:before {
  content: "\f4d9";
}

.ion-social-angular-outline:before {
  content: "\f4d8";
}

.ion-social-apple:before {
  content: "\f227";
}

.ion-social-apple-outline:before {
  content: "\f226";
}

.ion-social-bitcoin:before {
  content: "\f2af";
}

.ion-social-bitcoin-outline:before {
  content: "\f2ae";
}

.ion-social-buffer:before {
  content: "\f229";
}

.ion-social-buffer-outline:before {
  content: "\f228";
}

.ion-social-chrome:before {
  content: "\f4db";
}

.ion-social-chrome-outline:before {
  content: "\f4da";
}

.ion-social-codepen:before {
  content: "\f4dd";
}

.ion-social-codepen-outline:before {
  content: "\f4dc";
}

.ion-social-css3:before {
  content: "\f4df";
}

.ion-social-css3-outline:before {
  content: "\f4de";
}

.ion-social-designernews:before {
  content: "\f22b";
}

.ion-social-designernews-outline:before {
  content: "\f22a";
}

.ion-social-dribbble:before {
  content: "\f22d";
}

.ion-social-dribbble-outline:before {
  content: "\f22c";
}

.ion-social-dropbox:before {
  content: "\f22f";
}

.ion-social-dropbox-outline:before {
  content: "\f22e";
}

.ion-social-euro:before {
  content: "\f4e1";
}

.ion-social-euro-outline:before {
  content: "\f4e0";
}

.ion-social-facebook:before {
  content: "\f231";
}

.ion-social-facebook-outline:before {
  content: "\f230";
}

.ion-social-foursquare:before {
  content: "\f34d";
}

.ion-social-foursquare-outline:before {
  content: "\f34c";
}

.ion-social-freebsd-devil:before {
  content: "\f2c4";
}

.ion-social-github:before {
  content: "\f233";
}

.ion-social-github-outline:before {
  content: "\f232";
}

.ion-social-google:before {
  content: "\f34f";
}

.ion-social-google-outline:before {
  content: "\f34e";
}

.ion-social-googleplus:before {
  content: "\f235";
}

.ion-social-googleplus-outline:before {
  content: "\f234";
}

.ion-social-hackernews:before {
  content: "\f237";
}

.ion-social-hackernews-outline:before {
  content: "\f236";
}

.ion-social-html5:before {
  content: "\f4e3";
}

.ion-social-html5-outline:before {
  content: "\f4e2";
}

.ion-social-instagram:before {
  content: "\f351";
}

.ion-social-instagram-outline:before {
  content: "\f350";
}

.ion-social-javascript:before {
  content: "\f4e5";
}

.ion-social-javascript-outline:before {
  content: "\f4e4";
}

.ion-social-linkedin:before {
  content: "\f239";
}

.ion-social-linkedin-outline:before {
  content: "\f238";
}

.ion-social-markdown:before {
  content: "\f4e6";
}

.ion-social-nodejs:before {
  content: "\f4e7";
}

.ion-social-octocat:before {
  content: "\f4e8";
}

.ion-social-pinterest:before {
  content: "\f2b1";
}

.ion-social-pinterest-outline:before {
  content: "\f2b0";
}

.ion-social-python:before {
  content: "\f4e9";
}

.ion-social-reddit:before {
  content: "\f23b";
}

.ion-social-reddit-outline:before {
  content: "\f23a";
}

.ion-social-rss:before {
  content: "\f23d";
}

.ion-social-rss-outline:before {
  content: "\f23c";
}

.ion-social-sass:before {
  content: "\f4ea";
}

.ion-social-skype:before {
  content: "\f23f";
}

.ion-social-skype-outline:before {
  content: "\f23e";
}

.ion-social-snapchat:before {
  content: "\f4ec";
}

.ion-social-snapchat-outline:before {
  content: "\f4eb";
}

.ion-social-tumblr:before {
  content: "\f241";
}

.ion-social-tumblr-outline:before {
  content: "\f240";
}

.ion-social-tux:before {
  content: "\f2c5";
}

.ion-social-twitch:before {
  content: "\f4ee";
}

.ion-social-twitch-outline:before {
  content: "\f4ed";
}

.ion-social-twitter:before {
  content: "\f243";
}

.ion-social-twitter-outline:before {
  content: "\f242";
}

.ion-social-usd:before {
  content: "\f353";
}

.ion-social-usd-outline:before {
  content: "\f352";
}

.ion-social-vimeo:before {
  content: "\f245";
}

.ion-social-vimeo-outline:before {
  content: "\f244";
}

.ion-social-whatsapp:before {
  content: "\f4f0";
}

.ion-social-whatsapp-outline:before {
  content: "\f4ef";
}

.ion-social-windows:before {
  content: "\f247";
}

.ion-social-windows-outline:before {
  content: "\f246";
}

.ion-social-wordpress:before {
  content: "\f249";
}

.ion-social-wordpress-outline:before {
  content: "\f248";
}

.ion-social-yahoo:before {
  content: "\f24b";
}

.ion-social-yahoo-outline:before {
  content: "\f24a";
}

.ion-social-yen:before {
  content: "\f4f2";
}

.ion-social-yen-outline:before {
  content: "\f4f1";
}

.ion-social-youtube:before {
  content: "\f24d";
}

.ion-social-youtube-outline:before {
  content: "\f24c";
}

.ion-soup-can:before {
  content: "\f4f4";
}

.ion-soup-can-outline:before {
  content: "\f4f3";
}

.ion-speakerphone:before {
  content: "\f2b2";
}

.ion-speedometer:before {
  content: "\f2b3";
}

.ion-spoon:before {
  content: "\f2b4";
}

.ion-star:before {
  content: "\f24e";
}

.ion-stats-bars:before {
  content: "\f2b5";
}

.ion-steam:before {
  content: "\f30b";
}

.ion-stop:before {
  content: "\f24f";
}

.ion-thermometer:before {
  content: "\f2b6";
}

.ion-thumbsdown:before {
  content: "\f250";
}

.ion-thumbsup:before {
  content: "\f251";
}

.ion-toggle:before {
  content: "\f355";
}

.ion-toggle-filled:before {
  content: "\f354";
}

.ion-transgender:before {
  content: "\f4f5";
}

.ion-trash-a:before {
  content: "\f252";
}

.ion-trash-b:before {
  content: "\f253";
}

.ion-trophy:before {
  content: "\f356";
}

.ion-tshirt:before {
  content: "\f4f7";
}

.ion-tshirt-outline:before {
  content: "\f4f6";
}

.ion-umbrella:before {
  content: "\f2b7";
}

.ion-university:before {
  content: "\f357";
}

.ion-unlocked:before {
  content: "\f254";
}

.ion-upload:before {
  content: "\f255";
}

.ion-usb:before {
  content: "\f2b8";
}

.ion-videocamera:before {
  content: "\f256";
}

.ion-volume-high:before {
  content: "\f257";
}

.ion-volume-low:before {
  content: "\f258";
}

.ion-volume-medium:before {
  content: "\f259";
}

.ion-volume-mute:before {
  content: "\f25a";
}

.ion-wand:before {
  content: "\f358";
}

.ion-waterdrop:before {
  content: "\f25b";
}

.ion-wifi:before {
  content: "\f25c";
}

.ion-wineglass:before {
  content: "\f2b9";
}

.ion-woman:before {
  content: "\f25d";
}

.ion-wrench:before {
  content: "\f2ba";
}

.ion-xbox:before {
  content: "\f30c";
}

[class*=bt-] {
  font-family: "bowtie" !important;
  speak: none;
  font-style: normal;
  font-weight: normal;
  text-transform: none;
  line-height: 16px;
  /* Better Font Rendering =========== */
  -webkit-font-smoothing: antialiased;
  -moz-osx-font-smoothing: grayscale;
}

.bt-arrow-up:before {
  content: "\e900";
}

.bt-arrow-left:before {
  content: "\e901";
}

.bt-arrow-down:before {
  content: "\e902";
}

.bt-arrow-right:before {
  content: "\e903";
}

.bt-arrow-up-left:before {
  content: "\e904";
}

.bt-arrow-up-right:before {
  content: "\e905";
}

.bt-arrow-down-left:before {
  content: "\e906";
}

.bt-arrow-down-right:before {
  content: "\e907";
}

.bt-arrow-export:before {
  content: "\e908";
}

.bt-arrow-open:before {
  content: "\e909";
}

.bt-sort:before {
  content: "\e90a";
}

.bt-sort-ascending:before {
  content: "\e90b";
}

.bt-sort-descending:before {
  content: "\e90c";
}

.bt-switch:before {
  content: "\e90d";
}

.bt-synchronize:before {
  content: "\e90e";
}

.bt-transfer-download:before {
  content: "\e90f";
}

.bt-transfer-upload:before {
  content: "\e910";
}

.bt-azure-api-management:before {
  content: "\e911";
}

.bt-azure-service-endpoint:before {
  content: "\e912";
}

.bt-brand-android:before {
  content: "\e913";
}

.bt-brand-facebook:before {
  content: "\e914";
}

.bt-brand-git:before {
  content: "\e915";
}

.bt-brand-github:before {
  content: "\e916";
}

.bt-brand-maven:before {
  content: "\e917";
}

.bt-brand-mtm:before {
  content: "\e918";
}

.bt-brand-npm:before {
  content: "\e919";
}

.bt-brand-nuget:before {
  content: "\e91a";
}

.bt-brand-tfvc:before {
  content: "\e91b";
}

.bt-brand-twitter:before {
  content: "\e91c";
}

.bt-brand-visualstudio:before {
  content: "\e91d";
}

.bt-brand-windows:before {
  content: "\e91e";
}

.bt-git:before {
  content: "\e91f";
}

.bt-logo-visual-studio:before {
  content: "\e920";
}

.bt-tfvc-repo:before {
  content: "\e921";
}

.bt-chart-area:before {
  content: "\e922";
}

.bt-chart-bar:before {
  content: "\e923";
}

.bt-chart-column:before {
  content: "\e924";
}

.bt-chart-pie:before {
  content: "\e925";
}

.bt-chart-pivot:before {
  content: "\e926";
}

.bt-chart-stacked-area:before {
  content: "\e927";
}

.bt-chart-stacked-bar:before {
  content: "\e928";
}

.bt-chart-stacked-line:before {
  content: "\e929";
}

.bt-build-queue-new:before {
  content: "\e92a";
}

.bt-clone-to-desktop:before {
  content: "\e92b";
}

.bt-install:before {
  content: "\e92c";
}

.bt-comment:before {
  content: "\e92d";
}

.bt-comment-add:before {
  content: "\e92e";
}

.bt-comment-discussion:before {
  content: "\e92f";
}

.bt-comment-lines:before {
  content: "\e930";
}

.bt-comment-next:before {
  content: "\e931";
}

.bt-comment-outline:before {
  content: "\e932";
}

.bt-comment-previous:before {
  content: "\e933";
}

.bt-comment-urgent:before {
  content: "\e934";
}

.bt-alert:before {
  content: "\e935";
}

.bt-approve:before {
  content: "\e936";
}

.bt-approve-disapprove:before {
  content: "\e937";
}

.bt-blur:before {
  content: "\e938";
}

.bt-build:before {
  content: "\e939";
}

.bt-build-queue:before {
  content: "\e93a";
}

.bt-build-reason-checkin-shelveset:before {
  content: "\e93b";
}

.bt-calendar:before {
  content: "\e93c";
}

.bt-calendar-month:before {
  content: "\e93d";
}

.bt-camera:before {
  content: "\e93e";
}

.bt-clone:before {
  content: "\e93f";
}

.bt-cloud:before {
  content: "\e940";
}

.bt-cloud-fill:before {
  content: "\e941";
}

.bt-copy-to-clipboard:before {
  content: "\e942";
}

.bt-dashboard:before {
  content: "\e943";
}

.bt-dashboard-fill:before {
  content: "\e944";
}

.bt-database:before {
  content: "\e945";
}

.bt-deploy:before {
  content: "\e946";
}

.bt-redeploy:before {
  content: "\e947";
}

.bt-details-pane:before {
  content: "\e948";
}

.bt-edit:before {
  content: "\e949";
}

.bt-edit-outline:before {
  content: "\e94a";
}

.bt-edit-copy:before {
  content: "\e94b";
}

.bt-edit-cut:before {
  content: "\e94c";
}

.bt-editor-list-bullet:before {
  content: "\e94d";
}

.bt-edit-paste:before {
  content: "\e94e";
}

.bt-edit-delete:before {
  content: "\e94f";
}

.bt-edit-remove:before {
  content: "\e950";
}

.bt-edit-redo:before {
  content: "\e951";
}

.bt-edit-undo:before {
  content: "\e952";
}

.bt-edit-rename:before {
  content: "\e953";
}

.bt-attach:before {
  content: "\e954";
}

.bt-link:before {
  content: "\e955";
}

.bt-server:before {
  content: "\e956";
}

.bt-environment:before {
  content: "\e957";
}

.bt-devices:before {
  content: "\e958";
}

.bt-feedback-negative:before {
  content: "\e959";
}

.bt-feedback-positive:before {
  content: "\e95a";
}

.bt-folder:before {
  content: "\e95b";
}

.bt-image:before {
  content: "\e95c";
}

.bt-package:before {
  content: "\e95d";
}

.bt-package-fill:before {
  content: "\e95e";
}

.bt-heart:before {
  content: "\e95f";
}

.bt-heart-fill:before {
  content: "\e960";
}

.bt-heartbeat:before {
  content: "\e961";
}

.bt-heartbeat-fill:before {
  content: "\e962";
}

.bt-mail-message:before {
  content: "\e963";
}

.bt-mail-message-fill:before {
  content: "\e964";
}

.bt-math-minus:before {
  content: "\e965";
}

.bt-math-minus-light:before {
  content: "\e966";
}

.bt-math-minus-box-light:before {
  content: "\e967";
}

.bt-math-minus-box:before {
  content: "\e968";
}

.bt-math-minus-circle-outline:before {
  content: "\e969";
}

.bt-math-minus-circle:before {
  content: "\e96a";
}

.bt-math-multiply:before {
  content: "\e96b";
}

.bt-math-multiply-light:before {
  content: "\e96c";
}

.bt-math-multiply-box-light:before {
  content: "\e96d";
}

.bt-math-multiply-box:before {
  content: "\e96e";
}

.bt-math-multiply-box-outline:before {
  content: "\e96f";
}

.bt-math-plus:before {
  content: "\e970";
}

.bt-math-plus-light:before {
  content: "\e971";
}

.bt-math-plus-box-light:before {
  content: "\e972";
}

.bt-math-plus-box:before {
  content: "\e973";
}

.bt-math-plus-circle-outline:before {
  content: "\e974";
}

.bt-math-plus-circle:before {
  content: "\e975";
}

.bt-math-plus-heavy:before {
  content: "\e976";
}

.bt-check:before {
  content: "\e977";
}

.bt-check-light:before {
  content: "\e978";
}

.bt-feed:before {
  content: "\e979";
}

.bt-network-tower:before {
  content: "\e97a";
}

.bt-connect-to-feed:before {
  content: "\e97b";
}

.bt-plug:before {
  content: "\e97c";
}

.bt-plug-outline:before {
  content: "\e97d";
}

.bt-policy:before {
  content: "\e97e";
}

.bt-print:before {
  content: "\e97f";
}

.bt-recycle:before {
  content: "\e980";
}

.bt-robot:before {
  content: "\e981";
}

.bt-save:before {
  content: "\e982";
}

.bt-save-all:before {
  content: "\e983";
}

.bt-save-as:before {
  content: "\e984";
}

.bt-save-close:before {
  content: "\e985";
}

.bt-search:before {
  content: "\e986";
}

.bt-search-filter:before {
  content: "\e987";
}

.bt-search-filter-fill:before {
  content: "\e988";
}

.bt-security:before {
  content: "\e989";
}

.bt-security-access:before {
  content: "\e98a";
}

.bt-security-lock:before {
  content: "\e98b";
}

.bt-security-lock-fill:before {
  content: "\e98c";
}

.bt-security-unlock:before {
  content: "\e98d";
}

.bt-security-unlock-fill:before {
  content: "\e98e";
}

.bt-settings-gear:before {
  content: "\e98f";
}

.bt-settings-gear-outline:before {
  content: "\e990";
}

.bt-settings-wrench:before {
  content: "\e991";
}

.bt-trash:before {
  content: "\e992";
}

.bt-share:before {
  content: "\e993";
}

.bt-shop:before {
  content: "\e994";
}

.bt-shop-server:before {
  content: "\e995";
}

.bt-tag:before {
  content: "\e996";
}

.bt-tag-fill:before {
  content: "\e997";
}

.bt-user:before {
  content: "\e998";
}

.bt-users:before {
  content: "\e999";
}

.bt-variable:before {
  content: "\e99a";
}

.bt-video:before {
  content: "\e99b";
}

.bt-view-grid:before {
  content: "\e99c";
}

.bt-watch-eye:before {
  content: "\e99d";
}

.bt-watch-eye-fill:before {
  content: "\e99e";
}

.bt-live-update-feed:before {
  content: "\e99f";
}

.bt-checkbox:before {
  content: "\e9a0";
}

.bt-checkbox-empty:before {
  content: "\e9a1";
}

.bt-chevron-up:before {
  content: "\e9a2";
}

.bt-chevron-left:before {
  content: "\e9a3";
}

.bt-chevron-down:before {
  content: "\e9a4";
}

.bt-chevron-right:before {
  content: "\e9a5";
}

.bt-chevron-up-light:before {
  content: "\e9a6";
}

.bt-chevron-left-light:before {
  content: "\e9a7";
}

.bt-chevron-down-light:before {
  content: "\e9a8";
}

.bt-chevron-right-light:before {
  content: "\e9a9";
}

.bt-chevron-up-all:before {
  content: "\e9aa";
}

.bt-chevron-left-all:before {
  content: "\e9ab";
}

.bt-chevron-down-all:before {
  content: "\e9ac";
}

.bt-chevron-right-all:before {
  content: "\e9ad";
}

.bt-chevron-up-end:before {
  content: "\e9ae";
}

.bt-chevron-left-end:before {
  content: "\e9af";
}

.bt-chevron-down-end:before {
  content: "\e9b0";
}

.bt-chevron-right-end:before {
  content: "\e9b1";
}

.bt-fold-less:before {
  content: "\e9b2";
}

.bt-fold-more:before {
  content: "\e9b3";
}

.bt-ellipsis:before {
  content: "\e9b4";
}

.bt-ellipsis-vertical:before {
  content: "\e9b5";
}

.bt-favorite:before {
  content: "\e9b6";
}

.bt-favorite-outline:before {
  content: "\e9b7";
}

.bt-star-half:before {
  content: "\e9b8";
}

.bt-pin:before {
  content: "\e9b9";
}

.bt-pin-fill:before {
  content: "\e9ba";
}

.bt-pin-pinned:before {
  content: "\e9bb";
}

.bt-pin-pinned-fill:before {
  content: "\e9bc";
}

.bt-pin-unpin:before {
  content: "\e9bd";
}

.bt-pin-unpin-fill:before {
  content: "\e9be";
}

.bt-radio-button:before {
  content: "\e9bf";
}

.bt-radio-button-empty:before {
  content: "\e9c0";
}

.bt-resize-grip:before {
  content: "\e9c1";
}

.bt-separator:before {
  content: "\e9c2";
}

.bt-toggle-collapse:before {
  content: "\e9c3";
}

.bt-toggle-expand:before {
  content: "\e9c4";
}

.bt-toggle-collapse-all:before {
  content: "\e9c5";
}

.bt-toggle-expand-all:before {
  content: "\e9c6";
}

.bt-triangle-up:before {
  content: "\e9c7";
}

.bt-triangle-left:before {
  content: "\e9c8";
}

.bt-triangle-down:before {
  content: "\e9c9";
}

.bt-triangle-right:before {
  content: "\e9ca";
}

.bt-toggle-tree-expanded:before {
  content: "\e9cb";
}

.bt-toggle-tree-expanded-outline:before {
  content: "\e9cc";
}

.bt-toggle-tree-collapsed:before {
  content: "\e9cd";
}

.bt-view-full-screen:before {
  content: "\e9ce";
}

.bt-view-full-screen-exit:before {
  content: "\e9cf";
}

.bt-navigate-external:before {
  content: "\e9d0";
}

.bt-work-item-bar:before {
  content: "\e9d1";
}

.bt-format-font:before {
  content: "\e9d2";
}

.bt-format-bold:before {
  content: "\e9d3";
}

.bt-format-italic:before {
  content: "\e9d4";
}

.bt-format-underline:before {
  content: "\e9d5";
}

.bt-format-font-color:before {
  content: "\e9d6";
}

.bt-format-font-size:before {
  content: "\e9d7";
}

.bt-format-clear:before {
  content: "\e9d8";
}

.bt-format-indent-decrease:before {
  content: "\e9d9";
}

.bt-format-indent-increase:before {
  content: "\e9da";
}

.bt-format-list-ordered:before {
  content: "\e9db";
}

.bt-format-list-unordered:before {
  content: "\e9dc";
}

.bt-file:before {
  content: "\e9dd";
}

.bt-file-bug:before {
  content: "\e9de";
}

.bt-file-code:before {
  content: "\e9df";
}

.bt-file-comment:before {
  content: "\e9e0";
}

.bt-file-content:before {
  content: "\e9e1";
}

.bt-file-image:before {
  content: "\e9e2";
}

.bt-file-preview:before {
  content: "\e9e3";
}

.bt-file-symlink:before {
  content: "\e9e4";
}

.bt-media-play:before {
  content: "\e9e5";
}

.bt-media-play-fill:before {
  content: "\e9e6";
}

.bt-play:before {
  content: "\e9e7";
}

.bt-play-fill:before {
  content: "\e9e8";
}

.bt-pause:before {
  content: "\e9e9";
}

.bt-pause-fill:before {
  content: "\e9ea";
}

.bt-play-resume:before {
  content: "\e9eb";
}

.bt-play-resume-fill:before {
  content: "\e9ec";
}

.bt-stop:before {
  content: "\e9ed";
}

.bt-stop-fill:before {
  content: "\e9ee";
}

.bt-fast-backward:before {
  content: "\e9ef";
}

.bt-fast-backward-fill:before {
  content: "\e9f0";
}

.bt-fast-forward:before {
  content: "\e9f1";
}

.bt-fast-forward-fill:before {
  content: "\e9f2";
}

.bt-previous-frame:before {
  content: "\e9f3";
}

.bt-previous-frame-fill:before {
  content: "\e9f4";
}

.bt-next-frame:before {
  content: "\e9f5";
}

.bt-next-frame-fill:before {
  content: "\e9f6";
}

.bt-record:before {
  content: "\e9f7";
}

.bt-record-fill:before {
  content: "\e9f8";
}

.bt-menu:before {
  content: "\e9f9";
}

.bt-navigate-close:before {
  content: "\e9fa";
}

.bt-navigate-back-circle:before {
  content: "\e9fb";
}

.bt-navigate-back-disc:before {
  content: "\e9fc";
}

.bt-navigate-forward-circle:before {
  content: "\e9fd";
}

.bt-navigate-forward-disc:before {
  content: "\e9fe";
}

.bt-navigate-history:before {
  content: "\e9ff";
}

.bt-navigate-refresh:before {
  content: "\ea00";
}

.bt-navigate-reload:before {
  content: "\ea01";
}

.bt-status-error:before {
  content: "\ea02";
}

.bt-status-error-outline:before {
  content: "\ea03";
}

.bt-status-failure:before {
  content: "\ea04";
}

.bt-status-failure-outline:before {
  content: "\ea05";
}

.bt-status-help:before {
  content: "\ea06";
}

.bt-status-help-outline:before {
  content: "\ea07";
}

.bt-status-info:before {
  content: "\ea08";
}

.bt-status-info-outline:before {
  content: "\ea09";
}

.bt-status-no:before {
  content: "\ea0a";
}

.bt-status-no-fill:before {
  content: "\ea0b";
}

.bt-status-pause:before {
  content: "\ea0c";
}

.bt-status-pause-outline:before {
  content: "\ea0d";
}

.bt-status-run:before {
  content: "\ea0e";
}

.bt-status-run-outline:before {
  content: "\ea0f";
}

.bt-status-stop:before {
  content: "\ea10";
}

.bt-status-stop-outline:before {
  content: "\ea11";
}

.bt-status-success:before {
  content: "\ea12";
}

.bt-status-success-outline:before {
  content: "\ea13";
}

.bt-status-waiting:before {
  content: "\ea14";
}

.bt-status-waiting-fill:before {
  content: "\ea15";
}

.bt-status-warning:before {
  content: "\ea16";
}

.bt-status-warning-outline:before {
  content: "\ea17";
}

.bt-status-success-box:before {
  content: "\ea18";
}

.bt-test-fill:before {
  content: "\ea19";
}

.bt-test:before {
  content: "\ea1a";
}

.bt-test-auto-fill:before {
  content: "\ea1b";
}

.bt-test-auto:before {
  content: "\ea1c";
}

.bt-test-user-fill:before {
  content: "\ea1d";
}

.bt-test-user:before {
  content: "\ea1e";
}

.bt-test-explore-fill:before {
  content: "\ea1f";
}

.bt-trigger:before {
  content: "\ea20";
}

.bt-trigger-auto:before {
  content: "\ea21";
}

.bt-trigger-user:before {
  content: "\ea22";
}

.bt-folder-plan:before {
  content: "\ea23";
}

.bt-folder-query:before {
  content: "\ea24";
}

.bt-log:before {
  content: "\ea25";
}

.bt-step:before {
  content: "\ea26";
}

.bt-step-shared:before {
  content: "\ea27";
}

.bt-server-remote:before {
  content: "\ea28";
}

.bt-diff-image:before {
  content: "\ea29";
}

.bt-diff-image-overlay:before {
  content: "\ea2a";
}

.bt-diff-image-pixel:before {
  content: "\ea2b";
}

.bt-diff-inline:before {
  content: "\ea2c";
}

.bt-diff-side-by-side:before {
  content: "\ea2d";
}

.bt-repo:before {
  content: "\ea2e";
}

.bt-repo-fill:before {
  content: "\ea2f";
}

.bt-repo-git:before {
  content: "\ea30";
}

.bt-tfvc-change-list:before {
  content: "\ea31";
}

.bt-repo-submodule:before {
  content: "\ea32";
}

.bt-tfvc-folder:before {
  content: "\ea33";
}

.bt-repo-tfvc:before {
  content: "\ea34";
}

.bt-tfvc-branch:before {
  content: "\ea35";
}

.bt-tfvc-branch-locked:before {
  content: "\ea36";
}

.bt-tfvc-commit:before {
  content: "\ea37";
}

.bt-tfvc-compare:before {
  content: "\ea38";
}

.bt-tfvc-merge:before {
  content: "\ea39";
}

.bt-tfvc-pull-request:before {
  content: "\ea3a";
}

.bt-tfvc-shelveset:before {
  content: "\ea3b";
}

.bt-tfvc-raw-source:before {
  content: "\ea3c";
}

.bt-group-rows:before {
  content: "\ea3d";
}

.bt-recycle-bin-restore:before {
  content: "\ea3e";
}

.bt-view-list:before {
  content: "\ea3f";
}

.bt-view-list-group:before {
  content: "\ea40";
}

.bt-view-list-tree:before {
  content: "\ea41";
}

.bt-work-item:before {
  content: "\ea42";
}

.bt-work-item-bug:before {
  content: "\ea43";
}

.bt-work-item-move:before {
  content: "\ea44";
}

.bt-merge-duplicate:before {
  content: "\ea45";
}

.bt-storyboard:before {
  content: "\ea46";
}

.bt-auto-fill-template:before {
  content: "\ea47";
}

.bt-recycle-bin:before {
  content: "\ea48";
}

.bt-dot:before {
  content: "\ea49";
}

.bt-square:before {
  content: "\ea4a";
}

.bt-row-child:before {
  content: "\ea4b";
}

.bt-log-remove:before {
  content: "\ea4c";
}

.bt-live-update-feed-off:before {
  content: "\ea4d";
}

.bt-corner-resize:before {
  content: "\ea4e";
}

.bt-link-remove:before {
  content: "\ea4f";
}

.bt-spinner:before {
  content: "\ea50";
}

.bt-personalize:before {
  content: "\ea51";
}

.bt-parameter:before {
  content: "\ea52";
}

.bt-step-insert:before {
  content: "\ea53";
}

.bt-step-shared-add:before {
  content: "\ea54";
}

.bt-step-shared-insert:before {
  content: "\ea55";
}

.bt-process:before {
  content: "\ea56";
}

.bt-process-meta-task:before {
  content: "\ea57";
}

.bt-column-option:before {
  content: "\ea58";
}

.bt-globe:before {
  content: "\ea59";
}

.bt-locale-timezone:before {
  content: "\ea5a";
}

.bt-locale-language:before {
  content: "\ea5b";
}

.bt-feedback-positive-outline:before {
  content: "\ea5c";
}

.bt-feedback-negative-outline:before {
  content: "\ea5d";
}

.bt-contact-card:before {
  content: "\ea5e";
}

.bt-triangle:before {
  content: "\ea5f";
}

.bt-brand-vsts:before {
  content: "\ea60";
}

.bt-status-success-sm:before {
  content: "\ea61";
}

.bt-status-warning-sm:before {
  content: "\ea62";
}

.bt-status-info-sm:before {
  content: "\ea63";
}

.bt-status-failure-sm:before {
  content: "\ea64";
}

.bt-status-error-sm:before {
  content: "\ea65";
}

.bt-status-run-sm:before {
  content: "\ea66";
}

.bt-status-help-sm:before {
  content: "\ea67";
}

.bt-status-stop-sm:before {
  content: "\ea68";
}

.bt-status-pause-sm:before {
  content: "\ea69";
}

.bt-status-waiting-fill-sm:before {
  content: "\ea6a";
}

.bt-status-no-fill-sm:before {
  content: "\ea6b";
}

.bt-assessment-group:before {
  content: "\ea6c";
}

.bt-table:before {
  content: "\ea6d";
}

.bt-timeline-delivery:before {
  content: "\ea6e";
}

.bt-timeline-progress:before {
  content: "\ea6f";
}

.bt-file-type-sln:before {
  content: "\ea70";
}

.bt-application-window:before {
  content: "\ea71";
}

.bt-file-type-html:before {
  content: "\ea72";
}

.bt-file-type-js:before {
  content: "\ea73";
}

.bt-file-type-jsproj:before {
  content: "\ea74";
}

.bt-file-type-cs:before {
  content: "\ea75";
}

.bt-file-type-csproj:before {
  content: "\ea76";
}

.bt-file-type-vb:before {
  content: "\ea77";
}

.bt-file-type-vbproj:before {
  content: "\ea78";
}

.bt-file-type-cpp:before {
  content: "\ea79";
}

.bt-file-type-vcxproj:before {
  content: "\ea7a";
}

.bt-file-type-fs:before {
  content: "\ea7b";
}

.bt-file-type-fsproj:before {
  content: "\ea7c";
}

.bt-file-type-python:before {
  content: "\ea7d";
}

.bt-file-type-pyproj:before {
  content: "\ea7e";
}

.bt-file-type-typescript:before {
  content: "\ea7f";
}

.bt-file-type-coffeescript:before {
  content: "\ea80";
}

.bt-file-type-aspx:before {
  content: "\ea81";
}

.bt-file-type-css:before {
  content: "\ea82";
}

.bt-file-type-sass:before {
  content: "\ea83";
}

.bt-file-type-less:before {
  content: "\ea84";
}

.bt-file-type-json:before {
  content: "\ea85";
}

.bt-file-type-xml:before {
  content: "\ea86";
}

.bt-file-type-md:before {
  content: "\ea87";
}

.bt-file-type-powershell:before {
  content: "\ea88";
}

.bt-file-type-cmd:before {
  content: "\ea89";
}

.bt-file-type-java:before {
  content: "\ea8a";
}

.bt-file-type-sql:before {
  content: "\ea8b";
}

.bt-file-stack:before {
  content: "\ea8c";
}

.bt-script:before {
  content: "\ea8d";
}

.bt-default-executable:before {
  content: "\ea8e";
}

.bt-file-type-template:before {
  content: "\ea8f";
}

.bt-split:before {
  content: "\ea90";
}

.bt-image-action-log:before {
  content: "\ea91";
}

.bt-shield:before {
  content: "\ea92";
}

.bt-shield-fill:before {
  content: "\ea93";
}

.bt-tfvc-fork:before {
  content: "\ea94";
}

.bt-status-run-box:before {
  content: "\ea95";
}

.bt-arrow-import:before {
  content: "\ea96";
}

.bt-new-team-project:before {
  content: "\ea97";
}

.bt-package-feed-mix:before {
  content: "\ea98";
}

.bt-package-feed-remote:before {
  content: "\ea99";
}

.bt-package-feed-local:before {
  content: "\ea9a";
}

.bt-work-item-bar-outline:before {
  content: "\ea9b";
}

.bt-sort-asc:before {
  content: "\ea9c";
}

.bt-sort-desc:before {
  content: "\ea9d";
}

/**
 * Swiper 8.4.7
 * Most modern mobile touch slider and framework with hardware accelerated transitions
 * https://swiperjs.com
 *
 * Copyright 2014-2023 Vladimir Kharlampidi
 *
 * Released under the MIT License
 *
 * Released on: January 30, 2023
 */
@font-face {
  font-family: "swiper-icons";
  src: url("data:application/font-woff;charset=utf-8;base64, d09GRgABAAAAAAZgABAAAAAADAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAABGRlRNAAAGRAAAABoAAAAci6qHkUdERUYAAAWgAAAAIwAAACQAYABXR1BPUwAABhQAAAAuAAAANuAY7+xHU1VCAAAFxAAAAFAAAABm2fPczU9TLzIAAAHcAAAASgAAAGBP9V5RY21hcAAAAkQAAACIAAABYt6F0cBjdnQgAAACzAAAAAQAAAAEABEBRGdhc3AAAAWYAAAACAAAAAj//wADZ2x5ZgAAAywAAADMAAAD2MHtryVoZWFkAAABbAAAADAAAAA2E2+eoWhoZWEAAAGcAAAAHwAAACQC9gDzaG10eAAAAigAAAAZAAAArgJkABFsb2NhAAAC0AAAAFoAAABaFQAUGG1heHAAAAG8AAAAHwAAACAAcABAbmFtZQAAA/gAAAE5AAACXvFdBwlwb3N0AAAFNAAAAGIAAACE5s74hXjaY2BkYGAAYpf5Hu/j+W2+MnAzMYDAzaX6QjD6/4//Bxj5GA8AuRwMYGkAPywL13jaY2BkYGA88P8Agx4j+/8fQDYfA1AEBWgDAIB2BOoAeNpjYGRgYNBh4GdgYgABEMnIABJzYNADCQAACWgAsQB42mNgYfzCOIGBlYGB0YcxjYGBwR1Kf2WQZGhhYGBiYGVmgAFGBiQQkOaawtDAoMBQxXjg/wEGPcYDDA4wNUA2CCgwsAAAO4EL6gAAeNpj2M0gyAACqxgGNWBkZ2D4/wMA+xkDdgAAAHjaY2BgYGaAYBkGRgYQiAHyGMF8FgYHIM3DwMHABGQrMOgyWDLEM1T9/w8UBfEMgLzE////P/5//f/V/xv+r4eaAAeMbAxwIUYmIMHEgKYAYjUcsDAwsLKxc3BycfPw8jEQA/gZBASFhEVExcQlJKWkZWTl5BUUlZRVVNXUNTQZBgMAAMR+E+gAEQFEAAAAKgAqACoANAA+AEgAUgBcAGYAcAB6AIQAjgCYAKIArAC2AMAAygDUAN4A6ADyAPwBBgEQARoBJAEuATgBQgFMAVYBYAFqAXQBfgGIAZIBnAGmAbIBzgHsAAB42u2NMQ6CUAyGW568x9AneYYgm4MJbhKFaExIOAVX8ApewSt4Bic4AfeAid3VOBixDxfPYEza5O+Xfi04YADggiUIULCuEJK8VhO4bSvpdnktHI5QCYtdi2sl8ZnXaHlqUrNKzdKcT8cjlq+rwZSvIVczNiezsfnP/uznmfPFBNODM2K7MTQ45YEAZqGP81AmGGcF3iPqOop0r1SPTaTbVkfUe4HXj97wYE+yNwWYxwWu4v1ugWHgo3S1XdZEVqWM7ET0cfnLGxWfkgR42o2PvWrDMBSFj/IHLaF0zKjRgdiVMwScNRAoWUoH78Y2icB/yIY09An6AH2Bdu/UB+yxopYshQiEvnvu0dURgDt8QeC8PDw7Fpji3fEA4z/PEJ6YOB5hKh4dj3EvXhxPqH/SKUY3rJ7srZ4FZnh1PMAtPhwP6fl2PMJMPDgeQ4rY8YT6Gzao0eAEA409DuggmTnFnOcSCiEiLMgxCiTI6Cq5DZUd3Qmp10vO0LaLTd2cjN4fOumlc7lUYbSQcZFkutRG7g6JKZKy0RmdLY680CDnEJ+UMkpFFe1RN7nxdVpXrC4aTtnaurOnYercZg2YVmLN/d/gczfEimrE/fs/bOuq29Zmn8tloORaXgZgGa78yO9/cnXm2BpaGvq25Dv9S4E9+5SIc9PqupJKhYFSSl47+Qcr1mYNAAAAeNptw0cKwkAAAMDZJA8Q7OUJvkLsPfZ6zFVERPy8qHh2YER+3i/BP83vIBLLySsoKimrqKqpa2hp6+jq6RsYGhmbmJqZSy0sraxtbO3sHRydnEMU4uR6yx7JJXveP7WrDycAAAAAAAH//wACeNpjYGRgYOABYhkgZgJCZgZNBkYGLQZtIJsFLMYAAAw3ALgAeNolizEKgDAQBCchRbC2sFER0YD6qVQiBCv/H9ezGI6Z5XBAw8CBK/m5iQQVauVbXLnOrMZv2oLdKFa8Pjuru2hJzGabmOSLzNMzvutpB3N42mNgZGBg4GKQYzBhYMxJLMlj4GBgAYow/P/PAJJhLM6sSoWKfWCAAwDAjgbRAAB42mNgYGBkAIIbCZo5IPrmUn0hGA0AO8EFTQAA") format("woff");
  font-weight: 400;
  font-style: normal;
}
:root {
  --swiper-theme-color: #007aff;
}

.swiper {
  margin-left: auto;
  margin-right: auto;
  position: relative;
  overflow: hidden;
  list-style: none;
  padding: 0;
  /* Fix of Webkit flickering */
  z-index: 1;
}

.swiper-vertical > .swiper-wrapper {
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
}

.swiper-wrapper {
  position: relative;
  width: 100%;
  height: 100%;
  z-index: 1;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-transition-property: -webkit-transform;
  transition-property: -webkit-transform;
  transition-property: transform;
  transition-property: transform, -webkit-transform;
  -webkit-box-sizing: content-box;
          box-sizing: content-box;
}

.swiper-android .swiper-slide,
.swiper-wrapper {
  -webkit-transform: translate3d(0px, 0, 0);
          transform: translate3d(0px, 0, 0);
}

.swiper-pointer-events {
  -ms-touch-action: pan-y;
      touch-action: pan-y;
}
.swiper-pointer-events.swiper-vertical {
  -ms-touch-action: pan-x;
      touch-action: pan-x;
}

.swiper-slide {
  -ms-flex-negative: 0;
      flex-shrink: 0;
  width: 100%;
  height: 100%;
  position: relative;
  -webkit-transition-property: -webkit-transform;
  transition-property: -webkit-transform;
  transition-property: transform;
  transition-property: transform, -webkit-transform;
}

.swiper-slide-invisible-blank {
  visibility: hidden;
}

/* Auto Height */
.swiper-autoheight,
.swiper-autoheight .swiper-slide {
  height: auto;
}
.swiper-autoheight .swiper-wrapper {
  -webkit-box-align: start;
      -ms-flex-align: start;
          align-items: flex-start;
  -webkit-transition-property: height, -webkit-transform;
  transition-property: height, -webkit-transform;
  transition-property: transform, height;
  transition-property: transform, height, -webkit-transform;
}

.swiper-backface-hidden .swiper-slide {
  -webkit-transform: translateZ(0);
          transform: translateZ(0);
  -webkit-backface-visibility: hidden;
          backface-visibility: hidden;
}

/* 3D Effects */
.swiper-3d, .swiper-3d.swiper-css-mode .swiper-wrapper {
  -webkit-perspective: 1200px;
          perspective: 1200px;
}
.swiper-3d .swiper-wrapper,
.swiper-3d .swiper-slide,
.swiper-3d .swiper-slide-shadow,
.swiper-3d .swiper-slide-shadow-left,
.swiper-3d .swiper-slide-shadow-right,
.swiper-3d .swiper-slide-shadow-top,
.swiper-3d .swiper-slide-shadow-bottom,
.swiper-3d .swiper-cube-shadow {
  -webkit-transform-style: preserve-3d;
          transform-style: preserve-3d;
}
.swiper-3d .swiper-slide-shadow,
.swiper-3d .swiper-slide-shadow-left,
.swiper-3d .swiper-slide-shadow-right,
.swiper-3d .swiper-slide-shadow-top,
.swiper-3d .swiper-slide-shadow-bottom {
  position: absolute;
  left: 0;
  top: 0;
  width: 100%;
  height: 100%;
  pointer-events: none;
  z-index: 10;
}
.swiper-3d .swiper-slide-shadow {
  background: rgba(0, 0, 0, 0.15);
}
.swiper-3d .swiper-slide-shadow-left {
  background-image: -webkit-gradient(linear, right top, left top, from(rgba(0, 0, 0, 0.5)), to(rgba(0, 0, 0, 0)));
  background-image: linear-gradient(to left, rgba(0, 0, 0, 0.5), rgba(0, 0, 0, 0));
}
.swiper-3d .swiper-slide-shadow-right {
  background-image: -webkit-gradient(linear, left top, right top, from(rgba(0, 0, 0, 0.5)), to(rgba(0, 0, 0, 0)));
  background-image: linear-gradient(to right, rgba(0, 0, 0, 0.5), rgba(0, 0, 0, 0));
}
.swiper-3d .swiper-slide-shadow-top {
  background-image: -webkit-gradient(linear, left bottom, left top, from(rgba(0, 0, 0, 0.5)), to(rgba(0, 0, 0, 0)));
  background-image: linear-gradient(to top, rgba(0, 0, 0, 0.5), rgba(0, 0, 0, 0));
}
.swiper-3d .swiper-slide-shadow-bottom {
  background-image: -webkit-gradient(linear, left top, left bottom, from(rgba(0, 0, 0, 0.5)), to(rgba(0, 0, 0, 0)));
  background-image: linear-gradient(to bottom, rgba(0, 0, 0, 0.5), rgba(0, 0, 0, 0));
}

/* CSS Mode */
.swiper-css-mode > .swiper-wrapper {
  overflow: auto;
  scrollbar-width: none; /* For Firefox */
  -ms-overflow-style: none; /* For Internet Explorer and Edge */
}
.swiper-css-mode > .swiper-wrapper::-webkit-scrollbar {
  display: none;
}
.swiper-css-mode > .swiper-wrapper > .swiper-slide {
  scroll-snap-align: start start;
}

.swiper-horizontal.swiper-css-mode > .swiper-wrapper {
  -ms-scroll-snap-type: x mandatory;
      scroll-snap-type: x mandatory;
}

.swiper-vertical.swiper-css-mode > .swiper-wrapper {
  -ms-scroll-snap-type: y mandatory;
      scroll-snap-type: y mandatory;
}

.swiper-centered > .swiper-wrapper::before {
  content: "";
  -ms-flex-negative: 0;
      flex-shrink: 0;
  -webkit-box-ordinal-group: 10000;
      -ms-flex-order: 9999;
          order: 9999;
}
.swiper-centered.swiper-horizontal > .swiper-wrapper > .swiper-slide:first-child {
  -webkit-margin-start: var(--swiper-centered-offset-before);
          margin-inline-start: var(--swiper-centered-offset-before);
}
.swiper-centered.swiper-horizontal > .swiper-wrapper::before {
  height: 100%;
  width: var(--swiper-centered-offset-after);
}
.swiper-centered.swiper-vertical > .swiper-wrapper > .swiper-slide:first-child {
  -webkit-margin-before: var(--swiper-centered-offset-before);
          margin-block-start: var(--swiper-centered-offset-before);
}
.swiper-centered.swiper-vertical > .swiper-wrapper::before {
  width: 100%;
  height: var(--swiper-centered-offset-after);
}
.swiper-centered > .swiper-wrapper > .swiper-slide {
  scroll-snap-align: center center;
  scroll-snap-stop: always;
}

.air-datepicker-cell.-year-.-other-decade-, .air-datepicker-cell.-day-.-other-month- {
  color: var(--adp-color-other-month);
}

.air-datepicker-cell.-year-.-other-decade-:hover, .air-datepicker-cell.-day-.-other-month-:hover {
  color: var(--adp-color-other-month-hover);
}

.-disabled-.-focus-.air-datepicker-cell.-year-.-other-decade-, .-disabled-.-focus-.air-datepicker-cell.-day-.-other-month- {
  color: var(--adp-color-other-month);
}

.-selected-.air-datepicker-cell.-year-.-other-decade-, .-selected-.air-datepicker-cell.-day-.-other-month- {
  color: #fff;
  background: var(--adp-background-color-selected-other-month);
}

.-selected-.-focus-.air-datepicker-cell.-year-.-other-decade-, .-selected-.-focus-.air-datepicker-cell.-day-.-other-month- {
  background: var(--adp-background-color-selected-other-month-focused);
}

.-in-range-.air-datepicker-cell.-year-.-other-decade-, .-in-range-.air-datepicker-cell.-day-.-other-month- {
  background-color: var(--adp-background-color-in-range);
  color: var(--adp-color);
}

.-in-range-.-focus-.air-datepicker-cell.-year-.-other-decade-, .-in-range-.-focus-.air-datepicker-cell.-day-.-other-month- {
  background-color: var(--adp-background-color-in-range-focused);
}

.air-datepicker-cell.-year-.-other-decade-:empty, .air-datepicker-cell.-day-.-other-month-:empty {
  background: none;
  border: none;
}

.air-datepicker-cell {
  border-radius: var(--adp-cell-border-radius);
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  cursor: pointer;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  position: relative;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  z-index: 1;
}

.air-datepicker-cell.-focus- {
  background: var(--adp-cell-background-color-hover);
}

.air-datepicker-cell.-current- {
  color: var(--adp-color-current-date);
}

.air-datepicker-cell.-current-.-focus- {
  color: var(--adp-color);
}

.air-datepicker-cell.-current-.-in-range- {
  color: var(--adp-color-current-date);
}

.air-datepicker-cell.-disabled- {
  cursor: default;
  color: var(--adp-color-disabled);
}

.air-datepicker-cell.-disabled-.-focus- {
  color: var(--adp-color-disabled);
}

.air-datepicker-cell.-disabled-.-in-range- {
  color: var(--adp-color-disabled-in-range);
}

.air-datepicker-cell.-disabled-.-current-.-focus- {
  color: var(--adp-color-disabled);
}

.air-datepicker-cell.-in-range- {
  background: var(--adp-cell-background-color-in-range);
  border-radius: 0;
}

.air-datepicker-cell.-in-range-:hover {
  background: var(--adp-cell-background-color-in-range-hover);
}

.air-datepicker-cell.-range-from- {
  border: 1px solid var(--adp-cell-border-color-in-range);
  background-color: var(--adp-cell-background-color-in-range);
  border-radius: var(--adp-cell-border-radius) 0 0 var(--adp-cell-border-radius);
}

.air-datepicker-cell.-range-to- {
  border: 1px solid var(--adp-cell-border-color-in-range);
  background-color: var(--adp-cell-background-color-in-range);
  border-radius: 0 var(--adp-cell-border-radius) var(--adp-cell-border-radius) 0;
}

.air-datepicker-cell.-range-to-.-range-from- {
  border-radius: var(--adp-cell-border-radius);
}

.air-datepicker-cell.-selected- {
  color: #fff;
  border: none;
  background: var(--adp-cell-background-color-selected);
}

.air-datepicker-cell.-selected-.-current- {
  color: #fff;
  background: var(--adp-cell-background-color-selected);
}

.air-datepicker-cell.-selected-.-focus- {
  background: var(--adp-cell-background-color-selected-hover);
}

.air-datepicker-body {
  -webkit-transition: all var(--adp-transition-duration) var(--adp-transition-ease);
  transition: all var(--adp-transition-duration) var(--adp-transition-ease);
}

.air-datepicker-body.-hidden- {
  display: none;
}

.air-datepicker-body--day-names {
  display: grid;
  grid-template-columns: repeat(7, var(--adp-day-cell-width));
  margin: 8px 0 3px;
}

.air-datepicker-body--day-name {
  color: var(--adp-day-name-color);
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  -webkit-box-flex: 1;
      -ms-flex: 1;
          flex: 1;
  text-align: center;
  text-transform: uppercase;
  font-size: 0.8em;
}

.air-datepicker-body--day-name.-clickable- {
  cursor: pointer;
}

.air-datepicker-body--day-name.-clickable-:hover {
  color: var(--adp-day-name-color-hover);
}

.air-datepicker-body--cells {
  display: grid;
}

.air-datepicker-body--cells.-days- {
  grid-template-columns: repeat(7, var(--adp-day-cell-width));
  grid-auto-rows: var(--adp-day-cell-height);
}

.air-datepicker-body--cells.-months- {
  grid-template-columns: repeat(3, 1fr);
  grid-auto-rows: var(--adp-month-cell-height);
}

.air-datepicker-body--cells.-years- {
  grid-template-columns: repeat(4, 1fr);
  grid-auto-rows: var(--adp-year-cell-height);
}

.air-datepicker-nav {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: justify;
      -ms-flex-pack: justify;
          justify-content: space-between;
  border-bottom: 1px solid var(--adp-border-color-inner);
  min-height: var(--adp-nav-height);
  padding: var(--adp-padding);
  -webkit-box-sizing: content-box;
          box-sizing: content-box;
}

.-only-timepicker- .air-datepicker-nav {
  display: none;
}

.air-datepicker-nav--title, .air-datepicker-nav--action {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  cursor: pointer;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
}

.air-datepicker-nav--action {
  width: var(--adp-nav-action-size);
  border-radius: var(--adp-border-radius);
  -webkit-user-select: none;
  -moz-user-select: none;
  -ms-user-select: none;
      user-select: none;
}

.air-datepicker-nav--action:hover {
  background: var(--adp-background-color-hover);
}

.air-datepicker-nav--action:active {
  background: var(--adp-background-color-active);
}

.air-datepicker-nav--action.-disabled- {
  visibility: hidden;
}

.air-datepicker-nav--action svg {
  width: 32px;
  height: 32px;
}

.air-datepicker-nav--action path {
  fill: none;
  stroke: var(--adp-nav-arrow-color);
  stroke-width: 2px;
}

.air-datepicker-nav--title {
  border-radius: var(--adp-border-radius);
  padding: 0 8px;
}

.air-datepicker-nav--title i {
  font-style: normal;
  color: var(--adp-nav-color-secondary);
  margin-left: 0.3em;
}

.air-datepicker-nav--title:hover {
  background: var(--adp-background-color-hover);
}

.air-datepicker-nav--title:active {
  background: var(--adp-background-color-active);
}

.air-datepicker-nav--title.-disabled- {
  cursor: default;
  background: none;
}

.air-datepicker-buttons {
  display: grid;
  grid-auto-columns: 1fr;
  grid-auto-flow: column;
}

.air-datepicker-button {
  display: -webkit-inline-box;
  display: -ms-inline-flexbox;
  display: inline-flex;
  color: var(--adp-btn-color);
  border-radius: var(--adp-btn-border-radius);
  cursor: pointer;
  height: var(--adp-btn-height);
  border: none;
  background: rgba(255, 255, 255, 0);
}

.air-datepicker-button:hover {
  color: var(--adp-btn-color-hover);
  background: var(--adp-btn-background-color-hover);
}

.air-datepicker-button:focus {
  color: var(--adp-btn-color-hover);
  background: var(--adp-btn-background-color-hover);
  outline: none;
}

.air-datepicker-button:active {
  background: var(--adp-btn-background-color-active);
}

.air-datepicker-button span {
  outline: none;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  width: 100%;
  height: 100%;
}

.air-datepicker-time {
  display: grid;
  grid-template-columns: -webkit-max-content 1fr;
  grid-template-columns: max-content 1fr;
  grid-column-gap: 12px;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  position: relative;
  padding: 0 var(--adp-time-padding-inner);
}

.-only-timepicker- .air-datepicker-time {
  border-top: none;
}

.air-datepicker-time--current {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-flex: 1;
      -ms-flex: 1;
          flex: 1;
  font-size: 14px;
  text-align: center;
}

.air-datepicker-time--current-colon {
  margin: 0 2px 3px;
  line-height: 1;
}

.air-datepicker-time--current-hours, .air-datepicker-time--current-minutes {
  line-height: 1;
  font-size: 19px;
  font-family: "Century Gothic", CenturyGothic, AppleGothic, sans-serif;
  position: relative;
  z-index: 1;
}

.air-datepicker-time--current-hours:after, .air-datepicker-time--current-minutes:after {
  content: "";
  background: var(--adp-background-color-hover);
  border-radius: var(--adp-border-radius);
  position: absolute;
  left: -2px;
  top: -3px;
  right: -2px;
  bottom: -2px;
  z-index: -1;
  opacity: 0;
}

.air-datepicker-time--current-hours.-focus-:after, .air-datepicker-time--current-minutes.-focus-:after {
  opacity: 1;
}

.air-datepicker-time--current-ampm {
  text-transform: uppercase;
  -ms-flex-item-align: end;
      align-self: flex-end;
  color: var(--adp-time-day-period-color);
  margin-left: 6px;
  font-size: 11px;
  margin-bottom: 1px;
}

.air-datepicker-time--row {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  font-size: 11px;
  height: 17px;
  background: -webkit-gradient(linear, left top, right top, from(var(--adp-time-track-color)), to(var(--adp-time-track-color))) left 50%/100% var(--adp-time-track-height) no-repeat;
  background: linear-gradient(to right, var(--adp-time-track-color), var(--adp-time-track-color)) left 50%/100% var(--adp-time-track-height) no-repeat;
}

.air-datepicker-time--row:first-child {
  margin-bottom: 4px;
}

.air-datepicker-time--row input[type=range] {
  background: none;
  cursor: pointer;
  -webkit-box-flex: 1;
      -ms-flex: 1;
          flex: 1;
  height: 100%;
  width: 100%;
  padding: 0;
  margin: 0;
  -webkit-appearance: none;
}

.air-datepicker-time--row input[type=range]::-webkit-slider-thumb {
  -webkit-appearance: none;
}

.air-datepicker-time--row input[type=range]::-ms-tooltip {
  display: none;
}

.air-datepicker-time--row input[type=range]:hover::-webkit-slider-thumb {
  border-color: var(--adp-time-track-color-hover);
}

.air-datepicker-time--row input[type=range]:hover::-moz-range-thumb {
  border-color: var(--adp-time-track-color-hover);
}

.air-datepicker-time--row input[type=range]:hover::-ms-thumb {
  border-color: var(--adp-time-track-color-hover);
}

.air-datepicker-time--row input[type=range]:focus {
  outline: none;
}

.air-datepicker-time--row input[type=range]:focus::-webkit-slider-thumb {
  background: var(--adp-cell-background-color-selected);
  border-color: var(--adp-cell-background-color-selected);
}

.air-datepicker-time--row input[type=range]:focus::-moz-range-thumb {
  background: var(--adp-cell-background-color-selected);
  border-color: var(--adp-cell-background-color-selected);
}

.air-datepicker-time--row input[type=range]:focus::-ms-thumb {
  background: var(--adp-cell-background-color-selected);
  border-color: var(--adp-cell-background-color-selected);
}

.air-datepicker-time--row input[type=range]::-webkit-slider-thumb {
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  height: 12px;
  width: 12px;
  border-radius: 3px;
  border: 1px solid var(--adp-time-track-color);
  background: #fff;
  cursor: pointer;
  -webkit-transition: background var(--adp-transition-duration);
  transition: background var(--adp-transition-duration);
}

.air-datepicker-time--row input[type=range]::-moz-range-thumb {
  box-sizing: border-box;
  height: 12px;
  width: 12px;
  border-radius: 3px;
  border: 1px solid var(--adp-time-track-color);
  background: #fff;
  cursor: pointer;
  -moz-transition: background var(--adp-transition-duration);
  transition: background var(--adp-transition-duration);
}

.air-datepicker-time--row input[type=range]::-ms-thumb {
  box-sizing: border-box;
  height: 12px;
  width: 12px;
  border-radius: 3px;
  border: 1px solid var(--adp-time-track-color);
  background: #fff;
  cursor: pointer;
  -ms-transition: background var(--adp-transition-duration);
  transition: background var(--adp-transition-duration);
}

.air-datepicker-time--row input[type=range]::-webkit-slider-thumb {
  margin-top: calc(var(--adp-time-thumb-size) / 2 * -1);
}

.air-datepicker-time--row input[type=range]::-webkit-slider-runnable-track {
  border: none;
  height: var(--adp-time-track-height);
  cursor: pointer;
  color: rgba(0, 0, 0, 0);
  background: rgba(0, 0, 0, 0);
}

.air-datepicker-time--row input[type=range]::-moz-range-track {
  border: none;
  height: var(--adp-time-track-height);
  cursor: pointer;
  color: rgba(0, 0, 0, 0);
  background: rgba(0, 0, 0, 0);
}

.air-datepicker-time--row input[type=range]::-ms-track {
  border: none;
  height: var(--adp-time-track-height);
  cursor: pointer;
  color: rgba(0, 0, 0, 0);
  background: rgba(0, 0, 0, 0);
}

.air-datepicker-time--row input[type=range]::-ms-fill-lower {
  background: rgba(0, 0, 0, 0);
}

.air-datepicker-time--row input[type=range]::-ms-fill-upper {
  background: rgba(0, 0, 0, 0);
}

.air-datepicker {
  --adp-font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, Helvetica, Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol";
  --adp-font-size: 14px;
  --adp-width: 246px;
  --adp-z-index: 100;
  --adp-padding: 4px;
  --adp-grid-areas: "nav" "body" "timepicker" "buttons";
  --adp-transition-duration: .3s;
  --adp-transition-ease: ease-out;
  --adp-transition-offset: 8px;
  --adp-background-color: #fff;
  --adp-background-color-hover: #f0f0f0;
  --adp-background-color-active: #eaeaea;
  --adp-background-color-in-range: rgba(92, 196, 239, .1);
  --adp-background-color-in-range-focused: rgba(92, 196, 239, .2);
  --adp-background-color-selected-other-month-focused: #8ad5f4;
  --adp-background-color-selected-other-month: #a2ddf6;
  --adp-color: #4a4a4a;
  --adp-color-secondary: #9c9c9c;
  --adp-accent-color: #4eb5e6;
  --adp-color-current-date: var(--adp-accent-color);
  --adp-color-other-month: #dedede;
  --adp-color-disabled: #aeaeae;
  --adp-color-disabled-in-range: #939393;
  --adp-color-other-month-hover: #c5c5c5;
  --adp-border-color: #dbdbdb;
  --adp-border-color-inner: #efefef;
  --adp-border-radius: 4px;
  --adp-border-color-inline: #d7d7d7;
  --adp-nav-height: 32px;
  --adp-nav-arrow-color: var(--adp-color-secondary);
  --adp-nav-action-size: 32px;
  --adp-nav-color-secondary: var(--adp-color-secondary);
  --adp-day-name-color: #ff9a19;
  --adp-day-name-color-hover: #8ad5f4;
  --adp-day-cell-width: 1fr;
  --adp-day-cell-height: 32px;
  --adp-month-cell-height: 42px;
  --adp-year-cell-height: 56px;
  --adp-pointer-size: 10px;
  --adp-poiner-border-radius: 2px;
  --adp-pointer-offset: 14px;
  --adp-cell-border-radius: 4px;
  --adp-cell-background-color-hover: var(--adp-background-color-hover);
  --adp-cell-background-color-selected: #5cc4ef;
  --adp-cell-background-color-selected-hover: #45bced;
  --adp-cell-background-color-in-range: rgba(92, 196, 239, 0.1);
  --adp-cell-background-color-in-range-hover: rgba(92, 196, 239, 0.2);
  --adp-cell-border-color-in-range: var(--adp-cell-background-color-selected);
  --adp-btn-height: 32px;
  --adp-btn-color: var(--adp-accent-color);
  --adp-btn-color-hover: var(--adp-color);
  --adp-btn-border-radius: var(--adp-border-radius);
  --adp-btn-background-color-hover: var(--adp-background-color-hover);
  --adp-btn-background-color-active: var(--adp-background-color-active);
  --adp-time-track-height: 1px;
  --adp-time-track-color: #dedede;
  --adp-time-track-color-hover: #b1b1b1;
  --adp-time-thumb-size: 12px;
  --adp-time-padding-inner: 10px;
  --adp-time-day-period-color: var(--adp-color-secondary);
  --adp-mobile-font-size: 16px;
  --adp-mobile-nav-height: 40px;
  --adp-mobile-width: 320px;
  --adp-mobile-day-cell-height: 38px;
  --adp-mobile-month-cell-height: 48px;
  --adp-mobile-year-cell-height: 64px;
}

.air-datepicker-overlay {
  --adp-overlay-background-color: rgba(0, 0, 0, .3);
  --adp-overlay-transition-duration: .3s;
  --adp-overlay-transition-ease: ease-out;
  --adp-overlay-z-index: 99;
}

.air-datepicker {
  background: var(--adp-background-color);
  border: 1px solid var(--adp-border-color);
  -webkit-box-shadow: 0 4px 12px rgba(0, 0, 0, 0.15);
          box-shadow: 0 4px 12px rgba(0, 0, 0, 0.15);
  border-radius: var(--adp-border-radius);
  -webkit-box-sizing: content-box;
          box-sizing: content-box;
  display: grid;
  grid-template-columns: 1fr;
  grid-template-rows: repeat(4, -webkit-max-content);
  grid-template-rows: repeat(4, max-content);
  grid-template-areas: var(--adp-grid-areas);
  font-family: var(--adp-font-family), sans-serif;
  font-size: var(--adp-font-size);
  color: var(--adp-color);
  width: var(--adp-width);
  position: absolute;
  -webkit-transition: opacity var(--adp-transition-duration) var(--adp-transition-ease), -webkit-transform var(--adp-transition-duration) var(--adp-transition-ease);
  transition: opacity var(--adp-transition-duration) var(--adp-transition-ease), -webkit-transform var(--adp-transition-duration) var(--adp-transition-ease);
  transition: opacity var(--adp-transition-duration) var(--adp-transition-ease), transform var(--adp-transition-duration) var(--adp-transition-ease);
  transition: opacity var(--adp-transition-duration) var(--adp-transition-ease), transform var(--adp-transition-duration) var(--adp-transition-ease), -webkit-transform var(--adp-transition-duration) var(--adp-transition-ease);
  z-index: var(--adp-z-index);
}

.air-datepicker:not(.-custom-position-) {
  opacity: 0;
}

.air-datepicker.-from-top- {
  -webkit-transform: translateY(calc(var(--adp-transition-offset) * -1));
          transform: translateY(calc(var(--adp-transition-offset) * -1));
}

.air-datepicker.-from-right- {
  -webkit-transform: translateX(var(--adp-transition-offset));
          transform: translateX(var(--adp-transition-offset));
}

.air-datepicker.-from-bottom- {
  -webkit-transform: translateY(var(--adp-transition-offset));
          transform: translateY(var(--adp-transition-offset));
}

.air-datepicker.-from-left- {
  -webkit-transform: translateX(calc(var(--adp-transition-offset) * -1));
          transform: translateX(calc(var(--adp-transition-offset) * -1));
}

.air-datepicker.-active-:not(.-custom-position-) {
  -webkit-transform: translate(0, 0);
          transform: translate(0, 0);
  opacity: 1;
}

.air-datepicker.-active-.-custom-position- {
  -webkit-transition: none;
  transition: none;
}

.air-datepicker.-inline- {
  border-color: var(--adp-border-color-inline);
  -webkit-box-shadow: none;
          box-shadow: none;
  position: static;
  left: auto;
  right: auto;
  opacity: 1;
  -webkit-transform: none;
          transform: none;
}

.air-datepicker.-inline- .air-datepicker--pointer {
  display: none;
}

.air-datepicker.-is-mobile- {
  --adp-font-size: var(--adp-mobile-font-size);
  --adp-day-cell-height: var(--adp-mobile-day-cell-height);
  --adp-month-cell-height: var(--adp-mobile-month-cell-height);
  --adp-year-cell-height: var(--adp-mobile-year-cell-height);
  --adp-nav-height: var(--adp-mobile-nav-height);
  --adp-nav-action-size: var(--adp-mobile-nav-height);
  position: fixed;
  width: var(--adp-mobile-width);
  border: none;
}

.air-datepicker.-is-mobile- * {
  -webkit-tap-highlight-color: rgba(0, 0, 0, 0);
}

.air-datepicker.-is-mobile- .air-datepicker--pointer {
  display: none;
}

.air-datepicker.-is-mobile-:not(.-custom-position-) {
  -webkit-transform: translate(-50%, calc(-50% + var(--adp-transition-offset)));
          transform: translate(-50%, calc(-50% + var(--adp-transition-offset)));
}

.air-datepicker.-is-mobile-.-active-:not(.-custom-position-) {
  -webkit-transform: translate(-50%, -50%);
          transform: translate(-50%, -50%);
}

.air-datepicker.-custom-position- {
  -webkit-transition: none;
  transition: none;
}

.air-datepicker-global-container {
  position: absolute;
  left: 0;
  top: 0;
}

.air-datepicker--pointer {
  --pointer-half-size: calc(var(--adp-pointer-size) / 2);
  position: absolute;
  width: var(--adp-pointer-size);
  height: var(--adp-pointer-size);
  z-index: -1;
}

.air-datepicker--pointer:after {
  content: "";
  position: absolute;
  background: #fff;
  border-top: 1px solid var(--adp-border-color-inline);
  border-right: 1px solid var(--adp-border-color-inline);
  border-top-right-radius: var(--adp-poiner-border-radius);
  width: var(--adp-pointer-size);
  height: var(--adp-pointer-size);
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}

.-top-left- .air-datepicker--pointer, .-top-center- .air-datepicker--pointer, .-top-right- .air-datepicker--pointer, [data-popper-placement^=top] .air-datepicker--pointer {
  top: calc(100% - var(--pointer-half-size) + 1px);
}

.-top-left- .air-datepicker--pointer:after, .-top-center- .air-datepicker--pointer:after, .-top-right- .air-datepicker--pointer:after, [data-popper-placement^=top] .air-datepicker--pointer:after {
  -webkit-transform: rotate(135deg);
          transform: rotate(135deg);
}

.-right-top- .air-datepicker--pointer, .-right-center- .air-datepicker--pointer, .-right-bottom- .air-datepicker--pointer, [data-popper-placement^=right] .air-datepicker--pointer {
  right: calc(100% - var(--pointer-half-size) + 1px);
}

.-right-top- .air-datepicker--pointer:after, .-right-center- .air-datepicker--pointer:after, .-right-bottom- .air-datepicker--pointer:after, [data-popper-placement^=right] .air-datepicker--pointer:after {
  -webkit-transform: rotate(225deg);
          transform: rotate(225deg);
}

.-bottom-left- .air-datepicker--pointer, .-bottom-center- .air-datepicker--pointer, .-bottom-right- .air-datepicker--pointer, [data-popper-placement^=bottom] .air-datepicker--pointer {
  bottom: calc(100% - var(--pointer-half-size) + 1px);
}

.-bottom-left- .air-datepicker--pointer:after, .-bottom-center- .air-datepicker--pointer:after, .-bottom-right- .air-datepicker--pointer:after, [data-popper-placement^=bottom] .air-datepicker--pointer:after {
  -webkit-transform: rotate(315deg);
          transform: rotate(315deg);
}

.-left-top- .air-datepicker--pointer, .-left-center- .air-datepicker--pointer, .-left-bottom- .air-datepicker--pointer, [data-popper-placement^=left] .air-datepicker--pointer {
  left: calc(100% - var(--pointer-half-size) + 1px);
}

.-left-top- .air-datepicker--pointer:after, .-left-center- .air-datepicker--pointer:after, .-left-bottom- .air-datepicker--pointer:after, [data-popper-placement^=left] .air-datepicker--pointer:after {
  -webkit-transform: rotate(45deg);
          transform: rotate(45deg);
}

.-top-left- .air-datepicker--pointer, .-bottom-left- .air-datepicker--pointer {
  left: var(--adp-pointer-offset);
}

.-top-right- .air-datepicker--pointer, .-bottom-right- .air-datepicker--pointer {
  right: var(--adp-pointer-offset);
}

.-top-center- .air-datepicker--pointer, .-bottom-center- .air-datepicker--pointer {
  left: calc(50% - var(--adp-pointer-size) / 2);
}

.-left-top- .air-datepicker--pointer, .-right-top- .air-datepicker--pointer {
  top: var(--adp-pointer-offset);
}

.-left-bottom- .air-datepicker--pointer, .-right-bottom- .air-datepicker--pointer {
  bottom: var(--adp-pointer-offset);
}

.-left-center- .air-datepicker--pointer, .-right-center- .air-datepicker--pointer {
  top: calc(50% - var(--adp-pointer-size) / 2);
}

.air-datepicker--navigation {
  grid-area: nav;
}

.air-datepicker--content {
  -webkit-box-sizing: content-box;
          box-sizing: content-box;
  padding: var(--adp-padding);
  grid-area: body;
}

.-only-timepicker- .air-datepicker--content {
  display: none;
}

.air-datepicker--time {
  grid-area: timepicker;
}

.air-datepicker--buttons {
  grid-area: buttons;
}

.air-datepicker--buttons, .air-datepicker--time {
  padding: var(--adp-padding);
  border-top: 1px solid var(--adp-border-color-inner);
}

.air-datepicker-overlay {
  position: fixed;
  background: var(--adp-overlay-background-color);
  left: 0;
  top: 0;
  width: 0;
  height: 0;
  opacity: 0;
  -webkit-transition: opacity var(--adp-overlay-transition-duration) var(--adp-overlay-transition-ease), left 0s, height 0s, width 0s;
  transition: opacity var(--adp-overlay-transition-duration) var(--adp-overlay-transition-ease), left 0s, height 0s, width 0s;
  -webkit-transition-delay: 0s, var(--adp-overlay-transition-duration), var(--adp-overlay-transition-duration), var(--adp-overlay-transition-duration);
          transition-delay: 0s, var(--adp-overlay-transition-duration), var(--adp-overlay-transition-duration), var(--adp-overlay-transition-duration);
  z-index: var(--adp-overlay-z-index);
}

.air-datepicker-overlay.-active- {
  opacity: 1;
  width: 100%;
  height: 100%;
  -webkit-transition: opacity var(--adp-overlay-transition-duration) var(--adp-overlay-transition-ease), height 0s, width 0s;
  transition: opacity var(--adp-overlay-transition-duration) var(--adp-overlay-transition-ease), height 0s, width 0s;
}

.social, .drawerMenu, .footerMenu, .headerSliderMenu__wrapper, .headerNav {
  margin: 0;
  padding: 0;
  list-style: none;
}

.headerSliderMenu__button, .headerMenu__button, .headerCity__control, .inputGroup__button {
  position: relative;
  margin: 0;
  padding: 0;
  border: none;
  background: none;
  color: inherit;
  font-family: inherit;
  font-size: 100%;
  font-weight: normal;
  text-decoration: none;
  outline: none !important;
  cursor: pointer;
}

.category__link, .radio__control::after, .checkbox__control::after {
  position: absolute;
  top: 0;
  right: 0;
  bottom: 0;
  left: 0;
}

.currentOrder__container, .checkout__container, .cart__container, .promo__container, .mobileLocation__container, .footer__container, .searchbox__container, .header__container, .filter__container, .headline__container, .sector__container, .section__container, .container {
  width: calc(100% - var(--gap-big));
  max-width: 1400px;
  margin: 0 auto;
}
@media (max-width: 767.98px) {
  .currentOrder__container, .checkout__container, .cart__container, .promo__container, .mobileLocation__container, .footer__container, .searchbox__container, .header__container, .filter__container, .headline__container, .sector__container, .section__container, .container {
    width: calc(100% - var(--gap-2));
  }
}

@font-face {
  font-family: "Mulish";
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/Mulish/Mulish-VariableFont_wght.woff2") format("woff2-variations"), url("/bitrix/templates/webdelivery/assets/css/../fonts/Mulish/Mulish-VariableFont_wght.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "Roboto Flex";
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/RobotoFlex/RobotoFlex-VariableFont_GRAD,XTRA,YOPQ,YTAS,YTDE,YTFI,YTLC,YTUC,opsz,slnt,wdth,wght.woff2") format("woff2-variations"), url("/bitrix/templates/webdelivery/assets/css/../fonts/RobotoFlex/RobotoFlex-VariableFont_GRAD,XTRA,YOPQ,YTAS,YTDE,YTFI,YTLC,YTUC,opsz,slnt,wdth,wght.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "Manrope";
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/Manrope/Manrope-VariableFont_wght.woff2") format("woff2-variations"), url("/bitrix/templates/webdelivery/assets/css/../fonts/Manrope/Manrope-VariableFont_wght.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "Gilroy";
  font-style: normal;
  font-weight: 200;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/Gilroy/Gilroy-UltraLight.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "Gilroy";
  font-style: normal;
  font-weight: 300;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/Gilroy/Gilroy-Light.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "Gilroy";
  font-style: normal;
  font-weight: 400;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/Gilroy/Gilroy-Regular.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "Gilroy";
  font-style: normal;
  font-weight: 500;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/Gilroy/Gilroy-Medium.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "Gilroy";
  font-style: normal;
  font-weight: 600;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/Gilroy/Gilroy-SemiBold.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "Gilroy";
  font-style: normal;
  font-weight: 700;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/Gilroy/Gilroy-Bold.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "Gilroy";
  font-style: normal;
  font-weight: 800;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/Gilroy/Gilroy-Black.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "Gilroy";
  font-style: normal;
  font-weight: 900;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/Gilroy/Gilroy-ExtraBold.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "Montserrat";
  font-style: normal;
  font-weight: 400;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/montserrat/Montserrat-Regular.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "Montserrat";
  font-style: normal;
  font-weight: 500;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/montserrat/Montserrat-Medium.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "Montserrat";
  font-style: normal;
  font-weight: 600;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/montserrat/Montserrat-SemiBold.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "Montserrat";
  font-style: normal;
  font-weight: 700;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/montserrat/Montserrat-Bold.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "Montserrat";
  font-style: normal;
  font-weight: 800;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/montserrat/Montserrat-Black.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "Montserrat";
  font-style: normal;
  font-weight: 900;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/montserrat/Montserrat-ExtraBold.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "SFUIText";
  font-style: normal;
  font-weight: 400;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/SFUI/SFUIText-Regular.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "SFUIDisplay";
  font-style: normal;
  font-weight: 400;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/SFUI/SFUIDisplay-Regular.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "Golos-Text";
  font-style: normal;
  font-weight: 400;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/Golos-Text/Golos-Text_Regular.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "Golos-Text";
  font-style: normal;
  font-weight: 500;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/Golos-Text/Golos-Text_Medium.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "Golos-Text";
  font-style: normal;
  font-weight: 600;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/Golos-Text/Golos-Text_DemiBold.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "Golos-Text";
  font-style: normal;
  font-weight: 700;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/Golos-Text/Golos-Text_Bold.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "Golos-Text";
  font-style: normal;
  font-weight: 800;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/Golos-Text/Golos-Text_Black.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "EuclidCircularA";
  font-style: normal;
  font-weight: 300;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/EuclidCircularA/EuclidCircularA-Light.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "EuclidCircularA";
  font-style: normal;
  font-weight: 400;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/EuclidCircularA/EuclidCircularA-Regular.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "EuclidCircularA";
  font-style: normal;
  font-weight: 500;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/EuclidCircularA/EuclidCircularA-Medium.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "EuclidCircularA";
  font-style: normal;
  font-weight: 600;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/EuclidCircularA/EuclidCircularA-SemiBold.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "EuclidCircularA";
  font-style: normal;
  font-weight: 700;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/EuclidCircularA/EuclidCircularA-Bold.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "fontawesome";
  font-style: normal;
  font-weight: normal;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/fontawesome/fontawesome-webfont.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "FA Brands";
  font-style: normal;
  font-weight: normal;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/fontawesome/fa-brands-400.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "FA Brands";
  font-style: normal;
  font-weight: normal;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/fontawesome/fa-regular-400.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "FA Free";
  font-style: normal;
  font-weight: normal;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/fontawesome/fa-solid-900.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "feathericon";
  font-style: normal;
  font-weight: normal;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/feathericon/feathericon.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "iconsax";
  font-style: normal;
  font-weight: normal;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/iconsax/iconsax.woff2") format("woff2");
  font-display: swap;
}
@font-face {
  font-family: "bowtie";
  font-style: normal;
  font-weight: normal;
  src: url("/bitrix/templates/webdelivery/assets/css/../fonts/bowtie/bowtie.woff2") format("woff2");
  font-display: swap;
}
.layout {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  max-width: 100vw;
  min-width: var(--min-width);
  min-height: 100vh;
  padding: calc(var(--safe-top) + 162px) 0 0;
}
@media (max-width: 767.98px) {
  .layout {
    padding: calc(var(--safe-top) + 162px) 0 calc(var(--mobile-nav-height) + var(--safe-bottom) / 2);
  }
}
@media (max-width: 575.98px) {
  .layout {
    padding: calc(var(--safe-top) + 110px) 0 calc(var(--mobile-nav-height) + var(--safe-bottom) / 2);
  }
}
.layout--inner {
  --sticky-offset: 85px;
  padding: calc(var(--safe-top) + 102px) 0 0;
}
@media (max-width: 767.98px) {
  .layout--inner {
    padding: calc(var(--safe-top) + 102px) 0 calc(var(--mobile-nav-height) + var(--safe-bottom) / 2);
  }
}
@media (max-width: 575.98px) {
  .layout--inner {
    padding: calc(var(--safe-top) + 50px) 0 calc(var(--mobile-nav-height) + var(--safe-bottom) / 2);
  }
}
.layout__main {
  -webkit-box-flex: 1;
      -ms-flex: 1;
          flex: 1;
  background-color: var(--layout-color);
  margin-bottom: var(--gap);
  opacity: 0;
  visibility: hidden;
  -webkit-transform: translateY(50px);
          transform: translateY(50px);
  -webkit-animation: fadeInTrs var(--speed) both;
          animation: fadeInTrs var(--speed) both;
}
@media (max-width: 575.98px) {
  .layout__main {
    margin-bottom: var(--gap);
  }
}

*,
*:before,
*:after {
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}

::-moz-selection {
  background-color: var(--primary-color);
  color: #fff;
}

::selection {
  background-color: var(--primary-color);
  color: #fff;
}

html, body {
  color-scheme: var(--color-scheme);
  -ms-touch-action: manipulation;
      touch-action: manipulation;
  height: 100vh;
}

body {
  font-optical-sizing: none;
  font-variation-settings: "wght" 350, "wdth" 130, "YTDE" -130, "XTRA" 450, "YTLC" 490;
  min-width: 320px;
  position: relative;
  font-family: var(--default-font);
  font-size: var(--font-size-base);
  font-weight: normal;
  line-height: var(--line-height);
  color: var(--main-text-color);
  background-color: var(--layout-color);
  -webkit-transition: background-color var(--speed);
  transition: background-color var(--speed);
  overflow-x: hidden;
  scroll-behavior: smooth;
  -webkit-font-smoothing: antialiased;
  -moz-osx-font-smoothing: grayscale;
  -webkit-tap-highlight-color: transparent;
  -webkit-touch-callout: none;
}

.noscroll {
  overflow: hidden;
}
.noscroll--ios {
  position: fixed;
  height: 100%;
  width: 100%;
}

a {
  color: var(--primary-color);
  -webkit-transition: var(--speed);
  transition: var(--speed);
}
a:hover {
  color: var(--main-text-color);
  text-decoration: none;
}
a[href^=http]:not([data-noicon]):before {
  font-family: "feathericon";
  display: inline-block;
  font-size: 11px;
  padding-right: 3px;
  content: "\e95b";
}

img:not([src]) {
  visibility: hidden;
}

b,
strong {
  font-weight: bold;
}

p {
  margin: var(--gap) 0;
}
p:first-child {
  margin-top: 0;
}
p:last-child {
  margin-bottom: 0;
}

.text-secondary {
  color: var(--color-text-secondary);
}
.text-hint {
  color: var(--color-text-hint);
}
.text-small {
  font-size: var(--font-sie-small);
}
.text-nowrap {
  white-space: nowrap;
}
.text-center {
  text-align: center;
}

img:not([src]) {
  visibility: hidden;
}

svg {
  fill: none;
  stroke: currentColor;
  stroke-width: 2;
  stroke-linecap: round;
  stroke-linejoin: round;
}

pre {
  padding: calc(var(--gap) / 2);
  border-radius: 5px;
  background: var(--color-bg);
}

.ripple__root {
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  display: block;
  z-index: 0;
  overflow: hidden;
  position: absolute;
  border-radius: inherit;
  pointer-events: none;
}
.ripple__child {
  --ripple-end-opacity: .5;
  --ripple-end-size: scale(2);
  top: var(--ripple-t);
  left: var(--ripple-l);
  width: var(--ripple-w);
  height: var(--ripple-h);
  margin-left: var(--ripple-ml);
  margin-top: var(--ripple-mt);
  position: absolute;
  border-radius: 50%;
  -webkit-transform: scale(0.25);
          transform: scale(0.25);
  -webkit-transition: calc(var(--speed) * 1.2) linear;
  transition: calc(var(--speed) * 1.2) linear;
  cursor: pointer;
  z-index: 5;
}

.section {
  margin-bottom: var(--gap-big);
}
@media (max-width: 575.98px) {
  .section {
    margin-bottom: var(--gap-2);
  }
}
.section__header {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: justify;
      -ms-flex-pack: justify;
          justify-content: space-between;
  position: relative;
  margin: 0 0 var(--gap);
}
@media (max-width: 991.98px) {
  .section__header {
    margin: 0 0 var(--gap);
  }
}
.section__title {
  position: relative;
  margin: 0;
  font-size: var(--font-size-title);
  line-height: var(--line-height-title);
  font-weight: 500;
}
@media (max-width: 991.98px) {
  .section__title {
    font-size: var(--font-size-medium);
  }
}
.section__target {
  text-decoration: none;
}
.section__target_danger {
  color: var(--color-primary);
}
.section__target:hover {
  text-decoration: underline;
}
.section__chip {
  display: inline-block;
  margin-left: 10px;
  font-size: var(--font-size-tiny);
  line-height: 1;
  vertical-align: middle;
}
@media (max-width: 767.98px) {
  .section__chip {
    display: none;
  }
}
.section__more {
  display: -webkit-inline-box;
  display: -ms-inline-flexbox;
  display: inline-flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  margin: 0 0 0 var(--gap);
  color: var(--color-text-secondary);
  text-decoration: none;
  line-height: var(--line-height-title);
  white-space: nowrap;
}
@media (max-width: 991.98px) {
  .section__more {
    font-size: var(--font-size-small);
  }
}

.sector {
  margin-bottom: var(--gap-big);
}
@media (max-width: 575.98px) {
  .sector {
    margin-bottom: var(--gap);
  }
}
@media (min-width: 992px) {
  .sector__container {
    display: -webkit-box;
    display: -ms-flexbox;
    display: flex;
  }
}
.sector__sidebar {
  width: var(--sidebar-width);
  margin-right: var(--gap-2);
  position: sticky;
  top: 6rem;
  height: -webkit-fit-content;
  height: -moz-fit-content;
  height: fit-content;
}
@media (max-width: 991.98px) {
  .sector__sidebar {
    display: none;
  }
}
@media (min-width: 992px) {
  .sector__content {
    -webkit-box-flex: 1;
        -ms-flex: 1;
            flex: 1;
  }
}

.paper {
  position: relative;
  background-color: var(--paper-color);
  border-radius: var(--radius);
  padding: var(--gap-2);
  -webkit-transition: background-color var(--speed), -webkit-box-shadow var(--speed);
  transition: background-color var(--speed), -webkit-box-shadow var(--speed);
  transition: background-color var(--speed), box-shadow var(--speed);
  transition: background-color var(--speed), box-shadow var(--speed), -webkit-box-shadow var(--speed);
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
}
@media (max-width: 991.98px) {
  .paper {
    padding: var(--gap);
  }
}

.headline {
  margin: var(--gap-2) 0;
}
@media (max-width: 575.98px) {
  .headline {
    margin: var(--gap) 0;
  }
}
.headline__container {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
}
.headline__back {
  margin-right: var(--gap);
}
@media (max-width: 767.98px) {
  .headline__back {
    margin: 0;
  }
}
.headline__title {
  margin: 0;
  -webkit-transition: var(--speed);
  transition: var(--speed);
  line-height: var(--line-height-title);
}
@media (max-width: 767.98px) {
  .headline__title {
    font-size: var(--font-size-medium);
  }
}

.link-label {
  font-size: 1.15em;
  line-height: 1.25em;
}
.link-icon {
  font-size: 1.25em;
  line-height: 1.25em;
  margin-right: 0.6em;
}

.text-center {
  text-align: center;
}
.text-uppercase {
  text-transform: uppercase;
}

ul {
  padding-left: 16px;
}
ul li::marker {
  color: var(--primary-color);
}

.tab {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
      flex-wrap: wrap;
}
.tab::before {
  content: "";
  position: absolute;
  top: 0;
  right: 0;
  left: 0;
  height: calc(var(--button-size) + 8px);
  border-radius: calc(var(--radius) + 3px);
  background-color: var(--layout-color);
  -webkit-box-shadow: inset 0 0 2px var(--shadow-first), inset 0 0 12px var(--shadow-second);
          box-shadow: inset 0 0 2px var(--shadow-first), inset 0 0 12px var(--shadow-second);
}
.tab__control {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-flex: 1;
      -ms-flex: 1 1 auto;
          flex: 1 1 auto;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  min-height: var(--button-size);
  border-radius: var(--radius);
  padding: 0 var(--gap);
  margin: 0;
  cursor: pointer;
  background-color: var(--layout-color);
  -webkit-transition: 0.25s;
  transition: 0.25s;
  margin: 4px;
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
}
.tab__control--active {
  background-color: var(--paper-color);
}
.tab__control--active + .tab__panel {
  display: block;
  -webkit-animation: tabFadeIn 0.5s both;
          animation: tabFadeIn 0.5s both;
}
.tab__label {
  font-size: var(--font-size-base);
  line-height: var(--font-size-base);
  text-transform: uppercase;
  pointer-events: none;
}
.tab__panel {
  display: none;
  width: 100%;
  opacity: 0;
  -webkit-transform: translateY(-15px);
          transform: translateY(-15px);
  -webkit-box-flex: 0;
      -ms-flex: 0 0 100%;
          flex: 0 0 100%;
  -webkit-box-ordinal-group: 1001;
      -ms-flex-order: 1000;
          order: 1000;
  margin-top: var(--gap-2);
}
@media (max-width: 767.98px) {
  .tab__panel {
    margin-top: var(--gap);
  }
}

@-webkit-keyframes tabFadeIn {
  to {
    opacity: 1;
    -webkit-transform: translateY(0);
            transform: translateY(0);
  }
}

@keyframes tabFadeIn {
  to {
    opacity: 1;
    -webkit-transform: translateY(0);
            transform: translateY(0);
  }
}
.sideMenu {
  padding: 0;
  background-color: var(--paper-color);
  border-radius: var(--radius);
  -webkit-transition: background-color var(--speed), -webkit-box-shadow var(--speed);
  transition: background-color var(--speed), -webkit-box-shadow var(--speed);
  transition: background-color var(--speed), box-shadow var(--speed);
  transition: background-color var(--speed), box-shadow var(--speed), -webkit-box-shadow var(--speed);
  overflow: hidden;
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
}
.sideMenu__list {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  margin: 0;
  padding: 0;
  list-style-type: none;
}
.sideMenu__link {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  height: 50px;
  padding: 0 3rem 0 var(--gap);
  position: relative;
  overflow: hidden;
  -webkit-transition: var(--speed);
  transition: var(--speed);
  color: var(--main-text-color);
  transition: var(--speed);
}
.sideMenu__link::after {
  font-family: "feathericon";
  content: "\e930";
  font-size: var(--font-size-bigger);
  position: absolute;
  right: 0;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  height: 100%;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  width: 3rem;
}
.sideMenu__link:hover {
  color: var(--main-text-color);
  background-color: var(--focus-highlight);
}
.sideMenu__link--current {
  color: var(--primary-color);
}
.sideMenu__link--current:hover {
  color: var(--primary-color);
}
.sideMenu__label {
  -webkit-box-flex: 1;
      -ms-flex: 1 0 0px;
          flex: 1 0 0;
  font-size: var(--font-size-medium);
}
.sideMenu__view {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  width: 22px;
  margin-right: var(--gap);
}
.sideMenu__icon {
  width: 22px;
  height: 22px;
}

.form {
  position: relative;
}
.form__fieldset {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
      flex-wrap: wrap;
  -webkit-box-align: start;
      -ms-flex-align: start;
          align-items: flex-start;
  margin: 0 calc(var(--gap) * -1) calc(var(--gap-1-5) * -1) calc(var(--gap) * -1);
}
@media (max-width: 575.98px) {
  .form__fieldset {
    margin: 0 calc(var(--gap) * -0.5) calc(var(--gap) * -1) calc(var(--gap) * -0.5);
  }
}
.form__row {
  width: 100%;
  padding: 0 var(--gap);
  margin: 0 0 var(--gap-1-5) 0;
}
@media (max-width: 575.98px) {
  .form__row {
    padding: 0 calc(var(--gap) / 2);
    margin: 0 0 var(--gap) 0;
  }
}
.form__row--empty {
  display: none;
}
.form__row--fourth {
  width: 50%;
}
@media (min-width: 576px) {
  .form__row {
    width: 100%;
  }
  .form__row--half {
    width: 50%;
  }
  .form__row--third {
    width: 33.3333333333%;
  }
  .form__row--fourth {
    width: 25%;
  }
  .form__row--auto {
    width: auto;
  }
  .form__row--empty {
    display: block;
  }
}
.form__row--first {
  margin-top: 0;
}
.form__row--last {
  margin-bottom: 0;
}
.form__group {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
}
@media (max-width: 575.98px) {
  .form__group {
    -webkit-box-pack: justify;
        -ms-flex-pack: justify;
            justify-content: space-between;
  }
}
.form__label {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  font-size: var(--font-size-medium);
  font-weight: 500;
  margin: 0 0 var(--gap) 0;
}
.form__label--inline {
  display: -webkit-inline-box;
  display: -ms-inline-flexbox;
  display: inline-flex;
  -ms-flex-item-align: center;
      align-self: center;
  margin: 0 var(--gap) 0 0;
}
.form__actions {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -ms-flex-wrap: wrap;
      flex-wrap: wrap;
  -webkit-box-flex: 0;
      -ms-flex: 0 0 100%;
          flex: 0 0 100%;
  margin-top: var(--gap-2);
}
@media (max-width: 575.98px) {
  .form__actions {
    margin-top: var(--gap);
  }
}
.form__actions--center {
  text-align: center;
}
.form__actions .btn:not(:last-child) {
  margin: 0 var(--gap) 0 0;
}
@media (max-width: 575.98px) {
  .form__actions .btn:not(:last-child) {
    margin: 0 0 var(--gap) 0;
  }
}
.form__actions--fill {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: justify;
      -ms-flex-pack: justify;
          justify-content: space-between;
  justify-items: stretch;
}
.form__actions--fill .btn {
  -webkit-box-flex: 1;
      -ms-flex: 1 0 auto;
          flex: 1 0 auto;
  margin-left: var(--gap-0-5);
}
.form__actions--fill .btn:first-child {
  margin-left: 0;
}

.dropdown__wrapper {
  position: absolute;
  top: calc(var(--button-size) + 7px);
  left: 0;
  opacity: 0;
  max-width: 320px;
  -webkit-transform: translateY(15px);
          transform: translateY(15px);
  -webkit-transition: opacity var(--speed), visibility var(--speed), bottom var(--speed), -webkit-transform var(--speed);
  transition: opacity var(--speed), visibility var(--speed), bottom var(--speed), -webkit-transform var(--speed);
  transition: transform var(--speed), opacity var(--speed), visibility var(--speed), bottom var(--speed);
  transition: transform var(--speed), opacity var(--speed), visibility var(--speed), bottom var(--speed), -webkit-transform var(--speed);
  visibility: hidden;
  z-index: 50;
}
.dropdown__wrapper--active {
  -webkit-transform: translate(0);
          transform: translate(0);
  opacity: 1;
  visibility: visible;
}
.dropdown__content {
  border-radius: var(--radius);
  overflow: hidden;
  background-color: var(--paper-color);
  min-width: 100%;
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 3px 8px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 3px 8px var(--shadow-second);
}
.dropdown__item {
  padding: 0.5rem 1rem;
}

.image {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  -webkit-transition: var(--speed);
  transition: var(--speed);
  pointer-events: none;
  z-index: 0;
}
.image--cover {
  -o-object-fit: cover;
     object-fit: cover;
}
.image--contain {
  -o-object-fit: contain;
     object-fit: contain;
}

.lazyload {
  opacity: 0.5;
  -webkit-filter: blur(10px);
          filter: blur(10px);
}
.lazyload--svg {
  opacity: 1;
  -webkit-filter: none;
          filter: none;
}
.lazyload--loaded {
  opacity: 1;
  -webkit-filter: blur(0);
          filter: blur(0);
}

.btn {
  position: relative;
  display: -webkit-inline-box;
  display: -ms-inline-flexbox;
  display: inline-flex;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  padding: 0 var(--gap);
  height: var(--button-size);
  -webkit-user-select: none;
     -moz-user-select: none;
      -ms-user-select: none;
          user-select: none;
  cursor: pointer;
  outline: none;
  background-color: transparent;
  color: var(--main-text-color);
  border: var(--button-border-width, 0px) solid;
  border-radius: var(--radius);
  -webkit-transition: var(--speed);
  transition: var(--speed);
  -webkit-appearance: none;
     -moz-appearance: none;
          appearance: none;
  font-weight: 500;
  -webkit-tap-highlight-color: transparent;
}
@media (max-width: 575.98px) {
  .btn {
    width: 100%;
  }
}
.btn:hover {
  color: var(--main-text-color);
  background-color: var(--focus-highlight);
  text-decoration: none;
}
.btn:focus, .btn:active {
  outline: none;
}
.btn:disabled, .btn[disabled] {
  cursor: not-allowed;
  opacity: 0.4;
  pointer-events: none;
}
.btn--square {
  width: var(--button-size);
  padding: 0;
  border-radius: 50%;
}
.btn--small {
  padding: 0 0.55rem;
}
.btn--wide {
  width: 100%;
}
@media (min-width: 768px) {
  .btn--high {
    height: calc(var(--button-size) * 1.3);
  }
}
.btn--primary {
  background-color: var(--primary-color);
  color: var(--fill-btn-color);
}
.btn--primary:hover {
  background-color: var(--primary-color-dark);
  color: var(--fill-btn-color);
}
.btn--default {
  background-color: var(--default-color);
  color: var(--main-text-color);
}
.btn--default:hover {
  background-color: var(--default-color);
  color: var(--main-text-color);
}
.btn--light {
  background-color: var(--default-color);
  color: var(--main-text-color);
}
.btn--light:hover {
  background-color: var(--default-color);
  color: var(--main-text-color);
}
.btn--outline {
  --button-border-width: 2px;
  border-color: var(--primary-color);
}
.btn--inverse {
  background-color: var(--inverse-color);
  color: var(--inverse-text-color);
}
.btn--inverse:hover {
  background-color: var(--inverse-color);
  color: var(--inverse-text-color);
}
.btn--icon-big {
  font-size: 1.7em;
  border-radius: 50%;
  width: 50px;
  height: 50px;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
}
.btn__svg {
  height: var(--font-size-bigger);
  -webkit-box-flex: 0;
      -ms-flex: 0 0 var(--font-size-bigger);
          flex: 0 0 var(--font-size-bigger);
  pointer-events: none;
}
.btn__icon {
  font-size: var(--font-size-bigger);
  line-height: var(--font-size-bigger);
  pointer-events: none;
}
.btn__label {
  font-size: var(--font-size-medium);
  line-height: var(--font-size-medium);
  pointer-events: none;
  overflow: hidden;
  text-overflow: ellipsis;
  white-space: nowrap;
}
.btn__label + .btn__svg, .btn__svg + .btn__label, .btn__label + .btn__icon, .btn__icon + .btn__label {
  margin-left: calc(var(--gap) / 2);
}

.avatar {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
}
.avatar__image {
  width: 60px;
  height: 60px;
  border-radius: 50%;
  background-image: url("data:image/svg+xml,%3Csvg%20width%3D%2260%22%20height%3D%2260%22%20viewBox%3D%220%200%2060%2060%22%20fill%3D%22none%22%20xmlns%3D%22http%3A%2F%2Fwww.w3.org%2F2000%2Fsvg%22%3E%0A%3Cpath%20d%3D%22M10.75%2040C12.75%2036.75%2015.75%2035%2018.75%2035H30C21.75%2035%2015%2028.25%2015%2020C15%2011.75%2021.75%205%2030%205C38.25%205%2045%2011.75%2045%2020C45%2028.25%2038.25%2035%2030%2035H41.25C44.25%2035%2047%2036.75%2049.25%2040C51%2042.75%2052.25%2046.25%2052.5%2050C57.25%2044.75%2060%2037.75%2060%2030C60%2013.5%2046.5%200%2030%200C13.5%200%200%2013.5%200%2030C0%2037.75%203%2044.5%207.5%2050C8%2046.25%209%2042.5%2010.75%2040Z%22%20fill%3D%22%23D9D9D9%22%2F%3E%0A%3C%2Fsvg%3E%0A");
  background-position: center;
  background-size: cover;
}
.avatar__actions {
  margin-left: var(--gap);
}

.textfield {
  position: relative;
  display: block;
  margin: 0;
  -webkit-user-select: none;
     -moz-user-select: none;
      -ms-user-select: none;
          user-select: none;
  -webkit-tap-highlight-color: transparent;
  -webkit-touch-callout: none;
}
.textfield:hover input:not(:focus):not(:disabled):-moz-placeholder-shown, .textfield:hover textarea:not(:focus):not(:disabled):-moz-placeholder-shown {
  border-color: var(--border-color);
}
.textfield:hover input:not(:focus):not(:disabled):-ms-input-placeholder, .textfield:hover textarea:not(:focus):not(:disabled):-ms-input-placeholder {
  border-color: var(--border-color);
}
.textfield:hover input:not(:focus):not(:disabled):placeholder-shown,
.textfield:hover textarea:not(:focus):not(:disabled):placeholder-shown {
  border-color: var(--border-color);
}
.textfield--error .textfield__input {
  border-color: var(--danger) !important;
}
.textfield__required {
  font-size: var(--font-size-medium);
  color: var(--danger);
  margin-left: 3px;
}
.textfield__input, .textfield__area {
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
  margin: 0;
  border: solid 2px;
  border-color: transparent;
  border-radius: var(--radius);
  padding: var(--gap) var(--gap) 0;
  width: 100%;
  height: calc(var(--button-size) * 1.3);
  color: var(--main-text-color);
  background-color: var(--input-color);
  -webkit-box-shadow: none;
          box-shadow: none;
  font-family: inherit;
  font-size: inherit;
  line-height: inherit;
  caret-color: var(--primary-color);
  -webkit-transition: var(--speed);
  transition: var(--speed);
  -webkit-appearance: none;
     -moz-appearance: none;
          appearance: none;
}
.textfield__input + .textfield__label, .textfield__area + .textfield__label {
  position: absolute;
  top: 5px;
  left: var(--gap);
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  border-color: var(--border-color);
  width: calc(100% - var(--gap-2));
  max-height: 100%;
  color: var(--muted-text-color);
  font-size: var(--font-size-tiny);
  cursor: text;
  -webkit-transition: 0.1s;
  transition: 0.1s;
}
.textfield__input:focus, .textfield__area:focus {
  border-color: var(--primary-color) !important;
  background-color: transparent;
  outline: none;
}
.textfield__input:focus + .textfield__label, .textfield__area:focus + .textfield__label {
  color: var(--primary-color) !important;
}
.textfield__input:disabled, .textfield__area:disabled {
  color: var(--muted-text-color);
  cursor: not-allowed;
  opacity: 0.5;
}
.textfield__input:disabled + .textfield__label, .textfield__area:disabled + .textfield__label {
  color: var(--muted-text-color);
  cursor: not-allowed;
  opacity: 0.5;
}
.textfield__area {
  min-height: 150px;
  padding-top: var(--gap-1-5);
  resize: none;
}
.textfield input:not(:focus):-moz-placeholder-shown + span, .textfield textarea:not(:focus):-moz-placeholder-shown + span {
  font-size: inherit;
  top: 15px;
}
.textfield input:not(:focus):-ms-input-placeholder + span, .textfield textarea:not(:focus):-ms-input-placeholder + span {
  font-size: inherit;
  top: 15px;
}
.textfield input:not(:focus):placeholder-shown + span, .textfield textarea:not(:focus):placeholder-shown + span {
  font-size: inherit;
  top: 15px;
}
.textfield__alert {
  display: block;
  font-size: var(--font-size-small);
  line-height: var(--font-size-small);
  color: var(--danger);
  margin-top: calc(var(--gap) / 2);
}

::-webkit-input-placeholder {
  color: var(--muted-text-color);
}

::-moz-placeholder {
  color: var(--muted-text-color);
}

:-ms-input-placeholder {
  color: var(--muted-text-color);
}

::-ms-input-placeholder {
  color: var(--muted-text-color);
}

::placeholder {
  color: var(--muted-text-color);
}

::-webkit-datetime-edit-month-field {
  color: var(--muted-text-color);
}

::-webkit-datetime-edit-year-field {
  color: var(--muted-text-color);
}

.uploadFile {
  position: relative;
  margin: 0;
}
.uploadFile__input {
  display: none;
}

.inputGroup {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: stretch;
      -ms-flex-align: stretch;
          align-items: stretch;
  width: 100%;
  height: calc(var(--button-size) * 1.3);
}
.inputGroup--small {
  height: var(--button-size);
}
.inputGroup__field {
  display: block;
  -webkit-box-flex: 1;
      -ms-flex: 1 1 auto;
          flex: 1 1 auto;
  width: 1%;
  min-width: 0;
  height: inherit;
  border-radius: var(--radius) 0 0 var(--radius);
  border: 2px solid transparent;
  border-right-width: 0;
  padding: 0 var(--gap);
  outline: none;
  caret-color: var(--primary-color);
  background-color: var(--input-color);
  -webkit-transition: var(--speed);
  transition: var(--speed);
  -webkit-box-shadow: none;
          box-shadow: none;
  -webkit-appearance: none;
     -moz-appearance: none;
          appearance: none;
}
.inputGroup__field:hover {
  border-color: var(--border-color);
}
.inputGroup__field:focus {
  background-color: transparent;
  border-color: var(--primary-color);
}
.inputGroup__field--error {
  border-color: var(--danger) !important;
}
.inputGroup__button {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  width: auto !important;
  height: inherit;
  padding: 0 var(--gap);
  border-radius: 0 var(--radius) var(--radius) 0;
}
.inputGroup__svg {
  height: var(--font-size-bigger);
  width: var(--font-size-bigger);
}

.checkbox {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: self-start;
      -ms-flex-align: self-start;
          align-items: self-start;
  position: relative;
  width: -webkit-max-content;
  width: -moz-max-content;
  width: max-content;
  max-width: 100%;
  font-size: var(--font-size-base);
  font-weight: 400;
  line-height: var(--line-height);
  margin: 0;
  cursor: pointer;
}
.checkbox--listed {
  width: 100%;
  padding: calc(var(--gap) / 2) var(--gap-2);
}
@media (max-width: 767.98px) {
  .checkbox--listed {
    padding: calc(var(--gap) / 2) var(--gap);
  }
}
.checkbox__control {
  -webkit-appearance: none;
     -moz-appearance: none;
          appearance: none;
  position: relative;
  -webkit-box-flex: 0;
      -ms-flex: 0 0 auto;
          flex: 0 0 auto;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  width: 20px;
  height: 20px;
  margin: 1px 0 0;
  border: 2px solid var(--main-text-color);
  border-radius: 4px;
  -webkit-transition: background-color var(--speed), -webkit-box-shadow var(--speed);
  transition: background-color var(--speed), -webkit-box-shadow var(--speed);
  transition: background-color var(--speed), box-shadow var(--speed);
  transition: background-color var(--speed), box-shadow var(--speed), -webkit-box-shadow var(--speed);
  cursor: pointer;
}
.checkbox__control:focus {
  outline: none;
  -webkit-box-shadow: 0 0 0 2px var(--primary-color-transparent);
          box-shadow: 0 0 0 2px var(--primary-color-transparent);
}
.checkbox__control::after {
  content: "";
  background: var(--switcher);
  border-radius: 25%;
  margin: 3px;
  -webkit-transform: scale(0.5);
          transform: scale(0.5);
  opacity: 0;
  -webkit-transition: var(--speed);
  transition: var(--speed);
}
.checkbox__control:checked {
  background-color: var(--primary-color);
  border-color: var(--primary-color);
}
.checkbox__control:checked::after {
  -webkit-transform: scale(1);
          transform: scale(1);
  opacity: 1;
}
.checkbox__control:disabled {
  cursor: not-allowed;
  opacity: 0.5;
}
.checkbox__control:disabled + .checkbox__label {
  cursor: not-allowed;
  opacity: 0.5;
}
.checkbox__label {
  -webkit-box-flex: 1;
      -ms-flex: 1;
          flex: 1;
  margin: 0 0 0 10px;
}

.switch {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: self-start;
      -ms-flex-align: self-start;
          align-items: self-start;
  position: relative;
  width: -webkit-max-content;
  width: -moz-max-content;
  width: max-content;
  max-width: 100%;
  font-size: var(--font-size-base);
  font-weight: 400;
  line-height: var(--line-height);
  margin: 0;
  cursor: pointer;
}
.switch--full {
  -webkit-box-orient: horizontal;
  -webkit-box-direction: reverse;
      -ms-flex-direction: row-reverse;
          flex-direction: row-reverse;
  width: auto;
  max-width: 360px;
}
.switch--full .switch__control + .switch__label {
  margin: 0 10px 0 0;
}
.switch__control {
  -webkit-appearance: none;
     -moz-appearance: none;
          appearance: none;
  position: relative;
  -webkit-box-flex: 0;
      -ms-flex: 0 0 auto;
          flex: 0 0 auto;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  width: 38px;
  height: 20px;
  margin: 1px 0 0;
  border: 2px solid var(--main-text-color);
  border-radius: 11px;
  -webkit-transition: background-color var(--speed), -webkit-box-shadow var(--speed);
  transition: background-color var(--speed), -webkit-box-shadow var(--speed);
  transition: background-color var(--speed), box-shadow var(--speed);
  transition: background-color var(--speed), box-shadow var(--speed), -webkit-box-shadow var(--speed);
  cursor: pointer;
}
.switch__control:focus {
  outline: none;
  -webkit-box-shadow: 0 0 0 2px var(--primary-color-transparent);
          box-shadow: 0 0 0 2px var(--primary-color-transparent);
}
.switch__control::after {
  position: absolute;
  content: "";
  background: var(--main-text-color);
  margin: 2px;
  left: 0px;
  top: 0px;
  border-radius: 50%;
  width: 12px;
  height: 12px;
  background: var(--main-text-color);
  -webkit-transform: translateX(var(--x, 0));
          transform: translateX(var(--x, 0));
  -webkit-transition: var(--speed);
  transition: var(--speed);
}
.switch__control:checked {
  background: var(--primary-color);
  border-color: var(--primary-color);
}
.switch__control:checked::after {
  background: var(--switcher);
  -webkit-transform: translateX(18px);
          transform: translateX(18px);
  opacity: 1;
}
.switch__control:disabled {
  cursor: not-allowed;
  opacity: 0.5;
}
.switch__control:disabled + .switch__label {
  cursor: not-allowed;
  opacity: 0.5;
}
.switch__label {
  -webkit-box-flex: 1;
      -ms-flex: 1;
          flex: 1;
}
.switch__control + .switch__label {
  margin: 0 0 0 10px;
}

.radio {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: self-start;
      -ms-flex-align: self-start;
          align-items: self-start;
  position: relative;
  width: -webkit-max-content;
  width: -moz-max-content;
  width: max-content;
  max-width: 100%;
  font-size: var(--font-size-base);
  font-weight: 400;
  line-height: var(--line-height);
  margin: 0;
  cursor: pointer;
}
.radio--listed {
  width: 100%;
  padding: calc(var(--gap) / 2) var(--gap-2);
}
@media (max-width: 767.98px) {
  .radio--listed {
    padding: calc(var(--gap) / 2) var(--gap);
  }
}
.radio__input {
  position: absolute;
  left: -9999px;
}
.radio__control {
  -webkit-appearance: none;
     -moz-appearance: none;
          appearance: none;
  position: relative;
  -webkit-box-flex: 0;
      -ms-flex: 0 0 auto;
          flex: 0 0 auto;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  width: 20px;
  height: 20px;
  margin: 1px 0 0;
  border: 2px solid var(--main-text-color);
  border-radius: 50%;
  -webkit-transition: background-color var(--speed), -webkit-box-shadow var(--speed);
  transition: background-color var(--speed), -webkit-box-shadow var(--speed);
  transition: background-color var(--speed), box-shadow var(--speed);
  transition: background-color var(--speed), box-shadow var(--speed), -webkit-box-shadow var(--speed);
  cursor: pointer;
}
.radio__control:focus {
  outline: none;
  -webkit-box-shadow: 0 0 0 2px var(--primary-color-transparent);
          box-shadow: 0 0 0 2px var(--primary-color-transparent);
}
.radio__control::after {
  content: "";
  background: var(--switcher);
  border-radius: 50%;
  margin: 3px;
  -webkit-transform: scale(0.5);
          transform: scale(0.5);
  opacity: 0;
  -webkit-transition: var(--speed);
  transition: var(--speed);
}
.radio__control:checked {
  background: var(--primary-color);
  border-color: var(--primary-color);
}
.radio__control:checked::after {
  -webkit-transform: scale(1);
          transform: scale(1);
  opacity: 1;
}
.radio__control:disabled {
  cursor: not-allowed;
  opacity: 0.5;
}
.radio__control:disabled + .radio__label {
  cursor: not-allowed;
  opacity: 0.5;
}
.radio__label {
  -webkit-box-flex: 1;
      -ms-flex: 1;
          flex: 1;
  margin: 0 0 0 10px;
}

.radioBlock {
  --box-size: 90px;
  position: relative;
  display: block;
  width: 100%;
  margin: 0;
}
.radioBlock--small {
  --box-size: 60px;
}
.radioBlock + .radioBlock__control:checked {
  border-color: red;
}
.radioBlock__input {
  position: absolute;
  left: -9999px;
}
.radioBlock__input:checked + .radioBlock__box {
  border-color: var(--success);
}
.radioBlock__input:checked + .radioBlock__box .radioBlock__icon {
  opacity: 1;
}
.radioBlock__box {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: justify;
      -ms-flex-pack: justify;
          justify-content: space-between;
  min-height: var(--box-size);
  font-size: var(--font-size-base);
  font-weight: 400;
  line-height: var(--line-height);
  margin: 0;
  cursor: pointer;
  border: 2px solid var(--border-color);
  border-radius: var(--radius);
  padding: var(--gap) var(--gap-2);
  -webkit-transition: var(--speed);
  transition: var(--speed);
  overflow: hidden;
}
.radioBlock__box:hover {
  background-color: var(--focus-highlight);
}
.radioBlock__content {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  -webkit-box-flex: 1;
      -ms-flex: 1;
          flex: 1;
}
.radioBlock__label {
  font-size: var(--font-size-medium);
  font-weight: 500;
}
.radioBlock__description {
  font-size: var(--font-size-small);
  color: var(--hint-text-color);
}
.radioBlock__icon {
  width: 22px;
  height: 22px;
  color: var(--success);
  margin: 0 0 0 var(--gap);
  opacity: 0;
  -webkit-transition: var(--speed);
  transition: var(--speed);
}

.select {
  position: relative;
  display: block;
  -webkit-appearance: none;
     -moz-appearance: none;
          appearance: none;
}
.select__input {
  display: none;
}
.select__control {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  border-radius: var(--radius);
  height: calc(var(--button-size) * 1.3);
  background-color: var(--input-color);
  border: 2px solid transparent;
  color: var(--main-text-color);
  padding: 0 3rem 0 15px;
  cursor: pointer;
  -webkit-transition: var(--speed);
  transition: var(--speed);
}
.select__control[selected] {
  background-color: transparent;
  border-color: var(--primary-color) !important;
}
.select__control[selected]::before {
  border-color: var(--primary-color) !important;
}
.select__control[selected]::after {
  -webkit-transform: rotate(180deg);
          transform: rotate(180deg);
}
.select__control:hover {
  border-color: var(--border-color);
}
.select__control::before, .select__control::after {
  position: absolute;
  right: 0;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  height: 100%;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  width: 3rem;
  -webkit-transition: var(--speed);
  transition: var(--speed);
}
.select__control::before {
  content: "";
  border-left: 1px solid var(--border-color);
}
.select__control::after {
  font-family: "feathericon";
  content: "\e92e";
  font-size: 1.5rem;
}
.select__options {
  position: absolute;
  right: 0;
  border-radius: var(--radius);
  overflow: hidden;
  background-color: var(--paper-color);
  margin-top: 0.5rem;
  opacity: 0;
  -webkit-transform: translateY(15px);
          transform: translateY(15px);
  -webkit-transition: var(--speed);
  transition: var(--speed);
  visibility: hidden;
  z-index: 10;
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 3px 8px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 3px 8px var(--shadow-second);
}
.select__options--expanded {
  -webkit-transform: translateY(0);
          transform: translateY(0);
  opacity: 1;
  visibility: visible;
}
.select__list {
  position: relative;
  list-style-type: none;
  max-height: 189px;
  margin: var(--gap) 0;
  padding: 0;
  overflow-y: auto;
  overflow-x: hidden;
}
@media (max-width: 767.98px) {
  .select__list {
    max-height: 167px;
  }
}
.select__label {
  font-size: var(--font-size-bigger);
  font-weight: 700;
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  height: calc(var(--button-size) * 1.2);
  padding: 0 1rem;
  pointer-events: none;
}
.select__item {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  height: calc(var(--button-size) * 1.2);
  padding: 0 1rem;
  cursor: pointer;
  -webkit-transition: var(--speed);
  transition: var(--speed);
  overflow: hidden;
}
.select__item:hover {
  background-color: var(--focus-highlight);
  color: var(--primary-color);
}

.stepper {
  display: -webkit-inline-box;
  display: -ms-inline-flexbox;
  display: inline-flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  height: var(--button-size);
  border-radius: var(--radius);
  background-color: var(--primary-color);
}
.stepper__input {
  font-size: var(--font-size-medium);
  width: 44px;
  background-color: transparent;
  border: none;
  border-radius: 0;
  text-align: center;
  color: var(--fill-btn-color);
  -webkit-appearance: none;
          appearance: none;
  -moz-appearance: textfield;
  outline: none;
}
.stepper__input::-webkit-inner-spin-button, .stepper__input::-webkit-outer-spin-button {
  opacity: 0;
  -webkit-appearance: none;
          appearance: none;
}
.toast {
  position: fixed;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  right: var(--gap-2);
  bottom: var(--gap-2);
  z-index: 100;
}
@media (max-width: 767.98px) {
  .toast {
    -webkit-box-orient: vertical;
    -webkit-box-direction: reverse;
        -ms-flex-direction: column-reverse;
            flex-direction: column-reverse;
    right: calc(var(--gap) / 2);
    left: calc(var(--gap) / 2);
    bottom: auto;
    top: calc(var(--mobile-header-heigh) + var(--safe-top) + 10px);
  }
}
.toast__item {
  position: relative;
  min-width: 300px;
  padding: 0 var(--gap);
  margin: var(--gap) 0 0 0;
  border-radius: var(--radius);
  background-color: var(--inverse-transparent-color);
  -webkit-transition: all var(--speed);
  transition: all var(--speed);
  -webkit-transform: translateY(30px);
          transform: translateY(30px);
  opacity: 0;
  visibility: hidden;
  overflow: hidden;
  -webkit-backdrop-filter: saturate(180%) blur(20px);
          backdrop-filter: saturate(180%) blur(20px);
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
}
@media (max-width: 767.98px) {
  .toast__item {
    -webkit-transform: translateY(-30px);
            transform: translateY(-30px);
    margin: 0 0 var(--gap) 0;
  }
}
.toast__item--show {
  -webkit-transform: translateY(0);
          transform: translateY(0);
  opacity: 1;
  visibility: visible;
}
.toast__content {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  min-height: var(--button-size);
}
.toast__icon {
  font-size: var(--font-size-medium);
  color: var(--inverse-text-color);
  margin-right: 0.4rem;
}
.toast__text {
  line-height: var(--line-height-tiny);
  color: var(--inverse-text-color);
  -webkit-box-flex: 1;
      -ms-flex-positive: 1;
          flex-grow: 1;
  padding: 0.6rem 0;
}
.toast__link {
  position: relative;
  -webkit-box-flex: 0;
      -ms-flex: 0 0 auto;
          flex: 0 0 auto;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  font-weight: 600;
  color: var(--primary-color);
  margin-left: var(--gap);
  border-radius: 5px;
  height: 28px;
  padding: 0 6px;
  margin-left: 0.4rem;
}
.toast__link:hover {
  color: var(--primary-color);
  background: var(--inverse-focus-highlight);
}

.loader {
  --loader-size: 50px;
  --loader-stroke: 4;
  position: relative;
  pointer-events: none;
}
.loader--big {
  --loader-size: 100px;
  --loader-stroke: 3;
}
.loader--small {
  --loader-size: 24px;
  --loader-stroke: 5;
}
.loader--modal {
  height: 550px;
  width: 100%;
  border-radius: var(--radius);
  overflow: hidden;
  z-index: 1;
}
.loader--white .loader__circle {
  stroke: var(--switcher);
}
.loader--alert .loader__circle {
  stroke: var(--danger);
}
.loader--success .loader__circle {
  stroke: var(--success);
}
.loader__root {
  position: absolute;
  top: -1px;
  bottom: -1px;
  right: -1px;
  left: -1px;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  background-color: var(--paper-color-transparent);
  -webkit-transition: var(--speed);
  transition: var(--speed);
  z-index: 5;
  -webkit-animation: loader-show var(--speed) both;
          animation: loader-show var(--speed) both;
}
.loader__holder {
  width: var(--loader-size);
  height: var(--loader-size);
  -webkit-animation: circular-rotate 1.3s linear infinite;
          animation: circular-rotate 1.3s linear infinite;
}
.loader__svg {
  display: block;
  fill: none;
  stroke-width: var(--loader-stroke);
  stroke: var(--primary-color);
  stroke-linecap: round;
}
.loader__circle {
  -webkit-animation: circular-dash 1.3s ease-in-out infinite;
          animation: circular-dash 1.3s ease-in-out infinite;
  stroke-dasharray: 80px, 200px;
  stroke-dashoffset: 0px;
}

@-webkit-keyframes circular-rotate {
  0% {
    -webkit-transform-origin: 50% 50%;
            transform-origin: 50% 50%;
  }
  100% {
    -webkit-transform: rotate(360deg);
            transform: rotate(360deg);
  }
}

@keyframes circular-rotate {
  0% {
    -webkit-transform-origin: 50% 50%;
            transform-origin: 50% 50%;
  }
  100% {
    -webkit-transform: rotate(360deg);
            transform: rotate(360deg);
  }
}
@-webkit-keyframes circular-dash {
  0% {
    stroke-dasharray: 1px, 200px;
    stroke-dashoffset: 0px;
  }
  50% {
    stroke-dasharray: 100px, 200px;
    stroke-dashoffset: -15px;
  }
  100% {
    stroke-dasharray: 100px, 200px;
    stroke-dashoffset: -125px;
  }
}
@keyframes circular-dash {
  0% {
    stroke-dasharray: 1px, 200px;
    stroke-dashoffset: 0px;
  }
  50% {
    stroke-dasharray: 100px, 200px;
    stroke-dashoffset: -15px;
  }
  100% {
    stroke-dasharray: 100px, 200px;
    stroke-dashoffset: -125px;
  }
}
@-webkit-keyframes loader-show {
  from {
    opacity: 0;
  }
  to {
    opacity: 1;
    visibility: visible;
  }
}
@keyframes loader-show {
  from {
    opacity: 0;
  }
  to {
    opacity: 1;
    visibility: visible;
  }
}
@-webkit-keyframes loader-hide {
  from {
    opacity: 1;
  }
  to {
    opacity: 0;
    visibility: hidden;
  }
}
@keyframes loader-hide {
  from {
    opacity: 1;
  }
  to {
    opacity: 0;
    visibility: hidden;
  }
}
.dialog {
  position: fixed;
  top: 0;
  left: 0;
  bottom: 0;
  right: 0;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  overflow: hidden;
  opacity: 0;
  visibility: hidden;
  -webkit-transform: scale(0.95);
          transform: scale(0.95);
  -webkit-transition: var(--speed);
  transition: var(--speed);
  z-index: -1;
}
@media (max-width: 767.98px) {
  .dialog {
    opacity: 1;
    -webkit-box-align: end;
        -ms-flex-align: end;
            align-items: flex-end;
    -webkit-transform: translateY(100%);
            transform: translateY(100%);
  }
}
.dialog--open {
  opacity: 1;
  visibility: visible;
  -webkit-transform: scale(1);
          transform: scale(1);
  z-index: 95;
}
@media (max-width: 767.98px) {
  .dialog--open {
    -webkit-transform: translateY(0);
            transform: translateY(0);
  }
}
.dialog__window {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  background-color: var(--paper-color);
  width: 500px;
  max-width: calc(100% - var(--gap-2));
  max-height: calc(100vh - var(--gap-big) * 2);
  border-radius: var(--radius);
  -webkit-transition: background-color var(--speed);
  transition: background-color var(--speed);
  overflow: hidden;
  -webkit-box-shadow: 0 0 0 3px var(--paper-color);
          box-shadow: 0 0 0 3px var(--paper-color);
}
@media (max-width: 767.98px) {
  .dialog__window {
    max-height: calc(100vh - var(--gap-big));
    -webkit-box-shadow: none;
            box-shadow: none;
  }
}
.dialog__window--small {
  width: 400px;
}
.dialog__window--middle {
  width: 700px;
}
@media (max-width: 767.98px) {
  .dialog__window--middle {
    width: 500px;
    max-height: 94%;
  }
}
.dialog__window--wide {
  width: 1050px;
}
@media (max-width: 767.98px) {
  .dialog__window--wide {
    width: 600px;
    height: 95%;
  }
}
@media (max-width: 767.98px) {
  .dialog__window {
    max-width: 100%;
    border-radius: var(--radius) var(--radius) 0 0;
  }
  .dialog__window::before {
    content: "";
    position: absolute;
    top: 5px;
    left: 0;
    right: 0;
    width: var(--gap-big);
    height: 4px;
    opacity: 0.6;
    margin: 0 auto;
    border-radius: 2.5px;
    background-color: var(--inverse-transparent-color);
    z-index: 5;
  }
}
.dialog__header {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: justify;
      -ms-flex-pack: justify;
          justify-content: space-between;
  padding: var(--gap) var(--gap) 0 var(--gap-2);
}
@media (max-width: 767.98px) {
  .dialog__header {
    padding: var(--gap) var(--gap) 0 var(--gap);
  }
}
.dialog__title {
  -webkit-box-flex: 1;
      -ms-flex-positive: 1;
          flex-grow: 1;
  color: var(--main-text-color);
  font-size: var(--font-size-bigger);
  font-weight: 600;
  margin-right: var(--gap);
}
.dialog__title--center {
  text-align: center;
}
@media (max-width: 767.98px) {
  .dialog__title {
    font-size: var(--font-size-big);
  }
}
.dialog__closer {
  position: relative;
}
.dialog__closer--inner {
  position: absolute;
  right: 10px;
  top: 10px;
  border-radius: 50%;
  z-index: 20;
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 3px 8px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 3px 8px var(--shadow-second);
}
@media (max-width: 767.98px) {
  .dialog__closer--inner {
    right: var(--gap);
    top: var(--gap);
  }
}
.dialog__body {
  padding: var(--gap) var(--gap-2) var(--gap-2) var(--gap-2);
  overflow-y: auto;
  overflow-x: hidden;
}
@media (max-width: 767.98px) {
  .dialog__body {
    padding: var(--gap) var(--gap) calc(var(--gap) + var(--safe-bottom));
  }
}
.dialog__actions {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  gap: var(--gap);
  margin-top: var(--gap);
}

.backdrop {
  position: fixed;
  top: 0;
  left: 0;
  bottom: 0;
  right: 0;
  overflow: auto;
  background-color: #000000;
  background-color: rgba(0, 0, 0, 0.4);
  -webkit-backdrop-filter: saturate(180%) blur(15px);
          backdrop-filter: saturate(180%) blur(15px);
  z-index: 50;
}
.backdrop__show {
  -webkit-animation: backdrop-show var(--speed) both;
          animation: backdrop-show var(--speed) both;
}
.backdrop__hide {
  -webkit-animation: backdrop-hide var(--speed) both;
          animation: backdrop-hide var(--speed) both;
}

@-webkit-keyframes backdrop-show {
  from {
    opacity: 0;
  }
  to {
    opacity: 1;
    visibility: visible;
  }
}

@keyframes backdrop-show {
  from {
    opacity: 0;
  }
  to {
    opacity: 1;
    visibility: visible;
  }
}
@-webkit-keyframes backdrop-hide {
  from {
    opacity: 1;
  }
  to {
    opacity: 0;
    visibility: hidden;
  }
}
@keyframes backdrop-hide {
  from {
    opacity: 1;
  }
  to {
    opacity: 0;
    visibility: hidden;
  }
}
.refresher {
  display: none;
  position: absolute;
  top: var(--safe-top);
  left: 50%;
  margin-left: -1.5rem;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  width: 3rem;
  height: 3rem;
  background-color: var(--layout-color);
  border-radius: 50%;
  z-index: 10;
}
@media (max-width: 767.98px) {
  .refresher {
    display: -webkit-box;
    display: -ms-flexbox;
    display: flex;
  }
}
.refresher--elevated {
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 3px 8px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 3px 8px var(--shadow-second);
}
.refresher--transitioning {
  -webkit-transition: -webkit-transform var(--speed);
  transition: -webkit-transform var(--speed);
  transition: transform var(--speed);
  transition: transform var(--speed), -webkit-transform var(--speed);
}
.refresher__icon {
  font-size: 1.5rem;
  color: var(--muted-text-color);
  -webkit-transition: var(--speed);
  transition: var(--speed);
}

.progress__root {
  position: fixed;
  left: 0;
  top: 0;
  width: 100%;
  height: 4px;
  overflow: hidden;
  background-color: var(--primary-color-transparent);
  z-index: 50;
}
@media (max-width: 767.98px) {
  .progress__root {
    top: calc(var(--mobile-header-heigh) + var(--safe-top));
  }
}
.progress__bar {
  top: 0;
  left: 0;
  width: auto;
  bottom: 0;
  position: absolute;
  -webkit-transition: -webkit-transform 0.2s linear;
  transition: -webkit-transform 0.2s linear;
  transition: transform 0.2s linear;
  transition: transform 0.2s linear, -webkit-transform 0.2s linear;
  -webkit-transform-origin: left;
          transform-origin: left;
  background-color: var(--primary-color);
}
.progress__bar--first {
  -webkit-animation: progress-indeterminate1 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite;
          animation: progress-indeterminate1 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite;
}
.progress__bar--last {
  -webkit-animation: progress-indeterminate2 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) 1.15s infinite;
          animation: progress-indeterminate2 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) 1.15s infinite;
}

@-webkit-keyframes progress-indeterminate1 {
  0% {
    left: -35%;
    right: 100%;
  }
  60% {
    left: 100%;
    right: -90%;
  }
  100% {
    left: 100%;
    right: -90%;
  }
}

@keyframes progress-indeterminate1 {
  0% {
    left: -35%;
    right: 100%;
  }
  60% {
    left: 100%;
    right: -90%;
  }
  100% {
    left: 100%;
    right: -90%;
  }
}
@-webkit-keyframes progress-indeterminate2 {
  0% {
    left: -200%;
    right: 100%;
  }
  60% {
    left: 107%;
    right: -8%;
  }
  100% {
    left: 107%;
    right: -8%;
  }
}
@keyframes progress-indeterminate2 {
  0% {
    left: -200%;
    right: 100%;
  }
  60% {
    left: 107%;
    right: -8%;
  }
  100% {
    left: 107%;
    right: -8%;
  }
}
.custom-scrollbar::-webkit-scrollbar,
[custom-scrollbar]::-webkit-scrollbar {
  width: var(--scroll-width);
}
.custom-scrollbar::-webkit-scrollbar-track,
[custom-scrollbar]::-webkit-scrollbar-track {
  background: var(--border-color);
  border-radius: 3px;
}
.custom-scrollbar::-webkit-scrollbar-thumb,
[custom-scrollbar]::-webkit-scrollbar-thumb {
  background: var(--primary-color);
  -webkit-transition: var(--speed);
  transition: var(--speed);
  border-radius: 3px;
}
.custom-scrollbar::-webkit-scrollbar-thumb:hover,
[custom-scrollbar]::-webkit-scrollbar-thumb:hover {
  background: var(--primary-color);
}

.badge {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -ms-flex-line-pack: center;
      align-content: center;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  height: 20px;
  padding: 0 4px;
  z-index: 1;
  font-size: var(--font-size-badge);
  line-height: var(--font-size-badge);
  font-weight: 500;
  min-width: 20px;
  border-radius: var(--radius);
  border: 2px solid var(--paper-color);
  background-color: var(--primary-color);
  color: var(--switcher);
  pointer-events: none;
  -webkit-transition: var(--speed);
  transition: var(--speed);
}

.pagination {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
}
.pagination__list {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  list-style: none;
  padding: 0;
  margin: 0;
  gap: calc(var(--gap) / 2);
}
.pagination__link {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  width: var(--button-size);
  height: var(--button-size);
  border-radius: 50%;
  background-color: transparent;
  font-size: var(--font-size-medium);
  color: var(--main-text-color);
}
.pagination__link:hover {
  background-color: var(--focus-highlight);
}
.pagination__link--current {
  color: var(--fill-btn-color);
  background-color: var(--primary-color);
  cursor: not-allowed;
}
.pagination__link--current:hover {
  color: var(--fill-btn-color);
  background-color: var(--primary-color);
}
.pagination__icon {
  height: var(--font-size-bigger);
}

.stretched-link {
  top: 0;
  left: 0;
  bottom: 0;
  right: 0;
  position: absolute;
  width: 100%;
  height: 100%;
  -webkit-transition: var(--speed);
  transition: var(--speed);
  z-index: 5;
  cursor: pointer;
}
.stretched-link:hover {
  background-color: var(--focus-highlight);
}

.chip {
  display: -webkit-inline-box;
  display: -ms-inline-flexbox;
  display: inline-flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  width: -webkit-fit-content;
  width: -moz-fit-content;
  width: fit-content;
  min-height: 22px;
  background-color: var(--layout-color);
  color: var(--main-text-color);
  border-radius: var(--radius);
  padding: 0 0.5rem;
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 3px 8px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 3px 8px var(--shadow-second);
}
.chip:not(:only-child) {
  margin: 0 0.5rem 0.5rem 0;
}
@media (max-width: 767.98px) {
  .chip {
    min-height: 1.2rem;
  }
}
.chip--stock {
  background-color: #880e4f;
  color: var(--switcher);
}
.chip--hit {
  background-color: #e65100;
  color: var(--switcher);
}
.chip--hot {
  background-color: #b71c1c;
  color: var(--switcher);
}
.chip--new {
  background-color: hsl(225, 50%, 28%);
  color: var(--switcher);
}
.chip--primary {
  background-color: var(--primary-color);
  color: var(--switcher);
}
.chip__label {
  font-size: 0.8rem;
  line-height: 1;
  font-weight: 500;
  text-transform: uppercase;
}
@media (max-width: 767.98px) {
  .chip__label {
    font-size: 0.65rem;
  }
}

.alert {
  display: block;
  border: 2px solid;
  color: var(--main-text-color);
  border-radius: var(--radius);
  padding: calc(var(--gap) / 1.5) var(--gap);
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 3px 8px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 3px 8px var(--shadow-second);
}
.alert--inline {
  display: inline-block;
}
.alert--primary {
  border-color: var(--primary);
  color: var(--primary);
}
.alert--danger {
  border-color: var(--danger);
  color: var(--danger);
}
.alert--warning {
  border-color: var(--warning);
  color: var(--warning);
}
.alert--info {
  border-color: var(--info);
  color: var(--info);
}
.alert--primary {
  border-color: var(--primary-color);
  color: var(--primary-color);
}

.filter {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  margin-bottom: 1rem;
  -webkit-transition: var(--speed);
  transition: var(--speed);
}
.filter__mobile {
  display: none;
}
@media (max-width: 767.98px) {
  .filter__mobile {
    display: none;
    -webkit-box-flex: 1;
        -ms-flex: 1;
            flex: 1;
    -webkit-box-align: center;
        -ms-flex-align: center;
            align-items: center;
    background-color: var(--paper-color);
    border-radius: var(--radius);
    -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
            box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
  }
}
.filter__desktop {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
}
.filter__button {
  margin-right: 1rem;
}
.filter__list {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  margin: 0 -1rem;
  padding-bottom: 1rem;
  overflow-y: hidden;
  overflow-x: auto;
  -ms-overflow-style: none;
  scrollbar-width: none;
  -webkit-overflow-scrolling: touch;
}
.filter__list::-webkit-scrollbar {
  display: none;
}
.filter__list--disabled {
  pointer-events: none;
  overflow: hidden;
}
.filter__item {
  position: relative;
  white-space: nowrap;
  margin: 0 0 0 0.5rem;
}
.filter__item:first-child {
  margin-left: 1rem;
}
.filter__item:last-child {
  padding-right: 1rem;
}
.filter__control {
  display: none;
}
.filter__icon {
  height: 1.3rem;
  width: 1.3rem;
}
.filter__label {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  height: calc(var(--button-size) / 1.5);
  padding: 0 1rem;
  white-space: nowrap;
  border-radius: var(--radius);
  background-color: var(--paper-color);
  -webkit-transition: var(--speed);
  transition: var(--speed);
  overflow: hidden;
  cursor: pointer;
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
}
.filter__control:checked + .filter__label {
  color: var(--fill-btn-color);
  background-color: var(--primary-color);
}

.display-mobile {
  display: none;
}
@media (max-width: 767.98px) {
  .display-mobile {
    display: -webkit-box;
    display: -ms-flexbox;
    display: flex;
  }
}
.display-desktop {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
}
@media (max-width: 767.98px) {
  .display-desktop {
    display: none;
  }
}

.network {
  position: fixed;
  top: calc((var(--desktop-header-heigh) + var(--gap)) * -1);
  width: calc(100% - var(--gap-2));
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: justify;
      -ms-flex-pack: justify;
          justify-content: space-between;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  height: var(--desktop-header-heigh);
  padding: 0 var(--gap-2);
  margin: var(--gap) var(--gap) 0 var(--gap);
  border-radius: var(--radius);
  color: var(--main-text-color);
  overflow: hidden;
  z-index: 9999;
}
.network--online {
  background-color: var(--success);
  top: calc((var(--desktop-header-heigh) + var(--gap)) * -1);
  -webkit-transition: top var(--speed) 0.6s, background-color var(--speed);
  transition: top var(--speed) 0.6s, background-color var(--speed);
}
.network--offline {
  background-color: var(--danger);
  top: 0;
  -webkit-transition: top var(--speed), background-color var(--speed);
  transition: top var(--speed), background-color var(--speed);
}
@media (max-width: 767.98px) {
  .network {
    top: calc((var(--mobile-header-heigh) + var(--safe-top)) * -1);
    margin: 0;
    width: 100%;
    height: calc(var(--mobile-header-heigh) + var(--safe-top));
    padding: calc(var(--gap) + var(--safe-top)) var(--gap) var(--gap) var(--gap);
    border-radius: 0;
  }
  .network--online {
    top: calc((var(--mobile-header-heigh) + var(--safe-top)) * -1);
  }
  .network--offline {
    top: 0;
  }
}
.network__text {
  display: block;
  -webkit-box-flex: 1;
      -ms-flex: 1;
          flex: 1;
  font-size: var(--font-size-bigger);
  text-align: center;
  color: var(--switcher);
}
@media (max-width: 767.98px) {
  .network__text {
    font-size: var(--font-size-medium);
  }
}

.emptySection {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
}
.emptySection__content {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
}

.sliderPagination {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  margin-top: var(--gap);
}
@media (max-width: 767.98px) {
  .sliderPagination {
    margin-top: 0;
  }
}
.sliderPagination__bullet {
  width: 10px;
  height: 10px;
  border-radius: 5px;
  background-color: var(--border-color);
  -webkit-transition: var(--speed);
  transition: var(--speed);
  outline: none;
  cursor: pointer;
}
.sliderPagination__bullet:not(:last-child) {
  margin-right: 10px;
}
.sliderPagination__bullet--active {
  width: 30px;
  background-color: var(--primary-color);
}

.sliderArrow {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  line-height: 0;
  height: var(--button-size);
  width: var(--button-size);
  background-color: var(--inverse-color);
  border-radius: 50%;
  z-index: 10;
  outline: none;
  z-index: 5;
  cursor: pointer;
  -webkit-transition: var(--speed);
  transition: var(--speed);
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
}
@media (max-width: 767.98px) {
  .sliderArrow {
    display: none;
  }
}
.sliderArrow--disabled {
  opacity: 0;
  visibility: hidden;
}
.sliderArrow__icon {
  width: var(--font-size-large);
  height: var(--font-size-large);
  color: var(--inverse-text-color);
}

.fadeIn {
  opacity: 0;
  visibility: hidden;
  -webkit-animation: fadeIn var(--speed) both;
          animation: fadeIn var(--speed) both;
}

@-webkit-keyframes fadeInTrs {
  to {
    opacity: 1;
    visibility: visible;
    -webkit-transform: translate(0);
            transform: translate(0);
  }
}

@keyframes fadeInTrs {
  to {
    opacity: 1;
    visibility: visible;
    -webkit-transform: translate(0);
            transform: translate(0);
  }
}
@-webkit-keyframes fadeIn {
  to {
    opacity: 1;
    visibility: visible;
  }
}
@keyframes fadeIn {
  to {
    opacity: 1;
    visibility: visible;
  }
}
.air-datepicker {
  --adp-border-color: var(--border-color);
  --adp-border-radius: var(--radius);
  --adp-background-color: var(--paper-color);
  --adp-border-color-inner: var(--border-color);
  --adp-color: var(--main-text-color);
  --adp-color-secondary: var(--muted-text-color);
  --adp-color-other-month: var(--muted-text-color);
  --adp-color-disabled: var(--hint-text-color);
  --adp-accent-color: var(--primary-color);
  --adp-day-name-color: var(--warning);
  --adp-cell-background-color-selected: var(--primary-color);
  --adp-cell-background-color-selected-hover: var(--primary-color);
  --adp-background-color-selected-other-month: var(--primary-color-transparent);
  --adp-background-color-selected-other-month-focused: var(--primary-color-transparent);
  --adp-background-color-active: var(--primary-color-transparent);
  --adp-cell-background-color-hover: var(--default-color);
  --adp-background-color-hover: var(--default-color);
  --adp-time-track-color-hover: var(--border-color);
  --adp-time-track-color: var(--border-color);
  --adp-z-index: 25;
  font-family: var(--default-font);
  border-width: 0;
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 3px 8px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 3px 8px var(--shadow-second);
}
.air-datepicker--pointer {
  display: none;
}
.air-datepicker--buttons {
  padding: 5px;
}
.air-datepicker-time--current-hours, .air-datepicker-time--current-minutes {
  font-family: var(--default-font);
}
.air-datepicker-time--current-hours:after, .air-datepicker-time--current-minutes:after {
  border-radius: 5px;
}
.air-datepicker-overlay {
  --adp-overlay-z-index: 20;
  --adp-overlay-background-color: rgba(0,0,0,.4);
  -webkit-backdrop-filter: saturate(180%) blur(15px);
          backdrop-filter: saturate(180%) blur(15px);
}
.air-datepicker-time--row {
  --adp-time-thumb-size: 19px;
  height: 25px;
}
.air-datepicker-time--row input[type=range]::-webkit-slider-thumb {
  height: var(--adp-time-thumb-size);
}
.air-datepicker-time--row input[type=range]::-ms-thumb {
  height: var(--adp-time-thumb-size);
}
.air-datepicker-time--row input[type=range]::-moz-range-thumb {
  height: var(--adp-time-thumb-size);
}
.air-datepicker.-only-timepicker- .air-datepicker--time {
  border-top: none;
}

.header {
  position: fixed;
  top: 0;
  left: 0;
  right: 0;
  width: 100%;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
      flex-wrap: wrap;
  z-index: 15;
  background-color: var(--paper-color-transparent);
  -webkit-backdrop-filter: saturate(180%) blur(20px);
          backdrop-filter: saturate(180%) blur(20px);
  -webkit-transition: background-color var(--speed), -webkit-box-shadow var(--speed);
  transition: background-color var(--speed), -webkit-box-shadow var(--speed);
  transition: background-color var(--speed), box-shadow var(--speed);
  transition: background-color var(--speed), box-shadow var(--speed), -webkit-box-shadow var(--speed);
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
}
.header__safe {
  -ms-flex-preferred-size: 100%;
      flex-basis: 100%;
  height: var(--safe-top);
}
.header__top {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: justify;
      -ms-flex-pack: justify;
          justify-content: space-between;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  height: 42px;
  -webkit-transition: height var(--speed) ease-in-out, opacity var(--speed) ease-in-out;
  transition: height var(--speed) ease-in-out, opacity var(--speed) ease-in-out;
}
@media (max-width: 575.98px) {
  .header__top {
    display: none;
  }
}
.page-scrolled .header__top {
  height: 0;
  opacity: 0;
}
@media (max-width: 767.98px) {
  .header__nav {
    display: none;
  }
}
.header__middle {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: justify;
      -ms-flex-pack: justify;
          justify-content: space-between;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  height: var(--desktop-header-heigh);
  -webkit-transition: height var(--speed) ease-in-out, opacity var(--speed) ease-in-out;
  transition: height var(--speed) ease-in-out, opacity var(--speed) ease-in-out;
}
@media (max-width: 575.98px) {
  .header__middle {
    height: var(--mobile-header-heigh);
  }
}
.header__bottom {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  height: 60px;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-transition: height var(--speed) ease-in-out, opacity var(--speed) ease-in-out;
  transition: height var(--speed) ease-in-out, opacity var(--speed) ease-in-out;
}
.header__menu {
  -webkit-box-flex: 0;
      -ms-flex: 0 0 100%;
          flex: 0 0 100%;
  overflow: hidden;
}
.header__title {
  overflow: hidden;
  width: 100%;
  margin-right: 1rem;
  -webkit-transform: translateX(20px);
          transform: translateX(20px);
  opacity: 0;
  -webkit-animation: fadeIn 0.5s both;
          animation: fadeIn 0.5s both;
}
.header__toggler {
  display: none;
}
@media (max-width: 767.98px) {
  .header__toggler {
    display: -webkit-inline-box;
    display: -ms-inline-flexbox;
    display: inline-flex;
    margin-right: var(--gap);
  }
}
.header__brand {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: start;
      -ms-flex-align: start;
          align-items: flex-start;
  width: -webkit-fit-content;
  width: -moz-fit-content;
  width: fit-content;
  margin-right: var(--gap);
}
@media (max-width: 575.98px) {
  .header__brand {
    margin-right: auto;
  }
}
.header__logo {
  display: -webkit-inline-box;
  display: -ms-inline-flexbox;
  display: inline-flex;
  max-height: 40px;
  max-width: 250px;
}
@media (max-width: 767.98px) {
  .header__logo {
    max-width: 150px;
    max-height: 30px;
  }
}
@media (max-width: 575.98px) {
  .header__logo {
    max-width: 115px;
    max-height: 30px;
  }
}
.header__brand--mob {
        display: none;
    }
@media (max-width: 767.98px) {
    .header__brand--mob {
        display: flex;
    }
}
.header__brand--pc{
  display: flex;
}
@media (max-width: 767.98px) {
  .header__brand--pc {
    display: none;
  }
}
.header__location {
  max-width: 260px;
  margin-right: auto;
}
@media (max-width: 575.98px) {
  .header__location {
    display: none;
  }
}
.header__text {
  font-size: 1.8em;
  margin: 0;
  overflow: hidden;
  white-space: nowrap;
  text-overflow: ellipsis;
}
@media (max-width: 767.98px) {
  .header__text {
    font-size: 1.2em;
  }
}
.header__search {
  -webkit-box-flex: 1;
      -ms-flex: 1 1 0px;
          flex: 1 1 0;
  margin: 0 var(--gap);
}
@media (max-width: 991.98px) {
  .header__search {
    display: none;
  }
}
.header__phone {
  margin-right: var(--gap);
}
@media (max-width: 991.98px) {
  .header__phone {
    display: none;
  }
}
.header__actions {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
}

.headerCity {
  position: relative;
}
.headerCity__control {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-transition: var(--speed);
  transition: var(--speed);
  cursor: pointer;
  margin-right: var(--gap);
}
.headerCity__control:hover {
  color: var(--primary-color);
}
.headerCity__icon {
  color: var(--primary-color);
  margin-right: 10px;
  height: var(--font-size-medium);
  width: var(--font-size-medium);
}
.headerCity__ask {
  display: none;
  position: absolute;
  z-index: 10;
  top: calc(100% + 7px);
  left: 0;
  padding: var(--gap);
  border-radius: var(--radius);
  background-color: var(--paper-color);
  -webkit-transition: background-color var(--speed);
  transition: background-color var(--speed);
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
}
.headerCity__ask--opened {
  display: block;
}
.headerCity__question {
  white-space: nowrap;
  min-width: 200px;
  font-size: var(--font-size-medium);
  font-weight: 500;
  text-align: center;
}
.headerCity__actions {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: justify;
      -ms-flex-pack: justify;
          justify-content: space-between;
  margin: var(--gap) 0 0;
}
.headerCity__yes {
  -webkit-box-flex: 1;
      -ms-flex: 1 0 auto;
          flex: 1 0 auto;
  margin-right: var(--gap);
}
.headerCity__other {
  -webkit-box-flex: 0;
      -ms-flex: 0 0 auto;
          flex: 0 0 auto;
}

.headerInfo {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
}
.headerInfo__item {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  margin-right: var(--gap);
}
.headerInfo__icon {
  color: var(--primary-color);
  margin-right: 10px;
  height: var(--font-size-medium);
  width: var(--font-size-medium);
}
.headerInfo__label {
  margin-right: 5px;
}
@media (max-width: 991.98px) {
  .headerInfo__label {
    display: none;
  }
}
.headerInfo__value {
  color: var(--primary-color);
  font-weight: 500;
}
@media (max-width: 991.98px) {
  .headerInfo__value {
    color: var(--main-text-color);
  }
}

.headerNav {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
}
.headerNav__item:not(:last-child) {
  margin-right: var(--gap);
}
.headerNav__link {
  color: var(--muted-text-color);
}
.headerNav__link:hover {
  color: var(--primary-color);
}

.headerAction {
  position: relative;
}
@media (min-width: 768px) {
  .headerAction:not(:last-child) {
    margin-right: 3px;
  }
}
@media (min-width: 992px) {
  .headerAction--mobile {
    display: none;
  }
}
.headerAction__button {
  height: 40px;
  width: 40px;
}
@media (max-width: 767.98px) {
  .headerAction__button {
    width: 35px;
    height: 35px;
  }
}
.headerAction__button--wide {
  width: auto;
}
.headerAction__icon {
  width: 22px;
  height: 22px;
}
.headerAction__label {
  font-size: var(--font-size-medium);
  margin: 0 0 0 10px;
}
.headerAction__badge {
  position: absolute;
  top: 0;
  right: 0;
}
@media (max-width: 767.98px) {
  .headerAction__badge {
    top: -2px;
    right: -2px;
  }
}

.headerMenu {
  position: relative;
  width: 100%;
  overflow: hidden;
}
.headerMenu__rail {
  position: relative;
  overflow-x: auto;
  overflow-y: hidden;
  white-space: nowrap;
  font-size: 0;
  -webkit-overflow-scrolling: touch;
  -ms-overflow-style: -ms-autohiding-scrollbar;
  background-color: var(--layout-color);
  -webkit-transition: background-color var(--speed);
  transition: background-color var(--speed);
  border-radius: calc(var(--radius) + 3px);
  overflow-y: hidden;
  overflow-x: auto;
  -ms-overflow-style: none;
  scrollbar-width: none;
  -webkit-overflow-scrolling: touch;
}
.headerMenu__rail::-webkit-scrollbar {
  display: none;
}
.headerMenu__list {
  position: relative;
  float: left;
  list-style: none;
  padding: 0;
  margin: 0;
  -webkit-transition: -webkit-transform var(--speed) ease-in-out;
  transition: -webkit-transform var(--speed) ease-in-out;
  transition: transform var(--speed) ease-in-out;
  transition: transform var(--speed) ease-in-out, -webkit-transform var(--speed) ease-in-out;
}
.headerMenu__list--stop {
  -webkit-transition: none;
  transition: none;
}
.headerMenu__item {
  display: inline-block;
  white-space: nowrap;
  width: auto;
  padding: 3px;
}
.headerMenu__button {
  position: absolute;
  top: 0;
  bottom: 0;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  height: calc(var(--button-size) + 6px);
  width: calc(var(--button-size) + 6px);
  visibility: hidden;
  opacity: 0;
  -webkit-transition: var(--speed);
  transition: var(--speed);
  background-color: var(--paper-color);
  z-index: 2;
}
@media (max-width: 575.98px) {
  .headerMenu__button {
    display: none;
  }
}
.headerMenu__button--round {
  border-radius: 50% !important;
}
.headerMenu__button--prev {
  -webkit-box-shadow: 0 0 0 0 var(--paper-color);
          box-shadow: 0 0 0 0 var(--paper-color);
  left: calc(var(--button-size) * -1);
  border-radius: 50% 0 0 50%;
}
[data-overflowing=both] ~ .headerMenu__button--prev, [data-overflowing=left] ~ .headerMenu__button--prev {
  -webkit-box-shadow: 0 0 var(--gap) var(--gap) var(--paper-color);
          box-shadow: 0 0 var(--gap) var(--gap) var(--paper-color);
  left: 0;
  visibility: visible;
  opacity: 1;
}
.headerMenu__button--next {
  -webkit-box-shadow: 0 0 0 0 var(--paper-color);
          box-shadow: 0 0 0 0 var(--paper-color);
  right: calc(var(--button-size) * -1);
  border-radius: 0 50% 50% 0;
}
[data-overflowing=both] ~ .headerMenu__button--next, [data-overflowing=right] ~ .headerMenu__button--next {
  -webkit-box-shadow: 0 0 var(--gap) var(--gap) var(--paper-color);
          box-shadow: 0 0 var(--gap) var(--gap) var(--paper-color);
  right: 0;
  visibility: visible;
  opacity: 1;
}
.headerMenu__icon {
  height: var(--font-size-legend);
  width: var(--font-size-legend);
  pointer-events: none;
}

.headerSliderMenu {
  background-color: var(--layout-color);
  border-radius: calc(var(--radius) + 3px);
  -webkit-transition: background-color var(--speed), -webkit-box-shadow var(--speed);
  transition: background-color var(--speed), -webkit-box-shadow var(--speed);
  transition: background-color var(--speed), box-shadow var(--speed);
  transition: background-color var(--speed), box-shadow var(--speed), -webkit-box-shadow var(--speed);
  -webkit-box-shadow: inset 0 0 2px var(--shadow-first), inset 0 0 12px var(--shadow-second);
          box-shadow: inset 0 0 2px var(--shadow-first), inset 0 0 12px var(--shadow-second);
}
.headerSliderMenu__wrapper {
  -webkit-box-pack: justify;
      -ms-flex-pack: justify;
          justify-content: space-between;
}
.headerSliderMenu__item {
  width: auto;
  padding: 3px 0;
  margin: 0 3px;
}
.headerSliderMenu__control {
  position: relative;
  display: -webkit-inline-box;
  display: -ms-inline-flexbox;
  display: inline-flex;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  padding: 0 var(--gap);
  height: var(--button-size);
  -webkit-user-select: none;
     -moz-user-select: none;
      -ms-user-select: none;
          user-select: none;
  cursor: pointer;
  outline: none;
  background-color: transparent;
  color: var(--main-text-color);
  border: 2px solid transparent;
  border-radius: var(--radius);
  -webkit-transition: background-color var(--speed);
  transition: background-color var(--speed);
  -webkit-appearance: none;
     -moz-appearance: none;
          appearance: none;
  font-weight: 500;
  -webkit-tap-highlight-color: transparent;
}
.headerSliderMenu__control:hover {
  color: var(--main-text-color);
  background-color: var(--focus-highlight);
  text-decoration: none;
}
.headerSliderMenu__control[data-active=true] {
  border-color: var(--primary-color);
}
.headerSliderMenu__control-label {
  font-size: var(--font-size-medium);
  line-height: var(--font-size-medium);
  pointer-events: none;
  overflow: hidden;
  text-overflow: ellipsis;
  white-space: nowrap;
}
.headerSliderMenu__button {
  position: absolute;
  top: 0;
  bottom: 0;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  height: calc(var(--button-size) + 6px);
  width: calc(var(--button-size) + 6px);
  background-color: var(--paper-color);
  -webkit-box-shadow: 0 0 var(--gap) var(--gap) var(--paper-color);
          box-shadow: 0 0 var(--gap) var(--gap) var(--paper-color);
  z-index: 2;
}
@media (max-width: 575.98px) {
  .headerSliderMenu__button {
    display: none;
  }
}
.headerSliderMenu__button--round {
  border-radius: 50% !important;
}
.headerSliderMenu__button--prev {
  left: 0;
  border-radius: 50% 0 0 50%;
}
.headerSliderMenu__button--prev.headerSliderMenu__button--disabled {
  left: calc(var(--button-size) * -1);
  -webkit-box-shadow: 0 0 0 0 var(--paper-color);
          box-shadow: 0 0 0 0 var(--paper-color);
  visibility: hidden;
  opacity: 0;
}
.headerSliderMenu__button--next {
  right: 0;
  border-radius: 0 50% 50% 0;
}
.headerSliderMenu__button--next.headerSliderMenu__button--disabled {
  right: calc(var(--button-size) * -1);
  -webkit-box-shadow: 0 0 0 0 var(--paper-color);
          box-shadow: 0 0 0 0 var(--paper-color);
  visibility: hidden;
  opacity: 0;
}
.headerSliderMenu__icon {
  height: var(--font-size-legend);
  height: var(--font-size-large);
  width: var(--font-size-legend);
  width: var(--font-size-large);
  pointer-events: none;
}

.searchbox {
  position: absolute;
  width: 100%;
  height: 100%;
  top: 0;
  left: 0;
  right: 0;
  bottom: 0;
  background-color: var(--paper-color);
  padding: calc(var(--gap) + var(--safe-top)) var(--gap-2) var(--gap);
  z-index: 20;
  visibility: hidden;
  opacity: 0;
  -webkit-transition: var(--speed);
  transition: var(--speed);
}
.searchbox--active {
  visibility: visible;
  opacity: 1;
}
.searchbox__container {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: justify;
      -ms-flex-pack: justify;
          justify-content: space-between;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  height: 100%;
  width: 100%;
  margin: 0;
}
.searchbox__field {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-flex: 1;
      -ms-flex-positive: 1;
          flex-grow: 1;
  color: var(--muted-text-color);
}
.searchbox__icon {
  position: absolute;
  width: 20px;
  height: 20px;
  top: 12px;
  left: 10px;
  pointer-events: none;
}
@media (max-width: 767.98px) {
  .searchbox__icon {
    width: 18px;
    height: 18px;
    top: 8px;
    left: 9px;
  }
}
.searchbox__input {
  -webkit-box-flex: 1;
      -ms-flex: 1;
          flex: 1;
  font-family: var(--default-font);
  letter-spacing: 0;
  border: none;
  -webkit-box-shadow: none;
          box-shadow: none;
  margin-right: 1rem;
  padding: 0 1rem 0 2.5rem;
  height: 45px;
  font-size: var(--font-size-medium);
  background-color: transparent;
  caret-color: var(--primary-color);
  color: var(--main-text-color);
  border-radius: var(--radius);
  -webkit-transition: var(--speed);
  transition: var(--speed);
  -webkit-appearance: none;
     -moz-appearance: none;
          appearance: none;
}
@media (max-width: 767.98px) {
  .searchbox__input {
    padding: 0 1rem 0 2.2rem;
  }
}
.searchbox__input::-webkit-input-placeholder {
  color: var(--muted-text-color);
}
.searchbox__input::-moz-placeholder {
  color: var(--muted-text-color);
}
.searchbox__input:-ms-input-placeholder {
  color: var(--muted-text-color);
}
.searchbox__input::-ms-input-placeholder {
  color: var(--muted-text-color);
}
.searchbox__input::placeholder {
  color: var(--muted-text-color);
}
.searchbox__input::-webkit-search-cancel-button {
  display: none;
}
.searchbox__input:focus {
  outline: none;
  -webkit-box-shadow: 0 0 0 2px var(--primary-color) inset;
          box-shadow: 0 0 0 2px var(--primary-color) inset;
}
@media (max-width: 767.98px) {
  .searchbox__input {
    height: 35px;
    font-size: var(--font-size-base);
  }
}

.footer {
  background-color: var(--paper-color);
  -webkit-transition: background-color var(--speed), -webkit-box-shadow var(--speed);
  transition: background-color var(--speed), -webkit-box-shadow var(--speed);
  transition: background-color var(--speed), box-shadow var(--speed);
  transition: background-color var(--speed), box-shadow var(--speed), -webkit-box-shadow var(--speed);
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 -4px 12px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 -4px 12px var(--shadow-second);
}
.footer__subscribe {
  border-bottom: 1px solid var(--border-color);
}
.footer__middle {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
      flex-wrap: wrap;
  padding: var(--gap-big) 0;
  border-bottom: 1px solid var(--border-color);
}
@media (max-width: 767.98px) {
  .footer__middle {
    display: none;
  }
}
.footer__main {
  -webkit-box-flex: 1;
      -ms-flex: 1;
          flex: 1;
  margin-right: var(--gap);
}
.footer__info {
  max-width: 330px;
  min-width: 300px;
}
.footer__socials {
  margin: var(--gap-big) 0;
}
.footer__bottom {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
      flex-wrap: wrap;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: justify;
      -ms-flex-pack: justify;
          justify-content: space-between;
  padding: var(--gap-1-5) 0;
}
@media (max-width: 575.98px) {
  .footer__bottom {
    -webkit-box-orient: vertical;
    -webkit-box-direction: normal;
        -ms-flex-direction: column;
            flex-direction: column;
  }
}
.footer__payment {
  margin: 0 var(--gap);
}
@media (max-width: 575.98px) {
  .footer__payment {
    margin: var(--gap) 0;
  }
}
.footer__copyright {
  font-size: var(--font-size-tiny);
  color: var(--muted-text-color);
  text-transform: uppercase;
}

.footerMenu {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
      flex-wrap: wrap;
}
.footerMenu__item:not(:last-child) {
  margin-right: var(--gap-2);
}
.footerMenu__link {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  font-size: var(--font-size-medium);
  font-weight: 600;
  white-space: nowrap;
  color: var(--main-text-color);
  overflow: hidden;
}
.footerMenu__link:hover {
  color: var(--primary-color);
}
.footerMenu__link--current {
  color: var(--primary-color);
}

.navigation {
  display: none;
}
@media (max-width: 767.98px) {
  .navigation {
    position: fixed;
    display: -webkit-box;
    display: -ms-flexbox;
    display: flex;
    bottom: 0;
    width: 100%;
    height: calc(var(--mobile-nav-height) + var(--safe-bottom) / 2);
    margin: 0;
    -webkit-box-ordinal-group: 4;
        -ms-flex-order: 3;
            order: 3;
    border-radius: 0;
    padding: 0.5rem 0.5rem calc(0.5rem + var(--safe-bottom) / 2) 0.5rem;
    z-index: 10;
    -webkit-transition: var(--speed);
    transition: var(--speed);
    background-color: var(--paper-color-transparent);
    -webkit-backdrop-filter: saturate(180%) blur(20px);
            backdrop-filter: saturate(180%) blur(20px);
    -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 -4px 12px var(--shadow-second);
            box-shadow: 0 0 2px var(--shadow-first), 0 -4px 12px var(--shadow-second);
  }
}
.navigation__list {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  -webkit-box-flex: 1;
      -ms-flex-positive: 1;
          flex-grow: 1;
  list-style: none;
  padding: 0;
  margin: 0;
}
@media (max-width: 767.98px) {
  .navigation__list {
    -webkit-box-orient: horizontal;
    -webkit-box-direction: normal;
        -ms-flex-direction: row;
            flex-direction: row;
    -ms-flex-pack: distribute;
        justify-content: space-around;
    width: 100%;
  }
}
.navigation__item {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  margin-bottom: 1.4rem;
}
.navigation__item:last-of-type {
  margin-bottom: 0;
}
@media (max-width: 767.98px) {
  .navigation__item {
    margin-bottom: 0;
  }
}
.navigation__item--grow {
  -webkit-box-flex: 1;
      -ms-flex-positive: 1;
          flex-grow: 1;
}
@media (max-width: 767.98px) {
  .navigation__item--grow {
    -webkit-box-flex: 0;
        -ms-flex-positive: 0;
            flex-grow: 0;
  }
}
.navigation__link {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-user-select: none;
     -moz-user-select: none;
      -ms-user-select: none;
          user-select: none;
  border-radius: 50%;
  width: 50px;
  height: 50px;
  padding: 0;
  border: none;
  cursor: pointer;
  outline: none;
  -webkit-transition: var(--speed);
  transition: var(--speed);
  background-color: transparent;
  color: var(--main-text-color);
  -webkit-tap-highlight-color: transparent;
  -webkit-appearance: none;
     -moz-appearance: none;
          appearance: none;
}
@media (max-width: 767.98px) {
  .navigation__link {
    width: 40px;
    height: 40px;
  }
}
.navigation__link:focus {
  outline: none;
}
.navigation__link:hover {
  background-color: var(--focus-highlight);
}
.navigation__link--current {
  color: var(--primary-color);
}
.navigation__link--current:hover {
  color: var(--primary-color);
}
.navigation__link--current::after {
  content: "";
  display: block;
  position: absolute;
  height: 3px;
  width: 20px;
  bottom: 3px;
  border-radius: var(--radius);
  background-color: var(--primary-color);
}
@media (max-width: 767.98px) {
  .navigation__link--current::after {
    bottom: 1px;
  }
}
.navigation__icon {
  pointer-events: none;
  height: 24px;
  width: 24px;
}
@media (max-width: 767.98px) {
  .navigation__icon {
    height: 22px;
    width: 22px;
  }
}

@media (max-width: 767.98px) {
  .sidebar {
    display: none;
  }
}

.drawer {
  position: fixed;
  bottom: 0;
  top: 0;
  left: 0;
  right: 0;
  height: 100%;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  background-color: var(--layout-color);
  z-index: 95;
  -webkit-transform: translateX(-100%);
          transform: translateX(-100%);
  -webkit-transition: -webkit-transform var(--speed);
  transition: -webkit-transform var(--speed);
  transition: transform var(--speed);
  transition: transform var(--speed), -webkit-transform var(--speed);
  will-change: transform;
  overflow: hidden;
}
.drawer--open {
  -webkit-transform: translateX(0);
          transform: translateX(0);
}
.drawer__header {
  background-color: var(--paper-color);
  z-index: 2;
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 3px 8px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 3px 8px var(--shadow-second);
}
.drawer__header-safe {
  -ms-flex-preferred-size: 100%;
      flex-basis: 100%;
  height: var(--safe-top);
}
.drawer__header-wrapper {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: justify;
      -ms-flex-pack: justify;
          justify-content: space-between;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  height: 50px;
  padding: 0 var(--gap) 0 var(--gap-2);
}
.drawer__brand {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: start;
      -ms-flex-align: start;
          align-items: flex-start;
  width: -webkit-fit-content;
  width: -moz-fit-content;
  width: fit-content;
  margin-right: auto;
}
.drawer__logo {
  display: -webkit-inline-box;
  display: -ms-inline-flexbox;
  display: inline-flex;
  height: 3rem;
  max-width: 250px;
}
@media (max-width: 767.98px) {
  .drawer__logo {
    max-width: 150px;
    max-height: 30px;
  }
}
.drawer__content {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  padding: 0 0 calc(var(--gap) + var(--safe-bottom));
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  overflow-y: auto;
  overflow-x: hidden;
}
.drawer__menu {
  -webkit-box-flex: 1;
      -ms-flex: 1;
          flex: 1;
}
.drawer__auth {
  margin-top: var(--gap);
  padding: 0 var(--gap);
}
.drawer__block {
  margin: var(--gap) 0 0;
  padding: var(--gap) var(--gap-2);
  background-color: var(--paper-color);
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
}
.drawer__block--spaceless {
  padding: 0;
}
.drawer__closer {
  margin-left: var(--gap);
}

.drawerMenu {
  margin: var(--gap) 0 0;
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
}
.drawerMenu__item {
  position: relative;
  background-color: var(--paper-color);
}
.drawerMenu__name {
  font-size: var(--font-size-medium);
  line-height: var(--font-size-medium);
  font-weight: 600;
}
.drawerMenu__link {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  min-height: 45px;
  font-size: var(--font-size-medium);
  font-weight: 500;
  color: var(--main-text-color);
  padding: 0 var(--gap-2);
  overflow: hidden;
}
.drawerMenu__link:hover {
  color: var(--primary-color);
}
.drawerMenu__link--current::before {
  content: "";
  position: absolute;
  left: 10px;
  top: 21px;
  height: 4px;
  width: 10px;
  border-radius: var(--radius);
  background-color: var(--primary-color);
}
.drawerMenu__link--avatar {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  padding: var(--gap) var(--gap-2);
  gap: var(--gap);
}
.drawerMenu__icon {
  width: 23px;
  height: 23px;
  margin: 0 1rem 0 0;
}

.drawerInfo {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
}
.drawerInfo__set {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: start;
      -ms-flex-align: start;
          align-items: flex-start;
}
.drawerInfo__set:not(:last-child) {
  margin-bottom: var(--gap);
}
.drawerInfo__icon {
  stroke: var(--primary-color);
  width: 22px;
  height: 22px;
  margin-right: var(--gap);
}
.drawerInfo__label {
  font-size: var(--font-size-medium);
  line-height: var(--font-size-medium);
}
.drawerInfo__label:not(:last-child) {
  margin-bottom: calc(var(--gap) / 2);
}

.location {
  position: relative;
  width: 100%;
}

.locationAddresses--mobile {
  padding-top: var(--gap);
}
.locationAddresses__item {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  padding: 0 var(--gap);
  height: 50px;
  -webkit-transition: var(--speed);
  transition: var(--speed);
  cursor: pointer;
}
@media (max-width: 575.98px) {
  .locationAddresses__item {
    height: 53px;
  }
}
.locationAddresses__item:hover {
  background-color: var(--focus-highlight);
}
.locationAddresses__icon {
  width: 26px;
  height: 26px;
  color: var(--border-color);
}
.locationAddresses__item--current .locationAddresses__icon {
  color: var(--primary-color);
}
.locationAddresses__address {
  -webkit-box-flex: 1;
      -ms-flex: 1 0 0px;
          flex: 1 0 0;
  overflow: hidden;
  margin-left: calc(var(--gap) / 1.25);
}
.locationAddresses__label {
  font-size: var(--font-size-medium);
  line-height: var(--font-size-medium);
  color: var(--main-text-color);
}
.locationAddresses__description {
  font-size: var(--font-size-small);
  color: var(--hint-text-color);
}
.locationAddresses__label, .locationAddresses__description {
  overflow: hidden;
  text-overflow: ellipsis;
  white-space: nowrap;
}
.locationAddresses__actions {
  padding: var(--gap) var(--gap) calc(var(--gap) + var(--safe-bottom));
}

.mobileLocation {
  display: none;
}
@media (max-width: 575.98px) {
  .mobileLocation {
    display: -webkit-box;
    display: -ms-flexbox;
    display: flex;
    width: 100%;
    margin: var(--gap) 0;
  }
}
.mobileLocation__block {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  background-color: var(--paper-color);
  border-radius: var(--radius);
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
}

.bxmaker-authuserphone-header {
  display: none;
}

.bxmaker-authuserphone-enter-forget-form__or {
  height: 15px;
}

.bxmaker-authuserphone-enter,
.bxmaker-authuserphone-edit,
.bxmaker-authuserphone-simple {
  font-size: var(--font-size-medium);
  display: inline-block;
  padding: 0;
  -webkit-box-shadow: none;
          box-shadow: none;
  border-radius: 0;
  width: 100%;
  color: var(--main-text-color);
  background-color: transparent;
}

.bxmaker-authuserphone-usercallto {
  border-radius: var(--radius);
  height: calc(var(--button-size) * 1.3);
  background-color: var(--input-color);
}

.bxmaker-authuserphone-input-password__field,
.bxmaker-authuserphone-input-code__field,
.bxmaker-authuserphone-input-phone__field,
.bxmaker-authuserphone-input__field {
  -webkit-box-flex: 1;
      -ms-flex: auto;
          flex: auto;
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
  margin: 0;
  border: solid 2px;
  border-color: transparent;
  border-radius: var(--radius);
  padding: 0;
  width: 100%;
  height: calc(var(--button-size) * 1.3);
  color: var(--main-text-color);
  background-color: var(--input-color);
  -webkit-box-shadow: none;
  box-shadow: none;
  font-family: inherit;
  font-size: inherit;
  line-height: inherit;
  caret-color: var(--primary-color);
  -webkit-transition: var(--speed);
  transition: var(--speed);
  -webkit-appearance: none;
  -moz-appearance: none;
  appearance: none;
}

.bxmaker-authuserphone-input-password input[type=password],
.bxmaker-authuserphone-input-password input[type=text],
.bxmaker-authuserphone-input input[type=otp],
.bxmaker-authuserphone-input input[type=password],
.bxmaker-authuserphone-input input[type=phone],
.bxmaker-authuserphone-input input[type=text] {
  padding: var(--gap) var(--gap) 0;
  border-radius: var(--radius);
}

.bxmaker-authuserphone-input-phone input[type=text] {
  padding: var(--gap) var(--gap) 0 0;
  border-radius: 0 var(--radius) var(--radius) 0;
}

.bxmaker-authuserphone-input-phone input[type=text]::-webkit-input-placeholder {
  color: transparent;
}

.bxmaker-authuserphone-input-phone input[type=text]::-moz-placeholder {
  color: transparent;
}

.bxmaker-authuserphone-input-phone input[type=text]:-ms-input-placeholder {
  color: transparent;
}

.bxmaker-authuserphone-input-phone input[type=text]::-ms-input-placeholder {
  color: transparent;
}

.bxmaker-authuserphone-input-phone input[type=text]::placeholder {
  color: transparent;
}

.bxmaker-authuserphone-input-code input[type=otp],
.bxmaker-authuserphone-input-code input[type=password],
.bxmaker-authuserphone-input-code input[type=phone],
.bxmaker-authuserphone-input-code input[type=text] {
  font-weight: 700;
  letter-spacing: 10px;
}

.bxmaker-authuserphone-input-password__title,
.bxmaker-authuserphone-input-phone__title,
.bxmaker-authuserphone-input__title {
  top: 15px;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  border-color: var(--border-color);
  width: calc(100% - var(--gap-2));
  max-height: 100%;
  color: var(--muted-text-color);
  font-size: var(--font-size-base);
  cursor: text;
  -webkit-transition: 0.1s;
  transition: 0.1s;
}

.bxmaker-authuserphone-input__title {
  left: var(--gap);
}

.bxmaker-authuserphone-input-password--hover .bxmaker-authuserphone-input-password__title,
.bxmaker-authuserphone-input-phone--hover .bxmaker-authuserphone-input-phone__title,
.bxmaker-authuserphone-input--hover .bxmaker-authuserphone-input__title {
  font-size: var(--font-size-base);
  -webkit-transform: none;
          transform: none;
  top: 15px;
}

.bxmaker-authuserphone-input-phone--hover .bxmaker-authuserphone-input-phone__title {
  left: auto;
}

.bxmaker-authuserphone-input-password--focus .bxmaker-authuserphone-input-password__title,
.bxmaker-authuserphone-input-phone--focus .bxmaker-authuserphone-input-phone__title,
.bxmaker-authuserphone-input--focus .bxmaker-authuserphone-input__title {
  font-size: var(--font-size-tiny);
  -webkit-transform: none;
          transform: none;
  top: 5px;
  left: var(--gap) !important;
  color: var(--primary-color);
}

.bxmaker-authuserphone-input-phone--flag.bxmaker-authuserphone-input-phone--hover .bxmaker-authuserphone-input-phone__flag {
  padding: 0 8px;
}

.bxmaker-authuserphone-input-phone--flag.bxmaker-authuserphone-input-phone--focus .bxmaker-authuserphone-input-phone__flag {
  padding-top: 15px;
}

.bxmaker-authuserphone-input-password--hover .bxmaker-authuserphone-input-password__field,
.bxmaker-authuserphone-input-password:hover .bxmaker-authuserphone-input-password__field,
.bxmaker-authuserphone-input-code:hover .bxmaker-authuserphone-input-code__field,
.bxmaker-authuserphone-input-phone--hover .bxmaker-authuserphone-input-phone__field,
.bxmaker-authuserphone-input-phone:hover .bxmaker-authuserphone-input-phone__field,
.bxmaker-authuserphone-input--hover .bxmaker-authuserphone-input__field,
.bxmaker-authuserphone-input:hover .bxmaker-authuserphone-input__field {
  border-color: var(--border-color);
}

.bxmaker-authuserphone-input-password--focus .bxmaker-authuserphone-input-password__field,
.bxmaker-authuserphone-input-code--focus .bxmaker-authuserphone-input-code__field,
.bxmaker-authuserphone-input-phone--focus .bxmaker-authuserphone-input-phone__field,
.bxmaker-authuserphone-input--focus .bxmaker-authuserphone-input__field {
  border-color: var(--primary-color) !important;
}

.bxmaker-authuserphone-button__inner {
  position: relative;
  display: -webkit-inline-box;
  display: -ms-inline-flexbox;
  display: inline-flex;
  -webkit-box-pack: center;
  -ms-flex-pack: center;
  justify-content: center;
  -webkit-box-align: center;
  -ms-flex-align: center;
  align-items: center;
  padding: 0 var(--gap);
  height: var(--button-size);
  min-height: auto;
  -webkit-user-select: none;
  -moz-user-select: none;
  -ms-user-select: none;
  user-select: none;
  cursor: pointer;
  outline: 0;
  background-color: transparent;
  color: var(--main-text-color);
  border: var(--button-border-width, 0) solid;
  border-radius: var(--radius);
  -webkit-transition: var(--speed);
  transition: var(--speed);
  -webkit-appearance: none;
  -moz-appearance: none;
  appearance: none;
  font-weight: 500;
  -webkit-tap-highlight-color: transparent;
  background-color: var(--primary-color);
  color: var(--fill-btn-color);
  width: 100%;
}

.bxmaker-authuserphone-button:hover .bxmaker-authuserphone-button__inner {
  background-color: var(--primary-color);
  color: var(--fill-btn-color);
}

.bxmaker-authuserphone-button__title {
  font-size: var(--font-size-medium);
  line-height: var(--font-size-medium);
  pointer-events: none;
  overflow: hidden;
  text-overflow: ellipsis;
  white-space: nowrap;
  font-weight: normal;
  color: currentColor;
}

.popup-window {
  font: var(--font-size-base) var(--default-font);
  border-radius: var(--radius);
  background-color: var(--layout-color);
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
  box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
}

.popup-window-angly--arrow {
  background-color: var(--layout-color);
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
  box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
}

.main-phonenumber-country-flag {
  margin: 3px 10px 3px 0;
}

a.bxmaker-authuserphone-link {
  color: var(--primary-color);
}

a.bxmaker-authuserphone-link:hover {
  color: var(--main-text-color);
}

.bxmaker-authuserphone-input-password__visible:after {
  width: 24px;
  height: 24px;
}

.bxmaker-authuserphone-input-password__visible {
  opacity: 1;
}

.bxmaker-authuserphone-enter svg path,
.bxmaker-authuserphone-simple svg path {
  fill: var(--primary-color);
  stroke: none;
}

.bxmaker-authuserphone-button__inner svg path {
  fill: var(--fill-btn-color);
}

.bxmaker-authuserphone-captcha .bxmaker-authuserphone-refresh:hover,
.bxmaker-authuserphone-captcha .bxmaker-authuserphone-refresh {
  background: var(--primary-color);
}

.bxmaker-authuserphone-captcha .bxmaker-authuserphone-refresh svg path {
  stroke: var(--fill-btn-color);
}

.bxmaker-authuserphone-captcha .bxmaker-authuserphone-refresh svg path:last-child {
  fill: var(--fill-btn-color);
}

.bxmaker-authuserphone-captcha__img {
  border: none;
  height: calc(var(--button-size) * 1.3);
}

.bxmaker-authuserphone-captcha__img img {
  height: auto;
}

@media (prefers-color-scheme: dark) {
  .bxmaker-authuserphone-input-password__visible:after {
    background-image: url(data:image/svg+xml;base64,PHN2ZyB3aWR0aD0iMjQiIGhlaWdodD0iMjQiIHZpZXdCb3g9IjAgMCAyNCAyNCIgZmlsbD0ibm9uZSIgeG1sbnM9Imh0dHA6Ly93d3cudzMub3JnLzIwMDAvc3ZnIj4KPHBhdGggZD0iTTEgMTJDMSAxMiA1IDQgMTIgNEMxOSA0IDIzIDEyIDIzIDEyQzIzIDEyIDE5IDIwIDEyIDIwQzUgMjAgMSAxMiAxIDEyWiIgc3Ryb2tlPSJ3aGl0ZSIgc3Ryb2tlLXdpZHRoPSIyIiBzdHJva2UtbGluZWNhcD0icm91bmQiIHN0cm9rZS1saW5lam9pbj0icm91bmQiLz4KPHBhdGggZD0iTTEyIDE1QzEzLjY1NjkgMTUgMTUgMTMuNjU2OSAxNSAxMkMxNSAxMC4zNDMxIDEzLjY1NjkgOSAxMiA5QzEwLjM0MzEgOSA5IDEwLjM0MzEgOSAxMkM5IDEzLjY1NjkgMTAuMzQzMSAxNSAxMiAxNVoiIHN0cm9rZT0id2hpdGUiIHN0cm9rZS13aWR0aD0iMiIgc3Ryb2tlLWxpbmVjYXA9InJvdW5kIiBzdHJva2UtbGluZWpvaW49InJvdW5kIi8+Cjwvc3ZnPgo=);
  }
  .bxmaker-authuserphone-input-password__visible--active:after {
    background-image: url(data:image/svg+xml;base64,PHN2ZyB3aWR0aD0iMjQiIGhlaWdodD0iMjQiIHZpZXdCb3g9IjAgMCAyNCAyNCIgZmlsbD0ibm9uZSIgeG1sbnM9Imh0dHA6Ly93d3cudzMub3JnLzIwMDAvc3ZnIj4KPGcgY2xpcC1wYXRoPSJ1cmwoI2NsaXAwXzIxNF81KSI+CjxwYXRoIGQ9Ik0xNy45NCAxNy45NEMxNi4yMzA2IDE5LjI0MyAxNC4xNDkxIDE5Ljk2NDkgMTIgMjBDNSAyMCAxIDEyIDEgMTJDMi4yNDM4OSA5LjY4MTkyIDMuOTY5MTQgNy42NTY2MyA2LjA2IDYuMDYwMDNNOS45IDQuMjQwMDJDMTAuNTg4MyA0LjA3ODkgMTEuMjkzMSAzLjk5ODM2IDEyIDQuMDAwMDNDMTkgNC4wMDAwMyAyMyAxMiAyMyAxMkMyMi4zOTMgMTMuMTM1NiAyMS42NjkxIDE0LjIwNDggMjAuODQgMTUuMTlNMTQuMTIgMTQuMTJDMTMuODQ1NCAxNC40MTQ4IDEzLjUxNDEgMTQuNjUxMiAxMy4xNDYyIDE0LjgxNTFDMTIuNzc4MiAxNC45NzkxIDEyLjM4MDkgMTUuMDY3MyAxMS45NzgxIDE1LjA3NDRDMTEuNTc1MyAxNS4wODE1IDExLjE3NTIgMTUuMDA3NCAxMC44MDE2IDE0Ljg1NjVDMTAuNDI4MSAxNC43MDU2IDEwLjA4ODcgMTQuNDgxMSA5LjgwMzg1IDE0LjE5NjJDOS41MTg5NyAxMy45MTEzIDkuMjk0MzkgMTMuNTcyIDkuMTQzNTEgMTMuMTk4NEM4Ljk5MjYyIDEyLjgyNDkgOC45MTg1MyAxMi40MjQ3IDguOTI1NjMgMTIuMDIxOUM4LjkzMjc0IDExLjYxOTEgOS4wMjA5MSAxMS4yMjE5IDkuMTg0ODggMTAuODUzOUM5LjM0ODg0IDEwLjQ4NTkgOS41ODUyNSAxMC4xNTQ3IDkuODggOS44ODAwMyIgc3Ryb2tlPSJ3aGl0ZSIgc3Ryb2tlLXdpZHRoPSIyIiBzdHJva2UtbGluZWNhcD0icm91bmQiIHN0cm9rZS1saW5lam9pbj0icm91bmQiLz4KPHBhdGggZD0iTTEgMUwyMyAyMyIgc3Ryb2tlPSJ3aGl0ZSIgc3Ryb2tlLXdpZHRoPSIyIiBzdHJva2UtbGluZWNhcD0icm91bmQiIHN0cm9rZS1saW5lam9pbj0icm91bmQiLz4KPC9nPgo8ZGVmcz4KPGNsaXBQYXRoIGlkPSJjbGlwMF8yMTRfNSI+CjxyZWN0IHdpZHRoPSIyNCIgaGVpZ2h0PSIyNCIgZmlsbD0id2hpdGUiLz4KPC9jbGlwUGF0aD4KPC9kZWZzPgo8L3N2Zz4K);
  }
}
@media (prefers-color-scheme: light) {
  .bxmaker-authuserphone-input-password__visible:after {
    background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIyNCIgaGVpZ2h0PSIyNCIgdmlld0JveD0iMCAwIDI0IDI0IiBmaWxsPSJub25lIiBzdHJva2U9ImN1cnJlbnRDb2xvciIgc3Ryb2tlLXdpZHRoPSIyIiBzdHJva2UtbGluZWNhcD0icm91bmQiIHN0cm9rZS1saW5lam9pbj0icm91bmQiIGNsYXNzPSJmZWF0aGVyIGZlYXRoZXItZXllLW9mZiI+PHBhdGggZD0iTTE3Ljk0IDE3Ljk0QTEwLjA3IDEwLjA3IDAgMCAxIDEyIDIwYy03IDAtMTEtOC0xMS04YTE4LjQ1IDE4LjQ1IDAgMCAxIDUuMDYtNS45NE05LjkgNC4yNEE5LjEyIDkuMTIgMCAwIDEgMTIgNGM3IDAgMTEgOCAxMSA4YTE4LjUgMTguNSAwIDAgMS0yLjE2IDMuMTltLTYuNzItMS4wN2EzIDMgMCAxIDEtNC4yNC00LjI0Ij48L3BhdGg+PGxpbmUgeDE9IjEiIHkxPSIxIiB4Mj0iMjMiIHkyPSIyMyI+PC9saW5lPjwvc3ZnPg==);
  }
  .bxmaker-authuserphone-input-password__visible--active:after {
    background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHdpZHRoPSIyNCIgaGVpZ2h0PSIyNCIgdmlld0JveD0iMCAwIDI0IDI0IiBmaWxsPSJub25lIiBzdHJva2U9ImN1cnJlbnRDb2xvciIgc3Ryb2tlLXdpZHRoPSIyIiBzdHJva2UtbGluZWNhcD0icm91bmQiIHN0cm9rZS1saW5lam9pbj0icm91bmQiIGNsYXNzPSJmZWF0aGVyIGZlYXRoZXItZXllIj48cGF0aCBkPSJNMSAxMnM0LTggMTEtOCAxMSA4IDExIDgtNCA4LTExIDgtMTEtOC0xMS04eiI+PC9wYXRoPjxjaXJjbGUgY3g9IjEyIiBjeT0iMTIiIHI9IjMiPjwvY2lyY2xlPjwvc3ZnPg==);
  }
}
.bxmaker-authuserphone-message--error {
  color: var(--danger);
}

.bxmaker-authuserphone-timeout {
  font-size: var(--font-size-small);
  color: var(--muted-text-color);
}

.bxmaker-custom-policy {
  text-align: center;
  margin-top: 15px;
}

.catalogList {
  position: relative;
}
.catalogList__grid {
  display: grid;
  grid-template-columns: repeat(4, 1fr);
  gap: var(--gap-2);
}
@media (max-width: 991.98px) {
  .catalogList__grid {
    gap: var(--gap);
  }
}
@media (max-width: 575.98px) {
  .catalogList__grid {
    grid-template-columns: repeat(2, 1fr);
  }
}

.catalog__section {
    width: 100%;
}
.catalog__section {
    display: flex;
    column-gap: var(--gap-2);
}

.catalogMenu {
    position: sticky;
    top: var(--sticky-offset);
    width: 220px;
    height: -webkit-fit-content;
    height: -moz-fit-content;
    height: fit-content;
}

.catalogMenu__media {
    width: 30px;
    height: 30px;
    flex: 0 0 30px;
    border-radius: 5px;
    object-fit: cover;
    display: block;
}

.catalogMenu__media--empty {
    background: var(--default-color);
}
.catalogMenu__link.active .catalogMenu__name {
    color: var(--primary-color);
}
.catalogMenu__link {
    display: flex;
    align-items: center;
    column-gap: 10px;
    color: var(--main-text-color);
}
.catalogMenu__title {
    margin-bottom: 1.5rem;
    font-size: var(--font-size-big);
}

.sections-block {
    width: calc(100% - 220px - var(--gap-big));
}

.catalogMenu__element {
    margin-bottom: 1rem;
}

.category {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  height: 100%;
  background-color: var(--paper-color);
  border-radius: var(--radius);
  overflow: hidden;
  -webkit-transition: var(--speed);
  transition: var(--speed);
  z-index: 1;
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
}
.category--long {
  grid-column: span 2;
}
.category--long .category__picture {
  padding-top: calc(50% - var(--gap));
}
@media (max-width: 991.98px) {
  .category--long .category__picture {
    padding-top: calc(50% - var(--gap) / 2);
  }
}
.category__picture {
  position: relative;
  display: block;
  overflow: hidden;
  padding-top: 100%;
}
.category__image {
  position: relative;
  display: block;
  overflow: hidden;
  background-color: var(--focus-highlight);
}
.category__image--square {
  padding-top: 100%;
}
.category__image--horizontal {
  padding-top: 56.25%;
}
.category__image--vertical {
  padding-top: 125%;
}
.category__info {
  font-family: var(--heading-font);
  padding: 15px 25px;
}
.category__name {
  position: absolute;
  padding: 0 0.8rem;
  font-size: var(--font-size-bigger);
  font-weight: 600;
  top: var(--gap-1-5);
  left: var(--gap-1-5);
  max-width: calc(100% - var(--gap-1-5) * 2);
  z-index: 4;
  color: var(--main-text-color);
  background-color: var(--paper-color);
  border-radius: calc(var(--radius) - 5px);
  -webkit-transition: var(--speed);
  transition: var(--speed);
}
@media (max-width: 991.98px) {
  .category__name {
    font-size: var(--font-size-base);
    top: calc(var(--gap) / 2);
    left: calc(var(--gap) / 2);
    max-width: calc(100% - var(--gap));
  }
}
.productsList {
  position: relative;
}
.productsList__group:not(:last-child) {
  margin-bottom: var(--gap-2);
}
@media (max-width: 767.98px) {
  .productsList__group:not(:last-child) {
    margin-bottom: var(--gap);
  }
}
.productsList__header {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: justify;
      -ms-flex-pack: justify;
          justify-content: space-between;
  position: relative;
  margin: 0 0 var(--gap);
}
@media (max-width: 991.98px) {
  .productsList__header {
    margin: 0 0 var(--gap);
  }
}
.productsList__title {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-flex: 1;
      -ms-flex: 1;
          flex: 1;
  margin: 0;
  font-size: var(--font-size-headline);
  line-height: var(--font-height-headline);
  font-weight: 500;
}
.productsList__title::after, .productsList__title::before {
  content: "";
  display: inline-block;
  height: 3px;
  background-color: var(--primary-color);
  border-radius: 5px;
}
.productsList__title::before {
  -webkit-box-flex: 0;
      -ms-flex: 0 0 var(--gap-2);
          flex: 0 0 var(--gap-2);
  margin: 0 10px 0 0;
}
@media (max-width: 767.98px) {
  .productsList__title::before {
    -webkit-box-flex: 0;
        -ms-flex: 0 0 var(--gap);
            flex: 0 0 var(--gap);
  }
}
.productsList__title::after {
  -webkit-box-flex: 1;
      -ms-flex: 1 0 var(--gap-2);
          flex: 1 0 var(--gap-2);
  margin: 0 0 0 10px;
}
@media (max-width: 767.98px) {
  .productsList__title::after {
    -webkit-box-flex: 1;
        -ms-flex: 1 0 var(--gap);
            flex: 1 0 var(--gap);
  }
}
@media (max-width: 991.98px) {
  .productsList__title {
    font-size: var(--font-size-big);
  }
}
.productsList__grid {
  display: grid;
  grid-template-columns: repeat(auto-fill, minmax(290px, 1fr));
  gap: var(--gap-2);
  padding: 0;
}
@media (max-width: 767.98px) {
  .productsList__grid {
    grid-template-columns: repeat(auto-fill, minmax(160px, 1fr));
    gap: var(--gap);
  }
}
.productsList__item {
  border-radius: var(--radius);
}

@media (max-width: 767.98px) {
  .productsSlider__container {
    margin: 0 calc(var(--gap) * -1) calc(var(--gap) * -1) calc(var(--gap) * -1);
    overflow-y: visible;
  }
}
.productsSlider__wrapper {
  padding: calc(var(--gap) / 3) 0 var(--gap);
}
@media (max-width: 767.98px) {
  .productsSlider__wrapper {
    -webkit-transform: none !important;
            transform: none !important;
    -ms-overflow-style: none;
    scrollbar-width: none;
    -webkit-overflow-scrolling: touch;
    -ms-scroll-snap-type: x mandatory;
        scroll-snap-type: x mandatory;
    overflow-x: auto;
    overflow-y: hidden;
  }
  .productsSlider__wrapper::-webkit-scrollbar {
    display: none;
  }
}
.productsSlider__item {
  height: auto;
}
@media (max-width: 767.98px) {
  .productsSlider__item {
    width: 30vw;
    padding-right: var(--gap);
    scroll-snap-align: center;
  }
  .productsSlider__item:first-child {
    margin-left: var(--gap);
  }
}
@media (max-width: 575.98px) {
  .productsSlider__item {
    width: 46vw;
  }
}
@media (max-width: 767.98px) {
  .productsSlider__pagination {
    display: none;
  }
}

.productDetail {
    margin-bottom: var(--gap-big);
}
.productDetail__layout {
    display: -webkit-box;
    display: -ms-flexbox;
    display: flex;
    -webkit-column-gap: calc(var(--gap-2) * 2);
    -moz-column-gap: calc(var(--gap-2) * 2);
    column-gap: calc(var(--gap-2) * 2);
    row-gap: var(--gap-2);
}
@media (max-width: 767.98px) {
    .productDetail__layout {
        flex-direction: column;
    }
}
.productDetail__picture {
    position: sticky;
    top: var(--sticky-offset);
    width: 40%;
    height: 480px;
    overflow: hidden;
    border-radius: var(--radius);
    z-index: 2;
    opacity: 0;
    visibility: hidden;
    -webkit-animation: fadeIn var(--speed) both;
    animation: fadeIn var(--speed) both;
}
@media (max-width: 767.98px) {
    .productDetail__picture {
        position: relative;
        width: 100%;
        height: 300px;
        object-fit: cover;
        top: unset;
    }
}
.productDetail__description-title{
    font-size: var(--font-size-big);
}
.productDetail__nutritional {
    margin: var(--gap) 0;
    background: var(--paper-color);
    border-radius: var(--radius);
    padding: var(--gap-1-5);
}
.productDetail__nutritional .productNutritional{
  border-bottom: 0;
  padding-bottom: 0;
}
.productDetail__description-item{
    font-size: 1.2rem;
    line-height: 1.2;
}

.productDetail__actions .btn {
    width: auto;
}

.productDetail__actions .btn:hover{

}
.productDetail__actions {
    display: -webkit-box;
    display: -ms-flexbox;
    display: flex;
    -webkit-box-pack: justify;
    -ms-flex-pack: justify;
    justify-content: flex-start;
    -webkit-box-align: center;
    -ms-flex-align: center;
    align-items: center;
    gap: var(--gap);
    margin-bottom: var(--gap);
    column-gap: var(--gap-big);
}
.productDetail__info-group{

}
.productDetail__content{
    width: 45%;
}
@media (max-width: 767.98px) {
    .productDetail__content {
        width: 100%;
    }
}

.productDetail__content .productDetail__counter{
    padding: 0 0.5rem;
}

.productDetail__content .productModifier__item{
    -webkit-transition: var(--speed);
    transition: var(--speed);
}

.productDetail__content .productModifier--wd-list_image .productModifier__item:hover, .productDetail__content .productModifier--wd-list_no_image .productModifier__item:hover{
    padding: 0 0.5rem;
    -webkit-transition: var(--speed);
    transition: var(--speed);
}

.productDetail__content .product__stepper .btn--square {
    border-radius: var(--radius); 
}
    
.productDetail__content .product__stepper{
    background: var(--secondary-color);
}
.productDetail__content .btn__label, .productDetail__content .js-qty-value{
    color: var(--fill-btn-color);
    font-weight: 500;
    font-variation-settings: normal;
}

.productDetail__price-big{
    font-weight: 500;
    font-variation-settings: normal;
    font-size: 2.7rem;
    line-height: 1;
}
.productDetail__weight-big{
    color: var(--muted-text-color);
}


.card {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  height: 100%;
  background-color: var(--paper-color);
  border-radius: var(--radius);
  overflow: hidden;
  -webkit-transition: var(--speed);
  transition: var(--speed);
  z-index: 2;
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
}
.card--sold {
  opacity: 0.4;
}
.card__header {
  position: relative;
  overflow: hidden;
  -webkit-box-flex: 1;
      -ms-flex-positive: 1;
          flex-grow: 1;
  cursor: pointer;
  -webkit-transition: background-color var(--speed);
  transition: background-color var(--speed);
}
.card__header:hover {
  background-color: var(--focus-highlight);
}
.card__picture {
  position: relative;
  display: block;
  overflow: hidden;
  background-color: var(--focus-highlight);
}
.card__picture--square {
  padding-top: 100%;
}
.card__picture--horizontal {
  padding-top: 56.25%;
}
.card__picture--vertical {
  padding-top: 125%;
}
.card__chips {
  position: absolute;
  left: 1rem;
  top: 1rem;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
      flex-wrap: wrap;
  z-index: 3;
  pointer-events: none;
}
@media (max-width: 767.98px) {
  .card__chips {
    left: 0.5rem;
    top: 0.5rem;
  }
}
.card__text {
  padding: 0.8rem;
}
@media (max-width: 767.98px) {
  .card__text {
    padding: 0.5rem;
  }
}
.card__title {
  display: -webkit-box;
  -webkit-line-clamp: 2;
  -webkit-box-orient: vertical;
  font-size: var(--font-size-medium);
  line-height: 1.3;
  font-weight: 500;
  color: var(--main-text-color);
  overflow: hidden;
  text-overflow: ellipsis;
}
@media (max-width: 767.98px) {
  .card__title {
    font-size: var(--font-size-base);
  }
}
.card__size {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  color: var(--muted-text-color);
}
@media (max-width: 767.98px) {
  .card__size {
    font-size: var(--font-size-small);
  }
}
.card__price {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  font-size: 1.3em;
  font-weight: 500;
  color: var(--main-text-color);
}
@media (max-width: 767.98px) {
  .card__price {
    display: none;
  }
}
.card__divider {
  height: 1px;
  background-color: var(--border-color);
}
.card__footer {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: justify;
      -ms-flex-pack: justify;
          justify-content: space-between;
  padding: 0.8rem;
}
@media (max-width: 767.98px) {
  .card__footer {
    padding: 0.5rem;
  }
}
@media (max-width: 767.98px) {
  .card__button {
    width: 100%;
  }
}
.card__actions {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
}
@media (max-width: 767.98px) {
  .card__actions {
    -webkit-box-flex: 1;
        -ms-flex: 1;
            flex: 1;
    -webkit-box-pack: center;
        -ms-flex-pack: center;
            justify-content: center;
  }
}
.card__dropdown {
  margin-left: 0.5rem;
}
.card__counter {
  position: absolute;
  top: 0;
  right: 0;
  bottom: 0;
  left: 0;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  background-color: rgba(0, 0, 0, 0.65);
  color: var(--switcher);
  font-size: var(--font-size-headline);
  -webkit-transition: var(--speed);
  transition: var(--speed);
  opacity: 0;
  visibility: hidden;
  z-index: 2;
}
.card__counter--show {
  opacity: 1;
  visibility: visible;
}
.card__stepper {
  display: none;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: justify;
      -ms-flex-pack: justify;
          justify-content: space-between;
  -ms-flex-preferred-size: 100%;
      flex-basis: 100%;
  height: var(--button-size);
  background-color: var(--primary-color);
  border-radius: var(--radius);
}
@media (min-width: 768px) {
  .card__stepper {
    gap: var(--gap);
  }
}
.card__stepper-price {
  font-size: var(--font-size-medium);
  line-height: var(--font-size-medium);
  color: var(--fill-btn-color);
  font-weight: 500;
}
@media (min-width: 768px) {
  .card__stepper-price {
    display: none;
  }
}
.card__stepper--light {
  background-color: var(--default-color);
}
.card__stepper--light .card__stepper-price {
  color: var(--main-text-color);
}
.card__stepper--light .btn {
  color: var(--main-text-color);
}

.special {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  -ms-flex-negative: 0;
      flex-shrink: 0;
  height: 100%;
  overflow: hidden;
  background-color: var(--paper-color);
  border-radius: var(--radius);
  -webkit-transition: var(--speed);
  transition: var(--speed);
  z-index: 2;
  cursor: pointer;
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
}
.special__header {
  position: relative;
  overflow: hidden;
}
.special__picture {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  overflow: hidden;
  padding-top: 62%;
}
.special__body {
  padding: var(--gap);
  -webkit-box-flex: 1;
      -ms-flex: 1;
          flex: 1;
}
.special__title {
  font-size: var(--font-size-medium);
  line-height: 1.3;
  font-weight: 500;
  color: var(--main-text-color);
  overflow: hidden;
  text-overflow: ellipsis;
  display: -webkit-box;
  -webkit-line-clamp: 2;
  -webkit-box-orient: vertical;
}
@media (max-width: 767.98px) {
  .special__title {
    font-size: var(--font-size-base);
  }
}

.specialsList {
  position: relative;
}
.specialsList__grid {
  display: grid;
  grid-template-columns: repeat(auto-fill, minmax(350px, 1fr));
  gap: var(--gap-2);
  padding: 0;
}
@media (max-width: 991.98px) {
  .specialsList__grid {
    grid-template-columns: repeat(auto-fill, minmax(290px, 1fr));
    gap: var(--gap);
  }
}

.specialsSlider {
  position: relative;
}
.specialsSlider__container {
  min-width: 1px;
  -webkit-box-flex: 1;
      -ms-flex-positive: 1;
          flex-grow: 1;
  max-height: 500px;
}
@media (max-width: 767.98px) {
  .specialsSlider__container {
    margin: 0 calc(var(--gap) * -1) calc(var(--gap) * -1) calc(var(--gap) * -1);
  }
}
.specialsSlider__wrapper {
  padding: calc(var(--gap) / 3) 0 var(--gap);
}
@media (max-width: 767.98px) {
  .specialsSlider__wrapper {
    -webkit-transform: none !important;
            transform: none !important;
    -ms-overflow-style: none;
    scrollbar-width: none;
    -webkit-overflow-scrolling: touch;
    -ms-scroll-snap-type: x mandatory;
        scroll-snap-type: x mandatory;
    overflow-x: auto;
    overflow-y: hidden;
  }
  .specialsSlider__wrapper::-webkit-scrollbar {
    display: none;
  }
}
.specialsSlider__item {
  height: auto;
}
@media (max-width: 767.98px) {
  .specialsSlider__item {
    width: 75vw;
    padding-right: var(--gap);
    scroll-snap-align: center;
  }
  .specialsSlider__item:first-child {
    margin-left: var(--gap);
  }
  .specialsSlider__item:only-child {
    width: 96vw;
  }
}
@media (max-width: 767.98px) {
  .specialsSlider__pagination {
    display: none;
  }
}

.promotion {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  height: 100%;
  overflow: hidden;
}
.promotion--page {
  max-width: 950px;
  margin: 0 auto;
}
.promotion__content {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  max-height: calc(100vh - var(--gap-big) * 2);
}
.promotion__picture {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  overflow: hidden;
  padding-top: 62%;
  border-radius: var(--radius);
  z-index: 2;
}
.promotion__info {
  padding: var(--gap) var(--gap-2) var(--gap-2) var(--gap-2);
  overflow-y: auto;
  overflow-x: hidden;
}
@media (max-width: 767.98px) {
  .promotion__info {
    padding: var(--gap) var(--gap) calc(var(--gap) + var(--safe-bottom));
  }
}
.promotion__header {
  margin-bottom: var(--gap);
}
.promotion__title {
  font-size: var(--font-size-bigger);
  text-align: center;
  margin-bottom: var(--gap);
}
.promotion__code {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
}
.promotion__code-field {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  height: var(--button-size);
  min-width: 80px;
  font-size: var(--font-size-bigger);
  border: 2px solid var(--primary-color);
  border-radius: var(--radius) 0 0 var(--radius);
  padding: 0 calc(var(--gap) + var(--button-size) / 2) 0 var(--gap);
  margin-right: calc(var(--button-size) / -2);
  -webkit-user-select: text;
     -moz-user-select: text;
      -ms-user-select: text;
          user-select: text;
}

.promo {
  position: relative;
  overflow: hidden;
  margin: var(--gap-2) 0 var(--gap-big) 0;
}
@media (max-width: 767.98px) {
  .promo {
    margin: var(--gap) 0;
  }
}
@media (max-width: 767.98px) {
  .promo__slider {
    overflow: visible;
  }
}
.promo__wrapper {
  padding: calc(var(--gap) / 3) 0 var(--gap);
}
@media (max-width: 767.98px) {
  .promo__wrapper {
    overflow: visible;
  }
}
.promo__item {
  position: relative;
  border-radius: var(--radius);
  overflow: hidden;
  z-index: 2;
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
}
.promo__content {
  position: relative;
  overflow: hidden;
  cursor: pointer;
}
.promo__picture {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  padding-top: 35%;
}
@media (max-width: 767.98px) {
  .promo__picture {
    padding-top: 62%;
  }
}
.promo__arrow {
  position: absolute;
  top: calc(47% - 60px);
  width: 48px;
  height: 120px;
  z-index: 5;
  -webkit-transition: var(--speed);
  transition: var(--speed);
  cursor: pointer;
}
@media (max-width: 767.98px) {
  .promo__arrow {
    display: none;
  }
}
.promo__arrow--prev {
  left: 0;
}
.promo__arrow--prev.promo__arrow--disabled {
  left: -48px;
}
.promo__arrow--next {
  right: 0;
}
.promo__arrow--next.promo__arrow--disabled {
  right: -48px;
}
.promo__arrow--disabled {
  opacity: 0;
  visibility: hidden;
}
.promo__arrow-icon {
  stroke-width: 0;
}

.product {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-flex: 1;
      -ms-flex: 1 1 auto;
          flex: 1 1 auto;
  height: 100%;
  overflow: hidden;
}
@media (max-width: 767.98px) {
  .product {
    -webkit-box-orient: vertical;
    -webkit-box-direction: normal;
        -ms-flex-direction: column;
            flex-direction: column;
    overflow-y: auto;
    overflow-x: hidden;
    -ms-overflow-style: none;
    scrollbar-width: none;
    -webkit-overflow-scrolling: touch;
  }
  .product::-webkit-scrollbar {
    display: none;
  }
}
.product__picture {
  position: relative;
  width: 550px;
  height: 550px;
  overflow: hidden;
  border-radius: var(--radius);
  z-index: 2;
  opacity: 0;
  visibility: hidden;
  -webkit-animation: fadeIn var(--speed) both;
          animation: fadeIn var(--speed) both;
}
@media (max-width: 767.98px) {
  .product__picture {
    width: 100%;
    height: auto;
    padding-top: 100%;
  }
}
.product__chips {
  position: absolute;
  left: var(--gap);
  top: var(--gap);
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  z-index: 3;
  pointer-events: none;
}
.product__content {
  max-height: 550px;
  min-width: 400px;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  -webkit-box-flex: 1;
      -ms-flex: 1;
          flex: 1;
  overflow: hidden;
  opacity: 0;
  visibility: hidden;
  -webkit-animation: fadeIn var(--speed) both;
          animation: fadeIn var(--speed) both;
}
@media (max-width: 767.98px) {
  .product__content {
    max-height: -webkit-max-content;
    max-height: -moz-max-content;
    max-height: max-content;
    min-width: auto;
    overflow: visible;
  }
}
.product__header {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  min-height: 62px;
  padding: var(--gap) 4rem var(--gap) 2rem;
  border-radius: 0 0 var(--radius) var(--radius);
  -webkit-box-shadow: 0 0 2px 2px var(--shadow-first), 0 0 7px 7px var(--shadow-second);
          box-shadow: 0 0 2px 2px var(--shadow-first), 0 0 7px 7px var(--shadow-second);
}
@media (max-width: 767.98px) {
  .product__header {
    -webkit-box-orient: horizontal;
    -webkit-box-direction: reverse;
        -ms-flex-direction: row-reverse;
            flex-direction: row-reverse;
    padding: var(--gap);
    border-bottom: 1px solid var(--border-color);
    border-radius: 0;
    -webkit-box-shadow: none;
            box-shadow: none;
  }
}
.product__favourite {
  margin: 0 calc(var(--gap) / 2) 0 0;
}
@media (max-width: 767.98px) {
  .product__favourite {
    margin: 0 0 0 calc(var(--gap) / 2);
  }
}
.product__favourite-button {
  width: 35px;
  height: 35px;
}
.product__favourite-button--selected {
  color: var(--favourite);
  color: #EC407A;
}
.product__favourite-button--selected .btn__svg {
  fill: currentColor;
}
.product__title {
  -webkit-box-flex: 1;
      -ms-flex-positive: 1;
          flex-grow: 1;
  font-size: var(--font-size-big);
  line-height: var(--line-height-title);
  color: var(--main-text-color);
  font-weight: 500;
}
@media (max-width: 767.98px) {
  .product__title {
    font-size: var(--font-size-medium);
  }
}
.product__size {
  color: var(--muted-text-color);
  white-space: nowrap;
}
.product__info {
  -webkit-box-flex: 1;
      -ms-flex: 1;
          flex: 1;
  overflow-y: auto;
  overflow-x: hidden;
}
@media (max-width: 767.98px) {
  .product__info {
    overflow: visible;
  }
}
.product__nutritional {
  padding: 0 var(--gap-2);
  margin: var(--gap) 0;
}
@media (max-width: 767.98px) {
  .product__nutritional {
    padding: 0 var(--gap);
  }
}
.product__description {
  padding: 0 var(--gap-2);
  margin: var(--gap) 0;
}
@media (max-width: 767.98px) {
  .product__description {
    padding: 0 var(--gap);
  }
}
.product__description-item {
  line-height: var(--line-height-tiny);
  padding-bottom: var(--gap);
}
@media (max-width: 767.98px) {
  .product__description-item {
    font-size: var(--font-size-small);
  }
}
.product__description-item:last-child {
  border-bottom: 1px solid var(--border-color);
}
.product__modifier {
  margin: var(--gap) 0;
}
.product__actions {
  position: sticky;
  bottom: 0;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  width: 100%;
  background-color: var(--paper-color);
  padding: var(--gap) var(--gap-2) 13px;
  border-radius: var(--radius) var(--radius) 0 0;
  -webkit-box-shadow: 0 0 2px 2px var(--shadow-first), 0 0 7px 7px var(--shadow-second);
          box-shadow: 0 0 2px 2px var(--shadow-first), 0 0 7px 7px var(--shadow-second);
}
@media (max-width: 767.98px) {
  .product__actions {
    padding: var(--gap) var(--gap) calc(var(--gap) + var(--safe-bottom)) var(--gap);
  }
}
.product__price {
  display: -webkit-inline-box;
  display: -ms-inline-flexbox;
  display: inline-flex;
  margin: 0 3px;
}
.product__stepper {
  display: none;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  border-radius: var(--radius);
  background-color: var(--primary-color);
}
.product__counter {
  text-align: center;
  min-width: 130px;
  font-size: var(--font-size-big);
  line-height: var(--font-size-big);
  color: var(--fill-btn-color);
  font-weight: 500;
}

.productNutritional {
  position: relative;
  border-bottom: 1px solid var(--border-color);
  padding-bottom: var(--gap);
}
.productNutritional__title {
  margin-bottom: calc(var(--gap) / 3);
}
@media (max-width: 767.98px) {
  .productNutritional__title {
    font-size: var(--font-size-small);
  }
}
.productNutritional__list {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: justify;
      -ms-flex-pack: justify;
          justify-content: space-between;
}
.productNutritional__label {
  font-size: var(--font-size-tiny);
  color: var(--muted-text-color);
}

.productModifier {
  position: relative;
}
.productModifier--disabled {
  opacity: 0.25;
}
.productModifier--disabled::before {
  content: "";
  position: absolute;
  display: block;
  top: 0;
  bottom: 0;
  right: 0;
  left: 0;
  z-index: 15;
  cursor: not-allowed;
  -webkit-transition: var(--speed);
  transition: var(--speed);
}
.productModifier__set {
  margin-bottom: var(--gap);
  padding: 0 var(--gap-2);
}
.productModifier__set:last-of-type {
  margin-bottom: calc(var(--gap) / 2);
}
.productDetail .productModifier__set {
  margin-bottom: var(--gap-1-5);
  padding: 0;
}
.productModifier__title {
  font-size: var(--font-size-medium);
  margin-bottom: calc(var(--gap) / 2);
  color: var(--muted-text-color);
}
@media (max-width: 767.98px) {
  .productModifier__set {
    padding: 0 var(--gap);
  }
}
.modifier-label{
  display:flex;
  justify-content: space-between;
  margin:0;
}
.productModifier--wd-tile_image .modifier-label{
  flex-direction: column;
}
.modifier-label div:nth-child(2){
  width:50px;
  text-align: right;
}
.productModifier--wd-tile_image .modifier-label div{
  text-align: center;
  width: 100%;
}
.productModifier__maxsize {
    font-size: var(--font-size-small);
}
.productModifier--wd-tile_image .productModifier__img {
    border: 4px solid transparent;
    border-radius: var(--radius);
    transition: border-color .3s ease;
}
.productModifier--wd-tile_image .productModifier__item label:has(input:checked) .productModifier__img {
    border-color: var(--primary-color);
}
.productModifier--wd-list_image .productModifier__img {
    width: 60px;
    height: 60px;
    border-radius: 5px;
    object-fit: cover;
}
.productModifier .radio--listed, .productModifier .checkbox--listed {
    align-items: center;
    column-gap: 1rem;
    padding: calc(var(--gap) / 2) 0;
}
.productModifier--wd-tile_image .productModifier__set {
  display: grid;
  grid-template-columns: repeat(auto-fill, minmax(120px, 1fr));
  gap: 12px;
}
.productModifier--wd-tile_image .productModifier__title, .productModifier--wd-tile_image .productModifier__maxsize{
  grid-column: 1 / -1;
  margin-bottom: 0;
}
.productModifier--wd-tile_image .productModifier__item .radio__label, .productModifier--wd-tile_image .productModifier__item .checkbox__label {
  margin: 0;
}
.productModifier--wd-tile_image .productModifier__img{
  width: 100%;
  aspect-ratio: 1 / 1;
  object-fit: cover;
}
.productModifier--wd-tile_image .productModifier__item .radio--listed, .productModifier--wd-tile_image .productModifier__item .checkbox--listed{
  display: flex;
  flex-direction: column;
  padding: 0;
}
.productModifier--wd-tile_image .productModifier__item .radio--listed .radio__control, .productModifier--wd-tile_image .productModifier__item .checkbox--listed .checkbox__control{
  display: none;
}
@media (max-width: 768px) {
  .productModifier--wd-tile_image .productModifier__item {
    flex-basis: calc((100% - 12px) / 2);
    max-width: calc((100% - 12px) / 2);
  }
}
@media (max-width: 480px) {
  .productModifier--wd-tile_image .productModifier__item {
    flex-basis: 100%;
    max-width: 100%;
  }
}
.product__suggestions {
  padding: 0 var(--gap-2);
  margin: var(--gap) 0 0;
}
@media (max-width: 767.98px) {
  .product__suggestions {
    padding: 0 var(--gap);
  }
}
.product__suggestions-header {
  margin: 0 0 var(--gap);
}
.product__suggestions-header-title {
  font-size: var(--font-size-medium);
  font-weight: 500;
  color: var(--muted-text-color);
}
@media (min-width: 768px) {
  .product__suggestions .productsSlider__item {
    width: calc((100% - 16px) / 3);
    max-width: 220px;
  }
}
.product__suggestions .card__footer {
  -webkit-box-pack: end;
      -ms-flex-pack: end;
          justify-content: flex-end;
}
.product__suggestions .card__actions {
  width: 100%;
}
.product__suggestions .card__button {
  width: 100%;
  color: #fff;
}

.cart {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
}
.cart__empty {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  gap: var(--gap);
  max-width: 360px;
  margin: var(--gap) auto;
}
.cart__empty-icon {
  width: 90px;
  stroke: none;
  fill: var(--primary-color);
  margin-bottom: var(--gap);
}
.cart__empty-text {
  text-align: center;
}
.cart__layout {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  margin-bottom: var(--gap);
}
@media (max-width: 991.98px) {
  .cart__layout {
    -webkit-box-orient: vertical;
    -webkit-box-direction: normal;
        -ms-flex-direction: column;
            flex-direction: column;
  }
}
.cart__content {
  -webkit-box-flex: 1;
      -ms-flex: 1;
          flex: 1;
  margin: 0 var(--gap-2) 0 0;
  min-width: 0;
}
@media (max-width: 991.98px) {
  .cart__content {
    margin: 0 0 var(--gap-2) 0;
  }
}
.cart__header {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: justify;
      -ms-flex-pack: justify;
          justify-content: space-between;
  margin-bottom: var(--gap-2);
}
.cart__label {
  -webkit-box-flex: 1;
      -ms-flex-positive: 1;
          flex-grow: 1;
  font-size: var(--font-size-legend);
  margin-right: var(--gap);
}
@media (max-width: 767.98px) {
  .cart__label {
    font-size: var(--font-size-medium);
  }
}
.cart__list {
  overflow: hidden;
}
.cart__suggestions {
  margin: var(--gap-2) 0 0;
}
.cart__suggestions-header {
  margin: 0 0 var(--gap);
}
.cart__suggestions-header__title {
  position: relative;
  margin: 0;
  font-size: var(--font-size-title);
  line-height: var(--font-size-title);
  font-weight: 500;
}
@media (max-width: 991.98px) {
  .cart__suggestions-header__title {
    font-size: var(--font-size-medium);
  }
}
.cart__sidebar {
  position: sticky;
  top: var(--sticky-offset);
  width: var(--sidebar-width);
  height: -webkit-fit-content;
  height: -moz-fit-content;
  height: fit-content;
}
@media (max-width: 991.98px) {
  .cart__sidebar {
    width: auto;
  }
}

.cartProduct {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
}
.cartProduct:not(:last-child) {
  border-bottom: 1px dashed var(--border-color);
  padding-bottom: var(--gap);
  margin-bottom: var(--gap);
}
.cartProduct--gift {
  padding-right: calc(var(--gap) + 40px);
}
@media (max-width: 767.98px) {
  .cartProduct--gift {
    padding-right: 0;
  }
}
.cartProduct__content {
  position: relative;
  -webkit-box-flex: 1;
      -ms-flex: 1;
          flex: 1;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: justify;
      -ms-flex-pack: justify;
          justify-content: space-between;
  overflow: hidden;
}
@media (min-width: 992px) and (max-width: 1199.98px) {
  .cartProduct__content {
    -ms-flex-wrap: wrap;
        flex-wrap: wrap;
  }
}
@media (max-width: 767.98px) {
  .cartProduct__content {
    -ms-flex-wrap: wrap;
        flex-wrap: wrap;
  }
}
.cartProduct__picture {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-flex: 0;
      -ms-flex: 0 0 auto;
          flex: 0 0 auto;
  width: 120px;
  height: 120px;
  background-color: var(--layout-color);
  border-radius: var(--radius);
  margin-right: var(--gap);
  overflow: hidden;
  z-index: 2;
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 3px 8px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 3px 8px var(--shadow-second);
}
@media (max-width: 991.98px) {
  .cartProduct__picture {
    width: 70px;
    height: 70px;
  }
}
@media (max-width: 767.98px) {
  .cartProduct__picture {
    width: 50px;
    height: 50px;
    border-radius: calc(var(--radius) / 1.5);
  }
}
.cartProduct--soldout .cartProduct__picture::before {
  content: "";
  position: absolute;
  top: 0;
  bottom: 0;
  right: 0;
  left: 0;
  background-color: var(--paper-color-transparent);
  z-index: 15;
}
.cartProduct__info {
  position: relative;
  margin: 0 var(--gap) 0 0;
  overflow: hidden;
}
@media (max-width: 1399.98px) {
  .cartProduct__info {
    margin: 0 0 var(--gap) 0;
  }
}
.cartProduct--soldout .cartProduct__info::before {
  content: "";
  position: absolute;
  top: 0;
  bottom: 0;
  right: 0;
  left: 0;
  background-color: var(--paper-color-transparent);
  z-index: 15;
}
.cartProduct__name {
  display: -webkit-box;
  font-size: var(--font-size-bigger);
  font-weight: 500;
  line-height: 1.3;
  color: var(--main-text-color);
  margin-bottom: var(--gap);
  overflow: hidden;
  -webkit-line-clamp: 2;
  -webkit-box-orient: vertical;
}
@media (max-width: 767.98px) {
  .cartProduct__name {
    font-size: var(--font-size-medium);
    text-overflow: ellipsis;
  }
}
@media (max-width: 575.98px) {
  .cartProduct__name {
    margin-bottom: calc(var(--gap) / 2);
    padding-right: calc(var(--button-size));
  }
}
.cartProduct__name-size {
  color: var(--muted-text-color);
  white-space: nowrap;
}
.cartProduct__modificators {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
      flex-wrap: wrap;
  padding: 3px;
}
.cartProduct__additional {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
      flex-wrap: wrap;
}
@media (max-width: 767.98px) {
  .cartProduct__additional {
    -webkit-box-orient: vertical;
    -webkit-box-direction: normal;
        -ms-flex-direction: column;
            flex-direction: column;
  }
}
.cartProduct__ingredient {
  font-size: var(--font-size-small);
  color: var(--muted-text-color);
}
@media (min-width: 768px) {
  .cartProduct__ingredient:not(:first-child)::before {
    content: "•";
    display: inline-block;
    margin: 0 4px;
  }
}
.cartProduct__message {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  font-size: var(--font-size-bigger);
  line-height: var(--button-size);
}
.cartProduct__total {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: justify;
      -ms-flex-pack: justify;
          justify-content: space-between;
  min-width: 260px;
  height: -webkit-max-content;
  height: -moz-max-content;
  height: max-content;
}
@media (max-width: 575.98px) {
  .cartProduct__total {
    min-width: auto;
    -ms-flex-preferred-size: 100%;
        flex-basis: 100%;
  }
}
.cartProduct__price {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  font-size: var(--font-size-legend);
  line-height: var(--button-size);
  white-space: nowrap;
  width: 110px;
  margin-left: var(--gap);
}
@media (max-width: 767.98px) {
  .cartProduct__price {
    width: auto;
  }
}
.cartProduct__remove {
  margin-left: var(--gap);
}
@media (max-width: 575.98px) {
  .cartProduct__remove {
    position: absolute;
    top: -5px;
    right: -5px;
    margin: 0;
    z-index: 20;
  }
}
@media (max-width: 767.98px) {
  .cartProduct__button {
    width: calc(var(--button-size) * 0.8);
    height: calc(var(--button-size) * 0.8);
  }
}

.checkout {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
}
.checkout__auth {
  margin: 0 0 var(--gap-2);
}
@media (min-width: 768px) {
  .checkout__auth {
    padding: var(--gap-2);
  }
}
.checkout__form {
  position: relative;
}
.checkout__form--disabled {
  opacity: 0.25;
}
.checkout__form--disabled::before {
  content: "";
  position: absolute;
  top: calc(var(--gap) * -1);
  bottom: calc(var(--gap) * -1);
  right: calc(var(--gap) * -1);
  left: calc(var(--gap) * -1);
  display: block;
  z-index: 15;
  cursor: not-allowed;
  -webkit-transition: var(--speed);
  transition: var(--speed);
}
.checkout__layout {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  margin-bottom: var(--gap);
}
@media (max-width: 991.98px) {
  .checkout__layout {
    -webkit-box-orient: vertical;
    -webkit-box-direction: normal;
        -ms-flex-direction: column;
            flex-direction: column;
  }
}
.checkout__content {
  -webkit-box-flex: 1;
      -ms-flex: 1;
          flex: 1;
  margin: 0 var(--gap-2) 0 0;
}
@media (max-width: 991.98px) {
  .checkout__content {
    margin: 0 0 var(--gap-2) 0;
  }
}
.checkout__header {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: justify;
      -ms-flex-pack: justify;
          justify-content: space-between;
  margin-bottom: var(--gap-2);
}
.checkout__label {
  -webkit-box-flex: 1;
      -ms-flex-positive: 1;
          flex-grow: 1;
  font-size: var(--font-size-legend);
  margin-right: var(--gap);
}
@media (max-width: 767.98px) {
  .checkout__label {
    font-size: var(--font-size-medium);
  }
}
.checkout__step:not(:last-child) {
  margin-bottom: var(--gap-2);
}
@media (min-width: 768px) {
  .checkout__step {
    padding: var(--gap-2);
  }
}
.checkout__sidebar {
  position: sticky;
  top: var(--sticky-offset);
  width: var(--sidebar-width);
  height: -webkit-fit-content;
  height: -moz-fit-content;
  height: fit-content;
}
@media (max-width: 991.98px) {
  .checkout__sidebar {
    width: auto;
  }
}

.checkoutAuth {
  position: relative;
}
.checkoutAuth__form {
  max-width: 350px;
}
.checkoutAuth__text {
  margin-left: var(--gap-2);
}

.checkoutStep {
  position: relative;
}
.checkoutStep__header {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  margin-bottom: var(--gap-2);
}
@media (max-width: 767.98px) {
  .checkoutStep__header {
    margin-bottom: var(--gap);
  }
}
.checkoutStep__icon {
  height: 25px;
  width: 25px;
  color: var(--primary-color);
  margin-right: var(--gap);
}
@media (max-width: 767.98px) {
  .checkoutStep__icon {
    height: 22px;
    width: 22px;
  }
}
.checkoutStep__title {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  font-size: var(--font-size-legend);
  font-weight: 500;
}
@media (max-width: 767.98px) {
  .checkoutStep__title {
    font-size: var(--font-size-medium);
  }
}
.checkoutStep__chip {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  margin-left: var(--gap);
}
.checkoutStep__hidden {
  display: none;
  margin-top: var(--gap-2);
}
.checkoutStep__hidden--show {
  display: block;
}
.checkoutStep__receiving {
  margin-bottom: var(--gap-2);
}

.checkoutSuccess {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  max-width: 500px;
  margin: 0 auto;
  text-align: center;
}
.checkoutSuccess__title {
  font-size: var(--font-size-bigger);
}
.checkoutSuccess__icon {
  margin-top: var(--gap);
  width: 50px;
  height: 50px;
  stroke: var(--success);
  stroke-width: 10;
  opacity: 0;
  -webkit-transform: scale(0.8);
          transform: scale(0.8);
  -webkit-transform-origin: center;
          transform-origin: center;
  -webkit-animation: confirmCheck 0.15s 1.1s both;
          animation: confirmCheck 0.15s 1.1s both;
}
.checkoutSuccess__text {
  margin-top: var(--gap);
}
.checkoutSuccess__actions {
  margin-top: var(--gap);
}
.checkoutSuccess__payment {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  margin-top: var(--gap);
  padding-top: var(--gap);
  border-top: 1px solid var(--border-color);
}
.checkoutSuccess__payment-action {
  margin-top: var(--gap);
}

@-webkit-keyframes confirmCheck {
  to {
    opacity: 1;
    -webkit-transform: scale(1);
            transform: scale(1);
  }
}

@keyframes confirmCheck {
  to {
    opacity: 1;
    -webkit-transform: scale(1);
            transform: scale(1);
  }
}
.order {
  cursor: pointer;
}
.order:not(:last-child) {
  margin-bottom: var(--gap);
}
.order__content {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: start;
      -ms-flex-align: start;
          align-items: flex-start;
}
@media (max-width: 767.98px) {
  .order__content {
    -webkit-box-orient: vertical;
    -webkit-box-direction: normal;
        -ms-flex-direction: column;
            flex-direction: column;
  }
}
.order__label {
  -webkit-box-flex: 1;
      -ms-flex: 1 1 0px;
          flex: 1 1 0;
  line-height: 22px;
  margin: 0 var(--gap) 0 0;
}
@media (max-width: 767.98px) {
  .order__label {
    margin: 0 0 calc(var(--gap) / 2) 0;
  }
}
.order__status {
  padding: 0 calc(var(--gap) / 2);
  border-radius: var(--radius);
  color: var(--switcher);
}
.order__status--accepted {
  background-color: var(--border-color);
}
.order__status--await {
  background-color: var(--info);
}
.order__status--success {
  background-color: var(--success);
}
.order__status--canceled {
  background-color: var(--danger);
}
.order__status--onway {
  background-color: var(--warning);
}

.orderCheck {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  gap: var(--gap-big);
}
@media (max-width: 767.98px) {
  .orderCheck {
    -webkit-box-orient: vertical;
    -webkit-box-direction: normal;
        -ms-flex-flow: column;
            flex-flow: column;
    gap: var(--gap);
  }
}
@media (min-width: 768px) {
  .orderCheck__main {
    -webkit-box-flex: 1;
        -ms-flex-positive: 1;
            flex-grow: 1;
    max-height: 550px;
    padding-right: var(--gap);
    overflow-y: auto;
    overflow-x: hidden;
  }
}
.orderCheck__aside {
  -webkit-box-flex: 0;
      -ms-flex: 0 0 340px;
          flex: 0 0 340px;
}
@media (max-width: 991.98px) {
  .orderCheck__aside {
    -ms-flex-preferred-size: 300px;
        flex-basis: 300px;
  }
}
.orderCheck__header {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  height: 60px;
}
.orderCheck__title {
  font-size: var(--font-size-bigger);
  font-weight: 600;
  margin-right: var(--gap-2);
}
@media (max-width: 767.98px) {
  .orderCheck__list {
    border-bottom: 1px solid var(--border-color);
  }
}
.orderCheck__item {
  -ms-flex-preferred-size: 100%;
      flex-basis: 100%;
  padding: var(--gap) 0;
}
.orderCheck__item:first-child, .orderCheck__item:last-child {
  padding-top: 0;
}
.orderCheck__item:not(:last-child) {
  border-bottom: 1px dashed var(--border-color);
}
.orderCheck__item-line {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
}
.orderCheck__item-image {
  position: relative;
  width: 80px;
  height: 80px;
  border-radius: calc(var(--radius) / 1.5);
  overflow: hidden;
  margin-right: 10px;
}
@media (max-width: 767.98px) {
  .orderCheck__item-image {
    width: 60px;
    height: 60px;
  }
}
.orderCheck__item-label {
  -webkit-box-flex: 1;
      -ms-flex: 1 1 0px;
          flex: 1 1 0;
}
.orderCheck__item-quantity {
  color: var(--muted-text-color);
}
.orderCheck__item-cost {
  font-weight: 500;
}
.orderCheck__item-gift, .orderCheck__item-cost {
  min-width: 70px;
  text-align: right;
}
.orderCheck__item-quantity, .orderCheck__item-gift, .orderCheck__item-cost {
  margin-left: calc(var(--gap) / 2);
}
.orderCheck__item-additional {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
      flex-wrap: wrap;
  margin-top: 5px;
}
.orderCheck__item-ingredient {
  font-size: var(--font-size-small);
  color: var(--muted-text-color);
}
.orderCheck__item-ingredient:not(:first-child)::before {
  content: "•";
  display: inline-block;
  margin: 0 4px;
}
.orderCheck__details-block {
  margin-bottom: var(--gap);
}
.orderCheck__details-header {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: justify;
      -ms-flex-pack: justify;
          justify-content: space-between;
  margin-bottom: calc(var(--gap) / 2);
}
.orderCheck__details-status {
  padding: 0 calc(var(--gap) / 2);
  border-radius: var(--radius);
  color: var(--switcher);
}
.orderCheck__details-status--success {
  background-color: var(--success);
}
.orderCheck__details-status--danger {
  background-color: var(--danger);
}
.orderCheck__details-title {
  font-size: var(--font-size-medium);
  font-weight: 500;
}
.orderCheck__details-actions {
  margin-top: calc(var(--gap) / 2);
}
.orderCheck__set {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
}
.orderCheck__set-key {
  -webkit-box-flex: 0;
      -ms-flex: 0 0 180px;
          flex: 0 0 180px;
  color: var(--muted-text-color);
  margin-right: var(--gap);
}
@media (max-width: 767.98px) {
  .orderCheck__set-key {
    -webkit-box-flex: 1;
        -ms-flex: 1 1 0px;
            flex: 1 1 0;
  }
}
.orderCheck__set-value {
  font-variant: 500;
}
.orderCheck__actions {
  padding-top: var(--gap);
  border-top: 1px solid var(--border-color);
}
.orderCheck__actions .btn:not(:last-child) {
  margin: 0 var(--gap) 0 0;
}
@media (max-width: 575.98px) {
  .orderCheck__actions .btn:not(:last-child) {
    margin: 0 0 var(--gap) 0;
  }
}

.currentOrder {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  margin: var(--gap-2) 0;
}
@media (max-width: 767.98px) {
  .currentOrder {
    margin: var(--gap) 0;
  }
}
.auth {
  max-width: 500px;
  margin: 0 auto;
}

.inner-menu__list {
  display: grid;
  grid-template-columns: repeat(auto-fill, minmax(200px, 1fr));
  gap: var(--gap-2);
}
@media (max-width: 767.98px) {
  .inner-menu__list {
    grid-template-columns: 1fr;
    gap: var(--gap);
  }
}
.inner-menu__item {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  background-color: var(--paper-color);
  border-radius: var(--radius);
  -webkit-transition: var(--speed);
  transition: var(--speed);
  padding: 1rem;
  overflow: hidden;
  z-index: 1;
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
}
@media (max-width: 767.98px) {
  .inner-menu__item {
    -webkit-box-orient: horizontal;
    -webkit-box-direction: normal;
        -ms-flex-direction: row;
            flex-direction: row;
  }
}
.inner-menu__icon {
  height: 50px;
  width: 50px;
  margin: 0 0 1rem 0;
}
@media (max-width: 767.98px) {
  .inner-menu__icon {
    width: 25px;
    height: 25px;
    margin: 0 1rem 0 0;
  }
}
@media (max-width: 767.98px) {
  .inner-menu__label {
    -webkit-box-flex: 1;
        -ms-flex-positive: 1;
            flex-grow: 1;
  }
}

.social {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
      flex-wrap: wrap;
  color: var(--switcher);
  margin: 0 -3px;
  padding: 3px 0;
}
.social__item {
  margin: 3px;
}
.social__link {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  width: var(--button-size);
  height: var(--button-size);
  font-size: var(--font-size-medium);
  background-color: var(--social-default-color);
  color: currentColor;
  border-radius: 50%;
  overflow: hidden;
}
.social__link--facebook {
  --social-background: #4267B2;
}
.social__link--instagram {
  --social-background: radial-gradient(circle at 33% 100%, #FED373 4%, #F15245 30%, #D92E7F 62%, #9B36B7 85%, #515ECF);
}
.social__link--tripadvisor {
  --social-background: #1ca875;
}
.social__link--vk {
  --social-background: #2787F5;
}
.social__link--tiktok {
  --social-background: linear-gradient(45deg, #FC0E5C 0%, #2AF5EE 100%);
}
.social__link--ok {
  --social-background: #FF9205;
}
.social__link--yt {
  --social-background: #E62117;
}
.social__link--zen {
  --social-background: #525252;
}
.social__link--telegram {
  --social-background: #27A6E6;
}
.social__link--whatsapp {
  --social-background: #36D670;
}
.social__link::before {
  content: "";
  position: absolute;
  width: 100%;
  height: 100%;
  border-radius: 50%;
  background: var(--social-background);
  -webkit-transition: var(--speed);
  transition: var(--speed);
  opacity: 0;
}
.social__link:hover::before {
  opacity: 1;
}
.social__icon {
  fill: currentColor;
  stroke-width: 0;
  fill-rule: evenodd;
  clip-rule: evenodd;
  height: 17px;
  width: 17px;
  z-index: 2;
}

.paysystems {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
}
.paysystems__item:not(:last-child) {
  margin: 0 var(--gap) 0 0;
}
.paysystems__icon {
  stroke: transparent;
  stroke-width: 0;
  -webkit-filter: grayscale(1);
          filter: grayscale(1);
}
.paysystems__icon:hover {
  -webkit-filter: grayscale(0);
          filter: grayscale(0);
}

.subscribe {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  -ms-flex-wrap: wrap;
      flex-wrap: wrap;
  padding: var(--gap-2) 0;
}
@media (max-width: 767.98px) {
  .subscribe {
    -webkit-box-orient: vertical;
    -webkit-box-direction: normal;
        -ms-flex-direction: column;
            flex-direction: column;
  }
}
.subscribe__content {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  margin: 0 var(--gap-2) 0 0;
  max-width: 360px;
}
@media (max-width: 767.98px) {
  .subscribe__content {
    margin: 0 0 var(--gap-2) 0;
  }
}
.subscribe__icon {
  height: 40px;
  width: 40px;
  margin-right: var(--gap-2);
  stroke-width: 1.5;
}
@media (max-width: 767.98px) {
  .subscribe__icon {
    margin-right: var(--gap);
  }
}
.subscribe__label {
  font-size: var(--font-size-bigger);
}
.subscribe__description {
  color: var(--muted-text-color);
}
.subscribe__form {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  gap: 5px;
  min-width: 400px;
}
@media (max-width: 767.98px) {
  .subscribe__form {
    min-width: 350px;
  }
}
.subscribe__success {
  position: absolute;
  top: 0;
  right: 0;
  bottom: 0;
  left: 0;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  background-color: var(--paper-color);
  gap: var(--gap);
  opacity: 0;
  visibility: hidden;
  -webkit-transition: opacity var(--speed), visibility var(--speed);
  transition: opacity var(--speed), visibility var(--speed);
  z-index: 5;
}
.subscribe__success--show {
  opacity: 1;
  visibility: visible;
}
.subscribe__success-icon {
  width: 20px;
  stroke: var(--success);
}
.subscribe__error {
  display: none;
  color: var(--danger);
}

.contactList {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
}
.contactList__set {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: start;
      -ms-flex-align: start;
          align-items: flex-start;
}
.contactList__set:not(:last-child) {
  margin-bottom: var(--gap);
}
.contactList__icon {
  -webkit-box-flex: 0;
      -ms-flex: 0 0 20px;
          flex: 0 0 20px;
  stroke: var(--primary-color);
  margin-right: var(--gap);
}
.contactList__value:not(:last-child) {
  margin-bottom: calc(var(--gap) / 2);
}
.contactList__link {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  color: var(--main-text-color);
  font-size: var(--font-size-bigger);
  line-height: var(--font-size-bigger);
}
.contactList__description {
  font-size: var(--font-size-tiny);
  line-height: var(--font-size-tiny);
  color: var(--muted-text-color);
}

.contactsPage {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  gap: var(--gap-2);
}
@media (max-width: 575.98px) {
  .contactsPage {
    -webkit-box-orient: vertical;
    -webkit-box-direction: normal;
        -ms-flex-direction: column;
            flex-direction: column;
  }
}
.contactsPage__list {
  -ms-flex-preferred-size: 360px;
      flex-basis: 360px;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  gap: var(--gap);
}
@media (max-width: 575.98px) {
  .contactsPage__list {
    -ms-flex-preferred-size: auto;
        flex-basis: auto;
  }
}
.contactsPage__map {
  position: relative;
  -webkit-box-flex: 1;
      -ms-flex: 1 1 auto;
          flex: 1 1 auto;
  height: 400px;
  border-radius: var(--radius);
  overflow: hidden;
  z-index: 2;
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
}

.citySelect {
  position: relative;
}
.citySelect__search {
  margin-bottom: var(--gap);
}
.citySelect__list {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  overflow-y: auto;
  overflow-x: hidden;
}
.citySelect__list:not(:last-child) {
  margin-bottom: var(--gap);
}
.citySelect__list--search {
  height: 200px;
}
@media (max-width: 767.98px) {
  .citySelect__list--search {
    height: 350px;
  }
}
.citySelect__item {
  font-size: var(--font-size-medium);
  color: var(--main-text-color);
  width: -webkit-fit-content;
  width: -moz-fit-content;
  width: fit-content;
  margin-bottom: 5px;
}
.citySelect__item:hover {
  color: var(--primary-color);
}
.citySelect__item--hidden {
  display: none;
}

.receiving {
  position: relative;
}
.receiving__content {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
      flex-wrap: wrap;
}
.receiving__description {
  -webkit-box-flex: 1;
      -ms-flex: 1 1 100%;
          flex: 1 1 100%;
  margin-bottom: var(--gap);
  font-size: var(--font-size-medium);
  line-height: var(--font-size-medium);
}
.receiving__field {
  -webkit-box-flex: 1;
      -ms-flex-positive: 1;
          flex-grow: 1;
  margin-right: var(--gap);
}
@media (max-width: 767.98px) {
  .receiving__field {
    margin: 0;
  }
}
.receiving__map {
  position: relative;
  -webkit-box-flex: 1;
      -ms-flex: 1 1 100%;
          flex: 1 1 100%;
  height: 400px;
  margin-top: var(--gap-2);
  border-radius: var(--radius);
  overflow: hidden;
  z-index: 2;
  -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 3px 8px var(--shadow-second);
          box-shadow: 0 0 2px var(--shadow-first), 0 3px 8px var(--shadow-second);
}
@media (max-width: 767.98px) {
  .receiving__map {
    height: 320px;
  }
}
.receiving__actions {
  -ms-flex-preferred-size: 25%;
      flex-basis: 25%;
}
@media (max-width: 767.98px) {
  .receiving__actions {
    position: absolute;
    bottom: 0;
    width: 100%;
    padding: 0 var(--gap) var(--gap);
    z-index: 30;
  }
}

.summary {
  position: relative;
  overflow: hidden;
}
.summary__header {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  -webkit-box-pack: justify;
      -ms-flex-pack: justify;
          justify-content: space-between;
  margin-bottom: var(--gap);
}
.summary__title {
  -webkit-box-flex: 1;
      -ms-flex-positive: 1;
          flex-grow: 1;
  font-size: var(--font-size-legend);
  margin-right: var(--gap);
  font-weight: 500;
}
@media (max-width: 767.98px) {
  .summary__title {
    font-size: var(--font-size-medium);
  }
}
.summary__list {
  margin-bottom: var(--gap-2);
}
@media (max-width: 767.98px) {
  .summary__list {
    margin-bottom: var(--gap);
  }
}
.summary__minimum {
  margin-bottom: var(--gap);
}
.summary__item {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  font-size: var(--font-size-medium);
  color: var(--muted-text-color);
  margin-bottom: calc(var(--gap) / 2);
}
.summary__item:last-child {
  margin-bottom: 0;
}
.summary__item--total {
  color: var(--main-text-color);
  font-weight: 500;
}
@media (max-width: 767.98px) {
  .summary__item {
    font-size: var(--font-size-base);
  }
}
.summary__gap {
  -webkit-box-flex: 1;
      -ms-flex-positive: 1;
          flex-grow: 1;
  border-bottom: 2px dotted var(--border-color);
  margin: 0 10px 7px;
}
.summary__divider {
  height: 1px;
  background-color: var(--border-color);
  margin: var(--gap) 0;
}

.page-404 {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
      -ms-flex-direction: column;
          flex-direction: column;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  max-width: 500px;
  margin: var(--gap-big) auto;
}
.page-404__title {
  font-size: var(--font-size-bigger);
}
.page-404__icon {
  height: 80px;
  stroke: none;
  fill: var(--primary-color);
  margin: var(--gap-2) 0;
}
.page-404__icon path:nth-child(1),
.page-404__icon path:nth-child(2) {
  -webkit-transform-origin: center;
          transform-origin: center;
  -webkit-animation: sadAnimation 5s 1s infinite;
          animation: sadAnimation 5s 1s infinite;
}
.page-404__text {
  text-align: center;
}
.page-404__actions {
  margin-top: var(--gap);
}

@-webkit-keyframes sadAnimation {
  2% {
    -webkit-transform: matrix(1, 0, 0, 1, 0, 0);
            transform: matrix(1, 0, 0, 1, 0, 0);
  }
  4% {
    -webkit-transform: matrix(1, 0, 0, 0.01, 0, 0);
            transform: matrix(1, 0, 0, 0.01, 0, 0);
  }
  5% {
    -webkit-transform: matrix(1, 0, 0, 1, 0, 0);
            transform: matrix(1, 0, 0, 1, 0, 0);
  }
  8% {
    -webkit-transform: matrix(1, 0, 0, 0.01, 0, 0);
            transform: matrix(1, 0, 0, 0.01, 0, 0);
  }
  10% {
    -webkit-transform: matrix(1, 0, 0, 1, 0, 0);
            transform: matrix(1, 0, 0, 1, 0, 0);
  }
  100% {
    -webkit-transform: matrix(1, 0, 0, 1, 0, 0);
            transform: matrix(1, 0, 0, 1, 0, 0);
  }
}

@keyframes sadAnimation {
  2% {
    -webkit-transform: matrix(1, 0, 0, 1, 0, 0);
            transform: matrix(1, 0, 0, 1, 0, 0);
  }
  4% {
    -webkit-transform: matrix(1, 0, 0, 0.01, 0, 0);
            transform: matrix(1, 0, 0, 0.01, 0, 0);
  }
  5% {
    -webkit-transform: matrix(1, 0, 0, 1, 0, 0);
            transform: matrix(1, 0, 0, 1, 0, 0);
  }
  8% {
    -webkit-transform: matrix(1, 0, 0, 0.01, 0, 0);
            transform: matrix(1, 0, 0, 0.01, 0, 0);
  }
  10% {
    -webkit-transform: matrix(1, 0, 0, 1, 0, 0);
            transform: matrix(1, 0, 0, 1, 0, 0);
  }
  100% {
    -webkit-transform: matrix(1, 0, 0, 1, 0, 0);
            transform: matrix(1, 0, 0, 1, 0, 0);
  }
}
.developer {
  font-size: var(--font-size-tiny);
  color: var(--muted-text-color);
  text-transform: uppercase;
  text-wrap: pretty;
}
.developer__icon {
  color: var(--dev-icon-color);
}
.developer__link {
  color: var(--dev-link-color);
}
.cookie-banner {
    position: fixed;
    flex-direction: column;
    column-gap: 1.5rem;
    row-gap: 1rem;
    bottom: 30px;
    left: 20px;
    background-color: var(--paper-color);
    color: #333;
    padding: var(--gap);
    -webkit-box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
    box-shadow: 0 0 2px var(--shadow-first), 0 4px 12px var(--shadow-second);
    border-radius: var(--radius);
    justify-content: space-between;
    align-items: flex-start;
    font-size: 14px;
    z-index: 1000;
    max-width: 500px;
    display: none;
}
@media (max-width: 767.98px) {
  .cookie-banner {
    position: fixed;
    row-gap: 1rem;
    bottom: 30px;
    left: 10px;
    right: 10px;
    max-width: 100%;
    flex-direction: column;
  }
}
.cookie-banner-title{
  font-variation-settings: "wght" 600;
    font-size: 1.2rem;
    margin-bottom: 0.5rem;
}
.cookie-banner p{
  margin: 0;
}
.cookie-banner a {
  color: #007bff;
  text-decoration: underline;
}
.cookies-buttons {
    display: flex;
    column-gap: 1rem;
}
.cashback-modal-info-block{
  background: var(--primary-color-transparent);
  padding: var(--gap) var(--gap-2);
  border-radius: 10px;
  margin-bottom: var(--gap);
  color: var(--main-text-color);
}
.opacity-50{
    opacity: 0.5;
}
.gap-1 {
    column-gap: 0.5rem;
    row-gap: 0.5rem;
}
.gap-2 {
    column-gap: 1rem;
    row-gap: 1rem;
}
.delivery-slot {
    display: inline-block;
    position: relative;
    cursor: pointer;
}
.schedule {
    padding: 0 var(--gap);
    flex-direction: column;
}
.delivery-slot input {
    display: none;
}
.delivery-slot__box {
    display: inline-block;
    border: 2px solid var(--border-color);
    border-radius: 8px;
    padding: 10px 16px;
    text-align: center;
    min-width: 120px;
    transition: 0.2s;
    background: #f9f9f9;
}
.delivery-slot input:checked + .delivery-slot__box {
    border-color: var(--success);
    background: #eee;
}
.delivery-slot__box small {
    font-size: 12px;
    color: #777;
}
#delivery_add_item {
    font-size: 0.9rem;
}
/* End */


/* Start:/bitrix/templates/webdelivery/assets/css/custom.css?1784813278113*/
@charset "UTF-8";

.backdrop--stacked {
    z-index: 100;
}

.dialog--stacked.dialog--open {
    z-index: 105;
}

/* End */


/* Start:/bitrix/components/novox/delivery.zones_new/templates/.default/style.css?178593341123396*/
.deliveryChoice{position:relative;width:min(1160px,calc(100vw - 48px));height:min(670px,calc(100vh - 48px));padding:0!important;border-radius:24px!important;overflow:hidden;background:#fff}.deliveryChoice__close{position:absolute;right:16px;top:16px;z-index:30;background:#fff;box-shadow:0 2px 12px rgba(0,0,0,.12)}.deliveryChoice__receiving,.deliveryChoice__tabs{height:100%}.deliveryChoice__tabs{display:block!important;padding:0!important}.deliveryChoice__tabs:before{display:none!important}.deliveryChoice__sidebar{display:none}.deliveryChoice__panel{display:none!important;width:100%!important;max-width:none!important;height:100%;max-height:none!important;padding:0!important;margin:0!important;box-shadow:none!important;border-radius:0!important;opacity:1!important}.deliveryChoice__tab.tab__control--active~.deliveryChoice__panel{display:none!important}.deliveryChoice__panel.is-active,.deliveryChoice__panel.tab__panel--active{display:grid!important}.deliveryChoice__panel{grid-template-columns:495px minmax(0,1fr);background:#fff}.deliveryChoice__left{position:relative;display:flex;flex-direction:column;padding:28px 40px 24px;min-width:0;z-index:4}.deliveryChoice__desktopTitle{font-size:25px;line-height:1.2;font-weight:600;margin-bottom:22px}.deliveryChoice__desktopSwitcher{display:flex;gap:22px;margin-bottom:42px}.deliveryChoice__desktopSwitcher .tab__label{text-transform:none;font-size:18px}.deliveryChoice__hint{font-size:14px;margin-bottom:12px}.deliveryChoice__geo{display:flex;align-items:center;gap:10px;margin:12px 0 24px;padding:0;border:0;background:none;font:inherit;cursor:pointer;color:#262626}.deliveryChoice__geo svg,.deliveryChoice__pickupPin svg{width:20px;height:20px;fill:var(--main-text-color);}.deliveryChoice__addressExtra{display:grid;grid-template-columns:1fr 1fr;gap:18px 14px}.deliveryChoice__actions{margin-top:auto;display:flex;justify-content:center}.deliveryChoice__submit[disabled]{opacity:.5;pointer-events:none}.deliveryChoice__map{height:100%;margin:0!important;border-radius:0!important;box-shadow:none!important;overflow:hidden}.mapFrame{width:100%;height:100%}.mapPlacemark{position:absolute;bottom:50%;left:50%;transform:translateX(-50%);z-index:5;opacity:0;visibility:hidden;cursor:pointer;display:none}.mapPlacemark--unclickable{pointer-events:none}.mapPlacemark--active{display:block;animation:fadeIn var(--speed) both}.mapPlcemark__wrap{position:relative}.mapPlcemark__wrap-label{position:absolute;top:13px;left:15px;right:15px;display:block;line-height:17px;text-align:center;color:var(--fill-btn-color)}.mapDeliveryDetails{position:absolute;left:12px;top:12px;z-index:5}.mapDeliveryDetails__button{background:#fff!important;box-shadow:0 2px 10px rgba(0,0,0,.15)}.mapDeliveryDetails__content{min-width:260px}.deliveryChoice__pickupSearch{display:flex;align-items:center;gap:12px;margin-bottom:14px}.deliveryChoice__pickupSearch svg{width:22px;height:22px;fill:none;stroke:#111;stroke-width:2}.deliveryChoice__pickupSearch input{width:100%;border:0;background:transparent;outline:0;font:inherit}.deliveryChoice__pickupList{display:flex;flex-direction:column;gap:12px;overflow:auto;padding:0 2px 12px;max-height:360px}.deliveryChoice__pickupCard{display:flex;gap:10px;width:100%;padding:14px;border:2px solid #d3d3d3;border-radius:16px;background:#fff;text-align:left;cursor:pointer;font:inherit}.deliveryChoice__pickupCard.is-active{border-color:#2f8f78}.deliveryChoice__pickupPin{flex:0 0 20px}.deliveryChoice__pickupData{display:flex;flex-direction:column;gap:4px}.deliveryChoice__pickupData strong{font-size:16px;line-height:1.25}.deliveryChoice__workingTime{font-size:13px;line-height:1.45;color:#606060}.deliveryChoice__pickupCard[hidden]{display:none}.deliveryChoice__panel--pickup .deliveryChoice__desktopSwitcher{margin-bottom:30px}
@media (min-width:768px){.deliveryChoice__tabs>.deliveryChoice__sidebar>.deliveryChoice__switcher{display:none}.deliveryChoice__tabs>.deliveryChoice__panel{display:none!important}.deliveryChoice__tabs>.deliveryChoice__panel.tab__panel--active,.deliveryChoice__tabs>.deliveryChoice__panel.is-active{display:grid!important}}
@media (max-width:767.98px){.deliveryChoice{width:100vw;height:100dvh;max-height:none!important;border-radius:0!important}.deliveryChoice__close{right:14px;top:14px;width:50px;height:50px;border-radius:12px;background:#fff}.deliveryChoice__sidebar{display:block;position:absolute;left:14px;right:78px;top:14px;height: 54px;z-index:20}.deliveryChoice__title{display:none}.deliveryChoice__switcher{display:flex;background:#fff;border-radius:12px;height:50px;box-shadow:0 3px 15px rgba(0,0,0,.16)}.deliveryChoice__switcher .tab__label{text-transform:none}.deliveryChoice__panel{grid-template-columns:1fr!important;position:absolute;inset:0}.deliveryChoice__left{position:absolute;inset:0;z-index:10;padding:0;pointer-events:none}.deliveryChoice__desktopTitle,.deliveryChoice__desktopSwitcher,.deliveryChoice__hint,.deliveryChoice__geo,.deliveryChoice__addressExtra,.deliveryChoice__pickupList,.deliveryChoice__actions{display:none!important}.deliveryChoice__map{position:absolute;inset:0}.deliveryChoice__search,.deliveryChoice__pickupSearch{position:absolute;left:36px;right:36px;bottom:22px;width:auto;height:72px;margin:0;background:#fff;border-radius:10px;box-shadow:0 3px 18px rgba(0,0,0,.16);pointer-events:auto}.deliveryChoice__pickupSearch{display:flex!important;padding:0 30px}.deliveryChoice__pickupSearch svg{display:none}.deliveryChoice__pickupSearch input{font-size:23px}.mapDeliveryDetails{display:none}.mapPlacemark{z-index:6}.deliveryChoice__panel--pickup .deliveryChoice__left{display:block}.deliveryChoice__panel--delivery .deliveryChoice__search{display:block}}

/* Saved address integration inside the new modal foundation */
.deliveryChoice .wd-address-book,.deliveryChoice .wd-address-editor{display:flex;flex-direction:column;min-height:0;flex:1;padding:0}.deliveryChoice .wd-address-book__heading{display:flex;justify-content:space-between;align-items:flex-start;gap:14px;margin-bottom:18px}.deliveryChoice .wd-address-book__title,.deliveryChoice .wd-address-editor__title{margin:0 0 4px;font-size:20px;line-height:1.25}.deliveryChoice .wd-address-book__subtitle,.deliveryChoice .wd-address-editor__subtitle{margin:0;color:#707070;font-size:13px}.deliveryChoice .wd-secondary-button{border:0;border-radius:9px;background:#e9eaed;padding:10px 14px;font:inherit;cursor:pointer}.deliveryChoice .wd-address-list{display:flex;flex-direction:column;gap:12px;overflow:auto;padding:1px 3px 8px;min-height:0}.deliveryChoice .wd-address-card{display:flex;align-items:center;min-height:54px;padding:0 8px 0 14px;border:1px solid #dfe2e4;border-radius:14px;background:#fff}.deliveryChoice .wd-address-card.is-selected{border-color:var(--primary-color);box-shadow:0 0 0 1px var(--primary-color)}.deliveryChoice .wd-address-card__choice{display:flex;align-items:center;gap:11px;flex:1;min-width:0;cursor:pointer;margin-bottom:0}.deliveryChoice .wd-address-card__choice input{position:absolute;width:1px;height:1px;margin:0;opacity:0;pointer-events:none;clip:rect(0 0 0 0);clip-path:inset(50%);overflow:hidden}.deliveryChoice .wd-address-card__check{flex:0 0 18px;width:18px;height:18px;border:1.5px solid #d6dadd;border-radius:3px}.deliveryChoice .wd-address-card__choice input:checked+.wd-address-card__check{border-color:var(--primary-color);background:var(--primary-color);box-shadow:inset 0 0 0 4px #fff}.deliveryChoice .wd-address-card__text{font-size:15px;line-height:1.35}.deliveryChoice .wd-icon-button{flex:0 0 38px;width:38px;height:38px;border:0;background:transparent;cursor:pointer}.deliveryChoice .wd-icon-button svg{width:20px;height:20px;fill:#222}.deliveryChoice .wd-address-actions,.deliveryChoice .wd-editor-actions{padding-top:22px}.deliveryChoice .wd-editor-back{align-self:flex-start;margin:0 0 12px;padding:0;border:0;background:transparent;color:var(--main-text-color);cursor:pointer}.deliveryChoice .wd-address-editor__subtitle{margin-bottom:18px}.deliveryChoice .wd-delivery-details-grid{margin-top:0!important}.deliveryChoice .wd-pickup-list-button{display:none}.deliveryChoice .mapControls{position:absolute;right:16px;bottom:16px;z-index:8}.deliveryChoice .mapControls__button{display:block}.deliveryChoice .wd-pickup-card.is-selected{border-color:var(--primary-color)}.deliveryChoice .deliveryChoice__pickupList{max-height:none;flex:1;min-height:0}.deliveryChoice .deliveryChoice__left{overflow:hidden}.deliveryChoice .deliveryChoice__actions{flex:0 0 auto}

@media (max-width:767.98px){.deliveryChoice__panel--pickup .deliveryChoice__map {height: 100%;} .deliveryChoice__map {height: 80%;} .deliveryChoice .wd-address-book,.deliveryChoice .wd-address-editor{position:absolute;left:0;right:0;bottom:0;z-index:12;max-height:72vh;padding:28px 32px 18px;border-radius:32px 32px 0 0;background:#fff;pointer-events:auto;overflow:auto}.deliveryChoice .wd-address-book{top:auto;bottom:0;max-height:300px}.deliveryChoice .wd-address-book__subtitle{display:none}.deliveryChoice .wd-address-list{gap:4px}.deliveryChoice .wd-address-card{padding:9px;border:0;border-radius:9px}.deliveryChoice .wd-address-card__check{display:none}.deliveryChoice .wd-address-actions,.deliveryChoice .wd-editor-actions{position:sticky;bottom:0;padding-top:18px;background:#fff}.deliveryChoice .wd-address-actions .deliveryChoice__submit,.deliveryChoice .wd-editor-actions .deliveryChoice .wd-address-editor__title,.deliveryChoice .wd-address-editor__subtitle,.deliveryChoice .wd-editor-back,.deliveryChoice .wd-address-editor .deliveryChoice__geo{display:none!important}.deliveryChoice .wd-address-editor .deliveryChoice__search{position:static;width:auto;height:auto;margin:0 0 10px;box-shadow:none}.deliveryChoice .wd-address-editor .deliveryChoice__addressExtra{display:grid!important;grid-template-columns:1fr 1fr;gap:10px 10px}.deliveryChoice .wd-address-editor__title{font-size: initial;}.deliveryChoice .wd-address-editor .deliveryChoice__actions{display:flex!important}.deliveryChoice .deliveryChoice__panel--pickup .deliveryChoice__pickupList{display:none}.deliveryChoice .deliveryChoice__panel--pickup .wd-pickup-list-button{display:block;position:absolute;left:50%;bottom:24px;transform:translateX(-50%);z-index:14;pointer-events:auto;background:#2f8f78;color:#fff}.deliveryChoice .deliveryChoice__panel--pickup .deliveryChoice__actions{display:none!important}.deliveryChoice .mapControls{display:none}}

/* Mobile address list: fixed compact sheet and visible confirmation action. */
@media (max-width: 767.98px) {

    .wd-address-search-sheet__body .suggestions-suggestion {
        cursor: pointer;
        position: relative;
        display: -webkit-box;
        display: -ms-flexbox;
        display: flex;
        -webkit-box-orient: vertical;
        -webkit-box-direction: normal;
        -ms-flex-direction: column;
        flex-direction: column;
        align-items: flex-start;
        justify-content: center;
        height: auto;
        padding: 10px var(--gap);
        cursor: pointer;
        -webkit-transition: var(--speed);
        -o-transition: var(--speed);
        transition: var(--speed);
        overflow: hidden;
        line-height: 1.4;
    }
    .deliveryChoice .wd-address-book {
        top: auto;
        bottom: 0;
        height: 300px;
        max-height: 300px;
        overflow: hidden;
        box-sizing: border-box;
    }

    .deliveryChoice .wd-address-list {
        flex: 1 1 auto;
        gap: 4px;
        height: 200px;
        max-height: 200px;
        min-height: 0;
        overflow-y: auto;
        overscroll-behavior: contain;
    }

    .deliveryChoice .wd-address-actions {
        display: flex !important;
        flex: 0 0 auto;
        position: static;
        padding-top: 10px;
        background: #fff;
    }

    .deliveryChoice .wd-address-actions .deliveryChoice__submit {
        display: inline-flex !important;
        width: 100%;
    }

    .deliveryChoice .wd-editor-actions {
        display: flex !important;
    }
}

.deliveryChoice .wd-editor-actions {
    flex-direction: column;
    align-items: stretch;
    gap: 12px;
}
.deliveryChoice .wd-delete-address {
    min-height: 44px;
    border: 0;
    background: transparent;
    color: #c83d3d;
    font: inherit;
    cursor: pointer;
}
.deliveryChoice .wd-delete-address[hidden] {
    display: none !important;
}
.deliveryChoice .wd-delete-address:disabled {
    opacity: .5;
    cursor: default;
}

@media (max-width: 767.98px) {
    .deliveryChoice .wd-editor-actions {
        gap: 8px;
    }
    .deliveryChoice .wd-delete-address {
        display: block;
        width: 100%;
    }
    .deliveryChoice .wd-delete-address[hidden] {
        display: none !important;
    }
}


/* Local fallback for delivery/pickup details dropdowns. */
.deliveryChoice .mapDeliveryDetails.is-open .dropdown__wrapper{opacity:1;visibility:visible;}

/* Keep modal tab panels in the site tab layout coordinate system. */
.tab__panel.deliveryChoice__panel{
    -webkit-transform:none;
    transform:none;
}

.deliveryChoice .wd-address-editor__heading{display:flex;align-items:center;gap:12px;margin-bottom:4px}
.deliveryChoice .wd-address-editor__heading .wd-address-editor__title{margin:0}
.deliveryChoice .wd-editor-back{align-self:auto;flex:0 0 auto;margin:0}
.deliveryChoice .wd-pickup-mobile-header{display:none}

@media (max-width:767.98px){
    .deliveryChoice .wd-address-editor__heading{display:flex!important;align-items:center;gap:12px;margin-bottom:14px}
    .deliveryChoice .wd-address-editor__heading .wd-address-editor__title{display:block!important;margin:0;font-size:20px;line-height:1.25}
    .deliveryChoice .wd-address-editor__heading .wd-editor-back{display:flex!important}

    .deliveryChoice .deliveryChoice__panel--pickup .deliveryChoice__pickupSearch{display:none!important}
    .deliveryChoice .deliveryChoice__panel--pickup .deliveryChoice__pickupList{display:none}
    .deliveryChoice .deliveryChoice__panel--pickup .wd-pickup-mobile-header{display:none}

    .deliveryChoice .deliveryChoice__panel--pickup.is-pickup-list-open .deliveryChoice__left {
        display: flex;
        position: absolute;
        left: 0px;
        right: 0px;
        top: 0px;
        bottom: 0;
        z-index: 30;
        padding: 30px 30px 24px;
        border-radius: 30px 30px 0 0;
        background: #fff;
        pointer-events: auto;
        overflow: hidden;
    }
    .deliveryChoice .deliveryChoice__panel--pickup.is-pickup-list-open .wd-pickup-mobile-header{
        display:flex;align-items:center;justify-content:space-between;gap:20px;margin-bottom:28px;
    }
    .deliveryChoice .deliveryChoice__panel--pickup.is-pickup-list-open .wd-pickup-mobile-title{
        margin:0;font-size:23px;line-height:1.2;font-weight:600;
    }
    .deliveryChoice .deliveryChoice__panel--pickup.is-pickup-list-open .deliveryChoice__pickupSearch{
        display:flex!important;position:static;width:100%;height:46px;margin:0 0 24px;padding:0 20px;
        border-radius:10px;background:#e9eaed;box-shadow:none;
    }
    .deliveryChoice .deliveryChoice__panel--pickup.is-pickup-list-open .deliveryChoice__pickupSearch svg{display:block;flex:0 0 22px}
    .deliveryChoice .deliveryChoice__panel--pickup.is-pickup-list-open .deliveryChoice__pickupSearch input{font-size:17px}
    .deliveryChoice .deliveryChoice__panel--pickup.is-pickup-list-open .deliveryChoice__pickupList{
        display:flex!important;max-height:none;min-height:0;flex:1;gap:0;padding:0;overflow:auto;
    }
    .deliveryChoice .deliveryChoice__panel--pickup.is-pickup-list-open .deliveryChoice__pickupCard{
        padding:14px 0;border:0;border-radius:0;
    }
    .deliveryChoice .deliveryChoice__panel--pickup.is-pickup-list-open .deliveryChoice__pickupPin{display:none}
    .deliveryChoice .deliveryChoice__panel--pickup.is-pickup-list-open .wd-pickup-list-button{display:none}
}


.deliveryChoice .wd-pickup-mobile-details{display:none}
@media (max-width:767.98px){
    .deliveryChoice .wd-pickup-mobile-details{
        display:flex;position:absolute;left:0;right:0;bottom:0;z-index:28;
        max-height:300px;padding:0;border-radius:30px 30px 0 0;background:#fff;
        transform:translateY(105%);transition:transform .25s ease;pointer-events:none;
        flex-direction:column;overflow:hidden;
    }
    .deliveryChoice .wd-pickup-mobile-details.is-open{transform:translateY(0);pointer-events:auto;max-height:300px}
    .deliveryChoice .wd-pickup-mobile-details__header{display:flex;align-items:flex-start;gap:16px;flex:0 0 auto;padding:20px 22px 12px 30px;background:#fff}
    .deliveryChoice .wd-pickup-mobile-details__close{position:static;flex:0 0 auto;margin-left:auto}
    .deliveryChoice .wd-pickup-mobile-details__title{margin:4px 0 0;font-size:28px;line-height:1.15}
    .deliveryChoice .wd-pickup-mobile-details__body{min-height:0;overflow-y:auto;padding:0 30px 18px;-webkit-overflow-scrolling:touch}
    .deliveryChoice .wd-pickup-mobile-details__address{font-size:18px;line-height:1.35;color:#666}
    .deliveryChoice .wd-pickup-mobile-details__working{margin-top:18px;font-size:18px;line-height:1.45}
    .deliveryChoice .wd-pickup-mobile-details__phone{display:inline-block;margin-top:18px;font-size:19px;text-decoration:none}
    .deliveryChoice .wd-pickup-mobile-details__phone[hidden]{display:none}
    .deliveryChoice .wd-pickup-mobile-details__footer{flex:0 0 auto;padding:14px 30px 24px;background:#fff}
    .deliveryChoice .wd-pickup-mobile-details__actions{display:flex;justify-content:center;margin:0}
}

/* Mobile address search sheet */
.deliveryChoice .wd-address-search-trigger,
.deliveryChoice .wd-address-search-sheet {
    display: none;
}

@media (max-width: 767.98px) {
    .deliveryChoice .wd-address-search-control__desktop {
        display: none;
    }

    .deliveryChoice .wd-address-search-trigger {
        display: grid;
        grid-template-columns: minmax(0, 1fr) auto;
        width: 100%;
        min-height: 58px;
        padding: 9px 14px 9px 20px;
        border: 1px solid #d7d9dd;
        border-radius: 14px;
        background: #fff;
        text-align: left;
        cursor: pointer;
    }

    .deliveryChoice .wd-address-search-trigger__label {
        grid-column: 1;
        color: #9a9a9a;
        font-size: 12px;
        line-height: 1.2;
    }

    .deliveryChoice .wd-address-search-trigger__value {
        grid-column: 1;
        min-width: 0;
        overflow: hidden;
        color: #202020;
        font-size: 15px;
        line-height: 1.35;
        text-overflow: ellipsis;
        white-space: nowrap;
    }

    .deliveryChoice .wd-address-search-trigger__value.is-placeholder {
        color: #777;
    }

    .deliveryChoice .wd-address-search-trigger__icon {
        grid-column: 2;
        grid-row: 1 / 3;
        align-self: center;
        width: 22px;
        height: 22px;
        margin-left: 12px;
    }

    .deliveryChoice .wd-address-search-sheet {
        position: fixed;
        inset: 0;
        z-index: 80;
        display: flex;
        flex-direction: column;
        padding: 22px 20px max(22px, env(safe-area-inset-bottom));
        background: #fff;
        opacity: 0;
        visibility: hidden;
        pointer-events: none;
        transform: translateY(24px);
        transition: opacity .2s ease, visibility .2s ease, transform .2s ease;
    }

    .deliveryChoice .wd-address-search-sheet.is-open {
        opacity: 1;
        visibility: visible;
        pointer-events: auto;
        transform: none;
    }

    .deliveryChoice .wd-address-search-sheet__header {
        display: flex;
        align-items: center;
        justify-content: space-between;
        gap: 16px;
        flex: 0 0 auto;
        margin-bottom: 20px;
    }

    .deliveryChoice .wd-address-search-sheet__title {
        margin: 0;
        font-size: 24px;
        line-height: 1.2;
    }

    .deliveryChoice .wd-address-search-sheet__body {
        min-height: 0;
        flex: 1;
        overflow: visible;
    }

    .deliveryChoice .wd-address-search-sheet__footer {
        flex: 0 0 auto;
        padding-top: 16px;
    }

    .deliveryChoice .wd-address-search-sheet__footer .btn {
        width: 100%;
    }

    .deliveryChoice .wd-address-search-sheet .textfield {
        width: 100%;
    }

    .deliveryChoice .wd-address-search-sheet .suggestions-wrapper,
    .deliveryChoice .wd-address-search-sheet .suggestions-suggestions {
        width: 100% !important;
        max-width: none !important;
    }

    .deliveryChoice .wd-address-search-sheet .suggestions-suggestions {
        max-height: calc(100dvh - 150px) !important;
        overflow-y: auto !important;
        overscroll-behavior: contain;
    }
}

@media (max-width: 767.98px) {
    .deliveryChoice.is-address-search-open > .deliveryChoice__close,
    .deliveryChoice.is-address-search-open .deliveryChoice__sidebar {
        opacity: 0;
        visibility: hidden;
        pointer-events: none;
    }

    .deliveryChoice .wd-address-search-sheet__body {
        display: flex;
        flex-direction: column;
        overflow: hidden;
    }

    .deliveryChoice .wd-address-search-sheet__message {
        flex: 0 0 auto;
        min-height: 22px;
        margin-top: 10px;
        font-size: 14px;
        line-height: 1.45;
        color: #c53b3b;
    }

    .deliveryChoice .wd-address-search-sheet .suggestions-wrapper {
        position: static !important;
        display: block !important;
        width: 100% !important;
        min-width: 0;
        height: auto !important;
    }

    .deliveryChoice .wd-address-search-sheet .suggestions-suggestions {
        position: relative !important;
        inset: auto !important;
        display: block !important;
        width: 100% !important;
        height: auto !important;
        max-height: calc(100dvh - 210px) !important;
        max-height: calc(100vh - 210px) !important;
        margin-top: 12px;
        border: 0;
        box-shadow: none;
        overflow-x: hidden !important;
        overflow-y: auto !important;
        -webkit-overflow-scrolling: touch;
        overscroll-behavior: contain;
        opacity: 1 !important;
        visibility: visible !important;
    }

    .deliveryChoice .wd-address-search-sheet .suggestions-suggestion {
        display: block !important;
        width: 100%;
        min-height: 48px;
        box-sizing: border-box;
        color: #202020;
        background: #fff;
    }

    .deliveryChoice .wd-address-search-sheet .suggestions-suggestion > span {
        display: inline;
        color: inherit;
        visibility: visible;
    }
}

/* Ошибка обязательного поля квартиры */
.deliveryChoice .js-wd-apartment-field {
    position: relative;
    margin-bottom: 20px;
}

.deliveryChoice .js-wd-apartment-field .textfield__error {
    position: absolute;
    top: calc(100% + 4px);
    left: 0;
    display: none;
    font-size: 12px;
    line-height: 1.2;
    color: #c53b3b;
}

.deliveryChoice .js-wd-apartment-field.is-error .textfield__error {
    display: block;
}

.deliveryChoice .js-wd-apartment-field.is-error .textfield__input {
    border-color: #c53b3b;
}

.deliveryChoice .js-wd-apartment-field.is-error .textfield__label,
.deliveryChoice .js-wd-apartment-field.is-error .textfield__required {
    color: #c53b3b;
}


/* End */


/* Start:/bitrix/templates/webdelivery/libs/suggestions-jquery/dist/css/suggestions_custom.css?17848132784675*/
.suggestions-nowrap {
  /* white-space: nowrap; */
}
/**
 * Основной INPUT
 */
.suggestions-input {
  -ms-box-sizing: border-box;
  -moz-box-sizing: border-box;
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
  width: 100%;
}
.suggestions-input::-ms-clear {
  display: none;
}
.suggestions-wrapper {
  position: absolute;
  left: 0;
  top: calc(var(--button-size) * 1.3);
  width: 100%;
  margin-top: .5rem;
  z-index: 10;
}

/**
 * Выпадающий блок с найденными подсказками
 */
.suggestions-suggestions {
  background-color: var(--paper-color);
  color: var(--main-text-color);
  border-radius: var(--radius);
  overflow: hidden;
  padding: var(--gap) 0;
  -ms-box-sizing: border-box;
  -moz-box-sizing: border-box;
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
  cursor: default;
  min-width: 100%;
  max-width: 100%;
  z-index: 9999;
  -webkit-text-size-adjust: 100%;
  -webkit-box-shadow: 0 0 2px var(--shadow-first),0 3px 8px var(--shadow-second);
  box-shadow: 0 0 2px var(--shadow-first),0 3px 8px var(--shadow-second);
  opacity: 0;
  -webkit-transform: translateY(15px);
  -ms-transform: translateY(15px);
  transform: translateY(15px);
  visibility: hidden;
  animation: suggestions var(--speed) forwards;
}

@keyframes suggestions {
  to {
    -webkit-transform: translateY(0);
    -ms-transform: translateY(0);
    transform: translateY(0);
    opacity: 1;
    visibility: visible;
  }

}

.suggestions-suggestions strong {
  /* font-weight: normal; */
  color: var(--primary-color);
}
.suggestions-suggestions.suggestions-mobile {
  border-style: none;
}
.suggestions-suggestions.suggestions-mobile .suggestions-suggestion {
  border-bottom: 1px solid #ddd;
}
/**
 * Контейнер для одной подсказки
 */
.suggestions-suggestion {
  cursor: pointer; 
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
  -ms-flex-direction: column;
  flex-direction: column;
  align-items: flex-start;
  justify-content: center;
  height: calc(var(--button-size) * 1.2);
  padding: 0 var(--gap);
  cursor: pointer;
  -webkit-transition: var(--speed);
  -o-transition: var(--speed);
  transition: var(--speed);
  overflow: hidden;
}
.suggestions-suggestion:hover {
  background-color: var(--focus-highlight);
  color: var(--primary-color);
}
/**
 * Выбранная (активная) подсказка
 */
.suggestions-selected {
  background-color: var(--focus-highlight);
}
.suggestions-selected:hover {
  background-color: var(--focus-highlight);
}
/**
 * Информационный блок в верхней части выпадашки с подсказками
 */
.suggestions-hint {
  padding: 4px var(--gap);
  white-space: nowrap;
  overflow: hidden;
  color: var(--muted-text-color);
  font-size: var(--font-size-tiny);
  line-height: var(--font-size-tiny);
}
/**
 * Дополнительный текст в подсказке, который идет второй строкой
 */
.suggestions-subtext {
  color: var(--muted-text-color);
  font-size: var(--font-size-small);
}
/**
 * Размещает дополнительный текст в одну строку с основным текстом подсказки
 */
.suggestions-subtext_inline {
  display: inline-block;
  min-width: 6em;
  vertical-align: bottom;
  margin: 0 0.5em 0 0;
}
/**
 * Разделитель нескольких дополнительных текстов
 */
.suggestions-subtext-delimiter {
  display: inline-block;
  width: 2px;
}
/**
 * Выделяет подсказку
 */
.suggestions-subtext_label {
  margin: 0 0 0 0.25em;
  -webkit-border-radius: 3px;
  -moz-border-radius: 3px;
  border-radius: 3px;
  padding: 0 3px;
  background: #f5f5f5;
  font-size: 85%;
}
.suggestions-value[data-suggestion-status="LIQUIDATED"] {
  position: relative;
}
.suggestions-value[data-suggestion-status="LIQUIDATED"]:after {
  position: absolute;
  left: 0;
  right: 0;
  top: 50%;
  border-top: 1px solid rgba(0, 0, 0, 0.4);
  content: "";
}
/**
 * Промо-блок
 */
.suggestions-promo {
  font-size: 85%;
  display: none;
  color: #777;
  padding: 4px;
  text-align: center;
}
.suggestions-promo a {
  color: #777;
  display: block;
  filter: grayscale(100%);
  line-height: 20px;
  text-decoration: none;
}
.suggestions-promo a:hover {
  filter: grayscale(0);
}
.suggestions-promo svg {
  height: 20px;
  vertical-align: bottom;
}
@media screen and (min-width: 600px) {
  .suggestions-promo {
    position: absolute;
    top: 0;
    right: 0;
    text-align: left;
  }
}

/* End */
/* /bitrix/templates/webdelivery/assets/css/app.css?17848132781052459 */
/* /bitrix/templates/webdelivery/assets/css/custom.css?1784813278113 */
/* /bitrix/components/novox/delivery.zones_new/templates/.default/style.css?178593341123396 */
/* /bitrix/templates/webdelivery/libs/suggestions-jquery/dist/css/suggestions_custom.css?17848132784675 */